Index of /wp-content/uploads
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | $COMPQ-011510.jpg | 2010-10-26 12:05 | 124K | |
![[IMG]](/icons/image2.gif) | $COMPQ-012210(1).jpg | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | $COMPQ-012210.jpg | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | $COMPQ-020510.jpg | 2010-10-26 12:05 | 125K | |
![[IMG]](/icons/image2.gif) | $INDU-011510.jpg | 2010-10-26 12:05 | 127K | |
![[IMG]](/icons/image2.gif) | $INDU-012210.jpg | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | $INDU-020510.jpg | 2010-10-26 12:05 | 112K | |
![[IMG]](/icons/image2.gif) | $SPX-011510.jpg | 2010-10-26 12:05 | 123K | |
![[IMG]](/icons/image2.gif) | $SPX-012210.jpg | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | $SPX-020510.jpg | 2010-10-26 12:05 | 128K | |
![[IMG]](/icons/image2.gif) | $spx%20weekly%201_31..> | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | $spx%20weekly%201_31..> | 2010-10-26 12:05 | 72K | |
![[IMG]](/icons/image2.gif) | $spx%20weekly%201_31..> | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | $spx%20weekly%201_31..> | 2010-10-26 12:05 | 72K | |
![[IMG]](/icons/image2.gif) | $spx%20weekly%201_31..> | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | $spx%20weekly%201_31..> | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | $spx%20weekly%201_31..> | 2010-10-26 12:05 | 72K | |
![[IMG]](/icons/image2.gif) | $spx%20weekly%201_31..> | 2010-10-26 12:05 | 236K | |
![[IMG]](/icons/image2.gif) | 0001193125-07-109336..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | 01_17_3_prev.jpg | 2010-10-26 12:05 | 239K | |
![[IMG]](/icons/image2.gif) | 021511rosenblatt-tru..> | 2011-10-15 14:08 | 38K | |
![[IMG]](/icons/image2.gif) | 021511rosenblatt-tru..> | 2011-10-06 16:27 | 38K | |
![[IMG]](/icons/image2.gif) | 0218_clip_image019.jpg | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | 0218home.jpg | 2010-10-26 12:05 | 9.3K | |
![[IMG]](/icons/image2.gif) | 022659c8-13c6-47fb-9..> | 2012-09-18 14:20 | 29K | |
![[IMG]](/icons/image2.gif) | 022659c8-13c6-47fb-9..> | 2012-09-18 13:48 | 29K | |
![[IMG]](/icons/image2.gif) | 03_5.jpg | 2011-01-13 04:41 | 78K | |
![[IMG]](/icons/image2.gif) | 0417.jpg | 2011-01-27 19:00 | 109K | |
![[IMG]](/icons/image2.gif) | 0428_copper12.jpg | 2011-09-24 13:12 | 24K | |
![[IMG]](/icons/image2.gif) | 05-23-10-America_Ban..> | 2010-10-26 12:05 | 60K | |
![[IMG]](/icons/image2.gif) | 050411ind.jpg | 2011-05-04 09:22 | 90K | |
![[IMG]](/icons/image2.gif) | 06-07-10-Roadmap_0.gif | 2010-10-28 19:09 | 26K | |
![[IMG]](/icons/image2.gif) | 0702-higgs-boson-God..> | 2012-07-02 22:25 | 17K | |
![[IMG]](/icons/image2.gif) | 070610--Chip-Sales(1..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | 070610--Chip-Sales.jpg | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | 08_TradingPlaces_BD-..> | 2011-11-10 14:13 | 24K | |
![[IMG]](/icons/image2.gif) | 080911_0325_TheRetur..> | 2011-08-10 18:16 | 8.2K | |
![[IMG]](/icons/image2.gif) | 080911_0325_TheRetur..> | 2011-08-10 18:17 | 4.9K | |
![[IMG]](/icons/image2.gif) | 080911_0325_TheRetur..> | 2011-08-10 18:18 | 5.9K | |
![[IMG]](/icons/image2.gif) | 080911_0325_TheRetur..> | 2011-08-10 18:18 | 5.9K | |
![[IMG]](/icons/image2.gif) | 080911_0325_TheRetur..> | 2011-08-10 18:19 | 6.5K | |
![[IMG]](/icons/image2.gif) | 080911_0325_TheRetur..> | 2011-08-10 18:21 | 8.0K | |
![[IMG]](/icons/image2.gif) | 080911_0325_TheRetur..> | 2011-08-10 18:21 | 10K | |
![[IMG]](/icons/image2.gif) | 080911_0325_TheRetur..> | 2011-08-10 18:22 | 8.6K | |
![[IMG]](/icons/image2.gif) | 09-07-14_kunstler.png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 09-15-10-Jaws_of_Dea..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | 09_02_17c_deflation.png | 2012-10-13 18:49 | 79K | |
![[IMG]](/icons/image2.gif) | 091022-Thomas-Perez-..> | 2012-03-14 12:42 | 35K | |
![[IMG]](/icons/image2.gif) | 0923_moodys-standard..> | 2011-07-07 02:35 | 21K | |
![[IMG]](/icons/image2.gif) | 0930_Kuttner_lead.jpg | 2010-10-26 12:05 | 34K | |
![[IMG]](/icons/image2.gif) | 1(1).gif | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1(1).jpg | 2010-10-26 12:05 | 57K | |
![[IMG]](/icons/image2.gif) | 1(1).png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | 1(2).gif | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | 1(2).jpg | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | 1(2).png | 2010-10-26 12:05 | 87K | |
![[IMG]](/icons/image2.gif) | 1(3).gif | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | 1(3).jpg | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | 1(3).png | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | 1(4).gif | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 1(4).jpg | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | 1(4).png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | 1(5).gif | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 1(5).jpg | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | 1(5).png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 1(6).gif | 2010-10-26 12:05 | 9.6K | |
![[IMG]](/icons/image2.gif) | 1(6).jpg | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | 1(6).png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 1(7).gif | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 1(7).jpg | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | 1(7).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | 1(8).gif | 2010-10-26 12:05 | 57K | |
![[IMG]](/icons/image2.gif) | 1(8).jpg | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | 1(8).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | 1(9).gif | 2010-10-26 12:05 | 57K | |
![[IMG]](/icons/image2.gif) | 1(9).jpg | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 1(9).png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | 1(10).gif | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | 1(10).jpg | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | 1(10).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1(11).gif | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 1(11).jpg | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | 1(11).png | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | 1(12).gif | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 1(12).jpg | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | 1(12).png | 2010-10-26 12:05 | 58K | |
![[IMG]](/icons/image2.gif) | 1(13).gif | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1(13).jpg | 2010-10-26 12:05 | 34K | |
![[IMG]](/icons/image2.gif) | 1(13).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 1(14).gif | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | 1(14).jpg | 2010-10-26 12:05 | 34K | |
![[IMG]](/icons/image2.gif) | 1(14).png | 2010-10-26 12:05 | 143K | |
![[IMG]](/icons/image2.gif) | 1(15).gif | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | 1(15).jpg | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | 1(15).png | 2010-10-26 12:05 | 57K | |
![[IMG]](/icons/image2.gif) | 1(16).gif | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | 1(16).jpg | 2010-10-26 12:05 | 7.6K | |
![[IMG]](/icons/image2.gif) | 1(16).png | 2010-10-26 12:05 | 108K | |
![[IMG]](/icons/image2.gif) | 1(17).gif | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | 1(17).jpg | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | 1(17).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 1(18).gif | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | 1(18).jpg | 2010-10-26 12:05 | 69K | |
![[IMG]](/icons/image2.gif) | 1(18).png | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 1(19).jpg | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | 1(19).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 1(20).jpg | 2010-10-26 12:05 | 98K | |
![[IMG]](/icons/image2.gif) | 1(20).png | 2010-10-26 12:05 | 10K | |
![[IMG]](/icons/image2.gif) | 1(21).jpg | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | 1(21).png | 2010-10-26 12:05 | 68K | |
![[IMG]](/icons/image2.gif) | 1(22).jpg | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | 1(22).png | 2010-10-26 12:05 | 84K | |
![[IMG]](/icons/image2.gif) | 1(23).jpg | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | 1(23).png | 2010-10-26 12:05 | 6.2K | |
![[IMG]](/icons/image2.gif) | 1(24).jpg | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 1(24).png | 2010-10-26 12:05 | 71K | |
![[IMG]](/icons/image2.gif) | 1(25).jpg | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 1(25).png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | 1(26).jpg | 2010-10-26 12:05 | 8.0K | |
![[IMG]](/icons/image2.gif) | 1(26).png | 2010-10-26 12:05 | 405K | |
![[IMG]](/icons/image2.gif) | 1(27).jpg | 2010-10-26 12:05 | 67K | |
![[IMG]](/icons/image2.gif) | 1(27).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 1(28).jpg | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | 1(28).png | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | 1(29).jpg | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | 1(29).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 1(30).jpg | 2010-10-26 12:05 | 69K | |
![[IMG]](/icons/image2.gif) | 1(30).png | 2010-10-26 12:05 | 226K | |
![[IMG]](/icons/image2.gif) | 1(31).jpg | 2010-10-26 12:05 | 58K | |
![[IMG]](/icons/image2.gif) | 1(31).png | 2010-10-26 12:05 | 64K | |
![[IMG]](/icons/image2.gif) | 1(32).jpg | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | 1(32).png | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | 1(33).jpg | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 1(33).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1(34).jpg | 2010-10-26 12:05 | 56K | |
![[IMG]](/icons/image2.gif) | 1(34).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 1(35).jpg | 2010-10-26 12:05 | 58K | |
![[IMG]](/icons/image2.gif) | 1(35).png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 1(36).jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | 1(36).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 1(37).jpg | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | 1(37).png | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | 1(38).jpg | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 1(38).png | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | 1(39).jpg | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 1(39).png | 2010-10-26 12:05 | 87K | |
![[IMG]](/icons/image2.gif) | 1(40).jpg | 2010-10-26 12:05 | 98K | |
![[IMG]](/icons/image2.gif) | 1(40).png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 1(41).jpg | 2010-10-26 12:05 | 98K | |
![[IMG]](/icons/image2.gif) | 1(41).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | 1(42).jpg | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | 1(42).png | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | 1(43).jpg | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 1(43).png | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 1(44).jpg | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | 1(44).png | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 1(45).jpg | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | 1(45).png | 2010-10-26 12:05 | 222K | |
![[IMG]](/icons/image2.gif) | 1(46).jpg | 2010-10-26 12:05 | 37K | |
![[IMG]](/icons/image2.gif) | 1(46).png | 2010-10-26 12:05 | 222K | |
![[IMG]](/icons/image2.gif) | 1(47).jpg | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | 1(47).png | 2010-10-26 12:05 | 222K | |
![[IMG]](/icons/image2.gif) | 1(48).jpg | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | 1(48).png | 2010-10-26 12:05 | 62K | |
![[IMG]](/icons/image2.gif) | 1(49).jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 1(49).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1(50).jpg | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | 1(50).png | 2010-10-26 12:05 | 62K | |
![[IMG]](/icons/image2.gif) | 1(51).jpg | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | 1(51).png | 2010-10-26 12:05 | 6.6K | |
![[IMG]](/icons/image2.gif) | 1(52).jpg | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | 1(52).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | 1(53).jpg | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | 1(53).png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | 1(54).jpg | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1(54).png | 2010-10-26 12:05 | 110K | |
![[IMG]](/icons/image2.gif) | 1(55).jpg | 2010-10-26 12:05 | 70K | |
![[IMG]](/icons/image2.gif) | 1(55).png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | 1(56).jpg | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | 1(56).png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | 1(57).jpg | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1(57).png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | 1(58).jpg | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1(58).png | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | 1(59).jpg | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1(59).png | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | 1(60).jpg | 2010-10-26 12:05 | 5.5K | |
![[IMG]](/icons/image2.gif) | 1(60).png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 1(61).jpg | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | 1(61).png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 1(62).jpg | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | 1(62).png | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | 1(63).jpg | 2010-10-26 12:05 | 89K | |
![[IMG]](/icons/image2.gif) | 1(63).png | 2010-10-26 12:05 | 67K | |
![[IMG]](/icons/image2.gif) | 1(64).jpg | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | 1(64).png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 1(65).jpg | 2010-10-26 12:05 | 126K | |
![[IMG]](/icons/image2.gif) | 1(65).png | 2010-10-26 12:05 | 43K | |
![[IMG]](/icons/image2.gif) | 1(66).jpg | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | 1(66).png | 2010-10-26 12:05 | 69K | |
![[IMG]](/icons/image2.gif) | 1(67).jpg | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | 1(67).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | 1(68).jpg | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1(68).png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 1(69).jpg | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | 1(69).png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 1(70).jpg | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 1(70).png | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | 1(71).jpg | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | 1(71).png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | 1(72).jpg | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | 1(72).png | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | 1(73).jpg | 2010-10-26 12:05 | 132K | |
![[IMG]](/icons/image2.gif) | 1(73).png | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | 1(74).jpg | 2010-10-26 12:05 | 156K | |
![[IMG]](/icons/image2.gif) | 1(74).png | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | 1(75).jpg | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | 1(75).png | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | 1(76).jpg | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | 1(76).png | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | 1(77).jpg | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | 1(77).png | 2010-10-26 12:05 | 125K | |
![[IMG]](/icons/image2.gif) | 1(78).jpg | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | 1(78).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1(79).jpg | 2010-10-26 12:05 | 221K | |
![[IMG]](/icons/image2.gif) | 1(79).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1(80).jpg | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | 1(80).png | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | 1(81).jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 1(81).png | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | 1(82).jpg | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | 1(82).png | 2010-10-26 12:05 | 5.7K | |
![[IMG]](/icons/image2.gif) | 1(83).png | 2010-10-26 12:05 | 7.1K | |
![[IMG]](/icons/image2.gif) | 1(84).png | 2010-10-26 12:05 | 7.1K | |
![[IMG]](/icons/image2.gif) | 1(85).png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | 1(86).png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | 1(87).png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | 1(88).png | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 1(89).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1(90).png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 1(91).png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 1(92).png | 2010-10-26 12:05 | 57K | |
![[IMG]](/icons/image2.gif) | 1(93).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | 1(94).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1(95).png | 2011-04-19 10:10 | 135K | |
![[IMG]](/icons/image2.gif) | 1(96).png | 2011-04-19 14:23 | 27K | |
![[IMG]](/icons/image2.gif) | 1(97).png | 2011-04-20 13:00 | 46K | |
![[IMG]](/icons/image2.gif) | 1(98).png | 2011-04-20 13:01 | 46K | |
![[IMG]](/icons/image2.gif) | 1(99).png | 2011-04-25 12:53 | 22K | |
![[IMG]](/icons/image2.gif) | 1(100).png | 2011-04-25 13:23 | 154K | |
![[IMG]](/icons/image2.gif) | 1(101).png | 2011-04-25 13:59 | 161K | |
![[IMG]](/icons/image2.gif) | 1(102).png | 2011-04-25 14:00 | 161K | |
![[IMG]](/icons/image2.gif) | 1(103).png | 2011-04-26 12:49 | 134K | |
![[IMG]](/icons/image2.gif) | 1(104).png | 2011-04-29 14:59 | 155K | |
![[IMG]](/icons/image2.gif) | 1(105).png | 2011-05-04 14:40 | 21K | |
![[IMG]](/icons/image2.gif) | 1(106).png | 2011-05-10 10:51 | 20K | |
![[IMG]](/icons/image2.gif) | 1(107).png | 2011-05-10 13:20 | 20K | |
![[IMG]](/icons/image2.gif) | 1(108).png | 2011-05-10 14:33 | 22K | |
![[IMG]](/icons/image2.gif) | 1(109).png | 2011-05-12 10:30 | 21K | |
![[IMG]](/icons/image2.gif) | 1(110).png | 2011-05-12 13:29 | 27K | |
![[IMG]](/icons/image2.gif) | 1(111).png | 2011-05-12 15:45 | 158K | |
![[IMG]](/icons/image2.gif) | 1(112).png | 2011-05-12 15:46 | 84K | |
![[IMG]](/icons/image2.gif) | 1(113).png | 2011-05-13 14:35 | 32K | |
![[IMG]](/icons/image2.gif) | 1(114).png | 2011-05-17 11:49 | 19K | |
![[IMG]](/icons/image2.gif) | 1(115).png | 2011-05-17 14:51 | 31K | |
![[IMG]](/icons/image2.gif) | 1(116).png | 2011-05-18 11:34 | 48K | |
![[IMG]](/icons/image2.gif) | 1(117).png | 2011-05-19 11:04 | 27K | |
![[IMG]](/icons/image2.gif) | 1(118).png | 2011-05-19 14:44 | 33K | |
![[IMG]](/icons/image2.gif) | 1(119).png | 2011-05-20 10:19 | 19K | |
![[IMG]](/icons/image2.gif) | 1(120).png | 2011-05-20 14:27 | 28K | |
![[IMG]](/icons/image2.gif) | 1(121).png | 2011-05-26 14:38 | 22K | |
![[IMG]](/icons/image2.gif) | 1(122).png | 2011-05-26 14:39 | 22K | |
![[IMG]](/icons/image2.gif) | 1(123).png | 2011-06-01 13:10 | 29K | |
![[IMG]](/icons/image2.gif) | 1(124).png | 2011-06-02 12:06 | 135K | |
![[IMG]](/icons/image2.gif) | 1(125).png | 2011-06-06 15:34 | 29K | |
![[IMG]](/icons/image2.gif) | 1(126).png | 2011-06-08 13:22 | 410K | |
![[IMG]](/icons/image2.gif) | 1(127).png | 2011-06-15 12:48 | 118K | |
![[IMG]](/icons/image2.gif) | 1(128).png | 2011-06-17 13:21 | 35K | |
![[IMG]](/icons/image2.gif) | 1(129).png | 2011-06-17 15:17 | 75K | |
![[IMG]](/icons/image2.gif) | 1(130).png | 2011-06-17 15:17 | 75K | |
![[IMG]](/icons/image2.gif) | 1(131).png | 2011-06-21 12:55 | 67K | |
![[IMG]](/icons/image2.gif) | 1(132).png | 2011-06-29 15:05 | 21K | |
![[IMG]](/icons/image2.gif) | 1(133).png | 2011-06-29 15:07 | 20K | |
![[IMG]](/icons/image2.gif) | 1-300x214.gif | 2012-10-31 17:27 | 20K | |
![[IMG]](/icons/image2.gif) | 1.gif | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | 1.jpeg | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1.jpg | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | 1.png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 1KenFeinberg.jpg | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | 1[2](1).png | 2011-08-11 09:34 | 82K | |
![[IMG]](/icons/image2.gif) | 1[2].png | 2011-08-10 17:52 | 82K | |
![[IMG]](/icons/image2.gif) | 1a(1).jpg | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | 1a(1).png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 1a(2).jpg | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | 1a(2).png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | 1a(3).jpg | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | 1a(3).png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 1a(4).jpg | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | 1a(5).jpg | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | 1a.jpg | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | 1a.png | 2010-10-26 12:05 | 81K | |
![[IMG]](/icons/image2.gif) | 1aa(1).jpg | 2010-10-26 12:05 | 198K | |
![[IMG]](/icons/image2.gif) | 1aa.JPG | 2010-10-26 12:05 | 64K | |
![[IMG]](/icons/image2.gif) | 1absolute-debt_seren..> | 2010-10-26 12:05 | 44K | |
![[IMG]](/icons/image2.gif) | 1b(1).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 1b(2).png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 1b.png | 2010-10-26 12:05 | 79K | |
![[IMG]](/icons/image2.gif) | 1c(1).png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 1c(2).png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 1c.png | 2010-10-26 12:05 | 66K | |
![[IMG]](/icons/image2.gif) | 1com(1).jpg | 2010-10-26 12:05 | 72K | |
![[IMG]](/icons/image2.gif) | 1com.jpg | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | 1d(1).png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 1d.png | 2010-10-26 12:05 | 81K | |
![[IMG]](/icons/image2.gif) | 1 darling debt.jpg | 2011-07-20 13:13 | 36K | |
![[IMG]](/icons/image2.gif) | 1dougcartoon000362.jpg | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | 1e.png | 2010-10-26 12:05 | 79K | |
![[IMG]](/icons/image2.gif) | 1forte_alt_elert.jpg | 2010-10-26 12:05 | 9.1K | |
![[IMG]](/icons/image2.gif) | 1intel.png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 1jesse.jpg | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | 1 market top.gif | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | 1rohrsbw.jpg | 2010-10-26 12:05 | 6.2K | |
![[IMG]](/icons/image2.gif) | 1swine_flu_a_0424.jpg | 2010-10-26 12:05 | 93K | |
![[IMG]](/icons/image2.gif) | 1whphotos005327.jpg | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | 2(1).gif | 2010-10-26 12:05 | 6.2K | |
![[IMG]](/icons/image2.gif) | 2(1).jpg | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 2(1).png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 2(2).gif | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | 2(2).jpg | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | 2(2).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | 2(3).gif | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | 2(3).jpg | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | 2(3).png | 2010-10-26 12:05 | 197K | |
![[IMG]](/icons/image2.gif) | 2(4).jpg | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | 2(4).png | 2010-10-26 12:05 | 197K | |
![[IMG]](/icons/image2.gif) | 2(5).jpg | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | 2(5).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | 2(6).jpg | 2010-10-26 12:05 | 59K | |
![[IMG]](/icons/image2.gif) | 2(6).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | 2(7).jpg | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | 2(7).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 2(8).jpg | 2010-10-26 12:05 | 10K | |
![[IMG]](/icons/image2.gif) | 2(8).png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | 2(9).jpg | 2010-10-26 12:05 | 124K | |
![[IMG]](/icons/image2.gif) | 2(9).png | 2010-10-26 12:05 | 74K | |
![[IMG]](/icons/image2.gif) | 2(10).jpg | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 2(10).png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 2(11).jpg | 2010-10-26 12:05 | 58K | |
![[IMG]](/icons/image2.gif) | 2(11).png | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | 2(12).jpg | 2010-10-26 12:05 | 159K | |
![[IMG]](/icons/image2.gif) | 2(12).png | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 2(13).jpg | 2010-10-26 12:05 | 59K | |
![[IMG]](/icons/image2.gif) | 2(13).png | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 2(14).jpg | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | 2(14).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 2(15).png | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | 2(16).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 2(17).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 2(18).png | 2010-10-26 12:05 | 177K | |
![[IMG]](/icons/image2.gif) | 2(19).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 2(20).png | 2010-10-26 12:05 | 76K | |
![[IMG]](/icons/image2.gif) | 2(21).png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 2(22).png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 2(23).png | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | 2(24).png | 2010-10-26 12:05 | 58K | |
![[IMG]](/icons/image2.gif) | 2(25).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | 2(26).png | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | 2(27).png | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | 2(28).png | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | 2(29).png | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | 2(30).png | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | 2(31).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 2(32).png | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 2(33).png | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 2(34).png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | 2(35).png | 2011-04-27 15:23 | 24K | |
![[IMG]](/icons/image2.gif) | 2(36).png | 2011-04-29 10:42 | 211K | |
![[IMG]](/icons/image2.gif) | 2(37).png | 2011-05-12 09:46 | 198K | |
![[IMG]](/icons/image2.gif) | 2(38).png | 2011-05-18 13:54 | 24K | |
![[IMG]](/icons/image2.gif) | 2(39).png | 2011-05-20 12:46 | 68K | |
![[IMG]](/icons/image2.gif) | 2(40).png | 2011-05-26 15:48 | 136K | |
![[IMG]](/icons/image2.gif) | 2(41).png | 2011-05-26 15:49 | 136K | |
![[IMG]](/icons/image2.gif) | 2(42).png | 2011-05-26 15:51 | 136K | |
![[IMG]](/icons/image2.gif) | 2(43).png | 2011-06-01 13:11 | 23K | |
![[IMG]](/icons/image2.gif) | 2(44).png | 2011-06-08 13:23 | 81K | |
![[IMG]](/icons/image2.gif) | 2(45).png | 2011-06-14 11:52 | 56K | |
![[IMG]](/icons/image2.gif) | 2(46).png | 2011-06-21 15:41 | 79K | |
![[IMG]](/icons/image2.gif) | 2(47).png | 2011-07-01 12:33 | 59K | |
![[IMG]](/icons/image2.gif) | 2(48).png | 2011-07-01 12:45 | 59K | |
![[IMG]](/icons/image2.gif) | 2(49).png | 2011-07-15 12:57 | 59K | |
![[IMG]](/icons/image2.gif) | 2(50).png | 2011-10-21 14:40 | 36K | |
![[IMG]](/icons/image2.gif) | 2(51).png | 2011-12-02 10:18 | 36K | |
![[IMG]](/icons/image2.gif) | 2(52).png | 2011-12-02 10:19 | 36K | |
![[IMG]](/icons/image2.gif) | 2.JPG | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | 2.gif | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | 2.jpg | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | 2.png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 2[2](1).png | 2011-08-19 09:57 | 93K | |
![[IMG]](/icons/image2.gif) | 2[2].png | 2011-08-19 09:56 | 93K | |
![[IMG]](/icons/image2.gif) | 2[5](1).png | 2011-08-10 09:53 | 96K | |
![[IMG]](/icons/image2.gif) | 2[5].png | 2011-08-10 09:52 | 96K | |
![[IMG]](/icons/image2.gif) | 2a.jpg | 2010-10-26 12:05 | 43K | |
![[IMG]](/icons/image2.gif) | 2b.png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 2b2FT.jpg | 2010-12-07 16:43 | 196K | |
![[IMG]](/icons/image2.gif) | 2d7qj4b(1).png | 2011-04-15 16:01 | 45K | |
![[IMG]](/icons/image2.gif) | 2d7qj4b.png | 2011-04-15 15:57 | 48K | |
![[IMG]](/icons/image2.gif) | 2intel.png | 2010-10-26 12:05 | 9.4K | |
![[IMG]](/icons/image2.gif) | 2pkghql(1).png | 2011-03-28 14:04 | 106K | |
![[IMG]](/icons/image2.gif) | 2pkghql.png | 2011-03-28 14:04 | 106K | |
![[IMG]](/icons/image2.gif) | 2ymfgar.png | 2011-05-16 13:58 | 97K | |
![[IMG]](/icons/image2.gif) | 3(1).gif | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | 3(1).jpg | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | 3(1).png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 3(2).gif | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | 3(2).jpg | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | 3(2).png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | 3(3).jpg | 2010-10-26 12:05 | 69K | |
![[IMG]](/icons/image2.gif) | 3(3).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | 3(4).jpg | 2010-10-26 12:05 | 141K | |
![[IMG]](/icons/image2.gif) | 3(4).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | 3(5).jpg | 2010-10-26 12:05 | 8.0K | |
![[IMG]](/icons/image2.gif) | 3(5).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 3(6).jpg | 2010-10-26 12:05 | 8.0K | |
![[IMG]](/icons/image2.gif) | 3(6).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 3(7).png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 3(8).png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | 3(9).png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | 3(10).png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 3(11).png | 2010-10-26 12:05 | 102K | |
![[IMG]](/icons/image2.gif) | 3(12).png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 3(13).png | 2010-10-26 12:05 | 71K | |
![[IMG]](/icons/image2.gif) | 3(14).png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 3(15).png | 2010-10-26 12:05 | 44K | |
![[IMG]](/icons/image2.gif) | 3(16).png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | 3(17).png | 2010-10-26 12:05 | 9.2K | |
![[IMG]](/icons/image2.gif) | 3(18).png | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 3(19).png | 2010-10-26 12:05 | 9.2K | |
![[IMG]](/icons/image2.gif) | 3(20).png | 2010-10-26 12:05 | 9.2K | |
![[IMG]](/icons/image2.gif) | 3(21).png | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | 3(22).png | 2010-10-26 12:05 | 60K | |
![[IMG]](/icons/image2.gif) | 3(23).png | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | 3(24).png | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | 3(25).png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | 3(26).png | 2011-04-25 12:11 | 25K | |
![[IMG]](/icons/image2.gif) | 3(27).png | 2011-04-29 15:37 | 30K | |
![[IMG]](/icons/image2.gif) | 3(28).png | 2011-04-29 15:38 | 30K | |
![[IMG]](/icons/image2.gif) | 3(29).png | 2011-05-11 09:42 | 199K | |
![[IMG]](/icons/image2.gif) | 3(30).png | 2011-05-26 13:49 | 135K | |
![[IMG]](/icons/image2.gif) | 3(31).png | 2011-06-01 16:38 | 99K | |
![[IMG]](/icons/image2.gif) | 3(32).png | 2011-06-01 16:39 | 99K | |
![[IMG]](/icons/image2.gif) | 3(33).png | 2011-06-02 12:08 | 122K | |
![[IMG]](/icons/image2.gif) | 3(34).png | 2011-06-22 16:02 | 57K | |
![[IMG]](/icons/image2.gif) | 3(35).png | 2011-06-24 10:48 | 69K | |
![[IMG]](/icons/image2.gif) | 3(36).png | 2011-06-24 10:49 | 69K | |
![[IMG]](/icons/image2.gif) | 3(37).png | 2011-06-24 10:49 | 69K | |
![[IMG]](/icons/image2.gif) | 3(38).png | 2011-06-29 09:35 | 80K | |
![[IMG]](/icons/image2.gif) | 3(39).png | 2011-07-06 13:04 | 85K | |
![[IMG]](/icons/image2.gif) | 3(40).png | 2011-08-19 10:01 | 404K | |
![[IMG]](/icons/image2.gif) | 3(41).png | 2011-09-09 12:36 | 404K | |
![[IMG]](/icons/image2.gif) | 3(42).png | 2011-10-21 14:40 | 46K | |
![[IMG]](/icons/image2.gif) | 3-12-2010-3-25-16-PM..> | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 3-26-2010-9-11-35-AM..> | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | 3.JPG | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | 3.gif | 2010-10-26 12:05 | 5.8K | |
![[IMG]](/icons/image2.gif) | 3.jpg | 2010-10-26 12:05 | 37K | |
![[IMG]](/icons/image2.gif) | 3.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | 3 Black Crows.jpg | 2011-05-04 12:41 | 83K | |
![[IMG]](/icons/image2.gif) | 3PushDown.png | 2011-10-17 12:34 | 76K | |
![[IMG]](/icons/image2.gif) | 3appl.png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 3f3092e60aef7dcdc59f..> | 2011-03-28 15:37 | 208K | |
![[IMG]](/icons/image2.gif) | 3f3092e60aef7dcdc59f..> | 2011-03-28 15:33 | 208K | |
![[IMG]](/icons/image2.gif) | 3g46lve.png | 2011-10-19 13:41 | 59K | |
![[IMG]](/icons/image2.gif) | 3 min.JPG | 2011-06-03 15:25 | 123K | |
![[IMG]](/icons/image2.gif) | 4(1).jpg | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | 4(1).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | 4(2).jpg | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | 4(2).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | 4(3).jpg | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | 4(3).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 4(4).jpg | 2010-10-26 12:05 | 128K | |
![[IMG]](/icons/image2.gif) | 4(4).png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 4(5).jpg | 2010-10-26 12:05 | 146K | |
![[IMG]](/icons/image2.gif) | 4(5).png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | 4(6).jpg | 2011-11-29 12:51 | 83K | |
![[IMG]](/icons/image2.gif) | 4(6).png | 2010-10-26 12:05 | 113K | |
![[IMG]](/icons/image2.gif) | 4(7).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 4(8).png | 2010-10-26 12:05 | 73K | |
![[IMG]](/icons/image2.gif) | 4(9).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | 4(10).png | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | 4(11).png | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | 4(12).png | 2010-10-26 12:05 | 74K | |
![[IMG]](/icons/image2.gif) | 4(13).png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | 4(14).png | 2011-05-13 10:12 | 136K | |
![[IMG]](/icons/image2.gif) | 4(15).png | 2011-05-13 11:20 | 136K | |
![[IMG]](/icons/image2.gif) | 4(16).png | 2011-06-01 16:38 | 100K | |
![[IMG]](/icons/image2.gif) | 4(17).png | 2011-06-07 12:51 | 76K | |
![[IMG]](/icons/image2.gif) | 4(18).png | 2011-08-19 10:01 | 353K | |
![[IMG]](/icons/image2.gif) | 4(19).png | 2011-10-21 14:41 | 271K | |
![[IMG]](/icons/image2.gif) | 4-1-BigLots-Store.jpg | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | 4-2-2010-11-46-38-AM..> | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 4-2-2010-11-46-38-AM..> | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 4-9-2010-9-45-57-AMa..> | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 4-16-2010-1-34-14-PM..> | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 4-23-2010-4-31-25-PM..> | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | 4-23-2010-4-36-37-PM..> | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 4-30-2010-10-22-54-A..> | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 4.JPG | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | 4.gif | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | 4.jpg | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | 4.png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 4appl.png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 4lgnjvh.png | 2011-04-07 17:40 | 56K | |
![[IMG]](/icons/image2.gif) | 5(1).gif | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | 5(1).png | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | 5(2).png | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | 5(3).png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 5(4).png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 5(5).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 5(6).png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 5(7).png | 2010-10-26 12:05 | 140K | |
![[IMG]](/icons/image2.gif) | 5(8).png | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | 5(9).png | 2010-10-26 12:05 | 71K | |
![[IMG]](/icons/image2.gif) | 5(10).png | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | 5(11).png | 2010-10-26 12:05 | 44K | |
![[IMG]](/icons/image2.gif) | 5(12).png | 2011-06-07 12:56 | 98K | |
![[IMG]](/icons/image2.gif) | 5(13).png | 2011-06-22 13:24 | 135K | |
![[IMG]](/icons/image2.gif) | 5(14).png | 2011-06-24 16:02 | 135K | |
![[IMG]](/icons/image2.gif) | 5(15).png | 2011-06-29 10:35 | 57K | |
![[IMG]](/icons/image2.gif) | 5(16).png | 2011-06-30 09:49 | 74K | |
![[IMG]](/icons/image2.gif) | 5(17).png | 2011-07-01 10:26 | 79K | |
![[IMG]](/icons/image2.gif) | 5(18).png | 2011-07-06 11:09 | 92K | |
![[IMG]](/icons/image2.gif) | 5(19).png | 2011-07-13 09:49 | 262K | |
![[IMG]](/icons/image2.gif) | 5(20).png | 2011-08-19 13:26 | 20K | |
![[IMG]](/icons/image2.gif) | 5.JPG | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | 5.gif | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | 5.jpg | 2010-10-26 12:05 | 144K | |
![[IMG]](/icons/image2.gif) | 5.png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | 5KP Portfolio 2-26-2..> | 2012-02-26 10:32 | 50K | |
![[IMG]](/icons/image2.gif) | 5N95Lf5Hf3M43pc3o5c1..> | 2012-02-17 00:38 | 8.6K | |
![[IMG]](/icons/image2.gif) | 5aa.png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | 6(1).jpg | 2010-10-26 12:05 | 67K | |
![[IMG]](/icons/image2.gif) | 6(1).png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | 6(2).jpg | 2010-10-26 12:05 | 67K | |
![[IMG]](/icons/image2.gif) | 6(2).png | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | 6(3).jpg | 2011-07-06 11:27 | 800K | |
![[IMG]](/icons/image2.gif) | 6(3).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 6(4).jpg | 2011-07-06 12:58 | 800K | |
![[IMG]](/icons/image2.gif) | 6(4).png | 2010-10-26 12:05 | 149K | |
![[IMG]](/icons/image2.gif) | 6(5).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 6(6).png | 2010-10-26 12:05 | 69K | |
![[IMG]](/icons/image2.gif) | 6(7).png | 2010-10-26 12:05 | 44K | |
![[IMG]](/icons/image2.gif) | 6(8).png | 2011-06-22 13:25 | 125K | |
![[IMG]](/icons/image2.gif) | 6(9).png | 2011-06-30 09:52 | 53K | |
![[IMG]](/icons/image2.gif) | 6(10).png | 2011-07-13 10:08 | 36K | |
![[IMG]](/icons/image2.gif) | 6.JPG | 2010-10-26 12:05 | 40K | |
![[IMG]](/icons/image2.gif) | 6.jpg | 2010-10-26 12:05 | 67K | |
![[IMG]](/icons/image2.gif) | 6.png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 6_15_09.jpg | 2010-10-26 12:05 | 165K | |
![[IMG]](/icons/image2.gif) | 6a00d8341bf80c53ef01..> | 2011-10-28 16:39 | 101K | |
![[IMG]](/icons/image2.gif) | 6a00d8341bf80c53ef01..> | 2011-10-26 02:18 | 101K | |
![[IMG]](/icons/image2.gif) | 6a00d83451591e69e201..> | 2011-03-30 15:30 | 41K | |
![[IMG]](/icons/image2.gif) | 6a00d83451591e69e201..> | 2011-03-30 15:31 | 93K | |
![[IMG]](/icons/image2.gif) | 6a00e009898222883301..> | 2011-03-28 12:54 | 54K | |
![[IMG]](/icons/image2.gif) | 6a010536583aff970b01..> | 2012-04-25 16:30 | 40K | |
![[IMG]](/icons/image2.gif) | 6a010536583aff970b01..> | 2011-04-15 12:40 | 179K | |
![[IMG]](/icons/image2.gif) | 6a010536583aff970b01..> | 2012-07-21 18:48 | 98K | |
![[IMG]](/icons/image2.gif) | 6a010536583aff970b01..> | 2012-07-21 18:47 | 98K | |
![[IMG]](/icons/image2.gif) | 6a010536583aff970b01..> | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | 6a010536583aff970b01..> | 2012-02-14 11:05 | 16K | |
![[IMG]](/icons/image2.gif) | 6a010536583aff970b01..> | 2012-04-16 16:13 | 127K | |
![[IMG]](/icons/image2.gif) | 6a010536583aff970b01..> | 2011-03-05 18:37 | 27K | |
![[IMG]](/icons/image2.gif) | 6a010536583aff970b01..> | 2011-03-09 19:50 | 27K | |
![[IMG]](/icons/image2.gif) | 6a010536583aff970b01..> | 2011-03-28 17:12 | 27K | |
![[IMG]](/icons/image2.gif) | 6a010536583aff970b01..> | 2011-04-07 03:43 | 27K | |
![[IMG]](/icons/image2.gif) | 6a010536583aff970b01..> | 2011-01-06 03:48 | 27K | |
![[IMG]](/icons/image2.gif) | 6a010536583aff970b01..> | 2012-03-19 14:36 | 25K | |
![[IMG]](/icons/image2.gif) | 6a010536583aff970b01..> | 2011-10-12 12:36 | 49K | |
![[IMG]](/icons/image2.gif) | 6a010536583aff970b01..> | 2012-03-06 01:08 | 293K | |
![[IMG]](/icons/image2.gif) | 6aa.png | 2010-10-26 12:05 | 8.8K | |
![[IMG]](/icons/image2.gif) | 6sigkaa.png | 2011-05-17 15:55 | 93K | |
![[IMG]](/icons/image2.gif) | 6y7f6xc(1).png | 2011-03-25 12:13 | 135K | |
![[IMG]](/icons/image2.gif) | 6y7f6xc(2).png | 2011-03-25 12:19 | 135K | |
![[IMG]](/icons/image2.gif) | 6y7f6xc.png | 2011-03-25 12:10 | 135K | |
![[IMG]](/icons/image2.gif) | 7(1).jpg | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | 7(1).png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 7(2).jpg | 2011-07-13 12:54 | 517K | |
![[IMG]](/icons/image2.gif) | 7(2).png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | 7(3).jpg | 2011-07-19 11:52 | 550K | |
![[IMG]](/icons/image2.gif) | 7(3).png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 7(4).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 7(5).png | 2010-10-26 12:05 | 70K | |
![[IMG]](/icons/image2.gif) | 7(6).png | 2011-06-08 14:23 | 185K | |
![[IMG]](/icons/image2.gif) | 7(7).png | 2011-07-15 14:32 | 33K | |
![[IMG]](/icons/image2.gif) | 7.GIF | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | 7.JPG | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | 7.png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 7d9ae4471d9a32f4d743..> | 2011-03-23 13:52 | 7.8K | |
![[IMG]](/icons/image2.gif) | 7goog.png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 7isvs4b.png | 2011-11-23 15:20 | 29K | |
![[IMG]](/icons/image2.gif) | 8(1).jpg | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 8(1).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 8(2).jpg | 2011-07-20 13:31 | 170K | |
![[IMG]](/icons/image2.gif) | 8(2).png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | 8(3).png | 2010-10-26 12:05 | 70K | |
![[IMG]](/icons/image2.gif) | 8(4).png | 2011-07-13 16:30 | 28K | |
![[IMG]](/icons/image2.gif) | 8(5).png | 2011-08-23 14:00 | 33K | |
![[IMG]](/icons/image2.gif) | 8(6).png | 2011-08-23 14:04 | 33K | |
![[IMG]](/icons/image2.gif) | 8.JPG | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 8.png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 8 27 10.JPG | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | 8goog.png | 2010-10-26 12:05 | 10K | |
![[IMG]](/icons/image2.gif) | 9(1).jpg | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | 9(1).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 9(2).jpg | 2011-07-21 14:44 | 135K | |
![[IMG]](/icons/image2.gif) | 9(2).png | 2011-07-14 12:18 | 146K | |
![[IMG]](/icons/image2.gif) | 9(3).jpg | 2011-07-21 14:45 | 135K | |
![[IMG]](/icons/image2.gif) | 9.JPG | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | 9.jpg | 2011-08-23 11:37 | 136K | |
![[IMG]](/icons/image2.gif) | 9.png | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 10(1).jpg | 2010-10-26 12:05 | 5.6K | |
![[IMG]](/icons/image2.gif) | 10(1).png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 10(2).jpg | 2010-10-26 12:05 | 5.6K | |
![[IMG]](/icons/image2.gif) | 10(2).png | 2011-08-23 14:02 | 273K | |
![[IMG]](/icons/image2.gif) | 10(3).jpg | 2011-07-21 14:44 | 144K | |
![[IMG]](/icons/image2.gif) | 10(3).png | 2011-08-23 14:05 | 273K | |
![[IMG]](/icons/image2.gif) | 10.JPG | 2010-10-26 12:05 | 5.6K | |
![[IMG]](/icons/image2.gif) | 10.png | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | 10 breakeven.png | 2012-09-14 05:10 | 39K | |
![[IMG]](/icons/image2.gif) | 11(1).jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | 11(1).png | 2011-07-14 11:56 | 91K | |
![[IMG]](/icons/image2.gif) | 11(2).jpg | 2010-10-26 12:05 | 67K | |
![[IMG]](/icons/image2.gif) | 11(2).png | 2011-07-22 13:31 | 85K | |
![[IMG]](/icons/image2.gif) | 11(3).jpg | 2011-07-11 12:40 | 404K | |
![[IMG]](/icons/image2.gif) | 11(3).png | 2011-08-31 15:35 | 48K | |
![[IMG]](/icons/image2.gif) | 11(4).jpg | 2011-12-20 14:26 | 55K | |
![[IMG]](/icons/image2.gif) | 11(4).png | 2011-09-02 10:08 | 25K | |
![[IMG]](/icons/image2.gif) | 11(5).jpg | 2011-12-20 14:27 | 55K | |
![[IMG]](/icons/image2.gif) | 11(5).png | 2011-11-01 14:29 | 38K | |
![[IMG]](/icons/image2.gif) | 11-Economic-Crashes-..> | 2013-04-13 13:19 | 32K | |
![[IMG]](/icons/image2.gif) | 11.JPG | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | 11.jpg | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | 11.png | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | 12(1).png | 2011-07-11 13:09 | 95K | |
![[IMG]](/icons/image2.gif) | 12(2).png | 2011-07-11 13:10 | 95K | |
![[IMG]](/icons/image2.gif) | 12(3).png | 2011-07-22 10:11 | 66K | |
![[IMG]](/icons/image2.gif) | 12(4).png | 2011-08-05 11:22 | 74K | |
![[IMG]](/icons/image2.gif) | 12(5).png | 2011-08-24 09:36 | 50K | |
![[IMG]](/icons/image2.gif) | 12.JPG | 2011-09-09 12:19 | 43K | |
![[IMG]](/icons/image2.gif) | 12.png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | 13(1).png | 2011-08-22 12:27 | 54K | |
![[IMG]](/icons/image2.gif) | 13(2).png | 2011-08-22 12:30 | 54K | |
![[IMG]](/icons/image2.gif) | 13.JPG | 2011-07-12 11:05 | 305K | |
![[IMG]](/icons/image2.gif) | 13.png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | 13 II.png | 2011-11-22 12:51 | 34K | |
![[IMG]](/icons/image2.gif) | 14(1).jpg | 2011-07-22 13:24 | 182K | |
![[IMG]](/icons/image2.gif) | 14(1).png | 2011-08-05 12:22 | 26K | |
![[IMG]](/icons/image2.gif) | 14.JPG | 2011-07-12 13:29 | 548K | |
![[IMG]](/icons/image2.gif) | 14.png | 2011-07-25 12:50 | 25K | |
![[IMG]](/icons/image2.gif) | 15.JPG | 2011-07-22 15:31 | 172K | |
![[IMG]](/icons/image2.gif) | 15.png | 2011-08-05 12:23 | 101K | |
![[IMG]](/icons/image2.gif) | 15_dustinglloyd_lg-j..> | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | 16-Things-About-2013..> | 2012-12-29 05:04 | 22K | |
![[IMG]](/icons/image2.gif) | 17.png | 2011-08-02 15:01 | 88K | |
![[IMG]](/icons/image2.gif) | 18(1).png | 2011-07-29 10:05 | 21K | |
![[IMG]](/icons/image2.gif) | 18.png | 2011-07-28 15:23 | 37K | |
![[IMG]](/icons/image2.gif) | 19.png | 2011-07-29 09:49 | 72K | |
![[IMG]](/icons/image2.gif) | 20(1).jpg | 2011-08-05 14:46 | 106K | |
![[IMG]](/icons/image2.gif) | 20(2).jpg | 2011-08-08 10:52 | 106K | |
![[IMG]](/icons/image2.gif) | 20-Signs-That-The-Ne..> | 2013-04-30 23:51 | 134K | |
![[IMG]](/icons/image2.gif) | 20.JPG | 2011-08-05 14:45 | 106K | |
![[IMG]](/icons/image2.gif) | 20.png | 2011-08-01 12:52 | 6.4K | |
![[IMG]](/icons/image2.gif) | 21(1).png | 2011-08-05 14:47 | 19K | |
![[IMG]](/icons/image2.gif) | 21(2).png | 2011-08-08 14:45 | 95K | |
![[IMG]](/icons/image2.gif) | 21(3).png | 2011-08-08 14:47 | 83K | |
![[IMG]](/icons/image2.gif) | 21-Statistics-About-..> | 2013-04-05 19:58 | 13K | |
![[IMG]](/icons/image2.gif) | 21.JPG | 2011-08-05 13:09 | 428K | |
![[IMG]](/icons/image2.gif) | 21.png | 2011-08-05 14:47 | 19K | |
![[IMG]](/icons/image2.gif) | 22.JPG | 2011-08-18 11:15 | 49K | |
![[IMG]](/icons/image2.gif) | 22.png | 2011-08-08 10:53 | 4.6K | |
![[IMG]](/icons/image2.gif) | 22_02_12-Steve-Bell-..> | 2012-04-15 06:11 | 72K | |
![[IMG]](/icons/image2.gif) | 22k-bldg.jpg | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | 23.JPG | 2011-08-08 13:26 | 404K | |
![[IMG]](/icons/image2.gif) | 23.png | 2011-08-08 13:54 | 39K | |
![[IMG]](/icons/image2.gif) | 25KP Portfolio - 1-4..> | 2012-01-04 11:17 | 23K | |
![[IMG]](/icons/image2.gif) | 25KP Portfolio - 1-5..> | 2012-01-05 09:51 | 26K | |
![[IMG]](/icons/image2.gif) | 25KP Portfolio - 1-6..> | 2012-01-06 10:05 | 34K | |
![[IMG]](/icons/image2.gif) | 25KP Portfolio - 1-6..> | 2012-01-06 16:32 | 76K | |
![[IMG]](/icons/image2.gif) | 25KP Portfolio 1-22-..> | 2012-01-22 22:02 | 135K | |
![[IMG]](/icons/image2.gif) | 25KP Portfolio 1-30-..> | 2012-01-30 08:40 | 116K | |
![[IMG]](/icons/image2.gif) | 25KP Portfolio 1-30-..> | 2012-01-30 08:08 | 116K | |
![[IMG]](/icons/image2.gif) | 25KP Portfolio 1-30-..> | 2012-01-30 08:40 | 56K | |
![[IMG]](/icons/image2.gif) | 25KP Portfolio 1-30-..> | 2012-01-30 08:08 | 56K | |
![[IMG]](/icons/image2.gif) | 25KP Portfolio 2-26-..> | 2012-02-26 10:37 | 117K | |
![[IMG]](/icons/image2.gif) | 25KP Portfolio 2-26-..> | 2012-02-26 10:38 | 60K | |
![[IMG]](/icons/image2.gif) | 25 KP Recap 1-16-201..> | 2012-01-16 16:09 | 102K | |
![[IMG]](/icons/image2.gif) | 27-content(1).jpg | 2011-10-02 16:34 | 44K | |
![[IMG]](/icons/image2.gif) | 27-content.jpg | 2011-08-15 18:00 | 44K | |
![[IMG]](/icons/image2.gif) | 39(1).png | 2011-08-11 10:13 | 92K | |
![[IMG]](/icons/image2.gif) | 39.png | 2011-08-11 10:09 | 92K | |
![[IMG]](/icons/image2.gif) | 40(1).png | 2011-08-11 10:15 | 20K | |
![[IMG]](/icons/image2.gif) | 40-Statistics-About-..> | 2013-05-27 18:14 | 15K | |
![[IMG]](/icons/image2.gif) | 40.png | 2011-08-11 10:10 | 20K | |
![[IMG]](/icons/image2.gif) | 41.png | 2011-08-11 12:11 | 54K | |
![[IMG]](/icons/image2.gif) | 42.png | 2011-08-11 13:46 | 37K | |
![[IMG]](/icons/image2.gif) | 44.png | 2011-08-12 11:04 | 48K | |
![[IMG]](/icons/image2.gif) | 49 Everything is Mad..> | 2011-02-20 05:36 | 33K | |
![[IMG]](/icons/image2.gif) | 49 Everything is Mad..> | 2011-02-16 19:43 | 33K | |
![[IMG]](/icons/image2.gif) | 51SVS8ZJ75L__BO2,204..> | 2011-05-30 07:41 | 20K | |
![[IMG]](/icons/image2.gif) | 51SVS8ZJ75L__BO2,204..> | 2011-05-30 07:40 | 20K | |
![[IMG]](/icons/image2.gif) | 51ZkWz91O3L__SL110_.jpg | 2010-10-26 12:05 | 3.7K | |
![[IMG]](/icons/image2.gif) | 51k68MzRJNL__SS500_.jpg | 2011-10-17 16:44 | 41K | |
![[IMG]](/icons/image2.gif) | 66.JPG | 2011-08-08 15:05 | 4.6K | |
![[IMG]](/icons/image2.gif) | 66eiqwo(1).jpg | 2011-12-07 13:10 | 107K | |
![[IMG]](/icons/image2.gif) | 66eiqwo.jpg | 2011-12-07 13:08 | 107K | |
![[IMG]](/icons/image2.gif) | 77(1).png | 2011-08-15 16:07 | 67K | |
![[IMG]](/icons/image2.gif) | 77(2).png | 2011-11-10 10:53 | 43K | |
![[IMG]](/icons/image2.gif) | 77.jpg | 2011-07-01 13:07 | 63K | |
![[IMG]](/icons/image2.gif) | 77.png | 2011-08-15 14:47 | 27K | |
![[IMG]](/icons/image2.gif) | 88(1).png | 2011-08-17 09:38 | 30K | |
![[IMG]](/icons/image2.gif) | 88.JPG | 2011-07-08 13:53 | 83K | |
![[IMG]](/icons/image2.gif) | 88.png | 2011-08-09 11:58 | 27K | |
![[IMG]](/icons/image2.gif) | 90a1ecc7-76cd-497d-a..> | 2010-10-26 12:05 | 383K | |
![[IMG]](/icons/image2.gif) | 96ylthy.png | 2011-03-31 11:51 | 110K | |
![[IMG]](/icons/image2.gif) | 99.jpg | 2011-10-21 14:22 | 19K | |
![[IMG]](/icons/image2.gif) | 100 RICE-1(1).png | 2011-02-09 19:44 | 227K | |
![[IMG]](/icons/image2.gif) | 100 RICE-1.png | 2011-02-09 16:34 | 227K | |
![[IMG]](/icons/image2.gif) | 100_1012.jpg | 2010-12-13 20:42 | 15K | |
![[IMG]](/icons/image2.gif) | 142-jda(1).png | 2011-09-29 03:40 | 181K | |
![[IMG]](/icons/image2.gif) | 142-jda(2).png | 2011-11-10 16:33 | 181K | |
![[IMG]](/icons/image2.gif) | 142-jda(3).png | 2011-11-15 15:44 | 181K | |
![[IMG]](/icons/image2.gif) | 142-jda(4).png | 2011-11-27 13:31 | 181K | |
![[IMG]](/icons/image2.gif) | 142-jda(5).png | 2011-12-03 14:00 | 181K | |
![[IMG]](/icons/image2.gif) | 142-jda.png | 2011-09-29 03:40 | 181K | |
![[IMG]](/icons/image2.gif) | 200px-US-MarshallPla..> | 2011-11-01 16:35 | 14K | |
![[IMG]](/icons/image2.gif) | 220px-CGlass.jpg | 2012-03-30 16:53 | 13K | |
![[IMG]](/icons/image2.gif) | 220px-Jacob_Lew.jpg | 2013-01-09 16:49 | 13K | |
![[IMG]](/icons/image2.gif) | 220px-Ponzi1920.jpg | 2011-01-08 17:38 | 15K | |
![[IMG]](/icons/image2.gif) | 223ammo.jpg | 2011-11-02 14:21 | 76K | |
![[IMG]](/icons/image2.gif) | 250px-Pictogram_voti..> | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 288.gif | 2011-03-10 15:55 | 11K | |
![[IMG]](/icons/image2.gif) | 307_cell.jpg | 2011-02-23 05:17 | 10K | |
![[IMG]](/icons/image2.gif) | 317px-Mummy_in_Vatic..> | 2011-02-07 21:07 | 38K | |
![[IMG]](/icons/image2.gif) | 350px-Brueghel-tower..> | 2011-11-13 17:33 | 32K | |
![[IMG]](/icons/image2.gif) | 399px-Enchoen27n3200..> | 2012-10-23 18:08 | 71K | |
![[IMG]](/icons/image2.gif) | 446px-Punch_Anti-Iri..> | 2011-01-13 14:41 | 87K | |
![[IMG]](/icons/image2.gif) | 500x_3foxconn-worker..> | 2012-02-09 22:14 | 37K | |
![[IMG]](/icons/image2.gif) | 503px-Thomas_Jeffers..> | 2012-11-10 20:46 | 38K | |
![[IMG]](/icons/image2.gif) | 541px-Georgia_Aquari..> | 2011-03-21 18:25 | 91K | |
![[IMG]](/icons/image2.gif) | 541px-Georgia_Aquari..> | 2011-04-29 15:11 | 91K | |
![[IMG]](/icons/image2.gif) | 541px-Georgia_Aquari..> | 2011-02-10 14:04 | 91K | |
![[IMG]](/icons/image2.gif) | 588l9nx.png | 2011-03-29 11:45 | 931K | |
![[IMG]](/icons/image2.gif) | 600pxusfederalreserv..> | 2010-10-26 12:05 | 114K | |
![[IMG]](/icons/image2.gif) | 610x.jpg | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | 773px-Barter-Chicken..> | 2012-01-13 02:24 | 169K | |
![[IMG]](/icons/image2.gif) | 799px-12063_-_Santor..> | 2011-06-06 20:14 | 116K | |
![[IMG]](/icons/image2.gif) | 800LB Inflation Gori..> | 2011-05-01 02:23 | 70K | |
![[IMG]](/icons/image2.gif) | 800px-Avalanche_on_E..> | 2012-08-18 23:05 | 76K | |
![[IMG]](/icons/image2.gif) | 800px-Company-Shocke..> | 2010-10-26 12:05 | 165K | |
![[IMG]](/icons/image2.gif) | 800px-Gambling-ca-18..> | 2010-10-26 12:05 | 112K | |
![[IMG]](/icons/image2.gif) | 800px-Goldman_Sachs_..> | 2010-10-26 12:05 | 134K | |
![[IMG]](/icons/image2.gif) | 800px-Steve_case_050..> | 2011-02-07 19:57 | 60K | |
![[IMG]](/icons/image2.gif) | 868au8g.png | 2011-04-12 09:54 | 91K | |
![[IMG]](/icons/image2.gif) | 888.JPG | 2011-11-09 11:39 | 42K | |
![[IMG]](/icons/image2.gif) | 901_02_8700_prev-fre..> | 2010-10-26 12:05 | 138K | |
![[IMG]](/icons/image2.gif) | 901_02_8700_prev-fre..> | 2010-10-26 12:05 | 138K | |
![[IMG]](/icons/image2.gif) | 911 Sept 11 2011.jpg | 2011-09-12 09:14 | 60K | |
![[IMG]](/icons/image2.gif) | 1004-Wall-Street-Pro..> | 2011-11-05 16:42 | 73K | |
![[IMG]](/icons/image2.gif) | 1004-Wall-Street-Pro..> | 2011-11-08 01:39 | 73K | |
![[IMG]](/icons/image2.gif) | 1004-Wall-Street-Pro..> | 2011-10-11 14:46 | 73K | |
![[IMG]](/icons/image2.gif) | 1111.jpg | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | 1111_5.png | 2011-11-17 11:11 | 51K | |
![[IMG]](/icons/image2.gif) | 1111_WALL_STREETS_BI..> | 2010-10-26 12:05 | 74K | |
![[IMG]](/icons/image2.gif) | 1111_WALL_STREETS_BI..> | 2010-10-26 12:05 | 74K | |
![[IMG]](/icons/image2.gif) | 1112.png | 2011-11-17 11:10 | 45K | |
![[IMG]](/icons/image2.gif) | 1145gif.JPG | 2011-09-06 09:55 | 180K | |
![[IMG]](/icons/image2.gif) | 1348(1).png | 2011-05-09 14:07 | 125K | |
![[IMG]](/icons/image2.gif) | 1348.png | 2011-05-09 14:07 | 125K | |
![[IMG]](/icons/image2.gif) | 1939-glinda.jpg | 2011-10-12 01:28 | 65K | |
![[IMG]](/icons/image2.gif) | 1950-2010(1).jpg | 2011-11-18 12:45 | 50K | |
![[IMG]](/icons/image2.gif) | 1950-2010.jpg | 2011-11-18 12:43 | 50K | |
![[IMG]](/icons/image2.gif) | 2005-Touareg-W12-Spe..> | 2010-10-26 12:05 | 156K | |
![[IMG]](/icons/image2.gif) | 2006-2011.gif | 2011-11-14 11:51 | 29K | |
![[DIR]](/icons/folder.gif) | 2006/ | 2024-02-28 15:56 | - | |
![[DIR]](/icons/folder.gif) | 2007/ | 2024-02-28 15:56 | - | |
![[IMG]](/icons/image2.gif) | 2008-04-foreclosed-s..> | 2010-11-23 22:34 | 26K | |
![[IMG]](/icons/image2.gif) | 2008-04-foreclosed-s..> | 2010-12-26 14:44 | 26K | |
![[IMG]](/icons/image2.gif) | 2008-04-foreclosed-s..> | 2011-02-03 02:46 | 26K | |
![[IMG]](/icons/image2.gif) | 2008-04-foreclosed-s..> | 2011-02-15 17:04 | 26K | |
![[IMG]](/icons/image2.gif) | 2008-04-foreclosed-s..> | 2011-03-21 18:18 | 26K | |
![[IMG]](/icons/image2.gif) | 2008-04-foreclosed-s..> | 2011-05-18 13:27 | 26K | |
![[IMG]](/icons/image2.gif) | 2008-04-foreclosed-s..> | 2011-08-27 03:15 | 26K | |
![[IMG]](/icons/image2.gif) | 2008-04-foreclosed-s..> | 2011-08-31 04:13 | 26K | |
![[IMG]](/icons/image2.gif) | 2008-04-foreclosed-s..> | 2011-09-29 03:38 | 26K | |
![[IMG]](/icons/image2.gif) | 2008-04-foreclosed-s..> | 2011-12-21 17:24 | 26K | |
![[IMG]](/icons/image2.gif) | 2008-04-foreclosed-s..> | 2012-01-12 03:06 | 26K | |
![[IMG]](/icons/image2.gif) | 2008-04-foreclosed-s..> | 2010-11-10 14:26 | 26K | |
![[DIR]](/icons/folder.gif) | 2008/ | 2024-02-28 15:56 | - | |
![[IMG]](/icons/image2.gif) | 2008_09_housevote.jpg | 2010-10-26 12:05 | 64K | |
![[IMG]](/icons/image2.gif) | 2009-03-12-TOS_CHART..> | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | 2009-08-12-TOS_CHART..> | 2010-10-26 12:05 | 23K | |
![[DIR]](/icons/folder.gif) | 2009/ | 2024-02-28 15:57 | - | |
![[IMG]](/icons/image2.gif) | 2010-Semi-Revenue-Fo..> | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | 2010.gif | 2010-10-26 12:05 | 58K | |
![[DIR]](/icons/folder.gif) | 2010/ | 2024-02-28 15:57 | - | |
![[IMG]](/icons/image2.gif) | 2010_1_20_FedFinance..> | 2010-10-26 12:05 | 31K | |
![[DIR]](/icons/folder.gif) | 2011/ | 2024-02-28 15:57 | - | |
![[DIR]](/icons/folder.gif) | 2012/ | 2024-02-28 15:57 | - | |
![[DIR]](/icons/folder.gif) | 2013/ | 2024-02-28 15:57 | - | |
![[DIR]](/icons/folder.gif) | 2014/ | 2024-02-28 15:58 | - | |
![[DIR]](/icons/folder.gif) | 2015/ | 2024-02-28 15:58 | - | |
![[DIR]](/icons/folder.gif) | 2016/ | 2024-02-28 15:58 | - | |
![[DIR]](/icons/folder.gif) | 2017/ | 2024-02-28 16:15 | - | |
![[DIR]](/icons/folder.gif) | 2018/ | 2024-02-28 16:41 | - | |
![[DIR]](/icons/folder.gif) | 2019/ | 2024-02-28 17:04 | - | |
![[DIR]](/icons/folder.gif) | 2020/ | 2024-02-28 17:16 | - | |
![[DIR]](/icons/folder.gif) | 2021/ | 2024-02-28 17:30 | - | |
![[DIR]](/icons/folder.gif) | 2022/ | 2024-02-28 19:15 | - | |
![[DIR]](/icons/folder.gif) | 2023/ | 2024-02-28 23:17 | - | |
![[DIR]](/icons/folder.gif) | 2024/ | 2024-12-01 00:00 | - | |
![[DIR]](/icons/folder.gif) | 2025/ | 2025-12-01 00:00 | - | |
![[DIR]](/icons/folder.gif) | 2026/ | 2026-04-01 00:00 | - | |
![[IMG]](/icons/image2.gif) | 4965.jpg | 2011-06-28 20:19 | 20K | |
![[IMG]](/icons/image2.gif) | 6403bd3bdd72be77a3b7..> | 2011-03-24 13:47 | 185K | |
![[IMG]](/icons/image2.gif) | 7527_269699395230_80..> | 2011-03-14 16:52 | 23K | |
![[IMG]](/icons/image2.gif) | 7777.JPG | 2011-11-09 13:32 | 56K | |
![[IMG]](/icons/image2.gif) | 20159_c_large.png | 2011-11-02 12:44 | 55K | |
![[IMG]](/icons/image2.gif) | 24957_10150117950990..> | 2011-03-14 16:53 | 69K | |
![[IMG]](/icons/image2.gif) | 24957_10150117950990..> | 2011-03-14 16:48 | 69K | |
![[IMG]](/icons/image2.gif) | 58470.jpg | 2010-10-26 12:05 | 133K | |
![[IMG]](/icons/image2.gif) | 85700_600 - cartoon ..> | 2010-12-13 12:47 | 58K | |
![[IMG]](/icons/image2.gif) | 96074_600.jpg | 2011-07-31 03:42 | 83K | |
![[IMG]](/icons/image2.gif) | 96158_600.jpg | 2011-07-31 03:47 | 84K | |
![[IMG]](/icons/image2.gif) | 96506_600.jpg | 2011-08-07 04:36 | 84K | |
![[IMG]](/icons/image2.gif) | 98115-12488411121195..> | 2012-09-14 02:11 | 47K | |
![[IMG]](/icons/image2.gif) | 99146_600.jpg | 2011-10-16 03:30 | 113K | |
![[IMG]](/icons/image2.gif) | 100810PP(1).gif | 2010-10-26 12:05 | 8.0K | |
![[IMG]](/icons/image2.gif) | 100810PP.gif | 2010-10-26 12:05 | 8.1K | |
![[IMG]](/icons/image2.gif) | 100812PP.gif | 2010-10-26 12:05 | 8.1K | |
![[IMG]](/icons/image2.gif) | 100813PP.gif | 2010-10-26 12:05 | 8.2K | |
![[IMG]](/icons/image2.gif) | 100816PP.gif | 2010-10-26 12:05 | 8.0K | |
![[IMG]](/icons/image2.gif) | 100817PP.gif | 2010-10-26 12:05 | 8.1K | |
![[IMG]](/icons/image2.gif) | 110208PP.gif | 2011-02-08 09:16 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110210PP.gif | 2011-02-10 08:59 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110214PP.gif | 2011-02-14 09:05 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110215PP.gif | 2011-02-15 12:18 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110216PP.gif | 2011-02-16 08:57 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110216SPX.gif | 2011-02-16 08:58 | 43K | |
![[IMG]](/icons/image2.gif) | 110217ES.gif | 2011-02-17 08:54 | 28K | |
![[IMG]](/icons/image2.gif) | 110217PP.gif | 2011-02-17 08:52 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110218PP.gif | 2011-02-18 08:53 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110218VIX.gif | 2011-02-18 08:53 | 19K | |
![[IMG]](/icons/image2.gif) | 110222PP.gif | 2011-02-22 09:17 | 8.9K | |
![[IMG]](/icons/image2.gif) | 110223PP.gif | 2011-02-23 09:05 | 9.0K | |
![[IMG]](/icons/image2.gif) | 110225ES.gif | 2011-02-25 09:48 | 25K | |
![[IMG]](/icons/image2.gif) | 110225PP.gif | 2011-02-25 09:47 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110228PP(1).gif | 2011-03-01 09:54 | 8.8K | |
![[IMG]](/icons/image2.gif) | 110228PP.gif | 2011-02-28 09:02 | 8.8K | |
![[IMG]](/icons/image2.gif) | 110301ES.gif | 2011-03-01 09:55 | 27K | |
![[IMG]](/icons/image2.gif) | 110302PP2.gif | 2011-03-02 09:18 | 9.2K | |
![[IMG]](/icons/image2.gif) | 110303PP.gif | 2011-03-03 09:03 | 9.2K | |
![[IMG]](/icons/image2.gif) | 110304PP.gif | 2011-03-04 08:38 | 9.3K | |
![[IMG]](/icons/image2.gif) | 110307PP2.gif | 2011-03-07 09:16 | 9.3K | |
![[IMG]](/icons/image2.gif) | 110308PP.gif | 2011-03-08 09:10 | 9.2K | |
![[IMG]](/icons/image2.gif) | 110309PP(1).gif | 2011-03-09 08:36 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110309PP.gif | 2011-03-09 08:35 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110309SPY.gif | 2011-03-09 08:35 | 25K | |
![[IMG]](/icons/image2.gif) | 110310PP.gif | 2011-03-10 08:46 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110311ES.gif | 2011-03-11 08:57 | 27K | |
![[IMG]](/icons/image2.gif) | 110311PP.gif | 2011-03-11 08:56 | 9.0K | |
![[IMG]](/icons/image2.gif) | 110311SPY.gif | 2011-03-11 08:57 | 22K | |
![[IMG]](/icons/image2.gif) | 110316PP.gif | 2011-03-16 09:55 | 9.2K | |
![[IMG]](/icons/image2.gif) | 110317EWJ.gif | 2011-03-17 09:08 | 21K | |
![[IMG]](/icons/image2.gif) | 110317PP(1).gif | 2011-03-17 09:08 | 9.2K | |
![[IMG]](/icons/image2.gif) | 110317PP.gif | 2011-03-17 09:08 | 9.2K | |
![[IMG]](/icons/image2.gif) | 110318PCR.gif | 2011-03-18 08:24 | 67K | |
![[IMG]](/icons/image2.gif) | 110318PP.gif | 2011-03-18 08:24 | 9.2K | |
![[IMG]](/icons/image2.gif) | 110321PP.gif | 2011-03-21 10:11 | 8.9K | |
![[IMG]](/icons/image2.gif) | 110322PP.gif | 2011-03-22 09:04 | 9.2K | |
![[IMG]](/icons/image2.gif) | 110323PP(1).gif | 2011-03-23 09:05 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110323PP(2).gif | 2011-03-23 09:06 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110323PP.gif | 2011-03-23 09:04 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110324PP.gif | 2011-03-24 08:57 | 9.0K | |
![[IMG]](/icons/image2.gif) | 110325PP.gif | 2011-03-25 08:49 | 9.3K | |
![[IMG]](/icons/image2.gif) | 110328PP.gif | 2011-03-28 09:09 | 8.8K | |
![[IMG]](/icons/image2.gif) | 110329PP.gif | 2011-03-29 09:13 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110330ES.gif | 2011-03-30 09:12 | 23K | |
![[IMG]](/icons/image2.gif) | 110330PP.gif | 2011-03-30 09:08 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110331PP.gif | 2011-03-31 09:43 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110331_SPX_Table_Fir..> | 2011-03-31 11:15 | 69K | |
![[IMG]](/icons/image2.gif) | 110401PP.gif | 2011-04-01 08:25 | 9.2K | |
![[IMG]](/icons/image2.gif) | 110404PP.gif | 2011-04-04 08:38 | 9.2K | |
![[IMG]](/icons/image2.gif) | 110405PP.gif | 2011-04-05 08:48 | 9.0K | |
![[IMG]](/icons/image2.gif) | 110406PP.gif | 2011-04-06 09:08 | 9.2K | |
![[IMG]](/icons/image2.gif) | 110407PP.gif | 2011-04-07 08:56 | 9.0K | |
![[IMG]](/icons/image2.gif) | 110411PP.gif | 2011-04-11 09:01 | 8.9K | |
![[IMG]](/icons/image2.gif) | 110411 RUT Daily Tre..> | 2011-04-11 10:55 | 70K | |
![[IMG]](/icons/image2.gif) | 110412PP.gif | 2011-04-12 09:31 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110412 SPX Daily Ris..> | 2011-04-12 13:24 | 72K | |
![[IMG]](/icons/image2.gif) | 110412USO.gif | 2011-04-12 10:00 | 19K | |
![[IMG]](/icons/image2.gif) | 110413PP.gif | 2011-04-13 08:39 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110414PP.gif | 2011-04-14 09:16 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110415PP.gif | 2011-04-15 09:17 | 8.8K | |
![[IMG]](/icons/image2.gif) | 110418PP.gif | 2011-04-18 09:00 | 8.8K | |
![[IMG]](/icons/image2.gif) | 110418VIX.gif | 2011-04-18 09:01 | 17K | |
![[IMG]](/icons/image2.gif) | 110419PP.gif | 2011-04-19 08:59 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110419SPX.gif | 2011-04-19 08:59 | 17K | |
![[IMG]](/icons/image2.gif) | 110421PP.gif | 2011-04-21 08:50 | 9.0K | |
![[IMG]](/icons/image2.gif) | 110425PP(1).gif | 2011-04-25 08:55 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110425PP.gif | 2011-04-25 08:54 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110426PP.gif | 2011-04-26 08:54 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110427PP.gif | 2011-04-27 08:57 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110428ES.gif | 2011-04-28 08:58 | 17K | |
![[IMG]](/icons/image2.gif) | 110428PP.gif | 2011-04-28 08:57 | 8.8K | |
![[IMG]](/icons/image2.gif) | 110429PP.gif | 2011-04-29 09:28 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110502PP.gif | 2011-05-02 09:17 | 8.9K | |
![[IMG]](/icons/image2.gif) | 110503PP(1).gif | 2011-05-03 08:49 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110503PP.gif | 2011-05-03 08:49 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110503all.gif | 2011-05-03 08:50 | 31K | |
![[IMG]](/icons/image2.gif) | 110504PP.gif | 2011-05-04 09:22 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110505PP.gif | 2011-05-05 09:21 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110505ind.jpg | 2011-05-05 09:22 | 134K | |
![[IMG]](/icons/image2.gif) | 110506PP.gif | 2011-05-06 09:31 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110509PP.gif | 2011-05-09 08:58 | 8.8K | |
![[IMG]](/icons/image2.gif) | 110509ind.jpg | 2011-05-09 08:59 | 133K | |
![[IMG]](/icons/image2.gif) | 110510PP.gif | 2011-05-10 08:43 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110511PP(1).gif | 2011-05-11 08:52 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110511PP.gif | 2011-05-11 08:52 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110512PP.gif | 2011-05-12 09:17 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110512SPY.gif | 2011-05-12 09:16 | 20K | |
![[IMG]](/icons/image2.gif) | 110513DX2.gif | 2011-05-13 08:56 | 20K | |
![[IMG]](/icons/image2.gif) | 110513PP.gif | 2011-05-13 08:55 | 9.0K | |
![[IMG]](/icons/image2.gif) | 110516PP.gif | 2011-05-16 09:12 | 8.8K | |
![[IMG]](/icons/image2.gif) | 110517PP.gif | 2011-05-17 09:26 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110517SPY.gif | 2011-05-17 09:27 | 20K | |
![[IMG]](/icons/image2.gif) | 110518PP.gif | 2011-05-18 09:11 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110519DX.gif | 2011-05-19 09:08 | 24K | |
![[IMG]](/icons/image2.gif) | 110519PP.gif | 2011-05-19 09:07 | 9.0K | |
![[IMG]](/icons/image2.gif) | 110520PP.gif | 2011-05-20 09:16 | 8.8K | |
![[IMG]](/icons/image2.gif) | 110523PP.gif | 2011-05-22 22:48 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110525PP.gif | 2011-05-25 08:51 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110526PP.gif | 2011-05-26 09:07 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110527PP.gif | 2011-05-27 09:21 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110531DX.gif | 2011-05-31 09:08 | 21K | |
![[IMG]](/icons/image2.gif) | 110531PP.gif | 2011-05-31 08:47 | 8.8K | |
![[IMG]](/icons/image2.gif) | 110601PP.gif | 2011-06-01 08:53 | 8.8K | |
![[IMG]](/icons/image2.gif) | 110602PP.gif | 2011-06-02 08:52 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110603PP.gif | 2011-06-03 09:03 | 8.9K | |
![[IMG]](/icons/image2.gif) | 110606PP.gif | 2011-06-06 09:19 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110607PP.gif | 2011-06-07 08:58 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110607SPY.gif | 2011-06-07 08:57 | 25K | |
![[IMG]](/icons/image2.gif) | 110608PP.gif | 2011-06-08 09:18 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110609PP.gif | 2011-06-09 09:25 | 9.0K | |
![[IMG]](/icons/image2.gif) | 110610PP.gif | 2011-06-10 09:18 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110613PP.gif | 2011-06-13 09:19 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110615PP(1).gif | 2011-06-15 09:06 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110615PP.gif | 2011-06-15 09:02 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110615SPY(1).gif | 2011-06-15 09:07 | 24K | |
![[IMG]](/icons/image2.gif) | 110615SPY.gif | 2011-06-15 09:04 | 24K | |
![[IMG]](/icons/image2.gif) | 110616PP.gif | 2011-06-16 09:09 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110617DX.gif | 2011-06-17 09:03 | 23K | |
![[IMG]](/icons/image2.gif) | 110617PP.gif | 2011-06-17 09:02 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110620PP.gif | 2011-06-20 09:11 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110621PP.gif | 2011-06-21 08:53 | 9.0K | |
![[IMG]](/icons/image2.gif) | 110621RIMM.gif | 2011-06-21 08:53 | 22K | |
![[IMG]](/icons/image2.gif) | 110627PP.gif | 2011-06-27 09:45 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110628PP(1).gif | 2011-06-28 09:15 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110628PP.gif | 2011-06-28 09:14 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110629PP.gif | 2011-06-29 09:15 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110629SPX.gif | 2011-06-29 09:15 | 13K | |
![[IMG]](/icons/image2.gif) | 110630PP.gif | 2011-06-30 09:08 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110701PP.gif | 2011-07-01 08:30 | 9.2K | |
![[IMG]](/icons/image2.gif) | 110701_SPX_28_Months..> | 2011-07-01 10:04 | 45K | |
![[IMG]](/icons/image2.gif) | 110701_SPX_28_Months..> | 2011-07-01 10:02 | 79K | |
![[IMG]](/icons/image2.gif) | 110706PP.gif | 2011-07-06 09:24 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110707PP.gif | 2011-07-07 09:13 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110708PP.gif | 2011-07-08 08:35 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110711ES(1).gif | 2011-07-11 08:54 | 20K | |
![[IMG]](/icons/image2.gif) | 110711ES.gif | 2011-07-11 08:53 | 20K | |
![[IMG]](/icons/image2.gif) | 110711PP.gif | 2011-07-11 08:54 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110712PP.gif | 2011-07-12 09:08 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110713PP.gif | 2011-07-13 09:28 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110714PP(1).gif | 2011-07-14 09:18 | 8.8K | |
![[IMG]](/icons/image2.gif) | 110714PP(2).gif | 2011-07-14 09:18 | 8.8K | |
![[IMG]](/icons/image2.gif) | 110714PP.gif | 2011-07-14 09:18 | 8.8K | |
![[IMG]](/icons/image2.gif) | 110715PP(1).gif | 2011-07-18 09:24 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110715PP.gif | 2011-07-15 09:43 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110719PP.gif | 2011-07-19 09:44 | 9.2K | |
![[IMG]](/icons/image2.gif) | 110720PP.gif | 2011-07-20 09:27 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110721PP.gif | 2011-07-21 09:19 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110722PP.gif | 2011-07-22 09:26 | 9.0K | |
![[IMG]](/icons/image2.gif) | 110725PP.gif | 2011-07-25 09:23 | 9.1K | |
![[IMG]](/icons/image2.gif) | 110726PP.gif | 2011-07-26 09:16 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110802PP.gif | 2011-08-02 08:53 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110802SPY.gif | 2011-08-02 08:54 | 33K | |
![[IMG]](/icons/image2.gif) | 110803PP.gif | 2011-08-03 08:51 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110804PP.gif | 2011-08-04 08:46 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110805PP.gif | 2011-08-05 09:12 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110809PP.gif | 2011-08-09 08:33 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110810PP.gif | 2011-08-10 09:13 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110811PP.gif | 2011-08-11 09:23 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110819PP.gif | 2011-08-19 08:45 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110821PP.gif | 2011-08-22 09:00 | 9.0K | |
![[IMG]](/icons/image2.gif) | 110822PP.gif | 2011-08-23 08:50 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110822SPY.gif | 2011-08-23 08:49 | 17K | |
![[IMG]](/icons/image2.gif) | 110824PP.gif | 2011-08-24 09:18 | 8.5K | |
![[IMG]](/icons/image2.gif) | 110825PP.gif | 2011-08-25 09:13 | 8.5K | |
![[IMG]](/icons/image2.gif) | 110826PP.gif | 2011-08-26 09:57 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110831PP.gif | 2011-08-31 09:49 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110901PP.gif | 2011-09-01 08:40 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110902PP.gif | 2011-09-02 09:23 | 8.5K | |
![[IMG]](/icons/image2.gif) | 110902SPY.gif | 2011-09-02 09:25 | 22K | |
![[IMG]](/icons/image2.gif) | 110906ES.gif | 2011-09-06 09:05 | 15K | |
![[IMG]](/icons/image2.gif) | 110906PP.gif | 2011-09-06 09:04 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110907PP.gif | 2011-09-07 09:09 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110908PP.gif | 2011-09-08 08:50 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110909PP.gif | 2011-09-09 09:19 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110912PP.gif | 2011-09-12 08:57 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110913PP.gif | 2011-09-13 09:20 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110913SPY.gif | 2011-09-13 09:19 | 15K | |
![[IMG]](/icons/image2.gif) | 110914PP.gif | 2011-09-14 09:13 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110915PP.gif | 2011-09-15 09:06 | 8.5K | |
![[IMG]](/icons/image2.gif) | 110915QQQ.gif | 2011-09-15 09:07 | 14K | |
![[IMG]](/icons/image2.gif) | 110916PP.gif | 2011-09-16 09:04 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110919PP.gif | 2011-09-19 07:09 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110920PP.gif | 2011-09-20 09:11 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110922PP.gif | 2011-09-22 08:32 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110923PP.gif | 2011-09-23 09:20 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110926PP.gif | 2011-09-26 09:19 | 8.7K | |
![[IMG]](/icons/image2.gif) | 110927PP(1).gif | 2011-09-28 09:04 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110927PP.gif | 2011-09-27 08:59 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110929PP.gif | 2011-09-29 09:17 | 8.6K | |
![[IMG]](/icons/image2.gif) | 110929ZB.gif | 2011-09-29 09:23 | 14K | |
![[IMG]](/icons/image2.gif) | 110930PP.gif | 2011-09-30 09:19 | 8.7K | |
![[IMG]](/icons/image2.gif) | 111003SPY.gif | 2011-10-03 08:56 | 101K | |
![[IMG]](/icons/image2.gif) | 111101 EEM Daily Pos..> | 2011-11-01 13:51 | 115K | |
![[IMG]](/icons/image2.gif) | 111122 RUT 15min Dec..> | 2011-11-22 12:09 | 49K | |
![[IMG]](/icons/image2.gif) | 111122 RUT 15min Dec..> | 2011-11-22 12:07 | 49K | |
![[IMG]](/icons/image2.gif) | 111129 SPY 60min Rev..> | 2011-11-29 12:49 | 44K | |
![[IMG]](/icons/image2.gif) | 115057_mcdonalds.jpg | 2011-01-25 21:20 | 21K | |
![[IMG]](/icons/image2.gif) | 130125_sm.jpg | 2013-01-25 22:14 | 13K | |
![[IMG]](/icons/image2.gif) | 130525_TFTF_lg.jpg | 2013-05-25 16:45 | 19K | |
![[IMG]](/icons/image2.gif) | 130629_TFTF_sm.jpg | 2013-07-01 14:00 | 12K | |
![[IMG]](/icons/image2.gif) | 187929,xcitefun-tran..> | 2011-05-16 16:09 | 63K | |
![[IMG]](/icons/image2.gif) | 187929,xcitefun-tran..> | 2011-05-16 16:08 | 63K | |
![[IMG]](/icons/image2.gif) | 196421_1469749361965..> | 2013-05-15 12:29 | 57K | |
![[IMG]](/icons/image2.gif) | 196421_1469749361965..> | 2011-11-19 17:06 | 57K | |
![[IMG]](/icons/image2.gif) | 196421_1469749361965..> | 2011-07-18 21:36 | 57K | |
![[IMG]](/icons/image2.gif) | 393253_4158244751339..> | 2012-09-12 16:25 | 34K | |
![[IMG]](/icons/image2.gif) | 401156.jpg | 2011-12-29 16:34 | 14K | |
![[IMG]](/icons/image2.gif) | 474504-2671-27.jpg | 2012-03-14 14:02 | 26K | |
![[IMG]](/icons/image2.gif) | 517731_s.jpg | 2012-09-18 03:44 | 29K | |
![[IMG]](/icons/image2.gif) | 524202_3887286432079..> | 2012-07-13 18:48 | 22K | |
![[IMG]](/icons/image2.gif) | 560476_3718810362096..> | 2012-05-23 01:53 | 36K | |
![[IMG]](/icons/image2.gif) | 590109_566418_274930..> | 2010-12-10 01:17 | 32K | |
![[IMG]](/icons/image2.gif) | 1234527-le-end-graff..> | 2012-01-13 12:48 | 8.4K | |
![[IMG]](/icons/image2.gif) | 1234527-le-end-graff..> | 2011-12-21 23:55 | 8.4K | |
![[IMG]](/icons/image2.gif) | 1282219_looking_at_t..> | 2011-01-16 15:10 | 64K | |
![[IMG]](/icons/image2.gif) | 1622876_s.jpg | 2012-09-18 21:27 | 22K | |
![[IMG]](/icons/image2.gif) | 3106515_s.jpg | 2012-08-28 16:31 | 29K | |
![[IMG]](/icons/image2.gif) | 3797251_s.jpg | 2012-12-01 18:42 | 19K | |
![[IMG]](/icons/image2.gif) | 4467138_s(1).jpg | 2012-08-24 17:41 | 38K | |
![[IMG]](/icons/image2.gif) | 4467138_s.jpg | 2012-08-24 17:32 | 38K | |
![[IMG]](/icons/image2.gif) | 5996234_s.jpg | 2012-10-12 16:12 | 24K | |
![[IMG]](/icons/image2.gif) | 8292121_s.jpg | 2012-12-02 16:38 | 39K | |
![[IMG]](/icons/image2.gif) | 8883568-macro-shot-o..> | 2011-03-30 12:57 | 34K | |
![[IMG]](/icons/image2.gif) | 10132494rejection3-2..> | 2011-03-29 03:19 | 24K | |
![[IMG]](/icons/image2.gif) | 10710021_s.jpg | 2012-09-16 05:18 | 51K | |
![[IMG]](/icons/image2.gif) | 10732189.jpg | 2012-09-09 14:46 | 24K | |
![[IMG]](/icons/image2.gif) | 10861725_s.jpg | 2012-09-17 16:35 | 22K | |
![[IMG]](/icons/image2.gif) | 12812245_s.jpg | 2012-09-18 13:41 | 27K | |
![[IMG]](/icons/image2.gif) | 13180983_s.jpg | 2012-09-16 05:48 | 16K | |
![[IMG]](/icons/image2.gif) | 13894970_s.jpg | 2012-12-01 20:52 | 31K | |
![[IMG]](/icons/image2.gif) | 13995414_s.jpg | 2012-10-04 19:57 | 20K | |
![[IMG]](/icons/image2.gif) | 14414349_s.jpg | 2012-10-04 20:12 | 35K | |
![[IMG]](/icons/image2.gif) | 15089092_s (1).jpg | 2012-12-01 20:19 | 20K | |
![[IMG]](/icons/image2.gif) | 20090820_ussweethear..> | 2011-03-30 16:15 | 20K | |
![[IMG]](/icons/image2.gif) | 20091118we-banksy-cc..> | 2012-01-01 15:59 | 32K | |
![[IMG]](/icons/image2.gif) | 20111128Week.png | 2011-11-28 14:20 | 28K | |
![[IMG]](/icons/image2.gif) | 20111130_ES_Save(1).png | 2011-11-30 13:49 | 133K | |
![[IMG]](/icons/image2.gif) | 20111130_ES_Save.png | 2011-11-30 13:41 | 145K | |
![[IMG]](/icons/image2.gif) | 20111230_FOC10.png | 2012-01-08 21:43 | 84K | |
![[IMG]](/icons/image2.gif) | 20111230_FOC11.png | 2012-01-08 21:43 | 386K | |
![[IMG]](/icons/image2.gif) | 20112010.png | 2011-08-31 15:12 | 42K | |
![[IMG]](/icons/image2.gif) | 20121206-mark-carney..> | 2012-12-06 17:18 | 137K | |
![[IMG]](/icons/image2.gif) | 20130212-banks-too-b..> | 2013-02-15 13:43 | 322K | |
![[IMG]](/icons/image2.gif) | 20130419_chanos1.jpg | 2013-04-26 14:29 | 26K | |
![[IMG]](/icons/image2.gif) | 20130507_SPX1_0.jpg | 2013-05-10 17:37 | 29K | |
![[IMG]](/icons/image2.gif) | 32255204-32255209-sl..> | 2010-12-08 23:10 | 25K | |
![[IMG]](/icons/image2.gif) | 32255204-32255209-sl..> | 2011-01-15 16:58 | 25K | |
![[IMG]](/icons/image2.gif) | 32255204-32255209-sl..> | 2010-11-23 21:55 | 25K | |
![[IMG]](/icons/image2.gif) | 84008190staph4-15-11..> | 2011-04-17 14:31 | 35K | |
![[IMG]](/icons/image2.gif) | 753462542.jpg | 2013-01-29 13:55 | 52K | |
![[IMG]](/icons/image2.gif) | 803878905.jpg | 2013-01-29 13:55 | 47K | |
![[IMG]](/icons/image2.gif) | 1346202321_6110_thel..> | 2013-06-03 14:02 | 14K | |
![[IMG]](/icons/image2.gif) | 1621509809_Tide_Dete..> | 2012-03-15 13:57 | 96K | |
![[IMG]](/icons/image2.gif) | 1869559792_82506af2a..> | 2011-02-07 20:18 | 124K | |
![[IMG]](/icons/image2.gif) | 2443200304_4261ab269..> | 2012-02-22 16:37 | 6.3K | |
![[IMG]](/icons/image2.gif) | 3927520177_c82edc5da..> | 2011-12-16 12:25 | 36K | |
![[IMG]](/icons/image2.gif) | 4056337199_a4620eb2e..> | 2012-04-18 12:47 | 52K | |
![[IMG]](/icons/image2.gif) | 4400751317_d4d007562..> | 2012-01-13 14:35 | 42K | |
![[IMG]](/icons/image2.gif) | 5935295089_a25da94d6..> | 2012-07-07 16:33 | 438K | |
![[IMG]](/icons/image2.gif) | 6245781144_cb1dd1cf8..> | 2011-10-19 12:21 | 138K | |
![[IMG]](/icons/image2.gif) | 6245781144_cb1dd1cf8..> | 2011-10-27 17:16 | 138K | |
![[IMG]](/icons/image2.gif) | 6245781144_cb1dd1cf8..> | 2011-10-18 23:10 | 138K | |
![[IMG]](/icons/image2.gif) | 6497398985_84b7c5b47..> | 2012-11-14 17:10 | 670K | |
![[IMG]](/icons/image2.gif) | 6857656890_5d1484dba..> | 2012-04-15 13:34 | 24K | |
![[IMG]](/icons/image2.gif) | 7003771177_5a108c0dc..> | 2012-04-11 17:06 | 26K | |
![[IMG]](/icons/image2.gif) | 8191145456_d6ced0495..> | 2012-11-16 15:15 | 424K | |
![[IMG]](/icons/image2.gif) | 201201050106.jpg | 2012-01-27 03:30 | 24K | |
![[IMG]](/icons/image2.gif) | 110971578288374122_O..> | 2013-01-24 17:26 | 105K | |
![[IMG]](/icons/image2.gif) | 155937205818402435_C..> | 2012-12-26 04:30 | 9.8K | |
![[IMG]](/icons/image2.gif) | A1.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | A2.png | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | AA Money 1-3-2012.png | 2012-01-03 09:43 | 16K | |
![[IMG]](/icons/image2.gif) | AA Money 1-4-2012.png | 2012-01-04 09:36 | 16K | |
![[IMG]](/icons/image2.gif) | AA Money 1-5-2012.png | 2012-01-05 09:38 | 16K | |
![[IMG]](/icons/image2.gif) | AA Money 1-6-2012.png | 2012-01-06 09:35 | 16K | |
![[IMG]](/icons/image2.gif) | AA Money 1-6-2012 2.png | 2012-01-06 10:40 | 15K | |
![[IMG]](/icons/image2.gif) | AA Money 1-6-2012 3.png | 2012-01-06 11:33 | 17K | |
![[IMG]](/icons/image2.gif) | AA Money 1-22-2012 R..> | 2012-01-22 21:30 | 59K | |
![[IMG]](/icons/image2.gif) | AA Money 1-30-2012 R..> | 2012-01-30 06:51 | 59K | |
![[IMG]](/icons/image2.gif) | AA Money 11-20-2011.jpg | 2011-11-20 18:36 | 48K | |
![[IMG]](/icons/image2.gif) | AA Money 11-21-2011(..> | 2011-11-21 09:32 | 34K | |
![[IMG]](/icons/image2.gif) | AA Money 11-21-2011.jpg | 2011-11-21 09:32 | 34K | |
![[IMG]](/icons/image2.gif) | AA Money 11-21-2011.png | 2011-11-21 09:33 | 9.2K | |
![[IMG]](/icons/image2.gif) | AA Money 11-22-2011.jpg | 2011-11-22 09:32 | 38K | |
![[IMG]](/icons/image2.gif) | AA Money 11-23-2011(..> | 2011-11-23 09:32 | 37K | |
![[IMG]](/icons/image2.gif) | AA Money 11-23-2011(..> | 2011-11-23 09:32 | 37K | |
![[IMG]](/icons/image2.gif) | AA Money 11-23-2011.jpg | 2011-11-23 09:32 | 37K | |
![[IMG]](/icons/image2.gif) | AA Money 11-23-2011 ..> | 2011-11-23 11:03 | 12K | |
![[IMG]](/icons/image2.gif) | AA Money 11-23-2011 ..> | 2011-11-23 09:33 | 98K | |
![[IMG]](/icons/image2.gif) | AA Money 11-25-2011.jpg | 2011-11-25 09:36 | 35K | |
![[IMG]](/icons/image2.gif) | AA Money 11-28-2011.jpg | 2011-11-28 09:38 | 36K | |
![[IMG]](/icons/image2.gif) | AA Money 11-29-2011.jpg | 2011-11-29 09:36 | 38K | |
![[IMG]](/icons/image2.gif) | AA Money 11-30-2011.jpg | 2011-11-30 09:35 | 36K | |
![[IMG]](/icons/image2.gif) | AA Money 12-1-2011.jpg | 2011-12-01 09:33 | 35K | |
![[IMG]](/icons/image2.gif) | AA Money 12-2-2011.jpg | 2011-12-02 09:38 | 35K | |
![[IMG]](/icons/image2.gif) | AA Money 12-2-2011 2..> | 2011-12-02 11:49 | 44K | |
![[IMG]](/icons/image2.gif) | AA Money 12-5-2011.jpg | 2011-12-05 09:57 | 55K | |
![[IMG]](/icons/image2.gif) | AA Money 12-6-2011.jpg | 2011-12-06 09:37 | 58K | |
![[IMG]](/icons/image2.gif) | AA Money 12-7-2011.jpg | 2011-12-07 09:50 | 52K | |
![[IMG]](/icons/image2.gif) | AA Money 12-7-2011 2..> | 2011-12-07 12:30 | 50K | |
![[IMG]](/icons/image2.gif) | AA Money 12-8-2011.jpg | 2011-12-08 09:38 | 52K | |
![[IMG]](/icons/image2.gif) | AA Money 12-9-2011.jpg | 2011-12-09 09:40 | 51K | |
![[IMG]](/icons/image2.gif) | AA Money 12-11-2011 ..> | 2011-12-11 10:44 | 153K | |
![[IMG]](/icons/image2.gif) | AA Money 12-12-2011.jpg | 2011-12-12 09:38 | 50K | |
![[IMG]](/icons/image2.gif) | AA Money 12-13-2011.jpg | 2011-12-13 09:41 | 50K | |
![[IMG]](/icons/image2.gif) | AA Money 12-14-2011.jpg | 2011-12-14 09:35 | 50K | |
![[IMG]](/icons/image2.gif) | AA Money 12-15-2011.jpg | 2011-12-15 09:35 | 46K | |
![[IMG]](/icons/image2.gif) | AA Money 12-15-2011 ..> | 2011-12-15 11:10 | 46K | |
![[IMG]](/icons/image2.gif) | AA Money 12-16-2011.jpg | 2011-12-16 09:46 | 44K | |
![[IMG]](/icons/image2.gif) | AA Money 12-17-2011 ..> | 2011-12-17 09:56 | 159K | |
![[IMG]](/icons/image2.gif) | AA Money 12-19-2011.jpg | 2011-12-19 09:48 | 47K | |
![[IMG]](/icons/image2.gif) | AA Money 12-20-2011.jpg | 2011-12-20 09:51 | 46K | |
![[IMG]](/icons/image2.gif) | AA Money 12-21-2011.jpg | 2011-12-21 09:37 | 47K | |
![[IMG]](/icons/image2.gif) | AA Money 12-22-2011.jpg | 2011-12-22 09:39 | 47K | |
![[IMG]](/icons/image2.gif) | AA Money 12-23-2011.jpg | 2011-12-23 09:38 | 46K | |
![[IMG]](/icons/image2.gif) | AA Money 12-26-2011 ..> | 2011-12-26 16:25 | 125K | |
![[IMG]](/icons/image2.gif) | AA Money 12-27-2011.jpg | 2011-12-27 09:36 | 46K | |
![[IMG]](/icons/image2.gif) | AA Money 12-28-2011.jpg | 2011-12-28 09:34 | 46K | |
![[IMG]](/icons/image2.gif) | AA Money 12-29-2011.jpg | 2011-12-29 09:39 | 46K | |
![[IMG]](/icons/image2.gif) | AA Money 12-29-2011.png | 2011-12-30 09:38 | 16K | |
![[IMG]](/icons/image2.gif) | AA Money Recap 1-2-2..> | 2012-01-02 15:27 | 55K | |
![[IMG]](/icons/image2.gif) | AA Money Recap 1-2-2..> | 2012-01-02 15:26 | 55K | |
![[IMG]](/icons/image2.gif) | AA Money Recap 1-8-2..> | 2012-01-08 06:09 | 60K | |
![[IMG]](/icons/image2.gif) | AA Money Recap 1-16-..> | 2012-01-16 15:48 | 60K | |
![[IMG]](/icons/image2.gif) | AAPL-PCLN1.jpg | 2012-04-22 04:31 | 158K | |
![[IMG]](/icons/image2.gif) | AAPL 020513.jpg | 2013-02-06 08:09 | 68K | |
![[IMG]](/icons/image2.gif) | AAPL 030412.jpg | 2013-03-04 07:18 | 20K | |
![[IMG]](/icons/image2.gif) | AAPL 031313.jpg | 2013-03-13 09:10 | 30K | |
![[IMG]](/icons/image2.gif) | AAPL 12-7-2011.jpg | 2011-12-07 13:37 | 76K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 1-3-2012.png | 2012-01-03 09:57 | 18K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 1-3-2012 2.png | 2012-01-03 14:59 | 20K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 1-3-2012 3.png | 2012-01-03 15:18 | 17K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 1-3-2012 4.png | 2012-01-03 15:21 | 14K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 1-3-2012 Tr..> | 2012-01-03 16:15 | 17K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 1-4-2012.png | 2012-01-04 09:42 | 14K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 1-4-2012 2.png | 2012-01-04 09:59 | 16K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 1-4-2012 3.png | 2012-01-04 10:43 | 17K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 1-4-2012 4.png | 2012-01-04 17:08 | 24K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 1-5-2012.png | 2012-01-05 09:46 | 14K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 1-5-2012 2.png | 2012-01-05 10:48 | 17K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 1-6-2012.png | 2012-01-06 09:48 | 22K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 1-13-2012 R..> | 2012-01-16 16:06 | 135K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 1-22-2012 R..> | 2012-01-22 22:08 | 123K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 1-30-2012 R..> | 2012-01-30 07:20 | 128K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 2-26-2012 R..> | 2012-02-26 10:34 | 146K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 2-26-2012 R..> | 2012-02-26 10:34 | 46K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-15-2011.jpg | 2011-12-15 11:20 | 68K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-15-2011 ..> | 2011-12-15 14:44 | 138K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-15-2011 ..> | 2011-12-15 14:38 | 138K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-16-2011.jpg | 2011-12-16 09:53 | 55K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-16-2011 ..> | 2011-12-16 11:59 | 72K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-17-2011 ..> | 2011-12-17 09:29 | 163K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-19-2011(..> | 2011-12-19 10:04 | 69K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-19-2011.jpg | 2011-12-19 10:00 | 69K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-20-2011.jpg | 2011-12-20 09:56 | 68K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-20-2011 ..> | 2011-12-20 10:53 | 56K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-21-2011.jpg | 2011-12-21 09:43 | 67K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-21-2011 ..> | 2011-12-21 12:03 | 74K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-22-2011.jpg | 2011-12-22 09:47 | 79K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-23-2011.jpg | 2011-12-23 12:53 | 50K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-26-2011 ..> | 2011-12-26 16:50 | 202K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-27-2011.jpg | 2011-12-27 09:46 | 52K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-28-2011.jpg | 2011-12-28 09:43 | 74K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-29-2011.jpg | 2011-12-29 09:45 | 79K | |
![[IMG]](/icons/image2.gif) | AAPL 50k 12-29-2011.png | 2011-12-30 09:44 | 22K | |
![[IMG]](/icons/image2.gif) | AAPL 50k Recap 1-2-2..> | 2012-01-02 15:45 | 63K | |
![[IMG]](/icons/image2.gif) | AAPL 50k Recap 1-2-2..> | 2012-01-02 15:46 | 22K | |
![[IMG]](/icons/image2.gif) | AAPL 50k Recap 1-8-2..> | 2012-01-08 06:37 | 76K | |
![[IMG]](/icons/image2.gif) | AAPL 50k Recap 1-8-2..> | 2012-01-08 06:37 | 22K | |
![[IMG]](/icons/image2.gif) | AAPL April 6 2011.jpg | 2011-04-07 07:10 | 15K | |
![[IMG]](/icons/image2.gif) | AAPL CC July 19 201..> | 2011-07-20 04:44 | 65K | |
![[IMG]](/icons/image2.gif) | AAPL Jobs Cartoon.gif | 2012-03-19 09:36 | 107K | |
![[IMG]](/icons/image2.gif) | AAPL June 16 2016.jpg | 2011-06-16 15:58 | 35K | |
![[IMG]](/icons/image2.gif) | AAPL June 27 2013.jpg | 2013-06-27 08:05 | 59K | |
![[IMG]](/icons/image2.gif) | AAPL March 28 2012.jpg | 2012-03-28 09:00 | 22K | |
![[IMG]](/icons/image2.gif) | AAPL Portfolio 12-6-..> | 2011-12-06 15:45 | 34K | |
![[IMG]](/icons/image2.gif) | AAPL Portfolio 12-6-..> | 2011-12-06 16:02 | 61K | |
![[IMG]](/icons/image2.gif) | AAPL Portfolio 12-6-..> | 2011-12-06 15:59 | 64K | |
![[IMG]](/icons/image2.gif) | AAPL Portfolio 12-7-..> | 2011-12-07 12:14 | 40K | |
![[IMG]](/icons/image2.gif) | AAPL Portfolio 12-8-..> | 2011-12-08 09:43 | 41K | |
![[IMG]](/icons/image2.gif) | AAPL Portfolio 12-9-..> | 2011-12-09 09:45 | 46K | |
![[IMG]](/icons/image2.gif) | AAPL Portfolio 12-9-..> | 2011-12-09 10:36 | 40K | |
![[IMG]](/icons/image2.gif) | AAPL Portfolio 12-9-..> | 2011-12-09 13:15 | 48K | |
![[IMG]](/icons/image2.gif) | AAPL Portfolio 12-11..> | 2011-12-11 11:00 | 96K | |
![[IMG]](/icons/image2.gif) | AAPL Portfolio 12-12..> | 2011-12-12 09:46 | 47K | |
![[IMG]](/icons/image2.gif) | AAPL Portfolio 12-13..> | 2011-12-13 09:42 | 48K | |
![[IMG]](/icons/image2.gif) | AAPL Portfolio 12-14..> | 2011-12-14 09:41 | 60K | |
![[IMG]](/icons/image2.gif) | AB CEO compensation ..> | 2012-07-04 16:16 | 86K | |
![[IMG]](/icons/image2.gif) | ABT(1).jpg | 2011-01-29 22:13 | 67K | |
![[IMG]](/icons/image2.gif) | ABT.JPG | 2011-01-29 19:19 | 80K | |
![[IMG]](/icons/image2.gif) | AB V_ Peer Group sha..> | 2012-07-04 16:13 | 88K | |
![[IMG]](/icons/image2.gif) | AB v_ SPY Dec_ 31, 2..> | 2012-07-04 16:14 | 79K | |
![[IMG]](/icons/image2.gif) | ACLI.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | ADP Jan 5 2011.jpg | 2011-01-05 08:28 | 70K | |
![[IMG]](/icons/image2.gif) | ADP Jan 2010 Chart(1..> | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | ADP Jan 2010 Chart.jpg | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | ADP Oct 3 2012.jpg | 2012-10-03 08:32 | 28K | |
![[IMG]](/icons/image2.gif) | ADP Oct 6 2010.jpg | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | ADVENTURES OF ROBOTR..> | 2012-08-09 17:43 | 107K | |
![[IMG]](/icons/image2.gif) | AFs(1).png | 2011-05-03 12:18 | 88K | |
![[IMG]](/icons/image2.gif) | AFs(2).png | 2011-05-03 12:19 | 88K | |
![[IMG]](/icons/image2.gif) | AFs.png | 2011-05-03 12:18 | 88K | |
![[IMG]](/icons/image2.gif) | AIG-GS-NYFED_serendi..> | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | AIG-GS-NYFED_serendi..> | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | AMD.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | AMERICAN_KLEPTOCRACY..> | 2010-11-23 21:35 | 762K | |
![[IMG]](/icons/image2.gif) | AMZN March 22 2012.jpg | 2012-03-22 08:36 | 20K | |
![[IMG]](/icons/image2.gif) | AONE June 12 2012.jpg | 2012-06-13 09:01 | 55K | |
![[IMG]](/icons/image2.gif) | ARO.png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | ARRA_0.jpg | 2011-06-08 20:28 | 40K | |
![[IMG]](/icons/image2.gif) | Acrap.png | 2010-10-26 12:05 | 2.9K | |
![[IMG]](/icons/image2.gif) | Aldous_Huxley.gif | 2012-07-26 14:52 | 24K | |
![[IMG]](/icons/image2.gif) | Alex1(1).gif | 2011-11-08 01:40 | 28K | |
![[IMG]](/icons/image2.gif) | Alex1.gif | 2011-09-26 12:42 | 28K | |
![[IMG]](/icons/image2.gif) | Alice_in_Wonderland.jpg | 2011-11-25 19:21 | 63K | |
![[IMG]](/icons/image2.gif) | Alpha 2 Jan 18 2011.jpg | 2011-01-18 08:32 | 25K | |
![[IMG]](/icons/image2.gif) | Alpha 2 Jan 21 2011.jpg | 2011-01-21 08:06 | 64K | |
![[IMG]](/icons/image2.gif) | Alpha 2 Jan 24 2011(..> | 2011-01-24 08:03 | 29K | |
![[IMG]](/icons/image2.gif) | Alpha 2 Jan 24 2011.jpg | 2011-01-24 08:02 | 29K | |
![[IMG]](/icons/image2.gif) | Alpha 2 Jan 31 2011.jpg | 2011-01-31 07:48 | 30K | |
![[IMG]](/icons/image2.gif) | America for Sale.jpg | 2011-10-02 04:40 | 97K | |
![[IMG]](/icons/image2.gif) | American Might.jpg | 2011-07-07 15:59 | 11K | |
![[IMG]](/icons/image2.gif) | Anglo-English Transl..> | 2011-12-06 15:04 | 124K | |
![[IMG]](/icons/image2.gif) | Anglo-English Transl..> | 2011-12-06 14:58 | 124K | |
![[IMG]](/icons/image2.gif) | Annuities - Barron's..> | 2012-05-31 18:41 | 268K | |
![[IMG]](/icons/image2.gif) | Antarctic_Iceberg_18..> | 2012-07-22 05:32 | 68K | |
![[IMG]](/icons/image2.gif) | Apocalypse II.jpg | 2011-11-30 13:24 | 29K | |
![[IMG]](/icons/image2.gif) | Apple thing.jpg | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | Apple thing002.jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | Apple thing003.jpg | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | Apple thing004.jpg | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | Apple thing005.jpg | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | Apple thing006.jpg | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | Arrow !!(1).jpg | 2011-08-24 14:44 | 7.6K | |
![[IMG]](/icons/image2.gif) | Arrow !!.jpg | 2011-04-27 15:01 | 7.6K | |
![[IMG]](/icons/image2.gif) | AssetsofInsuredProbl..> | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | Avitar.jpg | 2011-07-12 13:49 | 3.4K | |
![[IMG]](/icons/image2.gif) | BANKSTALAND.jpg | 2010-11-29 20:27 | 60K | |
![[IMG]](/icons/image2.gif) | BANKSTER DOOMSDAY KI..> | 2010-11-29 22:28 | 53K | |
![[IMG]](/icons/image2.gif) | BANKSTER DOOMSDAY KI..> | 2010-11-29 22:39 | 53K | |
![[IMG]](/icons/image2.gif) | BANKSTER DOOMSDAY KI..> | 2010-11-29 21:03 | 53K | |
![[IMG]](/icons/image2.gif) | BBY May 22 2012.jpg | 2012-05-22 08:53 | 17K | |
![[IMG]](/icons/image2.gif) | BD-sign-up-here-box.jpg | 2012-12-18 02:01 | 48K | |
![[IMG]](/icons/image2.gif) | BEN DEVIL(1).jpg | 2011-12-08 01:40 | 214K | |
![[IMG]](/icons/image2.gif) | BEN DEVIL.jpg | 2011-02-03 18:55 | 214K | |
![[IMG]](/icons/image2.gif) | BIDU Oct $95 puts 20..> | 2010-10-16 09:32 | 50K | |
![[IMG]](/icons/image2.gif) | BIG Rating(1).jpg | 2010-10-29 14:12 | 545K | |
![[IMG]](/icons/image2.gif) | BIG Rating.jpg | 2010-10-29 14:09 | 545K | |
![[IMG]](/icons/image2.gif) | BIG Rating2.jpg | 2010-10-29 14:17 | 819K | |
![[IMG]](/icons/image2.gif) | BIG Rating3.jpg | 2010-10-29 14:19 | 545K | |
![[IMG]](/icons/image2.gif) | BIG Rating4.jpg | 2010-10-29 14:21 | 1.1M | |
![[IMG]](/icons/image2.gif) | BIG Rating5.jpg | 2010-10-29 14:22 | 394K | |
![[IMG]](/icons/image2.gif) | BIG Rating6.jpg | 2010-10-29 14:23 | 126K | |
![[IMG]](/icons/image2.gif) | BKX-8-19-1.png | 2011-08-19 14:19 | 30K | |
![[IMG]](/icons/image2.gif) | BKX.JPG | 2011-07-19 13:14 | 95K | |
![[IMG]](/icons/image2.gif) | BNN June 19 2012.jpg | 2012-06-20 07:58 | 23K | |
![[IMG]](/icons/image2.gif) | BSX-022610.jpg | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | BUST_Graffiti_sized(..> | 2011-12-16 00:36 | 44K | |
![[IMG]](/icons/image2.gif) | BUST_Graffiti_sized.jpg | 2011-11-28 02:52 | 44K | |
![[IMG]](/icons/image2.gif) | Bad Luck.jpg | 2011-05-15 06:24 | 42K | |
![[IMG]](/icons/image2.gif) | Bad Trade - Down Day..> | 2011-09-27 12:40 | 207K | |
![[IMG]](/icons/image2.gif) | Bad Trade - Down Day..> | 2011-09-27 12:19 | 207K | |
![[IMG]](/icons/image2.gif) | Bad Trade - RVX(1).jpg | 2011-09-27 12:41 | 216K | |
![[IMG]](/icons/image2.gif) | Bad Trade - RVX.jpg | 2011-09-27 12:21 | 216K | |
![[IMG]](/icons/image2.gif) | BalloonsIntoTheSunse..> | 2010-10-26 12:05 | 57K | |
![[IMG]](/icons/image2.gif) | Bambi vs Godzilla.jpg | 2011-07-06 23:01 | 55K | |
![[IMG]](/icons/image2.gif) | Band-levon-helmffhf.jpg | 2012-04-17 19:48 | 72K | |
![[IMG]](/icons/image2.gif) | Bank Fixing.jpg | 2012-06-25 08:06 | 17K | |
![[IMG]](/icons/image2.gif) | BankProblemLoansAppr..> | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | Bank Rescue.png | 2010-10-26 12:05 | 316K | |
![[IMG]](/icons/image2.gif) | Bass Rehypo.jpg | 2011-12-14 11:51 | 25K | |
![[IMG]](/icons/image2.gif) | Bear Flag(1).png | 2011-09-09 12:23 | 57K | |
![[IMG]](/icons/image2.gif) | Bear Flag.png | 2011-09-09 12:21 | 63K | |
![[IMG]](/icons/image2.gif) | Beavis-Butthead-Boeh..> | 2011-02-21 07:03 | 47K | |
![[IMG]](/icons/image2.gif) | Beijing Street scene..> | 2012-09-28 14:11 | 790K | |
![[IMG]](/icons/image2.gif) | Beijing Street scene..> | 2012-09-04 11:15 | 790K | |
![[IMG]](/icons/image2.gif) | Ben_Bernanke_hea_367..> | 2011-01-10 17:21 | 12K | |
![[IMG]](/icons/image2.gif) | Berducken(1).jpg | 2011-08-01 16:08 | 20K | |
![[IMG]](/icons/image2.gif) | Berducken(2).jpg | 2011-08-01 16:11 | 20K | |
![[IMG]](/icons/image2.gif) | Berducken.jpg | 2011-08-01 16:07 | 20K | |
![[IMG]](/icons/image2.gif) | Berkshire 030412.jpg | 2013-03-04 07:51 | 30K | |
![[IMG]](/icons/image2.gif) | Berkshire 2010 Repor..> | 2011-02-26 10:15 | 90K | |
![[IMG]](/icons/image2.gif) | Berkshire May 27 201..> | 2011-05-27 14:27 | 29K | |
![[IMG]](/icons/image2.gif) | Bernanke-Bills-New-F..> | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | Bernanke Tags March ..> | 2011-03-01 11:54 | 59K | |
![[IMG]](/icons/image2.gif) | Bernanke pours.jpg | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | Berskshire Passes.JPG | 2012-04-24 07:08 | 584K | |
![[IMG]](/icons/image2.gif) | Beta 3 Nov 21 2010(1..> | 2010-11-22 08:23 | 38K | |
![[IMG]](/icons/image2.gif) | Beta 3 Nov 21 2010.jpg | 2010-11-22 08:22 | 38K | |
![[IMG]](/icons/image2.gif) | Beta 3a Nov 21 2010.jpg | 2010-11-22 08:24 | 37K | |
![[IMG]](/icons/image2.gif) | Big Chart 9-20a.JPG | 2011-09-20 09:30 | 124K | |
![[IMG]](/icons/image2.gif) | Big Chart Sept 16 20..> | 2011-09-16 01:36 | 122K | |
![[IMG]](/icons/image2.gif) | BigLotsLogo.jpg | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | Big Picture 1.jpg | 2011-07-06 13:11 | 77K | |
![[IMG]](/icons/image2.gif) | Big Picture 2.jpg | 2011-07-06 13:11 | 67K | |
![[IMG]](/icons/image2.gif) | Bill Black.jpg | 2012-05-03 20:42 | 7.3K | |
![[IMG]](/icons/image2.gif) | Bill Black_0.jpg | 2010-10-26 01:40 | 5.2K | |
![[IMG]](/icons/image2.gif) | Biz Invest April 30 ..> | 2012-04-30 07:36 | 35K | |
![[IMG]](/icons/image2.gif) | Black Swan.png | 2011-10-07 14:00 | 18K | |
![[IMG]](/icons/image2.gif) | Black_Swan(1).jpg | 2012-04-11 19:37 | 10K | |
![[IMG]](/icons/image2.gif) | Black_Swan.jpg | 2012-04-11 19:36 | 10K | |
![[IMG]](/icons/image2.gif) | Boehner Aug 1 2011.jpg | 2011-08-02 02:55 | 9.5K | |
![[IMG]](/icons/image2.gif) | Boehner Sept 21 2011..> | 2011-09-22 08:57 | 31K | |
![[IMG]](/icons/image2.gif) | Bonds.png | 2011-09-22 15:07 | 27K | |
![[IMG]](/icons/image2.gif) | Bottom Fishing.gif | 2011-08-24 11:06 | 44K | |
![[IMG]](/icons/image2.gif) | Bounce chart(1).jpg | 2011-04-15 11:55 | 70K | |
![[IMG]](/icons/image2.gif) | Bounce chart.JPG | 2011-04-13 12:53 | 70K | |
![[IMG]](/icons/image2.gif) | Brandeis.jpg | 2010-10-26 12:05 | 7.9K | |
![[IMG]](/icons/image2.gif) | Bread and Circuses.png | 2012-03-16 09:05 | 11K | |
![[IMG]](/icons/image2.gif) | Buffett Feb 25 2011.jpg | 2011-02-26 10:18 | 8.7K | |
![[IMG]](/icons/image2.gif) | Buffett holdings Feb..> | 2011-02-26 19:07 | 75K | |
![[IMG]](/icons/image2.gif) | Bull Percent March 2..> | 2010-10-26 12:05 | 61K | |
![[IMG]](/icons/image2.gif) | Bundesarchiv_Bild_18..> | 2013-06-03 13:21 | 110K | |
![[IMG]](/icons/image2.gif) | Butterfly.png | 2011-06-23 11:12 | 85K | |
![[IMG]](/icons/image2.gif) | Buy Sell.jpg | 2010-10-26 12:05 | 43K | |
![[IMG]](/icons/image2.gif) | By-The-Numbers-20-Fa..> | 2013-01-09 20:55 | 58K | |
![[IMG]](/icons/image2.gif) | CAL.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | CANDYLAND(1).jpg | 2010-12-21 18:12 | 59K | |
![[IMG]](/icons/image2.gif) | CANDYLAND.jpg | 2010-11-07 15:12 | 59K | |
![[IMG]](/icons/image2.gif) | CBO August 1.png | 2011-09-08 04:15 | 54K | |
![[IMG]](/icons/image2.gif) | CL June 9 2011.jpg | 2011-06-09 12:35 | 31K | |
![[IMG]](/icons/image2.gif) | CL trading 2 3 2010.JPG | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | CMG2 Feb 11 2011.jpg | 2011-02-13 03:30 | 21K | |
![[IMG]](/icons/image2.gif) | CMG Feb 12 2011.jpg | 2011-02-13 03:27 | 54K | |
![[IMG]](/icons/image2.gif) | CMI June 6 2011.jpg | 2011-06-06 08:13 | 19K | |
![[IMG]](/icons/image2.gif) | CNX.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | COH 2011 -2012 so..> | 2012-12-27 14:26 | 92K | |
![[IMG]](/icons/image2.gif) | COLA April 14 2011.jpg | 2011-04-14 08:28 | 40K | |
![[IMG]](/icons/image2.gif) | COMP-5-2-1.png | 2011-05-02 12:33 | 64K | |
![[IMG]](/icons/image2.gif) | COMS%20Dec%20Volume_..> | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | COMS%20Dec%20Volume_..> | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | COMS%20Dec%20Volume_..> | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | COMS%20Dec%20Volume_..> | 2010-10-26 12:05 | 107K | |
![[IMG]](/icons/image2.gif) | COMS%20Dec%20Volume_..> | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | COMS_Calls_0.jpg | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | CPI Jan 2010a.gif | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | CRAZY BENNY(1).jpg | 2011-04-28 12:45 | 135K | |
![[IMG]](/icons/image2.gif) | CRAZY BENNY.jpg | 2010-11-07 18:31 | 135K | |
![[IMG]](/icons/image2.gif) | CRE-2009-charleshugh..> | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | CRE Percentage.jpg | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | CSFB_08182011.png | 2011-08-18 14:56 | 61K | |
![[IMG]](/icons/image2.gif) | CSTR 020712(1).jpg | 2012-02-07 08:44 | 81K | |
![[IMG]](/icons/image2.gif) | CSTR 020712.jpg | 2012-02-07 08:42 | 81K | |
![[IMG]](/icons/image2.gif) | CYH.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | Cactus_dances.gif | 2011-08-18 13:55 | 4.6K | |
![[IMG]](/icons/image2.gif) | Calendar Jan 10 2011..> | 2011-01-10 09:17 | 31K | |
![[IMG]](/icons/image2.gif) | Cancer.JPG | 2011-02-13 22:58 | 140K | |
![[IMG]](/icons/image2.gif) | Capital flows.png | 2012-04-28 08:23 | 68K | |
![[IMG]](/icons/image2.gif) | Capture.PNG | 2011-12-20 15:25 | 345K | |
![[IMG]](/icons/image2.gif) | Celg earn.JPG | 2011-02-16 22:50 | 134K | |
![[IMG]](/icons/image2.gif) | Celg l s(1).jpg | 2011-02-17 09:02 | 96K | |
![[IMG]](/icons/image2.gif) | Celg l s.JPG | 2011-02-16 23:09 | 92K | |
![[IMG]](/icons/image2.gif) | Celg mom.JPG | 2011-02-16 23:24 | 86K | |
![[IMG]](/icons/image2.gif) | Celg pos.JPG | 2011-02-17 09:04 | 78K | |
![[IMG]](/icons/image2.gif) | ChartImg.png | 2011-08-18 18:22 | 26K | |
![[IMG]](/icons/image2.gif) | Chart_1.gif | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Chart_2.gif | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Chart_3.gif | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Chart_4.gif | 2010-10-26 12:05 | 68K | |
![[IMG]](/icons/image2.gif) | Chart_5.gif | 2010-10-26 12:05 | 40K | |
![[IMG]](/icons/image2.gif) | Cheney_and_Bush_Borg..> | 2010-10-26 12:05 | 112K | |
![[IMG]](/icons/image2.gif) | Chicago, tbi.jpg | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | Chicken_Little.jpg | 2011-03-16 16:04 | 66K | |
![[IMG]](/icons/image2.gif) | Child-Hunger-425x557..> | 2013-04-26 00:23 | 45K | |
![[IMG]](/icons/image2.gif) | China Bubble Gum.jpg | 2010-10-26 12:05 | 7.5K | |
![[IMG]](/icons/image2.gif) | China Money Leak.jpg | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | Chinagreece(1).jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | Chinagreece.jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | ChinagreeceA.JPG | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | CigarSmokeR_28884925..> | 2011-06-11 20:20 | 8.8K | |
![[IMG]](/icons/image2.gif) | Class War is Over.jpg | 2011-09-27 15:18 | 78K | |
![[IMG]](/icons/image2.gif) | Clipboard04.jpg | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | Cocktail Empathy.jpg | 2010-10-26 12:05 | 7.9K | |
![[IMG]](/icons/image2.gif) | Cocoa, 400.jpg | 2011-04-08 01:08 | 35K | |
![[IMG]](/icons/image2.gif) | Coffee Party.jpg | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | Coming Soon(1).png | 2011-11-30 16:21 | 609K | |
![[IMG]](/icons/image2.gif) | Coming Soon(2).png | 2011-11-30 16:22 | 609K | |
![[IMG]](/icons/image2.gif) | Coming Soon.png | 2011-09-09 14:21 | 609K | |
![[IMG]](/icons/image2.gif) | Commodites Euros Mar..> | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | Commodity futures.jpg | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Competition_IMF-1(1)..> | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | Competition_IMF-1.gif | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | Confluence.png | 2011-05-04 17:08 | 8.9K | |
![[IMG]](/icons/image2.gif) | Congress deserves co..> | 2011-12-25 02:30 | 92K | |
![[IMG]](/icons/image2.gif) | Congress deserves co..> | 2011-12-25 02:29 | 92K | |
![[IMG]](/icons/image2.gif) | Coorporate Taxes.jpg | 2010-10-26 12:05 | 62K | |
![[IMG]](/icons/image2.gif) | Correl2_Small.jpg | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Corvette(1).jpg | 2010-11-17 14:37 | 39K | |
![[IMG]](/icons/image2.gif) | Corvette(2).jpg | 2011-08-15 14:40 | 39K | |
![[IMG]](/icons/image2.gif) | Corvette.jpg | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | Crack Spread.jpg | 2011-12-06 08:49 | 47K | |
![[IMG]](/icons/image2.gif) | Craig.jpg | 2011-03-09 11:47 | 36K | |
![[IMG]](/icons/image2.gif) | Cramer.JPG | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | Crude Inventory Jan ..> | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | Crude_Oil_Inventorie..> | 2011-01-10 15:13 | 45K | |
![[IMG]](/icons/image2.gif) | CyberSurferGirl2007(..> | 2011-08-25 12:39 | 128K | |
![[IMG]](/icons/image2.gif) | CyberSurferGirl2007(..> | 2011-08-25 12:40 | 128K | |
![[IMG]](/icons/image2.gif) | CyberSurferGirl2007.jpg | 2011-08-25 12:38 | 128K | |
![[IMG]](/icons/image2.gif) | DAX Aug 16 2011(1).jpg | 2011-08-16 12:06 | 32K | |
![[IMG]](/icons/image2.gif) | DAX Aug 16 2011.jpg | 2011-08-16 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | DAX Chart Aug 19 201..> | 2011-08-19 07:48 | 30K | |
![[IMG]](/icons/image2.gif) | DC Disasters.jpg | 2011-08-28 06:42 | 82K | |
![[IMG]](/icons/image2.gif) | DEFAULT(1).jpg | 2010-11-29 20:48 | 40K | |
![[IMG]](/icons/image2.gif) | DEFAULT.jpg | 2010-11-29 20:39 | 40K | |
![[IMG]](/icons/image2.gif) | DIA $95 puts 082509.png | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | DIA $111 Oct 16 2010..> | 2010-10-16 09:10 | 58K | |
![[IMG]](/icons/image2.gif) | DIA $120 puts March ..> | 2011-03-08 07:13 | 54K | |
![[IMG]](/icons/image2.gif) | DIA.JPG | 2011-02-06 15:12 | 84K | |
![[IMG]](/icons/image2.gif) | DIA 011201.JPG | 2010-10-26 12:05 | 81K | |
![[IMG]](/icons/image2.gif) | DIA 107 011210.JPG | 2010-10-26 12:05 | 81K | |
![[IMG]](/icons/image2.gif) | DIA Aug 5 2010.jpg | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | DIA Aug 12 2011.jpg | 2011-08-13 08:07 | 6.5K | |
![[IMG]](/icons/image2.gif) | DIA Chart Sept 2 201..> | 2011-09-05 21:25 | 21K | |
![[IMG]](/icons/image2.gif) | DIA Components Marc..> | 2012-03-17 09:02 | 111K | |
![[IMG]](/icons/image2.gif) | DIA Dec 9 2010.jpg | 2010-12-09 14:49 | 54K | |
![[IMG]](/icons/image2.gif) | DIA Dec 21 2010(1).jpg | 2010-12-21 21:46 | 28K | |
![[IMG]](/icons/image2.gif) | DIA Dec 21 2010(2).jpg | 2010-12-21 21:47 | 28K | |
![[IMG]](/icons/image2.gif) | DIA Dec 21 2010.jpg | 2010-12-21 21:45 | 28K | |
![[IMG]](/icons/image2.gif) | DIA Dec 21x 2010.jpg | 2010-12-21 21:49 | 14K | |
![[IMG]](/icons/image2.gif) | DIA Feb 6 2010.JPG | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | DIA Jan 10 2011.jpg | 2011-01-10 13:51 | 82K | |
![[IMG]](/icons/image2.gif) | DIA Jan 29 2011(1).jpg | 2011-01-29 07:56 | 55K | |
![[IMG]](/icons/image2.gif) | DIA Jan 29 2011(2).jpg | 2011-01-29 07:57 | 55K | |
![[IMG]](/icons/image2.gif) | DIA Jan 29 2011.jpg | 2011-01-29 07:55 | 55K | |
![[IMG]](/icons/image2.gif) | DIA July 7 2011.jpg | 2011-07-07 05:45 | 22K | |
![[IMG]](/icons/image2.gif) | DIA July 14 2010.JPG | 2010-10-26 12:05 | 74K | |
![[IMG]](/icons/image2.gif) | DIA July 29 2010.jpg | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | DIA Mar 3 2010.JPG | 2010-10-26 12:05 | 60K | |
![[IMG]](/icons/image2.gif) | DIA Mar 6 2010.JPG | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | DIA March 11 2011(1)..> | 2011-03-12 08:14 | 60K | |
![[IMG]](/icons/image2.gif) | DIA March 11 2011(2)..> | 2011-03-12 08:14 | 60K | |
![[IMG]](/icons/image2.gif) | DIA March 11 2011(3)..> | 2011-03-12 08:23 | 60K | |
![[IMG]](/icons/image2.gif) | DIA March 11 2011.jpg | 2011-03-12 08:13 | 60K | |
![[IMG]](/icons/image2.gif) | DIA March 21 2011.jpg | 2011-03-21 15:24 | 93K | |
![[IMG]](/icons/image2.gif) | DIA May 15 09.png | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | DIA May 29 2010.jpg | 2010-10-26 12:05 | 57K | |
![[IMG]](/icons/image2.gif) | DIA May 29 2010a.jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | DIA Nov 8 2010.jpg | 2010-11-08 08:43 | 47K | |
![[IMG]](/icons/image2.gif) | DIA Nov 26 2010.jpg | 2010-11-26 10:00 | 22K | |
![[IMG]](/icons/image2.gif) | DIA Nov 30 2010.jpg | 2010-11-30 08:02 | 80K | |
![[IMG]](/icons/image2.gif) | DIA Oct 5 2010.jpg | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | DIA Sept 21 2010.jpg | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | DIA Sept 21a 2010.jpg | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | DIA Sept 21b 2010.jpg | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | DIA Sept 24 2010.JPG | 2010-10-26 12:05 | 43K | |
![[IMG]](/icons/image2.gif) | DIA chart Nov 11 201..> | 2010-11-11 09:12 | 58K | |
![[IMG]](/icons/image2.gif) | DIA chart Nov 15 201..> | 2010-11-15 07:47 | 32K | |
![[IMG]](/icons/image2.gif) | DIA divergence.JPG | 2011-02-06 15:12 | 61K | |
![[IMG]](/icons/image2.gif) | DJI TLT(1).jpg | 2011-05-13 20:44 | 59K | |
![[IMG]](/icons/image2.gif) | DJI TLT.jpg | 2011-05-13 20:43 | 59K | |
![[IMG]](/icons/image2.gif) | DJI Targets.png | 2011-11-23 12:36 | 82K | |
![[IMG]](/icons/image2.gif) | DJSH Aug 28 09.png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | DJSH Dec 15 2011.jpg | 2011-12-15 05:58 | 64K | |
![[IMG]](/icons/image2.gif) | DJSH May 3 2010(1).jpg | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | DJSH May 3 2010.jpg | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | DJX Dec 20 2010.JPG | 2010-12-20 13:54 | 94K | |
![[IMG]](/icons/image2.gif) | DJX Jan 2010a.JPG | 2010-10-26 12:05 | 87K | |
![[IMG]](/icons/image2.gif) | DLTR.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | DRU.jpg | 2010-11-17 03:19 | 26K | |
![[IMG]](/icons/image2.gif) | DSC_9567.jpg | 2011-02-08 21:47 | 104K | |
![[IMG]](/icons/image2.gif) | DUG9.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | DXY(1).jpg | 2011-07-13 11:22 | 241K | |
![[IMG]](/icons/image2.gif) | DXY.JPG | 2011-07-12 00:27 | 179K | |
![[IMG]](/icons/image2.gif) | Dead Cat Bounce 2008..> | 2011-11-05 03:03 | 74K | |
![[IMG]](/icons/image2.gif) | Debt Ceiling.jpg | 2011-07-17 07:26 | 63K | |
![[IMG]](/icons/image2.gif) | Debt Web2 Sept 20 20..> | 2011-09-20 08:29 | 43K | |
![[IMG]](/icons/image2.gif) | Debt to GDP.JPG | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | Deception.jpg | 2010-11-15 18:43 | 167K | |
![[IMG]](/icons/image2.gif) | Deer Headlights.jpg | 2011-11-18 15:31 | 9.3K | |
![[IMG]](/icons/image2.gif) | DepositInsuranceFund..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Depression(1).png | 2010-10-26 12:05 | 347K | |
![[IMG]](/icons/image2.gif) | Depression.png | 2010-10-26 12:05 | 347K | |
![[IMG]](/icons/image2.gif) | Dog Sledding.jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | Doghouse.jpg | 2011-05-22 07:53 | 95K | |
![[IMG]](/icons/image2.gif) | Dolar Feb 1 2012.jpg | 2012-02-01 07:46 | 30K | |
![[IMG]](/icons/image2.gif) | Dolar Feb 10 2012.jpg | 2012-02-10 07:41 | 87K | |
![[IMG]](/icons/image2.gif) | Dollar 9-26-2011.jpg | 2011-09-26 13:37 | 103K | |
![[IMG]](/icons/image2.gif) | Dollar April 27 2011..> | 2011-04-27 15:57 | 13K | |
![[IMG]](/icons/image2.gif) | Dollar Dec 7 2010.jpg | 2010-12-07 03:14 | 12K | |
![[IMG]](/icons/image2.gif) | Dollar Dec 18 2010(1..> | 2010-12-19 18:02 | 27K | |
![[IMG]](/icons/image2.gif) | Dollar Dec 18 2010.jpg | 2010-12-19 17:59 | 27K | |
![[IMG]](/icons/image2.gif) | Dollar Falls Flat(1)..> | 2011-03-21 15:21 | 70K | |
![[IMG]](/icons/image2.gif) | Dollar Falls Flat.jpg | 2011-02-20 04:31 | 70K | |
![[IMG]](/icons/image2.gif) | Dollar Index May 1 2..> | 2011-05-02 09:17 | 15K | |
![[IMG]](/icons/image2.gif) | Dollar Jan 24 2011(1..> | 2011-01-24 07:21 | 15K | |
![[IMG]](/icons/image2.gif) | Dollar Jan 24 2011.jpg | 2011-01-24 07:21 | 15K | |
![[IMG]](/icons/image2.gif) | Dollar July 29 2010..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Dollar March 29 2011..> | 2011-03-29 11:24 | 68K | |
![[IMG]](/icons/image2.gif) | Dollar March 29 2011..> | 2011-03-29 11:24 | 68K | |
![[IMG]](/icons/image2.gif) | Dollar May 12 2011.jpg | 2011-05-12 09:37 | 14K | |
![[IMG]](/icons/image2.gif) | Dollar May 24 2011.jpg | 2011-05-24 08:26 | 43K | |
![[IMG]](/icons/image2.gif) | Dollar Nov 22 2010(1..> | 2010-11-24 08:11 | 17K | |
![[IMG]](/icons/image2.gif) | Dollar Nov 22 2010.jpg | 2010-11-24 08:10 | 17K | |
![[IMG]](/icons/image2.gif) | Dollar Oct 20 2010(1..> | 2010-10-20 20:02 | 11K | |
![[IMG]](/icons/image2.gif) | Dollar Oct 20 2010.jpg | 2010-10-20 20:02 | 11K | |
![[IMG]](/icons/image2.gif) | Dollar Rut Chart May..> | 2011-05-18 14:15 | 27K | |
![[IMG]](/icons/image2.gif) | Dollar Sept 12 2011(..> | 2011-09-15 09:28 | 21K | |
![[IMG]](/icons/image2.gif) | Dollar Sept 12 2011.jpg | 2011-09-12 08:16 | 21K | |
![[IMG]](/icons/image2.gif) | Dollar Sept 15 2011(..> | 2011-09-15 09:29 | 13K | |
![[IMG]](/icons/image2.gif) | Dollar Sept 15 2011.jpg | 2011-09-15 09:21 | 13K | |
![[IMG]](/icons/image2.gif) | Dollar UUP June 13 ..> | 2011-06-13 07:13 | 29K | |
![[IMG]](/icons/image2.gif) | Dollar etc Sept 25 2..> | 2011-11-24 09:00 | 28K | |
![[IMG]](/icons/image2.gif) | Dolllar Dec 15 2010.jpg | 2010-12-16 16:36 | 14K | |
![[IMG]](/icons/image2.gif) | Dot-Com-Bubble.png | 2013-05-20 16:28 | 465K | |
![[IMG]](/icons/image2.gif) | Dow-Jones-Crashes_20..> | 2010-10-26 12:05 | 91K | |
![[IMG]](/icons/image2.gif) | Dow 011210.JPG | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | Dow 10 day Apr 16.png | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | Dow 10 day Apr 24.png | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | Dow 10 day May2.png | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | Dow 2002-2004(1).jpg | 2010-10-26 12:05 | 56K | |
![[IMG]](/icons/image2.gif) | Dow 2002-2004.JPG | 2010-10-26 12:05 | 56K | |
![[IMG]](/icons/image2.gif) | Dow 2006-2009.JPG | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Dow 2009 q1.jpg | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | Dow 120209.JPG | 2010-10-26 12:05 | 34K | |
![[IMG]](/icons/image2.gif) | Dow Apr 2 2010.JPG | 2010-10-26 12:05 | 58K | |
![[IMG]](/icons/image2.gif) | Dow Apr 16 2010.jpg | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | Dow Apr 20 2010.jpg | 2010-10-26 12:05 | 78K | |
![[IMG]](/icons/image2.gif) | Dow April 21 2011.jpg | 2011-04-21 04:26 | 27K | |
![[IMG]](/icons/image2.gif) | Dow April 1987.jpg | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | Dow Aug 9 2011.jpg | 2011-08-08 17:30 | 26K | |
![[IMG]](/icons/image2.gif) | Dow Aug 10 2011.jpg | 2011-08-11 18:17 | 21K | |
![[IMG]](/icons/image2.gif) | Dow Aug 14 2010.jpg | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | Dow Aug 2009.jpg | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | Dow Chart Dec 19 201..> | 2011-12-19 10:05 | 184K | |
![[IMG]](/icons/image2.gif) | Dow Chart March 25 2..> | 2011-03-25 08:15 | 69K | |
![[IMG]](/icons/image2.gif) | Dow Dec 1 2010.jpg | 2010-12-01 11:11 | 80K | |
![[IMG]](/icons/image2.gif) | Dow Feb 7 2010 .jpg | 2010-10-26 12:05 | 96K | |
![[IMG]](/icons/image2.gif) | Dow Feb 10 2011.jpg | 2010-10-26 12:05 | 69K | |
![[IMG]](/icons/image2.gif) | Dow Feb 11 2010.JPG | 2010-10-26 12:05 | 38K | |
![[IMG]](/icons/image2.gif) | Dow Feb 11 2012.jpg | 2010-10-26 12:05 | 34K | |
![[IMG]](/icons/image2.gif) | Dow Feb 18 2010.jpg | 2010-10-26 12:05 | 91K | |
![[IMG]](/icons/image2.gif) | Dow Feb 20 2010.jpg | 2010-10-26 12:05 | 68K | |
![[IMG]](/icons/image2.gif) | Dow Feb 20 2010w.jpg | 2010-10-26 12:05 | 77K | |
![[IMG]](/icons/image2.gif) | Dow Feb 2009.jpg | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | Dow Feb 2010 2.jpg | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | Dow Feb 2010a.jpg | 2010-10-26 12:05 | 56K | |
![[IMG]](/icons/image2.gif) | Dow Futures 011310(1..> | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | Dow Futures 011310.JPG | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | Dow Futures Dec 9 20..> | 2011-12-09 08:17 | 76K | |
![[IMG]](/icons/image2.gif) | Dow Jan 3 2011.jpg | 2011-01-03 06:23 | 23K | |
![[IMG]](/icons/image2.gif) | Dow Jan 4 2011.jpg | 2011-01-04 00:02 | 18K | |
![[IMG]](/icons/image2.gif) | Dow Jan 4th.JPG | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Dow July 16 2010.JPG | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | Dow July 16a 2010.JPG | 2010-10-26 12:05 | 37K | |
![[IMG]](/icons/image2.gif) | Dow July 18, 2010.jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | Dow July 30 2010b.jpg | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Dow June 9 2010.jpg | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Dow June 12 2010.JPG | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | Dow June 17 2010.jpg | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | Dow June 17a 2010.jpg | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | Dow June 28 2010.jpg | 2010-10-26 12:05 | 67K | |
![[IMG]](/icons/image2.gif) | Dow June 29 2010.jpg | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Dow Mar 10 2010.JPG | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | Dow Mar 24 2010.jpg | 2010-10-26 12:05 | 64K | |
![[IMG]](/icons/image2.gif) | Dow March 8 2011.JPG | 2011-03-08 15:47 | 87K | |
![[IMG]](/icons/image2.gif) | Dow Nov 22 2010.jpg | 2010-11-24 11:42 | 21K | |
![[IMG]](/icons/image2.gif) | Dow Oct 15 2010.jpg | 2010-10-15 17:52 | 43K | |
![[IMG]](/icons/image2.gif) | Dow Oct 16 2010(1).jpg | 2010-10-16 08:14 | 29K | |
![[IMG]](/icons/image2.gif) | Dow Oct 16 2010.jpg | 2010-10-16 08:12 | 134K | |
![[IMG]](/icons/image2.gif) | Dow With Titles Dec ..> | 2011-12-02 08:25 | 81K | |
![[IMG]](/icons/image2.gif) | Dow puts July 2 201..> | 2011-07-03 11:53 | 53K | |
![[IMG]](/icons/image2.gif) | Drummer Wanted.jpg | 2013-06-27 15:27 | 34K | |
![[IMG]](/icons/image2.gif) | Drunken Ben(1).jpg | 2011-09-21 16:14 | 36K | |
![[IMG]](/icons/image2.gif) | Drunken Ben(2).jpg | 2011-09-27 15:28 | 36K | |
![[IMG]](/icons/image2.gif) | Drunken Ben(3).jpg | 2011-10-12 13:41 | 36K | |
![[IMG]](/icons/image2.gif) | Drunken Ben.JPG | 2011-09-21 16:13 | 36K | |
![[IMG]](/icons/image2.gif) | Durable Goods Feb 2..> | 2011-02-24 08:54 | 13K | |
![[IMG]](/icons/image2.gif) | EDZ.JPG | 2011-09-22 17:04 | 47K | |
![[IMG]](/icons/image2.gif) | EDZ Chart Aug 18 201..> | 2011-08-18 14:01 | 28K | |
![[IMG]](/icons/image2.gif) | EDZ Dec 10 2011.jpg | 2011-12-12 07:28 | 14K | |
![[IMG]](/icons/image2.gif) | EDZ March 13 2011.jpg | 2011-03-13 17:36 | 53K | |
![[IMG]](/icons/image2.gif) | E FEAR(1).jpg | 2010-11-18 01:35 | 70K | |
![[IMG]](/icons/image2.gif) | E FEAR(2).jpg | 2010-11-23 17:02 | 29K | |
![[IMG]](/icons/image2.gif) | E FEAR(3).jpg | 2010-11-24 02:26 | 29K | |
![[IMG]](/icons/image2.gif) | E FEAR(4).jpg | 2011-09-21 11:18 | 70K | |
![[IMG]](/icons/image2.gif) | E FEAR(5).jpg | 2011-10-04 14:29 | 29K | |
![[IMG]](/icons/image2.gif) | E FEAR(6).jpg | 2011-10-20 13:06 | 29K | |
![[IMG]](/icons/image2.gif) | E FEAR(7).jpg | 2011-11-17 18:35 | 29K | |
![[IMG]](/icons/image2.gif) | E FEAR(8).jpg | 2011-11-24 18:45 | 29K | |
![[IMG]](/icons/image2.gif) | E FEAR(9).jpg | 2011-12-04 16:17 | 29K | |
![[IMG]](/icons/image2.gif) | E FEAR(10).jpg | 2011-12-10 16:46 | 29K | |
![[IMG]](/icons/image2.gif) | E FEAR(11).jpg | 2012-01-12 03:23 | 29K | |
![[IMG]](/icons/image2.gif) | E FEAR.jpg | 2010-11-18 01:35 | 70K | |
![[IMG]](/icons/image2.gif) | EFSF-by-Lighthouse.png | 2011-12-09 08:05 | 90K | |
![[IMG]](/icons/image2.gif) | EGPT chart Feb 4 201..> | 2011-02-04 09:20 | 20K | |
![[IMG]](/icons/image2.gif) | EIA 03082012.jpg | 2012-03-08 08:50 | 155K | |
![[IMG]](/icons/image2.gif) | EIA 2222012.jpg | 2012-02-24 09:23 | 50K | |
![[IMG]](/icons/image2.gif) | EIA Report July 8 20..> | 2011-07-07 15:18 | 77K | |
![[IMG]](/icons/image2.gif) | EIA Report July 9 20..> | 2011-07-08 06:55 | 40K | |
![[IMG]](/icons/image2.gif) | EIA Report July 14 2..> | 2011-07-14 08:57 | 50K | |
![[IMG]](/icons/image2.gif) | EIA Report May 4 201..> | 2011-05-04 15:13 | 80K | |
![[IMG]](/icons/image2.gif) | EIA Report May 13 20..> | 2011-05-19 07:25 | 39K | |
![[IMG]](/icons/image2.gif) | EIA Status Dec 21 20..> | 2011-12-22 09:10 | 26K | |
![[IMG]](/icons/image2.gif) | ENDP(1).jpg | 2011-02-01 22:50 | 62K | |
![[IMG]](/icons/image2.gif) | ENDP.jpg | 2011-02-01 22:44 | 51K | |
![[IMG]](/icons/image2.gif) | ERX3.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | ERX4.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | ES%2012-11%20(60%20M..> | 2011-10-21 12:09 | 115K | |
![[IMG]](/icons/image2.gif) | ES%2012-11%20(60%20M..> | 2011-10-21 12:07 | 115K | |
![[IMG]](/icons/image2.gif) | ES%2091(1).jpg | 2011-11-04 14:58 | 58K | |
![[IMG]](/icons/image2.gif) | ES%2091(2).jpg | 2011-11-04 15:01 | 58K | |
![[IMG]](/icons/image2.gif) | ES%2091.JPG | 2011-11-04 14:57 | 58K | |
![[IMG]](/icons/image2.gif) | ES%2091.PNG | 2011-11-04 15:00 | 206K | |
![[IMG]](/icons/image2.gif) | ES-ZB-5-11-1.png | 2011-05-11 09:54 | 77K | |
![[IMG]](/icons/image2.gif) | ES-ZB-5-18-2.png | 2011-05-18 15:59 | 40K | |
![[IMG]](/icons/image2.gif) | ES 12_14_0.jpg | 2010-12-14 19:25 | 55K | |
![[IMG]](/icons/image2.gif) | ES2064.PNG | 2011-11-29 15:48 | 131K | |
![[IMG]](/icons/image2.gif) | ES_60min_Rising_Wedg..> | 2011-04-29 10:29 | 19K | |
![[IMG]](/icons/image2.gif) | EU-Poster-Tower-Of-B..> | 2013-01-09 20:56 | 40K | |
![[IMG]](/icons/image2.gif) | EU Debt.jpg | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | EURO.JPG | 2011-11-09 13:35 | 48K | |
![[IMG]](/icons/image2.gif) | EURO SLAVERY(1).jpg | 2010-11-23 17:01 | 26K | |
![[IMG]](/icons/image2.gif) | EURO SLAVERY(2).jpg | 2010-11-30 01:11 | 194K | |
![[IMG]](/icons/image2.gif) | EURO SLAVERY.jpg | 2010-11-23 17:00 | 26K | |
![[IMG]](/icons/image2.gif) | EU_USD.JPG | 2011-07-14 09:33 | 203K | |
![[IMG]](/icons/image2.gif) | EU team.jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | EWI-300x87.jpg | 2011-08-08 13:54 | 16K | |
![[IMG]](/icons/image2.gif) | EWI.jpg | 2011-08-08 14:16 | 110K | |
![[IMG]](/icons/image2.gif) | EWJ March 22 2011(1)..> | 2011-03-22 07:53 | 8.4K | |
![[IMG]](/icons/image2.gif) | EWJ March 22 2011(2)..> | 2011-03-22 07:53 | 8.4K | |
![[IMG]](/icons/image2.gif) | EWJ March 22 2011.jpg | 2011-03-22 07:53 | 8.4K | |
![[IMG]](/icons/image2.gif) | Earth-From-Space-300..> | 2013-05-15 11:40 | 38K | |
![[IMG]](/icons/image2.gif) | Economic Optimist.jpg | 2011-08-21 06:10 | 87K | |
![[IMG]](/icons/image2.gif) | Economic Recovery hi..> | 2011-07-10 05:58 | 46K | |
![[IMG]](/icons/image2.gif) | Economic Recovery hi..> | 2011-07-10 05:47 | 46K | |
![[IMG]](/icons/image2.gif) | Economy Trick or Tre..> | 2011-10-30 05:40 | 112K | |
![[IMG]](/icons/image2.gif) | Edit_2010-02-12_1.JPG | 2010-10-26 12:05 | 70K | |
![[IMG]](/icons/image2.gif) | Edit_2011-11-29_1.jpg | 2011-11-29 13:29 | 98K | |
![[IMG]](/icons/image2.gif) | Edward-Snowden2-300x..> | 2013-06-11 23:58 | 16K | |
![[IMG]](/icons/image2.gif) | EmoticonCoffeeSpit.gif | 2011-03-10 09:38 | 16K | |
![[IMG]](/icons/image2.gif) | Employment Costs Jul..> | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | EmploymentStressJune..> | 2010-10-26 12:05 | 131K | |
![[IMG]](/icons/image2.gif) | EmploymentStressJune..> | 2010-10-26 12:05 | 131K | |
![[IMG]](/icons/image2.gif) | EmptySilverVault.jpg | 2011-06-28 13:03 | 47K | |
![[IMG]](/icons/image2.gif) | Estonia.JPG | 2010-10-26 12:05 | 34K | |
![[IMG]](/icons/image2.gif) | Euro Crisis.jpg | 2011-11-20 06:08 | 102K | |
![[IMG]](/icons/image2.gif) | Euro Debt.jpg | 2011-12-10 13:57 | 81K | |
![[IMG]](/icons/image2.gif) | Euro II(1).jpg | 2011-11-29 12:46 | 72K | |
![[IMG]](/icons/image2.gif) | Euro II.JPG | 2011-11-29 12:43 | 152K | |
![[IMG]](/icons/image2.gif) | Euro Rescue.jpg | 2011-12-18 04:43 | 125K | |
![[IMG]](/icons/image2.gif) | Euro Saved Maybe (1)..> | 2011-11-06 04:55 | 83K | |
![[IMG]](/icons/image2.gif) | Euro and financial m..> | 2011-10-30 05:41 | 70K | |
![[IMG]](/icons/image2.gif) | Euro charts Feb 1 20..> | 2011-02-01 09:01 | 33K | |
![[IMG]](/icons/image2.gif) | Euro oil May 24 2011..> | 2011-05-24 14:47 | 26K | |
![[IMG]](/icons/image2.gif) | Europe-williambanzai..> | 2011-11-30 13:51 | 219K | |
![[IMG]](/icons/image2.gif) | European New Car Sal..> | 2012-03-19 12:35 | 31K | |
![[IMG]](/icons/image2.gif) | European Union Lifer..> | 2011-09-18 03:12 | 78K | |
![[IMG]](/icons/image2.gif) | Euro threat for Euro..> | 2011-11-27 02:00 | 34K | |
![[IMG]](/icons/image2.gif) | FAS.JPG | 2011-04-01 14:28 | 110K | |
![[IMG]](/icons/image2.gif) | FAS March 13 2011.jpg | 2011-03-13 11:45 | 56K | |
![[IMG]](/icons/image2.gif) | FAS May 21 2011.jpg | 2011-05-21 14:55 | 29K | |
![[IMG]](/icons/image2.gif) | FAS Money 1-3-2012.png | 2012-01-03 09:39 | 18K | |
![[IMG]](/icons/image2.gif) | FAS Money 1-3-2012 2..> | 2012-01-03 10:51 | 16K | |
![[IMG]](/icons/image2.gif) | FAS Money 1-4-2012.png | 2012-01-04 09:38 | 16K | |
![[IMG]](/icons/image2.gif) | FAS Money 1-4-2012 2..> | 2012-01-04 11:28 | 18K | |
![[IMG]](/icons/image2.gif) | FAS Money 1-5-2012.png | 2012-01-05 09:40 | 18K | |
![[IMG]](/icons/image2.gif) | FAS Money 1-6-2012.png | 2012-01-06 09:43 | 18K | |
![[IMG]](/icons/image2.gif) | FAS Money 1-6-2012 2..> | 2012-01-06 10:43 | 19K | |
![[IMG]](/icons/image2.gif) | FAS Money 1-22-2012 ..> | 2012-01-22 21:36 | 92K | |
![[IMG]](/icons/image2.gif) | FAS Money 1-30-2012 ..> | 2012-01-30 06:57 | 97K | |
![[IMG]](/icons/image2.gif) | FAS Money 2-26-2012 ..> | 2012-02-26 10:28 | 110K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-21-2011..> | 2011-11-21 09:36 | 12K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-21-2011..> | 2011-11-21 09:37 | 46K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-21-2011..> | 2011-11-21 13:05 | 14K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-21-2011..> | 2011-11-21 13:03 | 51K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-21-2011..> | 2011-11-21 13:06 | 51K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-21-2011..> | 2011-11-21 13:03 | 51K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-22-2011..> | 2011-11-22 09:35 | 51K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-22-2011..> | 2011-11-22 11:47 | 52K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-22-2011..> | 2011-11-22 11:47 | 52K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-23-2011..> | 2011-11-23 09:35 | 22K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-23-2011..> | 2011-11-23 09:35 | 22K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-23-2011..> | 2011-11-23 10:57 | 20K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-23-2011..> | 2011-11-23 11:37 | 19K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-23-2011..> | 2011-11-23 11:41 | 18K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-23-2011..> | 2011-11-23 11:41 | 18K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-23-2011..> | 2011-11-23 11:41 | 18K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-23-2011..> | 2011-11-23 11:37 | 19K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-23-2011..> | 2011-11-23 12:40 | 19K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-25-2011..> | 2011-11-25 09:34 | 56K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-25-2011..> | 2011-11-25 12:29 | 49K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-28-2011..> | 2011-11-28 09:33 | 51K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-28-2011..> | 2011-11-28 10:48 | 47K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-29-2011..> | 2011-11-29 09:32 | 47K | |
![[IMG]](/icons/image2.gif) | FAS Money 11-30-2011..> | 2011-11-30 09:37 | 47K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-1-2011.jpg | 2011-12-01 09:35 | 47K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-1-2011 ..> | 2011-12-01 11:21 | 56K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-2-2011.jpg | 2011-12-02 09:34 | 56K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-2-2011 ..> | 2011-12-02 10:53 | 59K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-5-2011.jpg | 2011-12-05 09:53 | 60K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-6-2011.jpg | 2011-12-06 09:33 | 60K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-7-2011.jpg | 2011-12-07 09:50 | 55K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-7-2011 ..> | 2011-12-07 12:02 | 60K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-8-2011.jpg | 2011-12-08 09:34 | 59K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-9-2011.jpg | 2011-12-09 09:38 | 61K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-9-2011 ..> | 2011-12-09 11:46 | 59K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-11-2011..> | 2011-12-11 10:52 | 181K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-11-2011..> | 2011-12-11 10:51 | 178K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-12-2011..> | 2011-12-12 09:42 | 50K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-12-2011..> | 2011-12-12 11:13 | 49K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-13-2011..> | 2011-12-13 09:43 | 49K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-14-2011..> | 2011-12-14 09:33 | 50K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-15-2011..> | 2011-12-15 09:53 | 56K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-16-2011..> | 2011-12-16 09:42 | 56K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-17-2011..> | 2011-12-16 12:13 | 55K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-19-2011..> | 2011-12-19 09:51 | 56K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-20-2011..> | 2011-12-20 09:48 | 55K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-20-2011..> | 2011-12-20 10:43 | 59K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-21-2011..> | 2011-12-21 09:35 | 56K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-22-2011..> | 2011-12-22 09:36 | 55K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-22-2011..> | 2011-12-22 11:11 | 60K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-23-2011..> | 2011-12-23 09:41 | 60K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-23-2011..> | 2011-12-23 11:27 | 66K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-26-2011..> | 2011-12-26 16:36 | 198K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-27-2011..> | 2011-12-27 09:33 | 62K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-28-2011..> | 2011-12-28 09:37 | 60K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-29-2011..> | 2011-12-29 09:39 | 62K | |
![[IMG]](/icons/image2.gif) | FAS Money 12-29-2011..> | 2011-12-30 09:34 | 21K | |
![[IMG]](/icons/image2.gif) | FAS Money Recap 1-2-..> | 2012-01-02 15:35 | 63K | |
![[IMG]](/icons/image2.gif) | FAS Money Recap 1-2-..> | 2012-01-02 15:36 | 18K | |
![[IMG]](/icons/image2.gif) | FAS Money Recap 1-8-..> | 2012-01-08 06:18 | 71K | |
![[IMG]](/icons/image2.gif) | FAS Money Recap 1-8-..> | 2012-01-08 06:19 | 19K | |
![[IMG]](/icons/image2.gif) | FAS Money Recap 1-16..> | 2012-01-16 15:52 | 85K | |
![[IMG]](/icons/image2.gif) | FAS Risk 12-2-2011.jpg | 2011-12-02 10:54 | 47K | |
![[IMG]](/icons/image2.gif) | FAS Strangle 1-30-20..> | 2012-01-30 07:14 | 104K | |
![[IMG]](/icons/image2.gif) | FAS Strangle 12-6-20..> | 2011-12-06 16:06 | 31K | |
![[IMG]](/icons/image2.gif) | FAS Strangle 12-16-2..> | 2011-12-16 09:56 | 20K | |
![[IMG]](/icons/image2.gif) | FAS Strangle 12-17-2..> | 2011-12-17 10:32 | 175K | |
![[IMG]](/icons/image2.gif) | FAS Strangle 12-17-2..> | 2011-12-17 10:10 | 180K | |
![[IMG]](/icons/image2.gif) | FAS Strangle 12-26-2..> | 2011-12-26 16:53 | 214K | |
![[IMG]](/icons/image2.gif) | FAS Strangle Experim..> | 2012-01-16 16:04 | 89K | |
![[IMG]](/icons/image2.gif) | FAS Strangle Experim..> | 2012-01-22 21:51 | 98K | |
![[IMG]](/icons/image2.gif) | FAS Strangle Experim..> | 2011-12-05 08:56 | 126K | |
![[IMG]](/icons/image2.gif) | FAS Strangle Experim..> | 2011-12-11 11:05 | 140K | |
![[IMG]](/icons/image2.gif) | FAS Strangle Recap 1..> | 2012-01-02 15:55 | 70K | |
![[IMG]](/icons/image2.gif) | FAS Strangle Recap 1..> | 2012-01-08 06:31 | 81K | |
![[IMG]](/icons/image2.gif) | FAZ 3-13.png | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | FAZ3.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | FB2(1).jpg | 2011-01-24 22:29 | 44K | |
![[IMG]](/icons/image2.gif) | FB2.jpg | 2010-12-20 22:53 | 44K | |
![[IMG]](/icons/image2.gif) | FDR.jpg | 2010-10-26 12:05 | 59K | |
![[IMG]](/icons/image2.gif) | FMDA.jpg | 2010-11-15 18:45 | 454K | |
![[IMG]](/icons/image2.gif) | FR 3.png | 2011-05-27 01:09 | 155K | |
![[IMG]](/icons/image2.gif) | FRB NEVADA-wb7.jpg | 2011-09-28 02:40 | 79K | |
![[IMG]](/icons/image2.gif) | FREE SPEECH.jpg | 2010-12-07 16:32 | 29K | |
![[IMG]](/icons/image2.gif) | FRX(1).jpg | 2010-10-28 17:10 | 73K | |
![[IMG]](/icons/image2.gif) | FRX.jpg | 2010-10-28 15:29 | 73K | |
![[IMG]](/icons/image2.gif) | FTSE Dec 27 2010.jpg | 2010-12-27 11:34 | 21K | |
![[IMG]](/icons/image2.gif) | FXE.JPG | 2011-08-12 11:06 | 114K | |
![[IMG]](/icons/image2.gif) | FXE.jpg | 2011-12-22 14:10 | 91K | |
![[IMG]](/icons/image2.gif) | Fcperkins.jpg | 2011-03-27 19:15 | 16K | |
![[IMG]](/icons/image2.gif) | Fear & Greed Variati..> | 2012-06-21 18:28 | 73K | |
![[IMG]](/icons/image2.gif) | Fear the Police.jpg | 2011-07-12 12:17 | 13K | |
![[IMG]](/icons/image2.gif) | Fed Chart Aug 15 201..> | 2011-08-15 09:09 | 14K | |
![[IMG]](/icons/image2.gif) | Fed Chart Aug 15 201..> | 2011-08-15 09:11 | 14K | |
![[IMG]](/icons/image2.gif) | Fed Chart Aug 15 201..> | 2011-08-15 09:08 | 14K | |
![[IMG]](/icons/image2.gif) | Fed Oct 21 2010(1).jpg | 2010-10-21 08:48 | 97K | |
![[IMG]](/icons/image2.gif) | Fed Oct 21 2010(2).jpg | 2010-10-21 08:48 | 97K | |
![[IMG]](/icons/image2.gif) | Fed Oct 21 2010.jpg | 2010-10-21 08:47 | 97K | |
![[IMG]](/icons/image2.gif) | Fed Oct 21a 2010.jpg | 2010-10-21 08:57 | 69K | |
![[IMG]](/icons/image2.gif) | Fed budget Sept 09.gif | 2010-10-26 12:05 | 10K | |
![[IMG]](/icons/image2.gif) | Federal-Reserve-Note..> | 2010-10-26 12:05 | 38K | |
![[IMG]](/icons/image2.gif) | Fed octopus-william ..> | 2011-10-18 23:06 | 101K | |
![[IMG]](/icons/image2.gif) | Fed vs S&P_0.jpg | 2013-05-10 17:32 | 25K | |
![[IMG]](/icons/image2.gif) | Ferguson_0.jpg | 2010-10-25 02:57 | 6.0K | |
![[IMG]](/icons/image2.gif) | Fibonacci.jpg | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | Figure 1 Curis.jpg | 2011-01-19 09:16 | 43K | |
![[IMG]](/icons/image2.gif) | Figure 2 Merck.jpg | 2011-01-19 09:29 | 56K | |
![[DIR]](/icons/folder.gif) | File/ | 2024-02-28 23:39 | - | |
![[IMG]](/icons/image2.gif) | Firefighters_from_ac..> | 2010-10-26 12:05 | 5.1K | |
![[IMG]](/icons/image2.gif) | Floor.png | 2011-08-18 12:50 | 93K | |
![[IMG]](/icons/image2.gif) | France.jpg | 2011-12-16 12:42 | 86K | |
![[IMG]](/icons/image2.gif) | Frankenstein.jpg | 2011-04-29 11:15 | 21K | |
![[IMG]](/icons/image2.gif) | Frankenstein_(1931)(..> | 2011-08-01 16:07 | 49K | |
![[IMG]](/icons/image2.gif) | Frankenstein_(1931)(..> | 2012-02-22 16:31 | 49K | |
![[IMG]](/icons/image2.gif) | Frankenstein_(1931).jpg | 2011-07-13 16:49 | 49K | |
![[IMG]](/icons/image2.gif) | Futures 2 2 2010.jpg | 2010-10-26 12:05 | 75K | |
![[IMG]](/icons/image2.gif) | Futures Aug 15 2012.jpg | 2012-08-15 08:25 | 115K | |
![[IMG]](/icons/image2.gif) | Futures May 1 2011.jpg | 2011-05-02 07:33 | 57K | |
![[IMG]](/icons/image2.gif) | Futures May 18 2011.jpg | 2011-05-18 15:46 | 27K | |
![[IMG]](/icons/image2.gif) | Futures May 19 2011.jpg | 2011-05-19 12:27 | 25K | |
![[IMG]](/icons/image2.gif) | GDP-Graph1(1).png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | GDP-Graph1(2).png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | GDP-Graph1.png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | GDP-YOY_serendipityT..> | 2010-10-26 12:05 | 61K | |
![[IMG]](/icons/image2.gif) | GDP Q109.gif | 2010-10-26 12:05 | 9.4K | |
![[IMG]](/icons/image2.gif) | GE July 17.png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | GHOST BP(1).jpg | 2010-12-24 02:56 | 457K | |
![[IMG]](/icons/image2.gif) | GHOST BP.jpg | 2010-12-24 02:53 | 457K | |
![[IMG]](/icons/image2.gif) | GLD 2011 $70 calls N..> | 2010-11-09 05:30 | 29K | |
![[IMG]](/icons/image2.gif) | GLD Dec 10 2010.jpg | 2010-12-10 09:01 | 27K | |
![[IMG]](/icons/image2.gif) | GLD Nov 09.gif | 2010-10-26 12:05 | 107K | |
![[IMG]](/icons/image2.gif) | GOLDMEMBER(1).jpg | 2011-09-17 02:25 | 101K | |
![[IMG]](/icons/image2.gif) | GOLDMEMBER.jpg | 2010-12-06 17:47 | 101K | |
![[IMG]](/icons/image2.gif) | GOOG April 15 2012.jpg | 2011-04-15 07:45 | 69K | |
![[IMG]](/icons/image2.gif) | GOOG Jan 24 2011.jpg | 2011-01-24 14:55 | 25K | |
![[IMG]](/icons/image2.gif) | GOP Jobs.jpg | 2011-09-11 05:11 | 101K | |
![[IMG]](/icons/image2.gif) | GREENSPAN PEPPER3(1)..> | 2011-02-16 00:01 | 86K | |
![[IMG]](/icons/image2.gif) | GREENSPAN PEPPER3.jpg | 2010-12-31 04:09 | 86K | |
![[IMG]](/icons/image2.gif) | GS.JPG | 2011-11-15 13:40 | 50K | |
![[IMG]](/icons/image2.gif) | GS Apr 27 2010.jpg | 2010-10-26 12:05 | 57K | |
![[IMG]](/icons/image2.gif) | GTL 7_0_0(1).png | 2011-05-05 03:38 | 74K | |
![[IMG]](/icons/image2.gif) | GTL 7_0_0.png | 2011-05-05 03:35 | 74K | |
![[IMG]](/icons/image2.gif) | Gap-Data_01.png | 2011-04-20 10:00 | 20K | |
![[IMG]](/icons/image2.gif) | Gas chart Oct 09.gif | 2010-10-26 12:05 | 9.6K | |
![[IMG]](/icons/image2.gif) | Gasoline Aug 23 2011..> | 2011-08-23 20:17 | 13K | |
![[IMG]](/icons/image2.gif) | Getting Used to Cris..> | 2011-10-23 07:11 | 107K | |
![[IMG]](/icons/image2.gif) | Global Debt Crisis.jpg | 2011-10-03 19:54 | 45K | |
![[IMG]](/icons/image2.gif) | Global HNW by region..> | 2010-11-16 00:43 | 19K | |
![[IMG]](/icons/image2.gif) | Global Meltdown.jpg | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | Gobal currency reser..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Gold Chart Sept 6 20..> | 2011-09-06 08:15 | 13K | |
![[IMG]](/icons/image2.gif) | Gold SPX May 31 2011..> | 2011-05-31 16:02 | 23K | |
![[IMG]](/icons/image2.gif) | Golden Duckat.jpg | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | Gold in Euros Oct 20..> | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | Good Trade - Down Da..> | 2011-09-27 12:34 | 167K | |
![[IMG]](/icons/image2.gif) | Good Trade - Down Da..> | 2011-09-27 12:14 | 167K | |
![[IMG]](/icons/image2.gif) | Good Trade - RVX(1).jpg | 2011-09-27 12:38 | 215K | |
![[IMG]](/icons/image2.gif) | Good Trade - RVX.jpg | 2011-09-27 12:16 | 215K | |
![[IMG]](/icons/image2.gif) | Good_Cop.jpg | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | Government Spending ..> | 2012-02-12 11:05 | 17K | |
![[IMG]](/icons/image2.gif) | Granlund - Greek Aus..> | 2011-06-26 06:28 | 89K | |
![[IMG]](/icons/image2.gif) | GreatDepressionUnemp..> | 2011-09-02 13:25 | 32K | |
![[IMG]](/icons/image2.gif) | GreatDepressionUnemp..> | 2011-08-29 16:48 | 32K | |
![[IMG]](/icons/image2.gif) | Greece Scylla Charyb..> | 2011-06-05 05:45 | 82K | |
![[IMG]](/icons/image2.gif) | Greece and the EU.jpg | 2011-06-19 07:05 | 30K | |
![[IMG]](/icons/image2.gif) | Greek Mountain of De..> | 2011-07-03 07:52 | 71K | |
![[IMG]](/icons/image2.gif) | Greek Odyssey Idiocy..> | 2011-11-06 04:54 | 97K | |
![[IMG]](/icons/image2.gif) | H&S(1).png | 2011-09-22 12:38 | 80K | |
![[IMG]](/icons/image2.gif) | H&S.png | 2011-09-21 16:12 | 80K | |
![[IMG]](/icons/image2.gif) | HFT.gif | 2010-10-26 12:05 | 9.3K | |
![[IMG]](/icons/image2.gif) | HFT6(1).jpg | 2011-04-15 12:42 | 112K | |
![[IMG]](/icons/image2.gif) | HFT6.jpg | 2010-12-06 04:06 | 112K | |
![[IMG]](/icons/image2.gif) | HFT DEVIL2 - WB7(1).jpg | 2011-01-13 14:15 | 259K | |
![[IMG]](/icons/image2.gif) | HFT DEVIL2 - WB7(2).jpg | 2011-01-13 14:23 | 259K | |
![[IMG]](/icons/image2.gif) | HFT DEVIL2 - WB7.jpg | 2010-12-01 16:09 | 259K | |
![[IMG]](/icons/image2.gif) | HIGH PRIEST.jpg | 2011-09-17 13:17 | 362K | |
![[IMG]](/icons/image2.gif) | HSI Mar 8 2010.jpg | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | HSI May 6 201o.jpg | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | HSI May 23 2010.jpg | 2010-10-26 12:05 | 37K | |
![[IMG]](/icons/image2.gif) | Hamlet.jpg | 2011-12-08 07:33 | 6.0K | |
![[IMG]](/icons/image2.gif) | Hamlet2(1).jpeg | 2011-12-13 07:30 | 272K | |
![[IMG]](/icons/image2.gif) | Hamlet2.jpeg | 2011-12-13 07:29 | 272K | |
![[IMG]](/icons/image2.gif) | Hang Seng Dec 15 201..> | 2010-12-16 09:02 | 25K | |
![[IMG]](/icons/image2.gif) | Hang Seng Mar 24 201..> | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | Happy new Austere(1)..> | 2012-01-08 04:41 | 158K | |
![[IMG]](/icons/image2.gif) | Happy new Austere.jpg | 2012-01-08 04:40 | 158K | |
![[IMG]](/icons/image2.gif) | Haurlan01.JPG | 2011-07-18 12:09 | 38K | |
![[IMG]](/icons/image2.gif) | Head and Shoulders 1..> | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | Head and Shoulders 1..> | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | Head and Shoulders 2..> | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | Help Me Out.jpg | 2011-12-04 03:17 | 72K | |
![[IMG]](/icons/image2.gif) | Higgs.jpeg | 2012-07-12 12:39 | 83K | |
![[IMG]](/icons/image2.gif) | Hong Kong House.jpg | 2010-12-23 04:55 | 36K | |
![[IMG]](/icons/image2.gif) | Household Wealth(1).jpg | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | Household Wealth.jpg | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | Housing Starts Sept ..> | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | Hov Feb 5 2011.jpg | 2011-02-05 09:23 | 25K | |
![[IMG]](/icons/image2.gif) | Humphrey Hawkins Feb..> | 2011-02-28 09:01 | 30K | |
![[IMG]](/icons/image2.gif) | IBM July 6.png | 2010-10-26 12:05 | 62K | |
![[IMG]](/icons/image2.gif) | ID-10013793.jpg | 2013-05-01 11:01 | 41K | |
![[IMG]](/icons/image2.gif) | IMAG0077.jpg | 2012-02-28 16:00 | 947K | |
![[IMG]](/icons/image2.gif) | IMAG0137.jpg | 2011-09-26 14:38 | 795K | |
![[IMG]](/icons/image2.gif) | IMAG0231 (1)(1).jpg | 2011-10-29 16:57 | 1.5M | |
![[IMG]](/icons/image2.gif) | IMAG0231 (1).jpg | 2011-10-28 16:45 | 1.5M | |
![[IMG]](/icons/image2.gif) | IMAG0231.jpg | 2011-10-28 16:44 | 1.5M | |
![[IMG]](/icons/image2.gif) | IMAG0267.jpg | 2012-08-20 13:52 | 747K | |
![[IMG]](/icons/image2.gif) | IMAG0285(1).jpg | 2012-02-28 16:00 | 680K | |
![[IMG]](/icons/image2.gif) | IMAG0285.jpg | 2012-02-23 02:22 | 680K | |
![[IMG]](/icons/image2.gif) | IMAG0307.jpg | 2012-05-06 02:08 | 1.0M | |
![[IMG]](/icons/image2.gif) | IMAG0331.jpg | 2012-05-27 02:50 | 1.2M | |
![[IMG]](/icons/image2.gif) | IMAG0449.jpg | 2012-04-29 02:16 | 617K | |
![[IMG]](/icons/image2.gif) | IMAG0480 (1).jpg | 2012-04-27 13:56 | 902K | |
![[IMG]](/icons/image2.gif) | IMAG0499.jpg | 2012-09-13 02:17 | 1.1M | |
![[IMG]](/icons/image2.gif) | IMAG0517.jpg | 2012-05-20 17:01 | 709K | |
![[IMG]](/icons/image2.gif) | IMGN.JPG | 2011-02-06 15:18 | 65K | |
![[IMG]](/icons/image2.gif) | IMG_0676.jpg | 2011-04-25 21:47 | 40K | |
![[IMG]](/icons/image2.gif) | IMG_1961.JPG | 2012-09-04 11:28 | 687K | |
![[IMG]](/icons/image2.gif) | IMG_2025.JPG | 2012-10-18 18:01 | 1.3M | |
![[IMG]](/icons/image2.gif) | IMG_2209.JPG | 2012-09-28 14:12 | 697K | |
![[IMG]](/icons/image2.gif) | IMG_2214.JPG | 2012-09-04 11:29 | 468K | |
![[IMG]](/icons/image2.gif) | IMG_2217.JPG | 2012-09-04 11:26 | 660K | |
![[IMG]](/icons/image2.gif) | IMG_2226.JPG | 2012-09-04 11:11 | 697K | |
![[IMG]](/icons/image2.gif) | IMG_2252.JPG | 2012-09-04 11:30 | 515K | |
![[IMG]](/icons/image2.gif) | IMG_2308.JPG | 2012-09-28 14:13 | 404K | |
![[IMG]](/icons/image2.gif) | IMG_5548.JPG | 2013-06-03 13:27 | 1.2M | |
![[IMG]](/icons/image2.gif) | IMG_5579.JPG | 2012-10-28 01:52 | 1.0M | |
![[IMG]](/icons/image2.gif) | IMG_11673d.jpg | 2011-02-08 20:07 | 70K | |
![[IMG]](/icons/image2.gif) | IPH market(1).jpg | 2011-04-17 17:35 | 43K | |
![[IMG]](/icons/image2.gif) | IPH market(2).jpg | 2011-04-17 17:36 | 43K | |
![[IMG]](/icons/image2.gif) | IPH market.JPG | 2011-04-17 14:36 | 43K | |
![[IMG]](/icons/image2.gif) | IPH market2.jpg | 2011-04-17 18:05 | 40K | |
![[IMG]](/icons/image2.gif) | IRA Portfolios 1-4-2..> | 2012-01-04 13:30 | 20K | |
![[IMG]](/icons/image2.gif) | ISM Sept 1 2010.jpg | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | ITMN.JPG | 2011-02-06 15:17 | 52K | |
![[IMG]](/icons/image2.gif) | IWM.JPG | 2011-09-22 15:23 | 45K | |
![[IMG]](/icons/image2.gif) | IWM2-300x211.jpg | 2011-11-27 13:51 | 24K | |
![[IMG]](/icons/image2.gif) | IWM60.png | 2011-06-21 12:53 | 57K | |
![[IMG]](/icons/image2.gif) | IWM511.png | 2011-05-11 12:22 | 106K | |
![[IMG]](/icons/image2.gif) | IWM Apr 20 2010.jpg | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | IWM Aug 9 2010.jpg | 2010-10-26 12:05 | 63K | |
![[IMG]](/icons/image2.gif) | IWM Chanell.png | 2011-04-26 13:53 | 201K | |
![[IMG]](/icons/image2.gif) | IWM Money 1-3-2012.png | 2012-01-03 09:46 | 23K | |
![[IMG]](/icons/image2.gif) | IWM Money 1-3-2012 2..> | 2012-01-03 10:59 | 18K | |
![[IMG]](/icons/image2.gif) | IWM Money 1-4-2012.png | 2012-01-04 09:40 | 18K | |
![[IMG]](/icons/image2.gif) | IWM Money 1-4-2012 2..> | 2012-01-04 11:31 | 19K | |
![[IMG]](/icons/image2.gif) | IWM Money 1-5-2012.png | 2012-01-05 09:44 | 19K | |
![[IMG]](/icons/image2.gif) | IWM Money 1-6-2012.png | 2012-01-06 09:46 | 19K | |
![[IMG]](/icons/image2.gif) | IWM Money 1-22-2012 ..> | 2012-01-22 21:44 | 55K | |
![[IMG]](/icons/image2.gif) | IWM Money 1-30-2012 ..> | 2012-01-30 07:08 | 70K | |
![[IMG]](/icons/image2.gif) | IWM Money 2-26-2012 ..> | 2012-02-26 10:30 | 70K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-21-2011..> | 2011-11-21 09:39 | 39K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-21-2011..> | 2011-11-21 09:39 | 39K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-21-2011..> | 2011-11-21 11:30 | 44K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-21-2011..> | 2011-11-21 11:31 | 44K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-21-2011..> | 2011-11-21 11:28 | 43K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-22-2011..> | 2011-11-22 09:38 | 46K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-22-2011..> | 2011-11-22 09:37 | 46K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-22-2011..> | 2011-11-22 11:53 | 43K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-22-2011..> | 2011-11-22 11:55 | 42K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-22-2011..> | 2011-11-22 11:56 | 42K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-22-2011..> | 2011-11-22 11:56 | 42K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-22-2011..> | 2011-11-22 11:56 | 42K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-22-2011..> | 2011-11-22 11:52 | 43K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-22-2011..> | 2011-11-22 11:57 | 14K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-23-2011..> | 2011-11-23 09:37 | 19K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-23-2011..> | 2011-11-23 10:50 | 12K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-23-2011..> | 2011-11-23 10:50 | 12K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-25-2011..> | 2011-11-25 09:38 | 46K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-25-2011..> | 2011-11-25 10:21 | 43K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-28-2011..> | 2011-11-28 09:36 | 43K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-29-2011..> | 2011-11-29 09:33 | 42K | |
![[IMG]](/icons/image2.gif) | IWM Money 11-30-2011..> | 2011-11-30 09:39 | 44K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-1-2011.jpg | 2011-12-01 09:37 | 42K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-1-2011 ..> | 2011-12-01 11:21 | 48K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-2-2011.jpg | 2011-12-02 09:36 | 47K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-5-2011.jpg | 2011-12-05 09:59 | 47K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-6-2011.jpg | 2011-12-06 09:35 | 47K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-7-2011.jpg | 2011-12-07 09:51 | 46K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-8-2011.jpg | 2011-12-08 09:36 | 49K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-9-2011.jpg | 2011-12-09 09:42 | 47K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-9-2011 ..> | 2011-12-09 11:41 | 38K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-11-2011..> | 2011-12-11 10:56 | 111K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-12-2011..> | 2011-12-12 09:44 | 36K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-12-2011..> | 2011-12-12 11:17 | 41K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-13-2011..> | 2011-12-13 09:43 | 42K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-14-2011..> | 2011-12-14 09:37 | 41K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-15-2011..> | 2011-12-15 09:49 | 48K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-16-2011..> | 2011-12-16 09:49 | 48K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-16-2011..> | 2011-12-16 12:22 | 57K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-17-2011..> | 2011-12-17 10:28 | 157K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-19-2011..> | 2011-12-19 09:54 | 57K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-20-2011..> | 2011-12-20 09:53 | 60K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-21-2011..> | 2011-12-21 09:40 | 57K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-22-2011..> | 2011-12-22 09:41 | 59K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-23-2011..> | 2011-12-23 09:54 | 59K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-23-2011..> | 2011-12-23 10:46 | 65K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-26-2011..> | 2011-12-26 16:45 | 160K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-27-2011..> | 2011-12-27 09:39 | 65K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-28-2011..> | 2011-12-28 09:40 | 63K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-29-2011..> | 2011-12-29 09:40 | 64K | |
![[IMG]](/icons/image2.gif) | IWM Money 12-29-2011..> | 2011-12-30 09:40 | 23K | |
![[IMG]](/icons/image2.gif) | IWM Money Recap 1-2-..> | 2012-01-02 15:43 | 57K | |
![[IMG]](/icons/image2.gif) | IWM Money Recap 1-8-..> | 2012-01-08 06:25 | 57K | |
![[IMG]](/icons/image2.gif) | IWM Money Recap 1-16..> | 2012-01-16 15:58 | 57K | |
![[IMG]](/icons/image2.gif) | IWM Money Test.png | 2011-12-30 05:04 | 23K | |
![[IMG]](/icons/image2.gif) | IYT Chart June 24 20..> | 2011-06-24 13:53 | 28K | |
![[IMG]](/icons/image2.gif) | Idiots Picture Large..> | 2010-11-28 01:39 | 248K | |
![[IMG]](/icons/image2.gif) | I love a plan coming..> | 2011-07-29 11:19 | 3.6K | |
![[IMG]](/icons/image2.gif) | I love a plan coming..> | 2011-08-04 10:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | I love a plan coming..> | 2011-09-22 16:06 | 3.6K | |
![[IMG]](/icons/image2.gif) | I love a plan coming..> | 2011-11-02 15:49 | 3.6K | |
![[IMG]](/icons/image2.gif) | I love a plan coming..> | 2011-11-09 14:12 | 3.6K | |
![[IMG]](/icons/image2.gif) | I love a plan coming..> | 2011-07-15 16:13 | 3.6K | |
![[DIR]](/icons/folder.gif) | Image/ | 2024-02-28 23:51 | - | |
![[IMG]](/icons/image2.gif) | ImageProxy.png | 2010-10-26 12:05 | 146K | |
![[IMG]](/icons/image2.gif) | ImageProxy2.png | 2010-10-26 12:05 | 157K | |
![[IMG]](/icons/image2.gif) | ImageProxy3.png | 2010-10-26 12:05 | 261K | |
![[IMG]](/icons/image2.gif) | Income Distribution ..> | 2010-10-26 12:05 | 93K | |
![[IMG]](/icons/image2.gif) | Income Distribution ..> | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | Income gap Sept 2010..> | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | Industrial Productio..> | 2010-10-26 12:05 | 9.7K | |
![[IMG]](/icons/image2.gif) | Inflation-Is-A-Tax-A..> | 2012-12-22 00:47 | 36K | |
![[IMG]](/icons/image2.gif) | Insider Trading Rati..> | 2012-06-16 14:44 | 76K | |
![[IMG]](/icons/image2.gif) | Inventory Report Jun..> | 2011-06-22 13:57 | 77K | |
![[IMG]](/icons/image2.gif) | Isle-of-Man.jpg | 2011-08-11 15:38 | 81K | |
![[IMG]](/icons/image2.gif) | Item-009-Limbo.jpg | 2010-10-26 12:05 | 79K | |
![[IMG]](/icons/image2.gif) | JPM-020510.jpg | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | JTX.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | Jackie watches Skate..> | 2010-12-22 16:04 | 129K | |
![[IMG]](/icons/image2.gif) | Jan 09 Dow.JPG | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | Japan-loans-big.gif | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | Japan Housewife fore..> | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | Japan May 15 2011.jpg | 2011-05-15 17:39 | 8.4K | |
![[IMG]](/icons/image2.gif) | Jobs April 2010.jpg | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | Jobs Sept 9 2011.jpg | 2011-09-09 07:58 | 20K | |
![[IMG]](/icons/image2.gif) | June11MarketReport.jpg | 2012-06-11 13:51 | 151K | |
![[IMG]](/icons/image2.gif) | KarlDenninger.jpg | 2010-10-26 12:05 | 1.6K | |
![[IMG]](/icons/image2.gif) | Keynes.gif | 2011-02-09 19:26 | 68K | |
![[IMG]](/icons/image2.gif) | Kondratieff.jpeg | 2012-09-24 13:26 | 56K | |
![[IMG]](/icons/image2.gif) | LIN2(1).jpg | 2010-12-14 20:15 | 58K | |
![[IMG]](/icons/image2.gif) | LIN2.jpg | 2010-12-14 20:13 | 58K | |
![[IMG]](/icons/image2.gif) | LUV.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | LZB_Presidents_Day_L..> | 2011-02-24 00:50 | 30K | |
![[IMG]](/icons/image2.gif) | Left Behind-1.jpg | 2011-05-29 03:31 | 71K | |
![[IMG]](/icons/image2.gif) | Levels 1-3-12.jpg | 2012-01-03 17:42 | 462K | |
![[IMG]](/icons/image2.gif) | Levels 1-4-12.jpg | 2012-01-04 17:08 | 456K | |
![[IMG]](/icons/image2.gif) | Levels 1-5-12.jpg | 2012-01-05 16:36 | 469K | |
![[IMG]](/icons/image2.gif) | Levels 3-15.jpg | 2011-03-15 17:57 | 116K | |
![[IMG]](/icons/image2.gif) | Levels 3-16(1).jpg | 2011-03-16 16:48 | 117K | |
![[IMG]](/icons/image2.gif) | Levels 3-16.jpg | 2011-03-16 16:48 | 117K | |
![[IMG]](/icons/image2.gif) | Levels 3-17.jpg | 2011-03-17 17:29 | 183K | |
![[IMG]](/icons/image2.gif) | Levels 3-21(1).jpg | 2011-03-21 17:20 | 167K | |
![[IMG]](/icons/image2.gif) | Levels 3-21.jpg | 2011-03-21 17:20 | 167K | |
![[IMG]](/icons/image2.gif) | Levels 3-24.jpg | 2011-03-25 04:56 | 167K | |
![[IMG]](/icons/image2.gif) | Levels 3-30(1).jpg | 2011-03-31 09:32 | 170K | |
![[IMG]](/icons/image2.gif) | Levels 3-30(2).jpg | 2011-03-31 09:33 | 170K | |
![[IMG]](/icons/image2.gif) | Levels 3-30(3).jpg | 2011-03-31 09:34 | 170K | |
![[IMG]](/icons/image2.gif) | Levels 3-30.jpg | 2011-03-31 09:32 | 170K | |
![[IMG]](/icons/image2.gif) | Levels 3-31.jpg | 2011-04-01 09:02 | 173K | |
![[IMG]](/icons/image2.gif) | Levels 4-2 V2.jpg | 2011-04-04 09:42 | 169K | |
![[IMG]](/icons/image2.gif) | Levels 4-5.jpg | 2011-04-05 16:59 | 168K | |
![[IMG]](/icons/image2.gif) | Levels 4-6.jpg | 2011-04-06 17:35 | 168K | |
![[IMG]](/icons/image2.gif) | Levels 4-7.jpg | 2011-04-07 16:30 | 168K | |
![[IMG]](/icons/image2.gif) | Levels 4-8.jpg | 2011-04-08 16:57 | 169K | |
![[IMG]](/icons/image2.gif) | Levels 4-11.jpg | 2011-04-11 17:01 | 176K | |
![[IMG]](/icons/image2.gif) | Levels 4-12.jpg | 2011-04-12 17:16 | 183K | |
![[IMG]](/icons/image2.gif) | Levels 4-13.jpg | 2011-04-13 16:28 | 180K | |
![[IMG]](/icons/image2.gif) | Levels 4-14.jpg | 2011-04-14 16:47 | 176K | |
![[IMG]](/icons/image2.gif) | Levels 4-15.jpg | 2011-04-15 16:41 | 181K | |
![[IMG]](/icons/image2.gif) | Levels 4-18(1).jpg | 2011-04-18 18:46 | 181K | |
![[IMG]](/icons/image2.gif) | Levels 4-18.jpg | 2011-04-18 18:42 | 176K | |
![[IMG]](/icons/image2.gif) | Levels 4-19.jpg | 2011-04-19 16:40 | 182K | |
![[IMG]](/icons/image2.gif) | Levels 4-20.jpg | 2011-04-20 16:34 | 183K | |
![[IMG]](/icons/image2.gif) | Levels 4-21.jpg | 2011-04-21 16:52 | 179K | |
![[IMG]](/icons/image2.gif) | Levels 4-25.jpg | 2011-04-25 18:47 | 180K | |
![[IMG]](/icons/image2.gif) | Levels 4-26.jpg | 2011-04-26 16:45 | 176K | |
![[IMG]](/icons/image2.gif) | Levels 4-27.jpg | 2011-04-27 16:45 | 178K | |
![[IMG]](/icons/image2.gif) | Levels 4-28.jpg | 2011-04-28 17:04 | 177K | |
![[IMG]](/icons/image2.gif) | Levels 4-28b.jpg | 2011-04-28 18:15 | 175K | |
![[IMG]](/icons/image2.gif) | Levels 4-29.jpg | 2011-04-29 16:30 | 174K | |
![[IMG]](/icons/image2.gif) | Levels 5-2.jpg | 2011-05-02 17:11 | 174K | |
![[IMG]](/icons/image2.gif) | Levels 5-3(1).jpg | 2011-05-03 17:48 | 178K | |
![[IMG]](/icons/image2.gif) | Levels 5-3.jpg | 2011-05-03 17:47 | 172K | |
![[IMG]](/icons/image2.gif) | Levels 5-4.jpg | 2011-05-04 16:52 | 178K | |
![[IMG]](/icons/image2.gif) | Levels 5-5.jpg | 2011-05-05 16:40 | 177K | |
![[IMG]](/icons/image2.gif) | Levels 5-6.jpg | 2011-05-06 16:43 | 178K | |
![[IMG]](/icons/image2.gif) | Levels 5-9.jpg | 2011-05-09 17:41 | 177K | |
![[IMG]](/icons/image2.gif) | Levels 5-9 V2.jpg | 2011-05-09 20:22 | 377K | |
![[IMG]](/icons/image2.gif) | Levels 5-10.jpg | 2011-05-10 18:10 | 376K | |
![[IMG]](/icons/image2.gif) | Levels 5-11.jpg | 2011-05-11 16:52 | 377K | |
![[IMG]](/icons/image2.gif) | Levels 5-12.jpg | 2011-05-12 17:09 | 379K | |
![[IMG]](/icons/image2.gif) | Levels 5-12b.jpg | 2011-05-13 01:12 | 380K | |
![[IMG]](/icons/image2.gif) | Levels 5-13.jpg | 2011-05-13 16:42 | 381K | |
![[IMG]](/icons/image2.gif) | Levels 5-16.jpg | 2011-05-16 16:42 | 389K | |
![[IMG]](/icons/image2.gif) | Levels 5-17.jpg | 2011-05-17 18:34 | 386K | |
![[IMG]](/icons/image2.gif) | Levels 5-18.jpg | 2011-05-18 17:43 | 381K | |
![[IMG]](/icons/image2.gif) | Levels 5-19.jpg | 2011-05-19 17:17 | 377K | |
![[IMG]](/icons/image2.gif) | Levels 5-20.jpg | 2011-05-20 17:31 | 373K | |
![[IMG]](/icons/image2.gif) | Levels 5-20b.jpg | 2011-05-20 22:04 | 371K | |
![[IMG]](/icons/image2.gif) | Levels 5-23.jpg | 2011-05-23 16:47 | 387K | |
![[IMG]](/icons/image2.gif) | Levels 5-24.jpg | 2011-05-24 16:57 | 487K | |
![[IMG]](/icons/image2.gif) | Levels 5-24b.jpg | 2011-05-24 16:59 | 447K | |
![[IMG]](/icons/image2.gif) | Levels 5-25.jpg | 2011-05-25 18:02 | 444K | |
![[IMG]](/icons/image2.gif) | Levels 5-26.jpg | 2011-05-26 16:47 | 444K | |
![[IMG]](/icons/image2.gif) | Levels 5-27.jpg | 2011-05-27 17:11 | 447K | |
![[IMG]](/icons/image2.gif) | Levels 5-31.jpg | 2011-05-31 17:45 | 197K | |
![[IMG]](/icons/image2.gif) | Levels 6-1.jpg | 2011-06-01 18:01 | 455K | |
![[IMG]](/icons/image2.gif) | Levels 6-2.jpg | 2011-06-02 16:36 | 461K | |
![[IMG]](/icons/image2.gif) | Levels 6-3.jpg | 2011-06-03 17:09 | 456K | |
![[IMG]](/icons/image2.gif) | Levels 6-6.jpg | 2011-06-06 17:29 | 418K | |
![[IMG]](/icons/image2.gif) | Levels 6-6v2.jpg | 2011-06-06 19:41 | 199K | |
![[IMG]](/icons/image2.gif) | Levels 6-7.jpg | 2011-06-07 17:07 | 452K | |
![[IMG]](/icons/image2.gif) | Levels 6-8.jpg | 2011-06-08 17:28 | 453K | |
![[IMG]](/icons/image2.gif) | Levels 6-9.jpg | 2011-06-09 16:53 | 450K | |
![[IMG]](/icons/image2.gif) | Levels 6-10.jpg | 2011-06-10 17:05 | 458K | |
![[IMG]](/icons/image2.gif) | Levels 6-13.jpg | 2011-06-13 16:44 | 460K | |
![[IMG]](/icons/image2.gif) | Levels 6-13b.jpg | 2011-06-13 17:30 | 462K | |
![[IMG]](/icons/image2.gif) | Levels 6-13c.jpg | 2011-06-13 17:39 | 464K | |
![[IMG]](/icons/image2.gif) | Levels 6-14.jpg | 2011-06-14 17:13 | 469K | |
![[IMG]](/icons/image2.gif) | Levels 6-15(1).jpg | 2011-06-15 17:00 | 471K | |
![[IMG]](/icons/image2.gif) | Levels 6-15.jpg | 2011-06-15 16:58 | 464K | |
![[IMG]](/icons/image2.gif) | Levels 6-15b.jpg | 2011-06-15 17:00 | 471K | |
![[IMG]](/icons/image2.gif) | Levels 6-16.jpg | 2011-06-16 17:06 | 463K | |
![[IMG]](/icons/image2.gif) | Levels 6-17.jpg | 2011-06-17 16:44 | 443K | |
![[IMG]](/icons/image2.gif) | Levels 6-20.jpg | 2011-06-20 16:36 | 450K | |
![[IMG]](/icons/image2.gif) | Levels 6-21.jpg | 2011-06-21 17:23 | 454K | |
![[IMG]](/icons/image2.gif) | Levels 6-22.jpg | 2011-06-22 17:01 | 450K | |
![[IMG]](/icons/image2.gif) | Levels 6-23.jpg | 2011-06-23 16:48 | 453K | |
![[IMG]](/icons/image2.gif) | Levels 6-24(1).jpg | 2011-06-24 17:07 | 452K | |
![[IMG]](/icons/image2.gif) | Levels 6-24.jpg | 2011-06-24 17:05 | 452K | |
![[IMG]](/icons/image2.gif) | Levels 6-27.jpg | 2011-06-27 16:36 | 456K | |
![[IMG]](/icons/image2.gif) | Levels 6-28.jpg | 2011-06-28 16:58 | 452K | |
![[IMG]](/icons/image2.gif) | Levels 6-29(1).jpg | 2011-06-29 17:32 | 452K | |
![[IMG]](/icons/image2.gif) | Levels 6-29.jpg | 2011-06-29 17:31 | 452K | |
![[IMG]](/icons/image2.gif) | Levels 6-30.jpg | 2011-06-30 16:35 | 449K | |
![[IMG]](/icons/image2.gif) | Levels 7-1.jpg | 2011-07-01 17:18 | 445K | |
![[IMG]](/icons/image2.gif) | Levels 7-5.jpg | 2011-07-05 19:55 | 455K | |
![[IMG]](/icons/image2.gif) | Levels 7-6.jpg | 2011-07-06 16:43 | 442K | |
![[IMG]](/icons/image2.gif) | Levels 7-7.jpg | 2011-07-07 16:48 | 487K | |
![[IMG]](/icons/image2.gif) | Levels 7-8.jpg | 2011-07-08 16:54 | 482K | |
![[IMG]](/icons/image2.gif) | Levels 7-11.jpg | 2011-07-11 16:34 | 494K | |
![[IMG]](/icons/image2.gif) | Levels 7-12.jpg | 2011-07-12 16:49 | 492K | |
![[IMG]](/icons/image2.gif) | Levels 7-13.jpg | 2011-07-13 17:55 | 498K | |
![[IMG]](/icons/image2.gif) | Levels 7-14.jpg | 2011-07-14 16:33 | 497K | |
![[IMG]](/icons/image2.gif) | Levels 7-15.jpg | 2011-07-15 17:40 | 492K | |
![[IMG]](/icons/image2.gif) | Levels 7-18.jpg | 2011-07-18 17:23 | 501K | |
![[IMG]](/icons/image2.gif) | Levels 7-19.jpg | 2011-07-19 17:06 | 505K | |
![[IMG]](/icons/image2.gif) | Levels 7-20.jpg | 2011-07-20 17:23 | 503K | |
![[IMG]](/icons/image2.gif) | Levels 7-21.jpg | 2011-07-21 19:42 | 503K | |
![[IMG]](/icons/image2.gif) | Levels 7-22.jpg | 2011-07-22 16:39 | 496K | |
![[IMG]](/icons/image2.gif) | Levels 7-25.jpg | 2011-07-25 16:36 | 500K | |
![[IMG]](/icons/image2.gif) | Levels 7-26.jpg | 2011-07-26 16:53 | 502K | |
![[IMG]](/icons/image2.gif) | Levels 7-27.jpg | 2011-07-27 17:06 | 504K | |
![[IMG]](/icons/image2.gif) | Levels 7-28.jpg | 2011-07-28 17:16 | 511K | |
![[IMG]](/icons/image2.gif) | Levels 7-29.jpg | 2011-07-29 16:35 | 502K | |
![[IMG]](/icons/image2.gif) | Levels 8-1.jpg | 2011-08-01 17:21 | 518K | |
![[IMG]](/icons/image2.gif) | Levels 8-1b.jpg | 2011-08-01 17:28 | 514K | |
![[IMG]](/icons/image2.gif) | Levels 8-2.jpg | 2011-08-02 16:36 | 516K | |
![[IMG]](/icons/image2.gif) | Levels 8-3.jpg | 2011-08-03 17:07 | 509K | |
![[IMG]](/icons/image2.gif) | Levels 8-4(1).jpg | 2011-08-04 18:29 | 492K | |
![[IMG]](/icons/image2.gif) | Levels 8-4.jpg | 2011-08-04 18:28 | 492K | |
![[IMG]](/icons/image2.gif) | Levels 8-5.jpg | 2011-08-05 17:09 | 481K | |
![[IMG]](/icons/image2.gif) | Levels 8-8.jpg | 2011-08-08 17:17 | 459K | |
![[IMG]](/icons/image2.gif) | Levels 8-9(1).jpg | 2011-08-09 17:03 | 454K | |
![[IMG]](/icons/image2.gif) | Levels 8-9(2).jpg | 2011-09-08 18:51 | 480K | |
![[IMG]](/icons/image2.gif) | Levels 8-9.jpg | 2011-08-09 17:02 | 454K | |
![[IMG]](/icons/image2.gif) | Levels 8-10.jpg | 2011-08-10 17:05 | 465K | |
![[IMG]](/icons/image2.gif) | Levels 8-11.jpg | 2011-08-11 16:53 | 471K | |
![[IMG]](/icons/image2.gif) | Levels 8-12.jpg | 2011-08-12 16:55 | 463K | |
![[IMG]](/icons/image2.gif) | Levels 8-12b.jpg | 2011-08-12 16:57 | 462K | |
![[IMG]](/icons/image2.gif) | Levels 8-15.jpg | 2011-08-15 16:45 | 464K | |
![[IMG]](/icons/image2.gif) | Levels 8-16.jpg | 2011-08-16 17:00 | 463K | |
![[IMG]](/icons/image2.gif) | Levels 8-17.jpg | 2011-08-17 17:23 | 472K | |
![[IMG]](/icons/image2.gif) | Levels 8-18.jpg | 2011-08-18 17:20 | 468K | |
![[IMG]](/icons/image2.gif) | Levels 8-19.jpg | 2011-08-19 17:27 | 474K | |
![[IMG]](/icons/image2.gif) | Levels 8-22.jpg | 2011-08-22 16:50 | 473K | |
![[IMG]](/icons/image2.gif) | Levels 8-23.jpg | 2011-08-23 17:37 | 456K | |
![[IMG]](/icons/image2.gif) | Levels 8-24(1).jpg | 2011-08-24 17:45 | 475K | |
![[IMG]](/icons/image2.gif) | Levels 8-24.jpg | 2011-08-24 17:42 | 462K | |
![[IMG]](/icons/image2.gif) | Levels 8-25.jpg | 2011-08-25 16:42 | 477K | |
![[IMG]](/icons/image2.gif) | Levels 8-26.jpg | 2011-08-26 17:14 | 473K | |
![[IMG]](/icons/image2.gif) | Levels 8-29.jpg | 2011-08-29 18:55 | 469K | |
![[IMG]](/icons/image2.gif) | Levels 8-30.jpg | 2011-08-30 16:44 | 467K | |
![[IMG]](/icons/image2.gif) | Levels 8-31.jpg | 2011-08-31 17:02 | 473K | |
![[IMG]](/icons/image2.gif) | Levels 9-1.jpg | 2011-09-01 17:01 | 473K | |
![[IMG]](/icons/image2.gif) | Levels 9-1b.jpg | 2011-09-01 17:03 | 471K | |
![[IMG]](/icons/image2.gif) | Levels 9-2.jpg | 2011-09-02 17:44 | 466K | |
![[IMG]](/icons/image2.gif) | Levels 9-6.jpg | 2011-09-06 19:50 | 471K | |
![[IMG]](/icons/image2.gif) | Levels 9-7.jpg | 2011-09-08 00:42 | 480K | |
![[IMG]](/icons/image2.gif) | Levels 9-8.jpg | 2011-09-08 18:51 | 480K | |
![[IMG]](/icons/image2.gif) | Levels 9-9.jpg | 2011-09-09 16:38 | 477K | |
![[IMG]](/icons/image2.gif) | Levels 9-12.jpg | 2011-09-12 16:46 | 475K | |
![[IMG]](/icons/image2.gif) | Levels 9-13.jpg | 2011-09-13 16:49 | 475K | |
![[IMG]](/icons/image2.gif) | Levels 9-14.jpg | 2011-09-14 16:46 | 478K | |
![[IMG]](/icons/image2.gif) | Levels 9-15.jpg | 2011-09-15 17:22 | 476K | |
![[IMG]](/icons/image2.gif) | Levels 9-16.jpg | 2011-09-16 16:50 | 472K | |
![[IMG]](/icons/image2.gif) | Levels 9-19.jpg | 2011-09-19 17:19 | 479K | |
![[IMG]](/icons/image2.gif) | Levels 9-20.jpg | 2011-09-20 21:29 | 476K | |
![[IMG]](/icons/image2.gif) | Levels 9-21.jpg | 2011-09-21 17:06 | 481K | |
![[IMG]](/icons/image2.gif) | Levels 9-22.jpg | 2011-09-22 16:56 | 486K | |
![[IMG]](/icons/image2.gif) | Levels 9-23.jpg | 2011-09-23 16:57 | 477K | |
![[IMG]](/icons/image2.gif) | Levels 9-26.jpg | 2011-09-26 17:02 | 480K | |
![[IMG]](/icons/image2.gif) | Levels 9-27.jpg | 2011-09-27 19:20 | 481K | |
![[IMG]](/icons/image2.gif) | Levels 9-28.jpg | 2011-09-28 18:34 | 484K | |
![[IMG]](/icons/image2.gif) | Levels 9-29.jpg | 2011-09-29 17:44 | 483K | |
![[IMG]](/icons/image2.gif) | Levels 9-30.jpg | 2011-09-30 16:56 | 482K | |
![[IMG]](/icons/image2.gif) | Levels 9-30a(1).jpg | 2011-10-01 12:07 | 125K | |
![[IMG]](/icons/image2.gif) | Levels 9-30a(2).jpg | 2011-10-01 12:08 | 125K | |
![[IMG]](/icons/image2.gif) | Levels 9-30a(3).jpg | 2011-10-01 12:09 | 125K | |
![[IMG]](/icons/image2.gif) | Levels 9-30a.JPG | 2011-10-01 12:07 | 125K | |
![[IMG]](/icons/image2.gif) | Levels 10-3.jpg | 2011-10-03 16:51 | 487K | |
![[IMG]](/icons/image2.gif) | Levels 10-4(1).jpg | 2011-10-05 08:05 | 124K | |
![[IMG]](/icons/image2.gif) | Levels 10-4.jpg | 2011-10-04 17:42 | 483K | |
![[IMG]](/icons/image2.gif) | Levels 10-5.jpg | 2011-10-05 16:44 | 487K | |
![[IMG]](/icons/image2.gif) | Levels 10-6.jpg | 2011-10-06 17:55 | 484K | |
![[IMG]](/icons/image2.gif) | Levels 10-7.jpg | 2011-10-07 16:50 | 487K | |
![[IMG]](/icons/image2.gif) | Levels 10-8.jpg | 2011-11-08 18:14 | 467K | |
![[IMG]](/icons/image2.gif) | Levels 10-10.jpg | 2011-10-10 17:09 | 482K | |
![[IMG]](/icons/image2.gif) | Levels 10-11.jpg | 2011-10-11 20:04 | 488K | |
![[IMG]](/icons/image2.gif) | Levels 10-11a(1).jpg | 2011-10-12 09:57 | 124K | |
![[IMG]](/icons/image2.gif) | Levels 10-11a.JPG | 2011-10-12 09:56 | 124K | |
![[IMG]](/icons/image2.gif) | Levels 10-11a.jpg | 2011-10-12 09:56 | 124K | |
![[IMG]](/icons/image2.gif) | Levels 10-12.jpg | 2011-10-12 18:49 | 488K | |
![[IMG]](/icons/image2.gif) | Levels 10-13.jpg | 2011-10-13 19:17 | 479K | |
![[IMG]](/icons/image2.gif) | Levels 10-14.jpg | 2011-10-14 17:40 | 484K | |
![[IMG]](/icons/image2.gif) | Levels 10-17.jpg | 2011-10-17 17:20 | 485K | |
![[IMG]](/icons/image2.gif) | Levels 10-18.jpg | 2011-10-18 18:22 | 488K | |
![[IMG]](/icons/image2.gif) | Levels 10-19.jpg | 2011-10-19 16:54 | 490K | |
![[IMG]](/icons/image2.gif) | Levels 10-20.jpg | 2011-10-20 17:31 | 490K | |
![[IMG]](/icons/image2.gif) | Levels 10-21.jpg | 2011-10-21 18:22 | 485K | |
![[IMG]](/icons/image2.gif) | Levels 10-24.jpg | 2011-10-24 17:45 | 476K | |
![[IMG]](/icons/image2.gif) | Levels 10-26.jpg | 2011-10-26 16:32 | 483K | |
![[IMG]](/icons/image2.gif) | Levels 10-27.jpg | 2011-10-27 18:19 | 474K | |
![[IMG]](/icons/image2.gif) | Levels 10-28.jpg | 2011-10-28 18:08 | 466K | |
![[IMG]](/icons/image2.gif) | Levels 10-31.jpg | 2011-10-31 16:29 | 469K | |
![[IMG]](/icons/image2.gif) | Levels 11-1.jpg | 2011-11-01 17:07 | 478K | |
![[IMG]](/icons/image2.gif) | Levels 11-2.jpg | 2011-11-02 16:37 | 476K | |
![[IMG]](/icons/image2.gif) | Levels 11-3.jpg | 2011-11-03 16:24 | 468K | |
![[IMG]](/icons/image2.gif) | Levels 11-4.jpg | 2011-11-04 16:42 | 471K | |
![[IMG]](/icons/image2.gif) | Levels 11-7.jpg | 2011-11-07 16:46 | 470K | |
![[IMG]](/icons/image2.gif) | Levels 11-9.jpg | 2011-11-09 16:30 | 470K | |
![[IMG]](/icons/image2.gif) | Levels 11-10-11.jpg | 2011-11-10 17:27 | 472K | |
![[IMG]](/icons/image2.gif) | Levels 11-11-11.jpg | 2011-11-11 17:17 | 590K | |
![[IMG]](/icons/image2.gif) | Levels 11-11-11b(1).jpg | 2011-11-14 12:22 | 469K | |
![[IMG]](/icons/image2.gif) | Levels 11-11-11b.jpg | 2011-11-11 17:18 | 469K | |
![[IMG]](/icons/image2.gif) | Levels 11-14-11.jpg | 2011-11-14 17:34 | 469K | |
![[IMG]](/icons/image2.gif) | Levels 11-15-11.jpg | 2011-11-15 17:01 | 466K | |
![[IMG]](/icons/image2.gif) | Levels 11-16-11.jpg | 2011-11-16 16:55 | 470K | |
![[IMG]](/icons/image2.gif) | Levels 11-17-11.jpg | 2011-11-17 17:11 | 468K | |
![[IMG]](/icons/image2.gif) | Levels 11-18-11.jpg | 2011-11-18 16:55 | 468K | |
![[IMG]](/icons/image2.gif) | Levels 11-21-11.jpg | 2011-11-21 19:19 | 471K | |
![[IMG]](/icons/image2.gif) | Levels 11-21-11b.jpg | 2011-11-21 19:24 | 467K | |
![[IMG]](/icons/image2.gif) | Levels 11-22-11.jpg | 2011-11-22 16:57 | 468K | |
![[IMG]](/icons/image2.gif) | Levels 11-23-11.jpg | 2011-11-23 17:15 | 472K | |
![[IMG]](/icons/image2.gif) | Levels 11-25-11.jpg | 2011-11-25 14:51 | 469K | |
![[IMG]](/icons/image2.gif) | Levels 11-28-11.jpg | 2011-11-28 17:12 | 470K | |
![[IMG]](/icons/image2.gif) | Levels 11-29-11.jpg | 2011-11-29 16:49 | 468K | |
![[IMG]](/icons/image2.gif) | Levels 11-30-11.jpg | 2011-12-01 08:19 | 253K | |
![[IMG]](/icons/image2.gif) | Levels 12-1-11.jpg | 2011-12-01 17:43 | 468K | |
![[IMG]](/icons/image2.gif) | Levels 12-2-11.jpg | 2011-12-02 17:30 | 462K | |
![[IMG]](/icons/image2.gif) | Levels 12-5-11v2.jpg | 2011-12-05 19:46 | 466K | |
![[IMG]](/icons/image2.gif) | Levels 12-6-11.jpg | 2011-12-06 16:37 | 460K | |
![[IMG]](/icons/image2.gif) | Levels 12-7-11.jpg | 2011-12-07 17:03 | 464K | |
![[IMG]](/icons/image2.gif) | Levels 12-8-11.jpg | 2011-12-08 17:28 | 465K | |
![[IMG]](/icons/image2.gif) | Levels 12-9-11.jpg | 2011-12-09 17:58 | 463K | |
![[IMG]](/icons/image2.gif) | Levels 12-12-11.jpg | 2011-12-12 16:36 | 463K | |
![[IMG]](/icons/image2.gif) | Levels 12-13-11.jpg | 2011-12-13 17:37 | 465K | |
![[IMG]](/icons/image2.gif) | Levels 12-14-11.jpg | 2011-12-14 21:07 | 465K | |
![[IMG]](/icons/image2.gif) | Levels 12-15-11.jpg | 2011-12-15 16:35 | 462K | |
![[IMG]](/icons/image2.gif) | Levels 12-16-11.jpg | 2011-12-16 16:53 | 464K | |
![[IMG]](/icons/image2.gif) | Levels 12-19-11.jpg | 2011-12-19 18:34 | 461K | |
![[IMG]](/icons/image2.gif) | Levels 12-20-11.jpg | 2011-12-20 16:45 | 461K | |
![[IMG]](/icons/image2.gif) | Levels 12-21-11.jpg | 2011-12-21 18:28 | 462K | |
![[IMG]](/icons/image2.gif) | Levels 12-22-11.jpg | 2011-12-22 18:01 | 451K | |
![[IMG]](/icons/image2.gif) | Levels 12-23-11.jpg | 2011-12-23 16:51 | 452K | |
![[IMG]](/icons/image2.gif) | Levels 12-27-11.jpg | 2011-12-27 16:48 | 454K | |
![[IMG]](/icons/image2.gif) | Levels 12-29-11.jpg | 2011-12-29 17:10 | 450K | |
![[IMG]](/icons/image2.gif) | Levels 12-30-11.jpg | 2011-12-30 16:32 | 448K | |
![[IMG]](/icons/image2.gif) | Levels March 14 2011..> | 2011-03-14 09:18 | 72K | |
![[IMG]](/icons/image2.gif) | Levels March 21 2011..> | 2011-03-21 09:25 | 32K | |
![[IMG]](/icons/image2.gif) | Levels March 21 2011..> | 2011-03-21 09:25 | 32K | |
![[IMG]](/icons/image2.gif) | Levels March 28 2011..> | 2011-03-28 09:31 | 167K | |
![[IMG]](/icons/image2.gif) | Levels March 28 2011..> | 2011-03-28 09:31 | 167K | |
![[IMG]](/icons/image2.gif) | Levels March 29 2011..> | 2011-03-30 09:38 | 170K | |
![[IMG]](/icons/image2.gif) | LhfDF.jpeg | 2012-09-26 16:44 | 122K | |
![[IMG]](/icons/image2.gif) | Liars.jpg | 2011-11-28 16:50 | 18K | |
![[IMG]](/icons/image2.gif) | Liars Poker.jpg | 2012-02-12 04:48 | 113K | |
![[IMG]](/icons/image2.gif) | Lilly_pipeline[1].GIF | 2010-10-26 12:05 | 203K | |
![[IMG]](/icons/image2.gif) | Lloyd smiling(1).jpg | 2011-11-16 10:50 | 11K | |
![[IMG]](/icons/image2.gif) | Lloyd smiling.JPG | 2011-09-01 11:17 | 11K | |
![[IMG]](/icons/image2.gif) | Lobbying by Sector F..> | 2011-03-01 08:33 | 20K | |
![[IMG]](/icons/image2.gif) | Lobbying by Sector F..> | 2011-03-01 08:06 | 20K | |
![[IMG]](/icons/image2.gif) | London Times.jpg | 2013-03-12 08:35 | 20K | |
![[IMG]](/icons/image2.gif) | M3 Supply Sept 2009.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | MISSION(1).jpg | 2010-12-08 22:09 | 87K | |
![[IMG]](/icons/image2.gif) | MISSION.jpg | 2010-11-15 18:56 | 87K | |
![[IMG]](/icons/image2.gif) | MLK Dream Update.jpg | 2012-01-15 00:33 | 89K | |
![[IMG]](/icons/image2.gif) | MM.JPG | 2011-04-06 17:00 | 47K | |
![[IMG]](/icons/image2.gif) | MOS May 15 09.png | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | M Pattern May 15 201..> | 2011-05-16 07:42 | 11K | |
![[IMG]](/icons/image2.gif) | MSFT.jpg | 2011-12-09 16:49 | 66K | |
![[IMG]](/icons/image2.gif) | Madame-Le-Moderateur..> | 2011-06-07 20:19 | 25K | |
![[IMG]](/icons/image2.gif) | Madame-Le-Moderateur..> | 2011-07-18 03:13 | 25K | |
![[IMG]](/icons/image2.gif) | Madame-Le-Moderateur..> | 2011-12-15 19:08 | 25K | |
![[IMG]](/icons/image2.gif) | Madame-Le-Moderateur..> | 2011-03-08 15:42 | 25K | |
![[IMG]](/icons/image2.gif) | Maddie Contemplates ..> | 2010-12-22 16:00 | 109K | |
![[IMG]](/icons/image2.gif) | Made-in-China-Americ..> | 2011-01-05 03:49 | 615K | |
![[IMG]](/icons/image2.gif) | Made-in-China-Americ..> | 2011-01-04 14:24 | 615K | |
![[IMG]](/icons/image2.gif) | Manson.jpg | 2012-04-12 20:01 | 56K | |
![[IMG]](/icons/image2.gif) | March 6 - 1.jpg | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | March 6 - 2.jpg | 2010-10-26 12:05 | 10K | |
![[IMG]](/icons/image2.gif) | March 6 - 3.jpg | 2010-10-26 12:05 | 56K | |
![[IMG]](/icons/image2.gif) | March 6 - 4.jpg | 2010-10-26 12:05 | 9.1K | |
![[IMG]](/icons/image2.gif) | Market Edge.jpg | 2010-10-26 12:05 | 8.8K | |
![[IMG]](/icons/image2.gif) | Market Trend.JPG | 2011-02-06 15:32 | 77K | |
![[IMG]](/icons/image2.gif) | McClellan Nov 28 201..> | 2011-11-28 09:29 | 31K | |
![[IMG]](/icons/image2.gif) | McHenryPage(1).gif | 2011-05-25 23:48 | 72K | |
![[IMG]](/icons/image2.gif) | McHenryPage.gif | 2011-05-25 23:47 | 72K | |
![[IMG]](/icons/image2.gif) | Meatmarket2.png | 2010-10-26 12:05 | 130K | |
![[IMG]](/icons/image2.gif) | Median Income.jpg | 2010-10-26 12:05 | 37K | |
![[IMG]](/icons/image2.gif) | Merkozy.jpg | 2011-08-17 07:34 | 38K | |
![[IMG]](/icons/image2.gif) | Merkozy Ambulance (1..> | 2011-10-23 07:10 | 70K | |
![[IMG]](/icons/image2.gif) | Metropolis-1928.jpg | 2011-02-15 00:06 | 40K | |
![[IMG]](/icons/image2.gif) | Mich June.gif | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | Micromet.JPG | 2011-05-16 08:43 | 106K | |
![[IMG]](/icons/image2.gif) | Middle Class Snake B..> | 2011-06-12 06:31 | 73K | |
![[IMG]](/icons/image2.gif) | Mish&Liz7.png | 2013-06-17 16:38 | 207K | |
![[IMG]](/icons/image2.gif) | Mission Impossible (..> | 2012-01-22 02:51 | 58K | |
![[IMG]](/icons/image2.gif) | Mister-Miyagi.jpg | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Moms-LBP.gif | 2010-10-26 12:05 | 159K | |
![[IMG]](/icons/image2.gif) | Moneyclock_972_19143..> | 2011-10-31 16:57 | 16K | |
![[IMG]](/icons/image2.gif) | Monopoly.jpg | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | Monster April 2010(1..> | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | Monster April 2010.jpg | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | Monster Feb 2010.JPG | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | More_Than_Meets_The_..> | 2010-10-26 12:05 | 58K | |
![[IMG]](/icons/image2.gif) | Moving_Up.png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | Mr_ Stick(1).jpg | 2011-09-02 15:31 | 38K | |
![[IMG]](/icons/image2.gif) | Mr_ Stick(2).jpg | 2011-09-06 15:13 | 38K | |
![[IMG]](/icons/image2.gif) | Mr_ Stick(3).jpg | 2011-09-23 16:00 | 38K | |
![[IMG]](/icons/image2.gif) | Mr_ Stick(4).jpg | 2011-11-23 14:29 | 38K | |
![[IMG]](/icons/image2.gif) | Mr_ Stick(5).jpg | 2011-11-23 14:43 | 38K | |
![[IMG]](/icons/image2.gif) | Mr_ Stick(6).jpg | 2011-11-23 14:44 | 38K | |
![[IMG]](/icons/image2.gif) | Mr_ Stick.jpg | 2011-09-02 15:27 | 38K | |
![[IMG]](/icons/image2.gif) | Multi-Chart 01102012..> | 2012-01-10 08:10 | 271K | |
![[IMG]](/icons/image2.gif) | Multi-Chart 03152012..> | 2012-03-15 08:40 | 336K | |
![[IMG]](/icons/image2.gif) | Multi-Chart 04162012..> | 2012-04-16 07:38 | 326K | |
![[IMG]](/icons/image2.gif) | Multi-Chart 041813.jpg | 2013-04-18 08:19 | 349K | |
![[IMG]](/icons/image2.gif) | Multi-Chart 04262012..> | 2012-04-26 09:09 | 359K | |
![[IMG]](/icons/image2.gif) | Multi-Chart Aug 12 2..> | 2011-08-12 15:38 | 33K | |
![[IMG]](/icons/image2.gif) | Multi-Chart July 26..> | 2011-07-26 03:15 | 102K | |
![[IMG]](/icons/image2.gif) | Multi-Chart June 8 2..> | 2011-06-08 19:56 | 32K | |
![[IMG]](/icons/image2.gif) | Multi-Chart March 13..> | 2011-03-13 11:22 | 33K | |
![[IMG]](/icons/image2.gif) | Multi Apr 17 2010.jpg | 2010-10-26 12:05 | 86K | |
![[IMG]](/icons/image2.gif) | Multi Apr 17 2010a.jpg | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | Multi Chart Apr 1 20..> | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | Multi Chart Apr 1 20..> | 2010-10-26 12:05 | 136K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 3 ..> | 2012-04-03 09:03 | 127K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 7 ..> | 2011-04-08 07:55 | 32K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 11..> | 2012-04-11 07:50 | 135K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 12..> | 2011-04-12 08:26 | 35K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 12..> | 2011-04-12 08:30 | 24K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 19..> | 2011-04-19 07:49 | 142K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 19..> | 2011-04-19 07:49 | 142K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 19..> | 2011-04-19 08:36 | 140K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 19..> | 2011-04-19 08:37 | 140K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 19..> | 2011-04-19 08:36 | 140K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 19..> | 2011-04-19 09:05 | 97K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 27..> | 2011-04-27 20:25 | 102K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 29..> | 2011-04-29 15:48 | 101K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 29..> | 2011-04-29 15:53 | 97K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 29..> | 2011-04-29 16:24 | 28K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 29..> | 2011-04-29 16:25 | 28K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 29..> | 2011-04-29 16:25 | 28K | |
![[IMG]](/icons/image2.gif) | Multi Chart April 29..> | 2011-04-29 16:24 | 28K | |
![[IMG]](/icons/image2.gif) | Multi Chart Aug 17 2..> | 2011-08-17 08:19 | 96K | |
![[IMG]](/icons/image2.gif) | Multi Chart Dec 11 2..> | 2010-12-11 08:05 | 33K | |
![[IMG]](/icons/image2.gif) | Multi Chart Dec 14 2..> | 2010-12-14 07:33 | 99K | |
![[IMG]](/icons/image2.gif) | Multi Chart Feb 3 20..> | 2012-02-03 08:11 | 101K | |
![[IMG]](/icons/image2.gif) | Multi Chart Feb 23 ..> | 2011-02-23 08:05 | 27K | |
![[IMG]](/icons/image2.gif) | Multi Chart Feb 24 ..> | 2011-02-24 07:24 | 123K | |
![[IMG]](/icons/image2.gif) | Multi Chart Feb 24 ..> | 2011-02-24 07:11 | 93K | |
![[IMG]](/icons/image2.gif) | Multi Chart Jan 4 20..> | 2011-01-04 08:43 | 36K | |
![[IMG]](/icons/image2.gif) | Multi Chart Jan 7 2..> | 2011-01-07 15:58 | 32K | |
![[IMG]](/icons/image2.gif) | Multi Chart Jan 10 ..> | 2011-01-10 07:43 | 95K | |
![[IMG]](/icons/image2.gif) | Multi Chart Jan 21 2..> | 2011-01-21 13:29 | 95K | |
![[IMG]](/icons/image2.gif) | Multi Chart Jan 24 2..> | 2011-01-24 14:00 | 28K | |
![[IMG]](/icons/image2.gif) | Multi Chart July 1 ..> | 2011-07-01 16:03 | 25K | |
![[IMG]](/icons/image2.gif) | Multi Chart July 5 2..> | 2012-07-05 08:08 | 136K | |
![[IMG]](/icons/image2.gif) | Multi Chart July 9 2..> | 2010-10-26 12:05 | 97K | |
![[IMG]](/icons/image2.gif) | Multi Chart July 27 ..> | 2010-10-26 12:05 | 34K | |
![[IMG]](/icons/image2.gif) | Multi Chart July 28 ..> | 2010-10-26 12:05 | 91K | |
![[IMG]](/icons/image2.gif) | Multi Chart July 28a..> | 2010-10-26 12:05 | 96K | |
![[IMG]](/icons/image2.gif) | Multi Chart July 30 ..> | 2010-10-26 12:05 | 97K | |
![[IMG]](/icons/image2.gif) | Multi Chart July 30 ..> | 2010-10-26 12:05 | 97K | |
![[IMG]](/icons/image2.gif) | Multi Chart June 12 ..> | 2010-10-26 12:05 | 139K | |
![[IMG]](/icons/image2.gif) | Multi Chart June 19 ..> | 2012-06-19 08:45 | 355K | |
![[IMG]](/icons/image2.gif) | Multi Chart June 21 ..> | 2010-10-26 12:05 | 94K | |
![[IMG]](/icons/image2.gif) | Multi Chart June 22 ..> | 2010-10-26 12:05 | 133K | |
![[IMG]](/icons/image2.gif) | Multi Chart June 22 ..> | 2011-06-22 15:58 | 32K | |
![[IMG]](/icons/image2.gif) | Multi Chart June 24 ..> | 2011-06-24 11:17 | 35K | |
![[IMG]](/icons/image2.gif) | Multi Chart June 26 ..> | 2012-06-26 08:54 | 135K | |
![[IMG]](/icons/image2.gif) | Multi Chart June 29 ..> | 2012-06-29 09:08 | 26K | |
![[IMG]](/icons/image2.gif) | Multi Chart Mar 1 20..> | 2010-10-26 12:05 | 92K | |
![[IMG]](/icons/image2.gif) | Multi Chart Mar 8 20..> | 2010-10-26 12:05 | 92K | |
![[IMG]](/icons/image2.gif) | Multi Chart Mar 9 20..> | 2010-10-26 12:05 | 93K | |
![[IMG]](/icons/image2.gif) | Multi Chart Mar 23 2..> | 2010-10-26 12:05 | 94K | |
![[IMG]](/icons/image2.gif) | Multi Chart Mar 26 2..> | 2010-10-26 12:05 | 62K | |
![[IMG]](/icons/image2.gif) | Multi Chart March 14..> | 2011-03-14 08:11 | 30K | |
![[IMG]](/icons/image2.gif) | Multi Chart March 16..> | 2011-03-16 23:34 | 31K | |
![[IMG]](/icons/image2.gif) | Multi Chart March 16..> | 2011-03-16 23:37 | 30K | |
![[IMG]](/icons/image2.gif) | Multi Chart March 16..> | 2011-03-16 23:38 | 28K | |
![[IMG]](/icons/image2.gif) | Multi Chart March 22..> | 2011-03-22 09:12 | 97K | |
![[IMG]](/icons/image2.gif) | Multi Chart March 31..> | 2011-03-31 09:22 | 145K | |
![[IMG]](/icons/image2.gif) | Multi Chart May 4 20..> | 2011-05-04 09:03 | 149K | |
![[IMG]](/icons/image2.gif) | Multi Chart May 5 20..> | 2011-05-05 07:41 | 32K | |
![[IMG]](/icons/image2.gif) | Multi Chart May 10 2..> | 2012-05-10 08:59 | 359K | |
![[IMG]](/icons/image2.gif) | Multi Chart May 15 2..> | 2012-05-15 08:14 | 357K | |
![[IMG]](/icons/image2.gif) | Multi Chart May 16 2..> | 2011-05-17 14:17 | 32K | |
![[IMG]](/icons/image2.gif) | Multi Chart May 17 2..> | 2012-05-17 08:18 | 365K | |
![[IMG]](/icons/image2.gif) | Multi Chart May 18D ..> | 2011-05-18 07:59 | 32K | |
![[IMG]](/icons/image2.gif) | Multi Chart May 23 2..> | 2011-05-22 21:20 | 98K | |
![[IMG]](/icons/image2.gif) | Multi Chart Nov 22 2..> | 2010-11-24 08:31 | 104K | |
![[IMG]](/icons/image2.gif) | Multi Chart Nov 29 2..> | 2010-11-29 08:34 | 134K | |
![[IMG]](/icons/image2.gif) | Multi Chart Oct 7 20..> | 2010-10-26 12:05 | 93K | |
![[IMG]](/icons/image2.gif) | Multi Chart Oct 7a 2..> | 2010-10-26 12:05 | 100K | |
![[IMG]](/icons/image2.gif) | Multi Chart Oct 12 2..> | 2011-10-12 15:13 | 103K | |
![[IMG]](/icons/image2.gif) | Multi Chart Oct 13 2..> | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | Multi Chart Oct 13a ..> | 2010-10-26 12:05 | 103K | |
![[IMG]](/icons/image2.gif) | Multi Chart Oct 13b ..> | 2010-10-26 12:05 | 102K | |
![[IMG]](/icons/image2.gif) | Multi Chart Oct 21 2..> | 2010-10-22 12:51 | 102K | |
![[IMG]](/icons/image2.gif) | Multi Chart Oct 21a ..> | 2010-10-25 03:47 | 27K | |
![[IMG]](/icons/image2.gif) | Multi Chart Oct 27 2..> | 2010-10-27 15:11 | 32K | |
![[IMG]](/icons/image2.gif) | Multi Chart Sept 1 2..> | 2011-09-01 14:28 | 27K | |
![[IMG]](/icons/image2.gif) | Multi Chart Sept 10 ..> | 2010-10-26 12:05 | 101K | |
![[IMG]](/icons/image2.gif) | Multi Chart Sept 10a..> | 2010-10-26 12:05 | 96K | |
![[IMG]](/icons/image2.gif) | Multi Chart Sept 11 ..> | 2012-09-11 08:06 | 141K | |
![[IMG]](/icons/image2.gif) | Multi Chart Sept 12 ..> | 2011-09-12 08:33 | 98K | |
![[IMG]](/icons/image2.gif) | Multi Chart Sept 14 ..> | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | Multi Chart Sept 15 ..> | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | Multi Chart Sept 21 ..> | 2010-10-26 12:05 | 150K | |
![[IMG]](/icons/image2.gif) | Multi Chart Sept 21a..> | 2010-10-26 12:05 | 99K | |
![[IMG]](/icons/image2.gif) | Multi Chart Sept 21b..> | 2010-10-26 12:05 | 140K | |
![[IMG]](/icons/image2.gif) | Multi Chart Silver M..> | 2011-05-02 09:29 | 85K | |
![[IMG]](/icons/image2.gif) | Multi Chart Silver M..> | 2011-05-24 07:50 | 87K | |
![[IMG]](/icons/image2.gif) | Multi Charta Jan 4 2..> | 2011-01-04 14:37 | 32K | |
![[IMG]](/icons/image2.gif) | Multi Feb 18 2010.jpg | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | Multi Feb 18 2010a.jpg | 2010-10-26 12:05 | 59K | |
![[IMG]](/icons/image2.gif) | Multi Feb 23 2010.jpg | 2010-10-26 12:05 | 92K | |
![[IMG]](/icons/image2.gif) | Multi chart Apr 27 2..> | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | Multi chart Apr 27 2..> | 2010-10-26 12:05 | 64K | |
![[IMG]](/icons/image2.gif) | Multi chart Apr 28 2..> | 2010-10-26 12:05 | 146K | |
![[IMG]](/icons/image2.gif) | Multi chart Apr 29 2..> | 2010-10-26 12:05 | 96K | |
![[IMG]](/icons/image2.gif) | Multi chart Aug 3 20..> | 2010-10-26 12:05 | 44K | |
![[IMG]](/icons/image2.gif) | Multi chart Aug 3a 2..> | 2010-10-26 12:05 | 90K | |
![[IMG]](/icons/image2.gif) | Multi chart Aug 11 2..> | 2010-10-26 12:05 | 100K | |
![[IMG]](/icons/image2.gif) | Multi chart Aug 11a ..> | 2010-10-26 12:05 | 95K | |
![[IMG]](/icons/image2.gif) | Multi chart Aug 19 2..> | 2010-10-26 12:05 | 100K | |
![[IMG]](/icons/image2.gif) | Multi chart Dec 1 20..> | 2010-12-01 11:16 | 29K | |
![[IMG]](/icons/image2.gif) | Multi chart Feb 5 20..> | 2011-02-05 06:21 | 28K | |
![[IMG]](/icons/image2.gif) | Multi chart Feb 5a 2..> | 2011-02-05 07:18 | 28K | |
![[IMG]](/icons/image2.gif) | Multi chart Feb 11 2..> | 2011-02-11 15:04 | 32K | |
![[IMG]](/icons/image2.gif) | Multi chart Feb 17 2..> | 2011-02-17 14:31 | 29K | |
![[IMG]](/icons/image2.gif) | Multi chart July 19 ..> | 2010-10-26 12:05 | 95K | |
![[IMG]](/icons/image2.gif) | Multi chart July 21 ..> | 2010-10-26 12:05 | 96K | |
![[IMG]](/icons/image2.gif) | Multi chart July 21a..> | 2010-10-26 12:05 | 90K | |
![[IMG]](/icons/image2.gif) | Multi chart June 1 2..> | 2010-10-26 12:05 | 69K | |
![[IMG]](/icons/image2.gif) | Multi chart June 2 2..> | 2010-10-26 12:05 | 61K | |
![[IMG]](/icons/image2.gif) | Multi chart June 2a ..> | 2010-10-26 12:05 | 64K | |
![[IMG]](/icons/image2.gif) | Multi chart June 4 2..> | 2010-10-26 12:05 | 136K | |
![[IMG]](/icons/image2.gif) | Multi chart June 5 2..> | 2010-10-26 12:05 | 134K | |
![[IMG]](/icons/image2.gif) | Multi chart June 5 2..> | 2010-10-26 12:05 | 135K | |
![[IMG]](/icons/image2.gif) | Multi chart June 7 2..> | 2010-10-26 12:05 | 138K | |
![[IMG]](/icons/image2.gif) | Multi chart June 7a ..> | 2010-10-26 12:05 | 91K | |
![[IMG]](/icons/image2.gif) | Multi chart June 24 ..> | 2010-10-26 12:05 | 136K | |
![[IMG]](/icons/image2.gif) | Multi chart June 24 ..> | 2010-10-26 12:05 | 136K | |
![[IMG]](/icons/image2.gif) | Multi chart June 29 ..> | 2010-10-26 12:05 | 142K | |
![[IMG]](/icons/image2.gif) | Multi chart June 29e..> | 2010-10-26 12:05 | 139K | |
![[IMG]](/icons/image2.gif) | Multi chart Mar 6 20..> | 2010-10-26 12:05 | 72K | |
![[IMG]](/icons/image2.gif) | Multi chart Mar 13 2..> | 2010-10-26 12:05 | 61K | |
![[IMG]](/icons/image2.gif) | Multi chart Mar 13 2..> | 2010-10-26 12:05 | 61K | |
![[IMG]](/icons/image2.gif) | Multi chart Mar 13 2..> | 2010-10-26 12:05 | 61K | |
![[IMG]](/icons/image2.gif) | Multi chart Mar 17 2..> | 2010-10-26 12:05 | 135K | |
![[IMG]](/icons/image2.gif) | Multi chart May 4 20..> | 2010-10-26 12:05 | 67K | |
![[IMG]](/icons/image2.gif) | Multi chart May 4a 2..> | 2010-10-26 12:05 | 97K | |
![[IMG]](/icons/image2.gif) | Multi chart May 8 20..> | 2010-10-26 12:05 | 148K | |
![[IMG]](/icons/image2.gif) | Multi chart May 8a 2..> | 2010-10-26 12:05 | 142K | |
![[IMG]](/icons/image2.gif) | Multi chart May 8b 2..> | 2010-10-26 12:05 | 99K | |
![[IMG]](/icons/image2.gif) | Multi chart May 8c 2..> | 2010-10-26 12:05 | 142K | |
![[IMG]](/icons/image2.gif) | Multi chart May 8d 2..> | 2010-10-26 12:05 | 143K | |
![[IMG]](/icons/image2.gif) | Multi chart May 11 2..> | 2010-10-26 12:05 | 177K | |
![[IMG]](/icons/image2.gif) | Multi chart May 13 2..> | 2010-10-26 12:05 | 93K | |
![[IMG]](/icons/image2.gif) | Multi chart May 13 2..> | 2010-10-26 12:05 | 88K | |
![[IMG]](/icons/image2.gif) | Multi chart May 18 2..> | 2010-10-26 12:05 | 90K | |
![[IMG]](/icons/image2.gif) | Multi chart May 18 2..> | 2010-10-26 12:05 | 94K | |
![[IMG]](/icons/image2.gif) | Multi chart May 25 2..> | 2010-10-26 12:05 | 139K | |
![[IMG]](/icons/image2.gif) | Multi chart May 25a ..> | 2010-10-26 12:05 | 137K | |
![[IMG]](/icons/image2.gif) | Multi chart May 26 2..> | 2010-10-26 12:05 | 133K | |
![[IMG]](/icons/image2.gif) | Multi chart May 28 2..> | 2010-10-26 12:05 | 93K | |
![[IMG]](/icons/image2.gif) | Multi chart Nov 10 2..> | 2010-11-10 07:47 | 142K | |
![[IMG]](/icons/image2.gif) | Multi chart Nov 15 2..> | 2010-11-15 08:06 | 142K | |
![[IMG]](/icons/image2.gif) | Multi chart Nov 18 2..> | 2010-11-18 07:49 | 28K | |
![[IMG]](/icons/image2.gif) | Multi chart Nov 18a ..> | 2010-11-18 08:00 | 33K | |
![[IMG]](/icons/image2.gif) | Multi chart Nov 18a ..> | 2010-11-18 08:00 | 33K | |
![[IMG]](/icons/image2.gif) | Multi chart Nov 18a ..> | 2010-11-18 07:59 | 33K | |
![[IMG]](/icons/image2.gif) | Multi chart Oct 23 2..> | 2010-10-25 03:05 | 142K | |
![[IMG]](/icons/image2.gif) | Multi chart Oct 28 2..> | 2010-10-28 15:04 | 33K | |
![[IMG]](/icons/image2.gif) | Multi chart Sept 1 2..> | 2010-10-26 12:05 | 37K | |
![[IMG]](/icons/image2.gif) | Multi chart Sept 1a ..> | 2010-10-26 12:05 | 143K | |
![[IMG]](/icons/image2.gif) | Multi charts Feb 1 2..> | 2011-02-01 10:33 | 26K | |
![[IMG]](/icons/image2.gif) | Multi currency June..> | 2011-06-13 16:18 | 28K | |
![[IMG]](/icons/image2.gif) | Multil Chart June 12..> | 2012-06-12 08:56 | 133K | |
![[IMG]](/icons/image2.gif) | Multil Chart June 25..> | 2013-06-25 08:50 | 126K | |
![[IMG]](/icons/image2.gif) | Multil Chart May 23a..> | 2012-05-24 08:14 | 39K | |
![[IMG]](/icons/image2.gif) | Multil Chart May 31 ..> | 2012-05-31 08:00 | 139K | |
![[IMG]](/icons/image2.gif) | Multipliers Aug 2010..> | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | Must Hold Levels Feb..> | 2011-02-28 09:16 | 29K | |
![[IMG]](/icons/image2.gif) | NAMO-050511.jpg | 2011-05-06 10:49 | 54K | |
![[IMG]](/icons/image2.gif) | NASDAQ-041211.jpg | 2011-04-13 10:08 | 67K | |
![[IMG]](/icons/image2.gif) | NDX March 17 2012.jpg | 2012-03-18 21:38 | 66K | |
![[IMG]](/icons/image2.gif) | NFP10Weakest[2].png | 2011-06-03 12:44 | 121K | |
![[IMG]](/icons/image2.gif) | NFP Feb 2010.gif | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | NFP June 1 2010.gif | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | NIB-Florida_Police-R..> | 2012-04-09 16:57 | 62K | |
![[IMG]](/icons/image2.gif) | NKD 061113.jpg | 2013-06-12 07:56 | 31K | |
![[IMG]](/icons/image2.gif) | NYMEX April 11 2011(..> | 2011-04-11 08:47 | 34K | |
![[IMG]](/icons/image2.gif) | NYMEX April 11 2011.jpg | 2011-04-11 08:46 | 26K | |
![[IMG]](/icons/image2.gif) | NYMEX Chat Feb 21 20..> | 2011-02-21 14:18 | 35K | |
![[IMG]](/icons/image2.gif) | NYMEX Chat Feb 21a 2..> | 2011-02-22 11:39 | 27K | |
![[IMG]](/icons/image2.gif) | NYMEX Feb 15 2011(1)..> | 2011-02-15 09:43 | 33K | |
![[IMG]](/icons/image2.gif) | NYMEX Feb 15 2011.jpg | 2011-02-15 09:43 | 33K | |
![[IMG]](/icons/image2.gif) | NYMEX July 8 2011.jpg | 2011-07-08 07:29 | 30K | |
![[IMG]](/icons/image2.gif) | NYMEX chart Feb 3 20..> | 2011-02-03 10:59 | 34K | |
![[IMG]](/icons/image2.gif) | NYSE%20PT%20June%202..> | 2010-10-26 12:05 | 238K | |
![[IMG]](/icons/image2.gif) | NYSE%20PT%20June%202..> | 2010-10-26 12:05 | 238K | |
![[IMG]](/icons/image2.gif) | NYSE%20PT%20June%202..> | 2010-10-26 12:05 | 238K | |
![[IMG]](/icons/image2.gif) | NYSE%20PT%20June%202..> | 2010-10-26 12:05 | 238K | |
![[IMG]](/icons/image2.gif) | NYSE 1210.jpg | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | NYSE Apr 14 2010.jpg | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | NYSE Feb 11 2010.JPG | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | NYSE March 17 2012.jpg | 2012-03-18 21:48 | 53K | |
![[IMG]](/icons/image2.gif) | NYSE weekly Jan.jpg | 2010-10-26 12:05 | 74K | |
![[IMG]](/icons/image2.gif) | Nas 1210.jpg | 2010-10-26 12:05 | 66K | |
![[IMG]](/icons/image2.gif) | Nas Feb 11 2010.JPG | 2010-10-26 12:05 | 43K | |
![[IMG]](/icons/image2.gif) | Nas Feb 14 2011.jpg | 2011-02-14 13:20 | 26K | |
![[IMG]](/icons/image2.gif) | Nas Feb 14a 2011.jpg | 2011-02-14 13:22 | 26K | |
![[IMG]](/icons/image2.gif) | Nasdaq Aug 16 2012.jpg | 2012-08-16 08:50 | 25K | |
![[IMG]](/icons/image2.gif) | Nas weekly Jan.jpg | 2010-10-26 12:05 | 70K | |
![[IMG]](/icons/image2.gif) | Nat gas Sept 2010.gif | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | Nat gas Sept 2010a.gif | 2010-10-26 12:05 | 5.7K | |
![[IMG]](/icons/image2.gif) | National Debt.jpg | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | New Year Bubbly(1).jpg | 2012-01-01 18:10 | 106K | |
![[IMG]](/icons/image2.gif) | New Year Bubbly.jpg | 2012-01-01 04:53 | 106K | |
![[IMG]](/icons/image2.gif) | New Years.jpg | 2012-01-01 04:52 | 98K | |
![[IMG]](/icons/image2.gif) | New_Homes.jpg | 2010-12-13 20:43 | 25K | |
![[ ]](/icons/layout.gif) | Newsletter 7AB(1).pdf | 2010-11-14 22:27 | 1.1M | |
![[ ]](/icons/layout.gif) | Newsletter 7AB.pdf | 2010-11-14 22:27 | 1.1M | |
![[ ]](/icons/layout.gif) | Newsletter 9S-1.pdf | 2010-11-28 01:31 | 1.5M | |
![[ ]](/icons/layout.gif) | Newsletter 9T.pdf | 2010-11-28 12:10 | 1.5M | |
![[ ]](/icons/layout.gif) | Newsletter 9U-1.pdf | 2010-11-28 13:26 | 1.5M | |
![[ ]](/icons/layout.gif) | Newsletter 10R(1).pdf | 2010-12-05 11:57 | 1.2M | |
![[ ]](/icons/layout.gif) | Newsletter 10R.pdf | 2010-12-05 02:07 | 1.2M | |
![[ ]](/icons/layout.gif) | Newsletter 10S.pdf | 2010-12-05 08:38 | 1.2M | |
![[ ]](/icons/layout.gif) | Newsletter 10T(1).pdf | 2010-12-05 12:06 | 1.2M | |
![[ ]](/icons/layout.gif) | Newsletter 10T(2).pdf | 2010-12-05 12:09 | 1.2M | |
![[ ]](/icons/layout.gif) | Newsletter 10T(3).pdf | 2010-12-05 12:33 | 1.2M | |
![[ ]](/icons/layout.gif) | Newsletter 10T.pdf | 2010-12-05 11:32 | 1.2M | |
![[ ]](/icons/layout.gif) | Newsletter 10U(1).pdf | 2010-12-05 16:46 | 1.2M | |
![[ ]](/icons/layout.gif) | Newsletter 10U.pdf | 2010-12-05 16:32 | 1.2M | |
![[ ]](/icons/layout.gif) | Newsletter11W.pdf | 2010-12-12 03:45 | 1.2M | |
![[IMG]](/icons/image2.gif) | Newsletter22 Cartoon..> | 2011-02-27 12:27 | 52K | |
![[IMG]](/icons/image2.gif) | Nik May 23 2010 .jpg | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | Nikk July 27 2010.jpg | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | Nikk Oct 4 2010.JPG | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | Nikkei 032613.jpg | 2013-03-26 08:03 | 55K | |
![[IMG]](/icons/image2.gif) | Nikkei 051713.jpg | 2013-05-17 09:07 | 39K | |
![[IMG]](/icons/image2.gif) | Nikkei May 5 2011.jpg | 2011-05-05 09:25 | 22K | |
![[IMG]](/icons/image2.gif) | No Distribution.png | 2011-06-17 14:57 | 35K | |
![[IMG]](/icons/image2.gif) | No Euros Please.jpg | 2011-12-18 04:43 | 51K | |
![[IMG]](/icons/image2.gif) | NoMoney.jpg | 2011-08-03 01:57 | 25K | |
![[IMG]](/icons/image2.gif) | Nostradamus_by_Cesar..> | 2011-03-23 18:12 | 35K | |
![[IMG]](/icons/image2.gif) | Not Tina.JPG | 2013-04-04 21:08 | 17K | |
![[IMG]](/icons/image2.gif) | OB-BK312_oj_rov_2008..> | 2011-09-08 12:37 | 81K | |
![[IMG]](/icons/image2.gif) | OB-OO229_crt_90_D_20..> | 2011-07-03 16:43 | 12K | |
![[IMG]](/icons/image2.gif) | OB-QD449_9dayra_K_20..> | 2011-10-17 15:59 | 59K | |
![[IMG]](/icons/image2.gif) | OXENGROUP300x115(1).gif | 2010-11-16 12:24 | 9.1K | |
![[IMG]](/icons/image2.gif) | OXENGROUP300x115.gif | 2010-11-16 12:23 | 9.1K | |
![[IMG]](/icons/image2.gif) | Obama-2 - jrdep(1).jpg | 2011-12-19 16:10 | 26K | |
![[IMG]](/icons/image2.gif) | Obama-2 - jrdep.jpg | 2010-12-11 12:58 | 26K | |
![[IMG]](/icons/image2.gif) | Obama Burning Cash1.jpg | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | ObamaEconomy.jpg | 2011-06-08 20:09 | 22K | |
![[IMG]](/icons/image2.gif) | Obama_Snake_Oil-jda.jpg | 2011-10-17 15:54 | 36K | |
![[IMG]](/icons/image2.gif) | Obamamoppingbrow.jpg | 2012-01-31 03:44 | 41K | |
![[IMG]](/icons/image2.gif) | Obamanomics.jpg | 2011-01-15 17:02 | 104K | |
![[IMG]](/icons/image2.gif) | Obamarella.jpg | 2010-10-26 12:05 | 57K | |
![[IMG]](/icons/image2.gif) | Occupy Wall Street P..> | 2011-10-09 05:05 | 67K | |
![[IMG]](/icons/image2.gif) | Off a Cliff.JPG | 2011-08-18 12:51 | 28K | |
![[IMG]](/icons/image2.gif) | Oil 031413(1).jpg | 2013-03-14 08:14 | 27K | |
![[IMG]](/icons/image2.gif) | Oil 031413.jpg | 2013-03-14 07:53 | 27K | |
![[IMG]](/icons/image2.gif) | Oil 2006 to 2009 May..> | 2011-05-25 17:51 | 63K | |
![[IMG]](/icons/image2.gif) | Oil COT 6-24.png | 2011-06-24 13:06 | 38K | |
![[IMG]](/icons/image2.gif) | Oil Dec 28 2011.jpg | 2011-12-28 05:38 | 26K | |
![[IMG]](/icons/image2.gif) | Oil Feb 2011.gif | 2011-01-12 11:23 | 17K | |
![[IMG]](/icons/image2.gif) | Oil Futures 01 11 20..> | 2012-01-11 07:16 | 91K | |
![[IMG]](/icons/image2.gif) | Oil Futures 11 17 20..> | 2011-11-17 07:47 | 26K | |
![[IMG]](/icons/image2.gif) | Oil Futures Dec 13 2..> | 2011-12-13 11:51 | 75K | |
![[IMG]](/icons/image2.gif) | Oil Futures Jan 28 2..> | 2013-01-29 08:13 | 26K | |
![[IMG]](/icons/image2.gif) | Oil Futures July 15 ..> | 2011-07-15 07:41 | 49K | |
![[IMG]](/icons/image2.gif) | Oil Futures June 17 ..> | 2013-06-17 08:23 | 38K | |
![[IMG]](/icons/image2.gif) | Oil Jan 04 2012.jpg | 2012-01-05 07:56 | 26K | |
![[IMG]](/icons/image2.gif) | Oil Lines 12-8-2011.jpg | 2011-12-08 09:54 | 55K | |
![[IMG]](/icons/image2.gif) | Oil March 8 2011.jpg | 2011-03-08 09:12 | 24K | |
![[IMG]](/icons/image2.gif) | Oil March 28 2011.jpg | 2011-03-28 11:23 | 23K | |
![[IMG]](/icons/image2.gif) | Oil Open Interest 20..> | 2011-05-26 15:20 | 37K | |
![[IMG]](/icons/image2.gif) | Oil Prices 11-29-201..> | 2011-11-29 10:13 | 123K | |
![[IMG]](/icons/image2.gif) | Oil Rig Storm.JPG | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | OilWell(1).jpg | 2011-09-15 19:01 | 11K | |
![[IMG]](/icons/image2.gif) | OilWell.jpg | 2011-04-14 18:18 | 11K | |
![[IMG]](/icons/image2.gif) | Oil stocks Aug 10 20..> | 2011-08-10 14:49 | 90K | |
![[IMG]](/icons/image2.gif) | Oil stocks Aug 10 20..> | 2011-08-10 14:50 | 90K | |
![[IMG]](/icons/image2.gif) | Oil stocks Aug 10 20..> | 2011-08-10 14:48 | 90K | |
![[IMG]](/icons/image2.gif) | Oil stocks March 30 ..> | 2011-03-31 08:49 | 25K | |
![[IMG]](/icons/image2.gif) | Oil stocks March 30 ..> | 2011-03-31 08:32 | 25K | |
![[IMG]](/icons/image2.gif) | Oil with Comments Ma..> | 2012-03-22 09:26 | 97K | |
![[IMG]](/icons/image2.gif) | Opec Demand forecast..> | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | Option Strategies.jpg | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | Osama Dead - Still U..> | 2011-05-08 06:11 | 69K | |
![[IMG]](/icons/image2.gif) | P1060551.jpg | 2010-12-23 02:00 | 34K | |
![[IMG]](/icons/image2.gif) | PCLN Chat Feb 25 201..> | 2011-02-25 07:57 | 56K | |
![[IMG]](/icons/image2.gif) | PCLN Oct $350 puts 2..> | 2010-10-16 11:43 | 56K | |
![[IMG]](/icons/image2.gif) | PICASSO.jpg | 2010-12-07 16:51 | 29K | |
![[IMG]](/icons/image2.gif) | PICTURES.jpg | 2010-12-07 16:29 | 63K | |
![[IMG]](/icons/image2.gif) | PLAN.jpg | 2010-12-07 16:52 | 40K | |
![[IMG]](/icons/image2.gif) | PLAT May 21 2010.jpg | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | PLDaRkVk8cwCQUML8aa4..> | 2012-07-18 12:58 | 24K | |
![[IMG]](/icons/image2.gif) | PLX(1).jpg | 2011-07-12 11:19 | 212K | |
![[IMG]](/icons/image2.gif) | PLX.JPG | 2011-07-12 11:18 | 212K | |
![[IMG]](/icons/image2.gif) | POMO1.jpg | 2010-12-05 02:16 | 86K | |
![[IMG]](/icons/image2.gif) | POMO March 10 2011.jpg | 2011-03-10 14:05 | 66K | |
![[IMG]](/icons/image2.gif) | POMO May 11 2011.jpg | 2011-05-11 14:03 | 82K | |
![[IMG]](/icons/image2.gif) | POMO SIGN.jpg | 2010-12-05 02:17 | 127K | |
![[IMG]](/icons/image2.gif) | PRISM-slides300(1).jpg | 2013-06-09 13:25 | 77K | |
![[IMG]](/icons/image2.gif) | PRISM-slides300.jpg | 2013-06-09 13:13 | 77K | |
![[IMG]](/icons/image2.gif) | PSW1.JPG | 2011-04-13 11:56 | 75K | |
![[IMG]](/icons/image2.gif) | PSW Chat Tags March ..> | 2011-03-01 20:33 | 75K | |
![[IMG]](/icons/image2.gif) | PSW Portfolios(1).png | 2012-01-04 13:18 | 19K | |
![[IMG]](/icons/image2.gif) | PSW Portfolios.png | 2012-01-04 13:14 | 19K | |
![[IMG]](/icons/image2.gif) | PSWweek1.gif | 2011-03-25 13:44 | 7.6K | |
![[IMG]](/icons/image2.gif) | PartyOnComrades.gif | 2010-10-26 12:05 | 821K | |
![[IMG]](/icons/image2.gif) | Paulvolcker.jpg | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | Pe.png | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | Peace2-1.jpg | 2010-12-26 17:26 | 79K | |
![[IMG]](/icons/image2.gif) | Pending Homes Oct 20..> | 2010-12-02 10:56 | 65K | |
![[IMG]](/icons/image2.gif) | Pendulum.gif | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | Picture%2042(1).jpg | 2011-09-02 14:45 | 24K | |
![[IMG]](/icons/image2.gif) | Picture%2042.JPG | 2011-09-02 14:41 | 27K | |
![[IMG]](/icons/image2.gif) | Picture%2042.png | 2011-09-02 14:39 | 46K | |
![[IMG]](/icons/image2.gif) | Picture%2047(1).jpg | 2011-09-07 10:30 | 40K | |
![[IMG]](/icons/image2.gif) | Picture%2047.JPG | 2011-09-07 10:27 | 42K | |
![[IMG]](/icons/image2.gif) | Picture%2047.png | 2011-09-07 10:25 | 76K | |
![[IMG]](/icons/image2.gif) | Picture%2048.png | 2011-11-09 13:31 | 41K | |
![[IMG]](/icons/image2.gif) | Picture 1(1).png | 2010-10-26 12:05 | 187K | |
![[IMG]](/icons/image2.gif) | Picture 1(2).png | 2010-10-26 12:05 | 136K | |
![[IMG]](/icons/image2.gif) | Picture 1(3).png | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Picture 1(4).png | 2010-10-26 12:05 | 43K | |
![[IMG]](/icons/image2.gif) | Picture 1(5).png | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Picture 1(6).png | 2010-10-26 12:05 | 38K | |
![[IMG]](/icons/image2.gif) | Picture 1(7).png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | Picture 1(8).png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | Picture 1.png | 2010-10-26 12:05 | 187K | |
![[IMG]](/icons/image2.gif) | Picture 2(1).png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | Picture 2(2).png | 2010-10-26 12:05 | 40K | |
![[IMG]](/icons/image2.gif) | Picture 2(3).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | Picture 2(4).png | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Picture 2(5).png | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | Picture 2.png | 2010-10-26 12:05 | 75K | |
![[IMG]](/icons/image2.gif) | Picture 3(1).png | 2010-10-26 12:05 | 57K | |
![[IMG]](/icons/image2.gif) | Picture 3(2).png | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | Picture 3(3).png | 2010-10-26 12:05 | 7.1K | |
![[IMG]](/icons/image2.gif) | Picture 3(4).png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | Picture 3(5).png | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | Picture 3.png | 2010-10-26 12:05 | 117K | |
![[IMG]](/icons/image2.gif) | Picture 4(1).png | 2010-10-26 12:05 | 125K | |
![[IMG]](/icons/image2.gif) | Picture 4(2).png | 2010-10-26 12:05 | 117K | |
![[IMG]](/icons/image2.gif) | Picture 4(3).png | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Picture 4(4).png | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Picture 4(5).png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | Picture 4(6).png | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Picture 4(7).png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | Picture 4(8).png | 2010-10-26 12:05 | 7.0K | |
![[IMG]](/icons/image2.gif) | Picture 4(9).png | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | Picture 4(10).png | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | Picture 4.png | 2010-10-26 12:05 | 125K | |
![[IMG]](/icons/image2.gif) | Picture 5(1).png | 2010-10-26 12:05 | 119K | |
![[IMG]](/icons/image2.gif) | Picture 5(2).png | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | Picture 5(3).png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | Picture 5.png | 2010-10-26 12:05 | 121K | |
![[IMG]](/icons/image2.gif) | Picture 6(1).png | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | Picture 6(2).png | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Picture 6(3).png | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Picture 6(4).png | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Picture 6.png | 2010-10-26 12:05 | 132K | |
![[IMG]](/icons/image2.gif) | Picture 7(1).png | 2010-10-26 12:05 | 125K | |
![[IMG]](/icons/image2.gif) | Picture 7(2).png | 2010-10-26 12:05 | 125K | |
![[IMG]](/icons/image2.gif) | Picture 7(3).png | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Picture 7(4).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | Picture 7.png | 2010-10-26 12:05 | 121K | |
![[IMG]](/icons/image2.gif) | Picture 8(1).png | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | Picture 8(2).png | 2010-10-26 12:05 | 7.6K | |
![[IMG]](/icons/image2.gif) | Picture 8(3).png | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Picture 8(4).png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | Picture 8(5).png | 2010-10-26 12:05 | 8.4K | |
![[IMG]](/icons/image2.gif) | Picture 8.png | 2010-10-26 12:05 | 63K | |
![[IMG]](/icons/image2.gif) | Picture 9(1).png | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Picture 9.png | 2010-10-26 12:05 | 121K | |
![[IMG]](/icons/image2.gif) | Picture 10(1).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | Picture 10.png | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | Picture 11(1).png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | Picture 11(2).png | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | Picture 11(3).png | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Picture 11(4).png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | Picture 11.png | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Picture 12(1).png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | Picture 12(2).png | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Picture 12.png | 2010-10-26 12:05 | 7.5K | |
![[IMG]](/icons/image2.gif) | Picture 13(1).png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | Picture 13.png | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Picture 14.png | 2010-10-26 12:05 | 37K | |
![[IMG]](/icons/image2.gif) | Picture 15(1).png | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | Picture 15.png | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | Picture 16(1).png | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Picture 16.png | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | Picture 17.png | 2010-10-26 12:05 | 38K | |
![[IMG]](/icons/image2.gif) | Picture 18.png | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Picture205.jpg | 2011-12-20 15:02 | 72K | |
![[IMG]](/icons/image2.gif) | Picture206.png | 2011-11-10 12:12 | 46K | |
![[IMG]](/icons/image2.gif) | Picture208.png | 2011-12-20 15:01 | 185K | |
![[IMG]](/icons/image2.gif) | Picture2015.jpg | 2011-12-21 12:16 | 37K | |
![[IMG]](/icons/image2.gif) | Picture2035(1).jpg | 2011-11-30 13:35 | 116K | |
![[IMG]](/icons/image2.gif) | Picture2035.jpg | 2011-11-16 10:19 | 69K | |
![[IMG]](/icons/image2.gif) | Picture2044.jpg | 2011-11-30 16:20 | 84K | |
![[IMG]](/icons/image2.gif) | Picture2047.JPG | 2011-09-07 10:50 | 40K | |
![[IMG]](/icons/image2.gif) | Picture2063(1).png | 2011-11-22 12:09 | 35K | |
![[IMG]](/icons/image2.gif) | Picture2063.png | 2011-11-22 12:08 | 35K | |
![[IMG]](/icons/image2.gif) | Picture20101(1).png | 2011-12-13 15:56 | 39K | |
![[IMG]](/icons/image2.gif) | Picture20101.png | 2011-12-13 15:55 | 39K | |
![[IMG]](/icons/image2.gif) | Picture20171(1).png | 2011-12-12 14:59 | 110K | |
![[IMG]](/icons/image2.gif) | Picture20171(2).png | 2011-12-12 15:01 | 54K | |
![[IMG]](/icons/image2.gif) | Picture20171.png | 2011-12-12 14:43 | 110K | |
![[IMG]](/icons/image2.gif) | Picture20444.jpg | 2011-12-06 11:56 | 41K | |
![[IMG]](/icons/image2.gif) | Pipeline.JPG | 2011-04-17 17:46 | 64K | |
![[IMG]](/icons/image2.gif) | Pivot IWM May 10 201..> | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | Plume-Map.jpeg | 2012-09-19 17:29 | 103K | |
![[IMG]](/icons/image2.gif) | Predatory Lending.jpg | 2010-10-26 12:05 | 102K | |
![[IMG]](/icons/image2.gif) | Presentation1(1).jpg | 2010-10-26 12:05 | 56K | |
![[IMG]](/icons/image2.gif) | Presentation1(2).jpg | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | Presentation1(3).jpg | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | Presentation1.jpg | 2010-10-26 12:05 | 101K | |
![[IMG]](/icons/image2.gif) | Projection20DailyII.png | 2011-11-23 15:07 | 86K | |
![[IMG]](/icons/image2.gif) | Q.png | 2011-06-21 15:27 | 35K | |
![[IMG]](/icons/image2.gif) | Q1 Prelim GDP.jpg | 2012-04-27 14:39 | 246K | |
![[IMG]](/icons/image2.gif) | QE 3.JPG | 2011-08-18 12:51 | 77K | |
![[IMG]](/icons/image2.gif) | QE3 2 Aug 26 2011.jpg | 2011-08-26 16:27 | 26K | |
![[IMG]](/icons/image2.gif) | QE3 H&S.JPG | 2011-10-03 14:35 | 42K | |
![[IMG]](/icons/image2.gif) | QE3 tracker 1.JPG | 2011-08-26 16:16 | 37K | |
![[IMG]](/icons/image2.gif) | QM April 7 2011.jpg | 2011-04-08 12:07 | 9.5K | |
![[IMG]](/icons/image2.gif) | QM April 7a 2011.jpg | 2011-04-08 12:28 | 9.2K | |
![[IMG]](/icons/image2.gif) | QQQQ Dec 27 2011.jpg | 2010-12-27 13:49 | 24K | |
![[IMG]](/icons/image2.gif) | QQQQ Nov 22 2010.jpg | 2010-11-24 07:58 | 70K | |
![[IMG]](/icons/image2.gif) | QSFT-021210.jpg | 2010-10-26 12:05 | 38K | |
![[IMG]](/icons/image2.gif) | RB Futures 04 11 201..> | 2012-04-12 08:27 | 85K | |
![[IMG]](/icons/image2.gif) | RB Futures 06 14 201..> | 2012-06-15 07:55 | 55K | |
![[IMG]](/icons/image2.gif) | RGR.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | RIMM Dec 10 2011.jpg | 2011-12-10 11:18 | 46K | |
![[IMG]](/icons/image2.gif) | RIMM June 1 2011.jpg | 2011-06-01 11:05 | 58K | |
![[IMG]](/icons/image2.gif) | RNC Slide Show.JPG | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | RUT-4-26-1.png | 2011-04-26 13:51 | 31K | |
![[IMG]](/icons/image2.gif) | RUT-5-10-2.png | 2011-05-11 10:45 | 28K | |
![[IMG]](/icons/image2.gif) | RUT-5-11-1.png | 2011-05-11 12:24 | 30K | |
![[IMG]](/icons/image2.gif) | RUT-5-18-2.png | 2011-05-18 11:16 | 38K | |
![[IMG]](/icons/image2.gif) | RUT 1.png | 2011-06-28 13:34 | 76K | |
![[IMG]](/icons/image2.gif) | RUT 2 Jan 18 2011.jpg | 2011-01-21 11:04 | 33K | |
![[IMG]](/icons/image2.gif) | RUT 60min Triangle B..> | 2011-09-23 13:14 | 88K | |
![[IMG]](/icons/image2.gif) | RUT Feb 11 2010.JPG | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | RUT Mar 12 2011.jpg | 2010-10-26 12:05 | 69K | |
![[IMG]](/icons/image2.gif) | RUT March 17 2012.jpg | 2012-03-18 22:11 | 71K | |
![[IMG]](/icons/image2.gif) | RUT March 20 2012.jpg | 2012-03-20 07:44 | 13K | |
![[IMG]](/icons/image2.gif) | RUT March 30 2012.jpg | 2012-03-30 08:24 | 74K | |
![[IMG]](/icons/image2.gif) | RUT May 27 2010.jpg | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | RUT Nov 2 2011.jpg | 2011-11-03 06:44 | 14K | |
![[IMG]](/icons/image2.gif) | Rambo Lloyd(1).jpg | 2011-11-30 13:25 | 45K | |
![[IMG]](/icons/image2.gif) | Rambo Lloyd(2).jpg | 2011-12-01 12:09 | 45K | |
![[IMG]](/icons/image2.gif) | Rambo Lloyd(3).jpg | 2011-12-29 14:37 | 45K | |
![[IMG]](/icons/image2.gif) | Rambo Lloyd.jpg | 2011-11-22 14:48 | 45K | |
![[IMG]](/icons/image2.gif) | Reactors April 11 20..> | 2011-04-11 07:29 | 18K | |
![[IMG]](/icons/image2.gif) | Real Daily Yield.jpg | 2011-12-06 08:44 | 37K | |
![[IMG]](/icons/image2.gif) | Real Income Growth.jpg | 2012-03-06 07:19 | 31K | |
![[IMG]](/icons/image2.gif) | Recessions.jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | Red Arrow(1).jpg | 2011-08-03 14:21 | 3.8K | |
![[IMG]](/icons/image2.gif) | Red Arrow(2).jpg | 2011-08-18 12:55 | 3.8K | |
![[IMG]](/icons/image2.gif) | Red Arrow.jpg | 2011-07-22 15:21 | 3.8K | |
![[IMG]](/icons/image2.gif) | Rescue Plan(1).jpg | 2012-02-05 05:18 | 46K | |
![[IMG]](/icons/image2.gif) | Rescue Plan.jpg | 2011-07-24 04:01 | 74K | |
![[IMG]](/icons/image2.gif) | Retail Sales.gif | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | Retail Sales Jan 201..> | 2010-10-26 12:05 | 9.3K | |
![[IMG]](/icons/image2.gif) | Retail Sales March 2..> | 2010-10-26 12:05 | 171K | |
![[IMG]](/icons/image2.gif) | Retail Sales Oct 14 ..> | 2011-10-14 08:45 | 21K | |
![[IMG]](/icons/image2.gif) | Retail Sales Sept 20..> | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | Retirement income.jpg | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Riot Map Jan 31 201..> | 2011-01-31 08:05 | 18K | |
![[IMG]](/icons/image2.gif) | RobertReich.jpg | 2010-10-26 12:05 | 9.6K | |
![[IMG]](/icons/image2.gif) | Russell Chart May 3 ..> | 2011-05-03 06:36 | 65K | |
![[IMG]](/icons/image2.gif) | Russell Dec 7, 2011.jpg | 2011-12-07 08:42 | 28K | |
![[IMG]](/icons/image2.gif) | Russell II.JPG | 2011-09-07 11:19 | 27K | |
![[IMG]](/icons/image2.gif) | Russell next 2 weeks..> | 2011-09-07 11:17 | 34K | |
![[IMG]](/icons/image2.gif) | Rut1(1).png | 2011-03-24 14:07 | 64K | |
![[IMG]](/icons/image2.gif) | Rut1.png | 2011-03-24 14:04 | 64K | |
![[IMG]](/icons/image2.gif) | Rut 1209.jpg | 2010-10-26 12:05 | 66K | |
![[IMG]](/icons/image2.gif) | Rut 1209a.jpg | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | Rut 1209b.jpg | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | Ryan Paul Plan April..> | 2011-04-04 15:02 | 39K | |
![[IMG]](/icons/image2.gif) | S&P.JPG | 2010-10-26 12:05 | 38K | |
![[IMG]](/icons/image2.gif) | S&P 11 22 2011.jpg | 2011-11-22 05:22 | 25K | |
![[IMG]](/icons/image2.gif) | S&P 11 24 2011.jpg | 2011-11-23 14:57 | 62K | |
![[IMG]](/icons/image2.gif) | S&P 50 pc.jpg | 2010-10-26 12:05 | 62K | |
![[IMG]](/icons/image2.gif) | S&P 50 pc002.jpg | 2010-10-26 12:05 | 62K | |
![[IMG]](/icons/image2.gif) | S&P April 15 2011.jpg | 2011-04-15 16:00 | 26K | |
![[IMG]](/icons/image2.gif) | S&P Divergence.png | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | S&P Jan 28 2011.jpg | 2011-01-28 12:51 | 18K | |
![[IMG]](/icons/image2.gif) | S&P Negative Outlook..> | 2011-04-24 05:06 | 109K | |
![[IMG]](/icons/image2.gif) | S&P Sept 13 2010.jpg | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | S&P Support.png | 2011-05-02 13:08 | 48K | |
![[IMG]](/icons/image2.gif) | S&P chart 5-1.jpg | 2010-10-26 12:05 | 122K | |
![[IMG]](/icons/image2.gif) | S&P chart 11-11-09.png | 2010-10-26 12:05 | 138K | |
![[IMG]](/icons/image2.gif) | S&P in Euros 031809.png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | S&P vs Oil.png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | SANTA CLOSED.jpg | 2010-12-14 20:12 | 30K | |
![[IMG]](/icons/image2.gif) | SANTA FRAUD.jpg | 2010-12-06 14:22 | 179K | |
![[IMG]](/icons/image2.gif) | SDS March 28 2011.jpg | 2011-03-29 04:20 | 26K | |
![[IMG]](/icons/image2.gif) | SDS March 28a 2011.jpg | 2011-03-29 08:36 | 27K | |
![[IMG]](/icons/image2.gif) | SODA 50613a.jpg | 2013-06-06 09:20 | 17K | |
![[IMG]](/icons/image2.gif) | SONC2.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | SPR 1976-2008 A.GIF | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | SPX-4-25-1.png | 2011-04-25 14:12 | 87K | |
![[IMG]](/icons/image2.gif) | SPX-4-27-2.png | 2011-04-27 12:10 | 49K | |
![[IMG]](/icons/image2.gif) | SPX-4-29-1(1).png | 2011-04-29 11:04 | 49K | |
![[IMG]](/icons/image2.gif) | SPX-4-29-1(2).png | 2011-04-29 11:05 | 49K | |
![[IMG]](/icons/image2.gif) | SPX-4-29-1.png | 2011-04-29 11:02 | 77K | |
![[IMG]](/icons/image2.gif) | SPX-5-10-1.png | 2011-05-10 10:47 | 44K | |
![[IMG]](/icons/image2.gif) | SPX-8-18-2.png | 2011-08-18 12:06 | 46K | |
![[IMG]](/icons/image2.gif) | SPX-10-yr-yield-and-..> | 2012-04-23 20:27 | 112K | |
![[IMG]](/icons/image2.gif) | SPX.png | 2010-11-30 14:02 | 24K | |
![[IMG]](/icons/image2.gif) | SPX 050709.png | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | SPX1.png | 2011-07-07 11:58 | 108K | |
![[IMG]](/icons/image2.gif) | SPX2.png | 2011-07-07 11:59 | 46K | |
![[IMG]](/icons/image2.gif) | SPX4(1).png | 2011-08-18 10:21 | 140K | |
![[IMG]](/icons/image2.gif) | SPX4.png | 2011-08-15 14:08 | 59K | |
![[IMG]](/icons/image2.gif) | SPX8.png | 2011-09-26 13:46 | 45K | |
![[IMG]](/icons/image2.gif) | SPX16.png | 2011-05-19 12:01 | 150K | |
![[IMG]](/icons/image2.gif) | SPX 60min Rising Cha..> | 2011-05-18 09:44 | 66K | |
![[IMG]](/icons/image2.gif) | SPX444.png | 2011-09-09 13:58 | 266K | |
![[IMG]](/icons/image2.gif) | SPX 5911.png | 2011-05-09 13:00 | 32K | |
![[IMG]](/icons/image2.gif) | SPX Apr 14 2011.JPG | 2011-04-14 07:03 | 90K | |
![[IMG]](/icons/image2.gif) | SPX Apr 14a 2011.JPG | 2011-04-14 12:27 | 94K | |
![[IMG]](/icons/image2.gif) | SPX Apr 19 2011.JPG | 2011-04-19 14:35 | 92K | |
![[IMG]](/icons/image2.gif) | SPX Aug 6 2010.jpg | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | SPX Aug 10 2010.jpg | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | SPXAvgDecIntraday_th..> | 2011-12-12 14:49 | 72K | |
![[IMG]](/icons/image2.gif) | SPXAvgDecIntraday_th..> | 2011-12-12 14:57 | 72K | |
![[IMG]](/icons/image2.gif) | SPXAvgDecIntraday_th..> | 2011-12-12 14:33 | 72K | |
![[IMG]](/icons/image2.gif) | SPX CMG chart Nov 1 ..> | 2010-11-01 02:02 | 49K | |
![[IMG]](/icons/image2.gif) | SPX Chart Sept 1 201..> | 2011-09-02 01:02 | 66K | |
![[IMG]](/icons/image2.gif) | SPX Chat Feb 19 2011..> | 2011-02-19 09:41 | 67K | |
![[IMG]](/icons/image2.gif) | SPX DBA June 10.png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | SPX Dec 18 2010.jpg | 2010-12-19 08:39 | 67K | |
![[IMG]](/icons/image2.gif) | SPX Dec 28 2011.jpg | 2011-12-28 07:02 | 65K | |
![[IMG]](/icons/image2.gif) | SPX Dec 28 2011a.jpg | 2011-12-28 07:12 | 64K | |
![[IMG]](/icons/image2.gif) | SPXF.png | 2011-05-17 12:23 | 119K | |
![[IMG]](/icons/image2.gif) | SPX Feb 25 2011(1).jpg | 2011-02-28 07:40 | 28K | |
![[IMG]](/icons/image2.gif) | SPX Feb 25 2011.JPG | 2011-02-28 07:39 | 28K | |
![[IMG]](/icons/image2.gif) | SPX Gold Feb 14 2011..> | 2011-02-14 09:09 | 61K | |
![[IMG]](/icons/image2.gif) | SPX July 8 2010.jpg | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | SPX July 8 2011.jpg | 2011-07-07 08:49 | 69K | |
![[IMG]](/icons/image2.gif) | SPX July 25 2010.jpg | 2010-10-26 12:05 | 62K | |
![[IMG]](/icons/image2.gif) | SPX July 25a 2010.jpg | 2010-10-26 12:05 | 63K | |
![[IMG]](/icons/image2.gif) | SPX June 7 2011.jpg | 2011-06-06 19:59 | 70K | |
![[IMG]](/icons/image2.gif) | SPX June 11 2010.jpg | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | SPX June 11a 2010.jpg | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | SPX June 11b 2010.jpg | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | SPX June 19a 2010.jpg | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | SPX Long Term.png | 2011-06-29 15:32 | 187K | |
![[IMG]](/icons/image2.gif) | SPX Mar 9 2010.jpg | 2010-10-26 12:05 | 102K | |
![[IMG]](/icons/image2.gif) | SPX Mar 12 2010.jpg | 2010-10-26 12:05 | 69K | |
![[IMG]](/icons/image2.gif) | SPX Mar 26 2010.jpg | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | SPX March 9 creash M..> | 2011-03-07 07:55 | 44K | |
![[IMG]](/icons/image2.gif) | SPX March 9 creash M..> | 2011-03-07 07:54 | 44K | |
![[IMG]](/icons/image2.gif) | SPX March 13 2012.jpg | 2012-03-14 09:20 | 23K | |
![[IMG]](/icons/image2.gif) | SPX March 17 2012(1..> | 2012-03-17 08:02 | 73K | |
![[IMG]](/icons/image2.gif) | SPX March 17 2012.jpg | 2012-03-17 07:30 | 74K | |
![[IMG]](/icons/image2.gif) | SPX May 4 2010.jpg | 2010-10-26 12:05 | 66K | |
![[IMG]](/icons/image2.gif) | SPX May 5 2010(1).jpg | 2010-10-26 12:05 | 66K | |
![[IMG]](/icons/image2.gif) | SPX May 5 2010.jpg | 2010-10-26 12:05 | 66K | |
![[IMG]](/icons/image2.gif) | SPX May 5a 2010.jpg | 2010-10-26 12:05 | 88K | |
![[IMG]](/icons/image2.gif) | SPX May 13 2013.jpg | 2013-06-13 08:36 | 67K | |
![[IMG]](/icons/image2.gif) | SPX May 15 2010.jpg | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | SPX May 21 2010.jpg | 2010-10-26 12:05 | 86K | |
![[IMG]](/icons/image2.gif) | SPX May 23 2010(1).jpg | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | SPX May 23 2010.jpg | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | SPX May 23 2011.jpg | 2011-05-22 20:21 | 67K | |
![[IMG]](/icons/image2.gif) | SPX May 23a 2011.JPG | 2011-05-23 15:36 | 45K | |
![[IMG]](/icons/image2.gif) | SPX May 25 2011.jpg | 2011-05-25 15:44 | 60K | |
![[IMG]](/icons/image2.gif) | SPX Nov 27 2010.jpg | 2010-11-27 06:15 | 65K | |
![[IMG]](/icons/image2.gif) | SPX Oct 1 2010.JPG | 2010-10-26 12:05 | 94K | |
![[IMG]](/icons/image2.gif) | SPX Oct 5 2010.png | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | SPX Oil June 2009a.png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | SPX Sept 2 2010.jpg | 2010-10-26 12:05 | 68K | |
![[IMG]](/icons/image2.gif) | SPX Sept 15 2010.jpg | 2010-10-26 12:05 | 106K | |
![[IMG]](/icons/image2.gif) | SPX Sept 26 2011.jpg | 2011-09-26 08:39 | 101K | |
![[IMG]](/icons/image2.gif) | SPX Sept 27 2010.jpg | 2010-10-26 12:05 | 70K | |
![[IMG]](/icons/image2.gif) | SPX Sept 27a 2011.JPG | 2011-09-27 07:13 | 57K | |
![[IMG]](/icons/image2.gif) | SPX Sept 27b 2011.jpg | 2011-09-27 11:03 | 21K | |
![[IMG]](/icons/image2.gif) | SPX Sept 28 2011.jpg | 2010-10-26 12:05 | 67K | |
![[IMG]](/icons/image2.gif) | SPX Sept 30 2010.jpg | 2010-10-26 12:05 | 40K | |
![[IMG]](/icons/image2.gif) | SPX Support.png | 2011-04-18 14:47 | 100K | |
![[IMG]](/icons/image2.gif) | SPX UUP July 7 201..> | 2011-07-06 13:52 | 22K | |
![[IMG]](/icons/image2.gif) | SPX Week and Comment..> | 2011-03-04 08:23 | 45K | |
![[IMG]](/icons/image2.gif) | SPX_Stats_Last_Tradi..> | 2011-07-01 10:01 | 45K | |
![[IMG]](/icons/image2.gif) | SPX_Stats_Last_Tradi..> | 2011-04-29 10:06 | 45K | |
![[IMG]](/icons/image2.gif) | SPX bat.JPG | 2011-09-09 12:18 | 66K | |
![[IMG]](/icons/image2.gif) | SPXgif(1).jpg | 2011-09-01 00:12 | 126K | |
![[IMG]](/icons/image2.gif) | SPXgif(2).jpg | 2011-09-01 12:03 | 126K | |
![[IMG]](/icons/image2.gif) | SPXgif(3).jpg | 2011-09-06 10:18 | 126K | |
![[IMG]](/icons/image2.gif) | SPXgif.JPG | 2011-08-31 11:04 | 126K | |
![[IMG]](/icons/image2.gif) | SPX in Oil Jun 10.png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | SPXtoday(1).png | 2011-04-20 11:10 | 103K | |
![[IMG]](/icons/image2.gif) | SPXtoday.png | 2011-04-20 11:09 | 103K | |
![[IMG]](/icons/image2.gif) | SPY(1).jpg | 2011-09-26 18:48 | 103K | |
![[IMG]](/icons/image2.gif) | SPY(2).jpg | 2011-09-26 18:52 | 103K | |
![[IMG]](/icons/image2.gif) | SPY(3).jpg | 2011-09-26 18:54 | 95K | |
![[IMG]](/icons/image2.gif) | SPY-Volatility-view-..> | 2011-05-26 13:47 | 73K | |
![[IMG]](/icons/image2.gif) | SPY.JPG | 2011-07-19 12:59 | 128K | |
![[IMG]](/icons/image2.gif) | SPY Apr 14 2010.jpg | 2010-10-26 12:05 | 62K | |
![[IMG]](/icons/image2.gif) | SPY Aug 4 2011(1).jpg | 2011-08-04 17:07 | 105K | |
![[IMG]](/icons/image2.gif) | SPY Aug 4 2011(2).jpg | 2011-08-04 17:08 | 105K | |
![[IMG]](/icons/image2.gif) | SPY Aug 4 2011.JPG | 2011-08-04 17:06 | 105K | |
![[IMG]](/icons/image2.gif) | SPY Daily Chart 12-0..> | 2011-12-09 14:55 | 68K | |
![[IMG]](/icons/image2.gif) | SPYDaily_thumb.png | 2011-12-06 12:54 | 12K | |
![[IMG]](/icons/image2.gif) | SPY Dec_ 18 - Dec_ 3..> | 2013-01-06 20:22 | 35K | |
![[IMG]](/icons/image2.gif) | SPY Dec_ 28, 2012 -..> | 2013-01-06 20:23 | 41K | |
![[IMG]](/icons/image2.gif) | SPYFIBbacktest(1).png | 2011-08-31 12:00 | 75K | |
![[IMG]](/icons/image2.gif) | SPYFIBbacktest(2).png | 2011-08-31 12:04 | 75K | |
![[IMG]](/icons/image2.gif) | SPYFIBbacktest.png | 2011-08-31 11:57 | 75K | |
![[IMG]](/icons/image2.gif) | SPY Feb 10 2010.jpg | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | SPY July 15.jpg | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | SPY July 21 2011.jpg | 2011-07-21 14:42 | 40K | |
![[IMG]](/icons/image2.gif) | SPY June 2 yr.png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | SPY Long Term.png | 2011-05-03 13:01 | 87K | |
![[IMG]](/icons/image2.gif) | SPY MA.JPG | 2011-02-06 15:13 | 69K | |
![[IMG]](/icons/image2.gif) | SPY Trends(1).jpg | 2011-02-06 15:16 | 75K | |
![[IMG]](/icons/image2.gif) | SPY Trends.JPG | 2011-02-06 15:15 | 75K | |
![[IMG]](/icons/image2.gif) | SPY Volume Jan 2010.bmp | 2010-10-26 12:05 | 898K | |
![[IMG]](/icons/image2.gif) | SPY Volume Jan 2010a..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | SPY_1hr_520.png | 2011-05-20 15:02 | 82K | |
![[IMG]](/icons/image2.gif) | SPY_15m_525.png | 2011-05-25 14:10 | 95K | |
![[IMG]](/icons/image2.gif) | SPY_15min_67.png | 2011-06-07 12:53 | 78K | |
![[IMG]](/icons/image2.gif) | SPY_April27-2011_5mi..> | 2011-04-27 13:56 | 70K | |
![[IMG]](/icons/image2.gif) | SQUIDFACE.jpg | 2011-01-08 02:55 | 65K | |
![[IMG]](/icons/image2.gif) | SRS.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | SRS8.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | STRANGE LEAK.jpg | 2010-12-14 19:05 | 68K | |
![[ ]](/icons/layout.gif) | SWW June 3 2012 (1)(..> | 2012-06-03 03:09 | 1.1M | |
![[ ]](/icons/layout.gif) | SWW June 3 2012 (1).pdf | 2012-06-03 03:08 | 1.1M | |
![[ ]](/icons/layout.gif) | SWW May 26 2012 - JL..> | 2012-05-27 02:48 | 1.1M | |
![[ ]](/icons/layout.gif) | SWW May 26 2012 Real..> | 2012-05-27 07:14 | 1.3M | |
![[ ]](/icons/layout.gif) | SWW May 26 2012 Real..> | 2012-05-27 07:15 | 1.3M | |
![[ ]](/icons/layout.gif) | SWW May 26 2012 Real..> | 2012-05-27 07:05 | 1.3M | |
![[IMG]](/icons/image2.gif) | SagradaFamiliaDoor.jpeg | 2012-09-23 20:21 | 48K | |
![[IMG]](/icons/image2.gif) | Sam Antar CTV News.jpg | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | Santa Euro Crisis.jpg | 2011-12-11 06:09 | 56K | |
![[IMG]](/icons/image2.gif) | Schwab_serendipityTh..> | 2010-10-26 12:05 | 74K | |
![[IMG]](/icons/image2.gif) | Scott Brown.jpg | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | ScreenHunter_03 Jun_..> | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | ScreenHunter_03 Jun_..> | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | ScreenHunter_04 Jun_..> | 2010-10-26 12:05 | 807 | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-08-..> | 2011-08-04 16:07 | 53K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-08-..> | 2011-08-04 13:32 | 55K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-08-..> | 2011-08-04 16:06 | 55K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-08-..> | 2011-08-04 13:32 | 55K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-08-..> | 2011-08-05 11:11 | 56K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-08-..> | 2011-08-08 10:29 | 59K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-08-..> | 2011-08-08 10:28 | 59K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-08-..> | 2011-08-08 11:35 | 59K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-08-..> | 2011-08-17 11:51 | 14K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-08-..> | 2011-08-18 14:13 | 50K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-08-..> | 2011-08-26 13:16 | 57K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-08-..> | 2011-08-26 13:16 | 57K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-08-..> | 2011-08-26 13:15 | 57K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-09-..> | 2011-09-07 12:14 | 52K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-09-..> | 2011-09-13 08:56 | 61K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-09-..> | 2011-09-13 08:55 | 61K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-09-..> | 2011-09-13 14:10 | 56K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-09-..> | 2011-09-15 11:12 | 61K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-09-..> | 2011-09-15 11:28 | 75K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-09-..> | 2011-09-16 10:28 | 57K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-09-..> | 2011-09-16 10:27 | 57K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-09-..> | 2011-09-21 22:49 | 59K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-10-..> | 2011-10-03 10:09 | 59K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-10-..> | 2011-10-06 15:22 | 59K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-10-..> | 2011-10-07 10:25 | 62K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-10-..> | 2011-10-12 11:25 | 62K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-10-..> | 2011-10-17 12:08 | 57K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-10-..> | 2011-10-17 12:08 | 57K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-10-..> | 2011-10-21 10:56 | 23K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-11-..> | 2011-11-13 14:21 | 103K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-11-..> | 2011-11-13 14:21 | 103K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-11-..> | 2011-11-13 14:22 | 108K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-11-..> | 2011-11-13 14:22 | 101K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2011-11-..> | 2011-11-13 14:23 | 81K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-01-..> | 2012-01-23 14:51 | 215K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-01-..> | 2012-01-23 14:57 | 144K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-01-..> | 2012-01-23 03:50 | 15K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-01-..> | 2012-01-25 02:22 | 359K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-01-..> | 2012-01-29 07:00 | 398K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-01-..> | 2012-01-29 07:07 | 494K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-06 00:32 | 34K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-22 16:39 | 394K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-22 16:38 | 394K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-23 14:14 | 200K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-26 07:22 | 171K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:08 | 315K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:15 | 138K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:08 | 138K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:09 | 115K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:15 | 115K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:09 | 115K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:15 | 143K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:06 | 302K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:10 | 140K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:10 | 147K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:08 | 147K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:07 | 112K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:07 | 112K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:06 | 91K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:06 | 181K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:05 | 192K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:05 | 96K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:33 | 40K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 20:33 | 94K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-28 13:42 | 59K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 21:35 | 220K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 21:34 | 130K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-27 21:35 | 183K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-28 00:33 | 176K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-28 00:32 | 176K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-02-..> | 2012-02-28 12:15 | 250K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-03-..> | 2012-03-04 17:24 | 366K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-03-..> | 2012-03-04 06:10 | 366K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-03-..> | 2012-03-09 03:48 | 204K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-03-..> | 2012-03-13 21:17 | 12K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-03-..> | 2012-03-14 02:55 | 214K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-03-..> | 2012-11-08 17:53 | 70K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-03-..> | 2013-03-11 20:41 | 70K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-03-..> | 2013-05-13 11:41 | 70K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-03-..> | 2012-03-24 02:43 | 70K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-03-..> | 2012-03-29 02:11 | 119K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-03-..> | 2012-03-31 00:46 | 191K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-03-..> | 2012-03-31 03:20 | 261K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-04-..> | 2012-04-03 19:49 | 183K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-04-..> | 2012-04-05 21:05 | 361K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-04-..> | 2012-04-09 21:41 | 73K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-04-..> | 2012-04-11 16:07 | 43K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-04-..> | 2012-04-11 05:17 | 43K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-04-..> | 2012-04-23 12:14 | 127K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-04-..> | 2012-04-23 12:13 | 172K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-04-..> | 2012-04-26 22:02 | 113K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-04-..> | 2012-04-26 22:01 | 143K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-04-..> | 2012-04-27 20:46 | 139K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-05-..> | 2012-05-10 19:40 | 41K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-05-..> | 2012-05-26 21:18 | 108K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-06-..> | 2012-06-03 03:10 | 647K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-06-..> | 2012-06-10 00:01 | 356K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-06-..> | 2012-06-17 01:21 | 441K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-06-..> | 2012-06-24 03:58 | 298K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-06-..> | 2012-07-01 00:39 | 515K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-07-..> | 2012-07-08 04:21 | 249K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-07-..> | 2012-07-09 13:31 | 76K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-07-..> | 2012-07-09 13:31 | 176K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-07-..> | 2012-07-09 13:32 | 145K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-07-..> | 2012-07-09 13:33 | 84K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-07-..> | 2012-07-15 04:28 | 571K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-07-..> | 2012-07-21 14:47 | 23K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-07-..> | 2012-07-22 04:58 | 763K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-07-..> | 2012-07-29 00:09 | 587K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-07-..> | 2012-07-28 15:44 | 135K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-07-..> | 2012-07-30 13:28 | 183K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-07-..> | 2012-07-31 18:05 | 98K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-01 13:27 | 247K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-01 13:26 | 243K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-01 13:29 | 203K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-01 13:30 | 154K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-02 14:54 | 249K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-05 05:34 | 457K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-07 19:39 | 80K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-07 19:36 | 561K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-12-08 15:10 | 406K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-07 19:40 | 419K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-08 16:17 | 166K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-10-18 14:43 | 166K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2013-03-11 20:42 | 166K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-07 18:37 | 166K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-09 13:51 | 337K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-09 13:55 | 493K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-11 17:15 | 175K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-12 07:15 | 448K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-17 15:13 | 92K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-14 14:00 | 86K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-15 15:25 | 159K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-17 19:59 | 277K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-17 15:13 | 244K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-20 13:07 | 138K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-24 17:43 | 131K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-24 19:40 | 89K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-08-..> | 2012-08-28 17:21 | 322K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-01 11:26 | 199K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-04 19:02 | 157K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-10 21:49 | 60K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-12 16:43 | 161K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-12 05:53 | 218K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-12 05:55 | 399K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-14 05:08 | 343K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-16 05:12 | 116K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-17 16:39 | 268K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-18 13:40 | 144K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-19 20:21 | 109K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-20 15:46 | 122K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-20 15:23 | 122K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-20 15:56 | 207K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-24 18:49 | 290K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-24 19:24 | 269K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-10-09 13:32 | 102K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-25 22:08 | 102K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-26 03:09 | 67K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-26 02:48 | 67K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-26 21:15 | 88K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-09-..> | 2012-09-30 04:43 | 236K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-03 14:31 | 64K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-03 14:36 | 133K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-03 14:37 | 72K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-03 15:30 | 160K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-04 19:51 | 90K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-04 14:32 | 172K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-04 03:42 | 110K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-05 17:47 | 16K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-05 21:40 | 199K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-05 13:01 | 28K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-05 13:04 | 173K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-05 13:06 | 186K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-05 13:42 | 181K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-07 17:02 | 178K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-08 15:33 | 45K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-09 17:07 | 28K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-10 19:29 | 68K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-11 00:48 | 116K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-12 16:12 | 28K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-12 02:58 | 46K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-12 16:14 | 79K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-12 18:35 | 65K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-12 15:32 | 97K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-12 15:47 | 141K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-14 12:04 | 105K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-17 15:12 | 298K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-21 11:06 | 152K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-21 12:29 | 162K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-23 18:17 | 54K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-23 18:19 | 54K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-23 18:15 | 54K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-23 18:22 | 341K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-23 19:19 | 145K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-25 16:32 | 384K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-25 16:55 | 83K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-26 16:58 | 133K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-26 05:23 | 71K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-29 16:26 | 372K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-31 17:27 | 61K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-29 18:40 | 61K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-29 20:42 | 160K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-29 15:36 | 107K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-30 05:13 | 87K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-31 13:46 | 220K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-30 22:17 | 220K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-31 04:10 | 365K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-10-..> | 2012-10-31 17:28 | 23K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-02 17:15 | 452K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-03 16:04 | 158K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-03 17:58 | 311K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-03 15:34 | 211K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-05 20:05 | 140K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-05 11:26 | 173K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-05 15:03 | 392K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-07 05:13 | 166K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-07 19:26 | 130K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-07 21:07 | 51K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-07 22:49 | 126K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-08 18:59 | 285K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-08 17:57 | 60K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-08 03:43 | 60K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-11 19:17 | 90K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-15 19:44 | 221K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-16 19:00 | 397K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-16 19:03 | 381K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-16 21:30 | 158K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-18 21:05 | 259K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-19 20:01 | 165K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-19 20:01 | 165K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-19 14:58 | 93K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-21 04:30 | 120K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-26 22:36 | 226K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-11-..> | 2012-11-28 03:53 | 298K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-01 18:25 | 343K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-01 20:20 | 76K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-03 06:26 | 19K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-04 15:38 | 185K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-05 19:59 | 74K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-05 22:56 | 292K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-07 14:30 | 192K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-08 04:46 | 158K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-08 04:47 | 158K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-08 17:10 | 224K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-09 17:26 | 144K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-15 03:35 | 280K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-16 05:07 | 114K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-22 01:28 | 90K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-23 04:45 | 187K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-24 06:21 | 25K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2012-12-..> | 2012-12-25 18:51 | 116K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-01 11:55 | 342K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-06 03:31 | 143K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-08 22:34 | 74K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-10 03:06 | 83K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-13 05:09 | 129K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-13 05:14 | 86K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-14 16:37 | 125K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-14 04:48 | 129K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-14 04:45 | 129K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-16 21:07 | 129K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-19 18:55 | 170K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-19 19:27 | 185K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-20 07:11 | 428K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-22 04:13 | 699K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-22 04:41 | 48K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-22 04:45 | 220K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-22 04:50 | 29K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-24 18:11 | 69K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-24 18:13 | 61K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-26 00:15 | 45K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-25 15:47 | 199K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-26 19:18 | 83K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-30 02:43 | 231K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-30 16:35 | 286K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-31 20:18 | 358K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-01-..> | 2013-01-31 20:16 | 358K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-02-..> | 2013-02-01 05:17 | 74K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-02-..> | 2013-02-12 00:47 | 127K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-02-..> | 2013-02-19 01:36 | 37K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-02-..> | 2013-02-22 21:19 | 54K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-03-..> | 2013-03-03 13:31 | 143K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-03-..> | 2013-03-18 16:54 | 128K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-03-..> | 2013-03-24 15:34 | 137K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-03-..> | 2013-03-29 18:34 | 406K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-03-..> | 2013-03-29 18:24 | 406K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-04 00:29 | 170K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-03 13:26 | 34K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-05 16:35 | 111K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-05 18:31 | 563K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-07 19:53 | 175K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-08 11:30 | 81K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-16 12:34 | 173K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-14 02:38 | 173K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-14 13:36 | 120K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-17 17:29 | 299K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-17 22:51 | 379K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-17 12:54 | 202K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-17 13:58 | 90K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-18 16:06 | 373K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-18 19:42 | 97K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-18 20:48 | 189K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-19 15:22 | 42K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-20 13:36 | 68K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-23 17:16 | 110K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-24 16:33 | 56K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-24 17:11 | 127K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-24 15:39 | 95K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-25 18:23 | 23K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-25 18:58 | 273K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-25 11:26 | 68K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-25 15:29 | 252K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-26 11:05 | 170K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-26 11:18 | 196K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-26 12:05 | 203K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-26 14:48 | 41K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-27 12:43 | 226K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-28 17:45 | 36K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-04-..> | 2013-04-29 10:57 | 81K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-01 23:59 | 250K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-02 18:41 | 56K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-03 19:37 | 70K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-03 13:19 | 167K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-06 15:26 | 215K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-09 16:54 | 122K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-14 12:56 | 15K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-15 11:58 | 76K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-15 14:35 | 191K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-15 15:51 | 236K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-15 15:53 | 349K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-17 10:23 | 102K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-18 12:57 | 118K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-20 20:04 | 144K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-20 21:10 | 90K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-20 12:44 | 24K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-22 21:01 | 142K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-26 01:49 | 101K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-30 17:03 | 44K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-30 20:26 | 57K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-30 13:20 | 263K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-05-..> | 2013-05-31 16:17 | 385K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-03 00:22 | 119K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-03 17:24 | 59K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-04 17:07 | 417K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-05 23:22 | 436K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-05 23:04 | 436K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-05 12:45 | 187K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-06 11:01 | 119K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-08 16:16 | 28K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-10 13:25 | 312K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-10 14:05 | 116K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-11 16:13 | 33K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-11 23:46 | 87K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-11 15:13 | 98K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-13 11:22 | 106K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-16 01:01 | 94K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-17 18:27 | 86K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-18 17:39 | 50K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-18 23:42 | 94K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-20 18:39 | 101K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-20 23:27 | 177K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-21 01:03 | 206K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-21 18:37 | 309K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-24 18:06 | 201K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-26 20:15 | 233K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-27 00:57 | 294K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-26 14:40 | 99K | |
![[IMG]](/icons/image2.gif) | Screen Shot 2013-06-..> | 2013-06-30 01:36 | 127K | |
![[IMG]](/icons/image2.gif) | Screen shot 2.png | 2011-03-14 17:54 | 81K | |
![[IMG]](/icons/image2.gif) | Screen shot 2at 1_01..> | 2010-10-26 12:05 | 254K | |
![[IMG]](/icons/image2.gif) | Screen shot 3 PM(1).png | 2011-03-14 17:55 | 31K | |
![[IMG]](/icons/image2.gif) | Screen shot 3 PM.png | 2011-03-14 17:55 | 31K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-09-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-09-..> | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-09-..> | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-09-..> | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-09-..> | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-09-..> | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-09-..> | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-10-..> | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-10-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-10-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-10-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-10-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-10-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-11-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-11-..> | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-11-..> | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-11-..> | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-11-..> | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-11-..> | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-11-..> | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-11-..> | 2010-10-26 12:05 | 141K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-12-..> | 2010-10-26 12:05 | 38K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-12-..> | 2010-10-26 12:05 | 60K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-12-..> | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-12-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-12-..> | 2010-10-26 12:05 | 58K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-12-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-12-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-12-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-12-..> | 2010-10-26 12:05 | 34K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-12-..> | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-12-..> | 2010-10-26 12:05 | 38K | |
![[IMG]](/icons/image2.gif) | Screen shot 2009-12-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 8.4K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 101K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-01-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 136K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 317K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 190K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 184K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 170K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 170K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 163K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 183K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 183K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 183K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 158K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 158K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 158K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 303K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 306K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 121K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 268K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 202K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 203K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 93K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 182K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 279K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 382K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 78K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 78K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 117K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 136K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 250K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 6.0K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 260K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 208K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 234K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 62K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 115K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 113K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 139K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 139K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 235K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 165K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 161K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 409K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 409K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-02-..> | 2010-10-26 12:05 | 73K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 136K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 148K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 148K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 148K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 96K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 96K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 96K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 220K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 253K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 243K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 56K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 246K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 246K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 120K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 66K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 87K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 147K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 78K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 59K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 64K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 196K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 177K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 236K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 236K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 235K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 103K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 110K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 109K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 96K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 96K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 120K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 277K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 367K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 297K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 288K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 216K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 6.0K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 166K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 166K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 166K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 6.1K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 129K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 126K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 121K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 116K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 109K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 106K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 113K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 60K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 60K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 60K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 79K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 89K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 89K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 89K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 10K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 126K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 112K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 69K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 87K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 191K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 202K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 237K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 137K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 179K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 179K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 155K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 179K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 199K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 158K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 196K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 196K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 62K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 74K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 114K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 77K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 110K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 106K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 97K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 44K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 59K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 161K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 208K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 107K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 177K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 183K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 77K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 77K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 77K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 202K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 115K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 215K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 178K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 94K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 94K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 94K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 103K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 87K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 159K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 183K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-03-..> | 2010-10-26 12:05 | 119K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 101K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-11-17 16:01 | 213K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-01-06 19:07 | 213K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-03-10 18:45 | 213K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-03-19 14:14 | 213K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-07-11 22:59 | 213K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-08-27 14:14 | 213K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-10-08 02:11 | 213K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-10-19 12:30 | 213K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-11-23 02:57 | 213K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-11-26 17:34 | 213K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-11-16 10:07 | 213K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 119K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 115K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-03-24 16:44 | 91K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 76K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 154K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-11-07 16:11 | 293K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-02-15 11:37 | 293K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-09-30 20:03 | 293K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 293K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 152K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 152K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 78K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-11-16 10:11 | 148K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 148K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 272K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-02-23 21:14 | 146K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-02-24 00:57 | 146K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 146K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 148K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 56K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 56K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 313K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-02-16 20:10 | 89K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-03-24 01:13 | 89K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 89K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 167K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 94K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 119K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 164K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 222K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 216K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 183K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 143K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 143K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 155K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 155K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 233K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 137K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 88K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 213K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 136K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 95K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 95K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 106K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 106K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 179K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 179K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 179K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 78K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 78K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 129K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 141K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 132K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 159K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 181K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 129K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 129K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 102K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 102K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 143K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 130K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 94K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 123K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 341K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 357K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 165K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 165K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 165K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 165K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 165K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 130K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 126K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 162K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 184K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 184K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 184K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-09-05 23:24 | 78K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 78K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 145K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 70K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 70K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 127K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 154K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 136K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 124K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 180K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 195K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 158K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 189K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 142K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 142K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 142K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 158K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 158K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 89K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 89K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 98K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 239K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 239K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 96K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 108K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-03-21 18:16 | 111K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 111K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 158K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 58K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 108K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 108K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 121K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 123K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2011-03-24 16:49 | 126K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-04-..> | 2010-10-26 12:05 | 126K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 229K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2011-03-25 22:14 | 229K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 229K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2011-09-15 20:31 | 109K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 109K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 158K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 6.0K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 156K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 147K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 147K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 150K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 155K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 89K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 76K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-11-13 22:54 | 146K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-11-17 19:30 | 146K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-11-17 19:34 | 146K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2011-02-16 16:38 | 146K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2011-03-24 16:47 | 146K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2011-12-12 14:02 | 146K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 146K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 121K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 121K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 104K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 147K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 72K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 145K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 88K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 88K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 158K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 104K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 189K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 189K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 182K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 109K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 251K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 109K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 148K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 319K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 319K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 563K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 109K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 166K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 166K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 168K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 111K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 118K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 210K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 210K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 792K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 87K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 153K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 86K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 113K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 63K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 63K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 141K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 223K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 183K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 283K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 89K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 89K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 62K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 137K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 99K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 99K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 72K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 110K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 110K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 77K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 77K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 131K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 97K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 151K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 131K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 110K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 95K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 122K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 143K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 156K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 171K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 143K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 99K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 230K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 230K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 196K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 214K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 105K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 152K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 222K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 222K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 180K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 106K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 76K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 117K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 91K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 91K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 115K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 160K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 5.9K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 320K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-05-..> | 2010-10-26 12:05 | 77K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 110K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 110K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 144K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 111K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 148K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 180K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 180K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 152K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 139K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 79K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 253K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 84K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 143K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 94K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 169K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 169K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 158K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 158K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 122K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 146K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 158K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 158K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 101K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 390K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 64K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 244K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 244K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 63K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 141K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 141K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 180K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 151K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 157K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 34K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 100K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 152K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 142K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 142K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 153K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 141K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 109K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 153K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 137K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 117K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 179K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 76K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 43K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 106K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 136K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 218K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 168K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 123K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 184K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 145K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 145K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 119K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 188K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 147K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 151K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 76K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 44K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 75K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 156K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 156K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 106K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 136K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 259K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 184K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 184K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 146K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 146K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 146K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 44K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 150K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 150K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-06-..> | 2010-10-26 12:05 | 150K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 190K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 129K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 72K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 151K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 151K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 151K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 143K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 159K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 124K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 168K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 126K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 255K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 152K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 152K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 152K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 152K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 152K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 152K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 152K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 152K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 185K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 194K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 181K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 181K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 67K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 95K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 67K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 269K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 143K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 76K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 76K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 134K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 59K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 175K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 175K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 72K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 129K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 183K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 157K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 121K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 140K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 175K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 350K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 147K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 147K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 72K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 141K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 141K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 57K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 117K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 191K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 34K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 73K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 80K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 151K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 179K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 191K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 72K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 517K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 112K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 151K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 151K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 43K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 137K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 129K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 66K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 66K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 179K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-07-..> | 2010-10-26 12:05 | 179K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 103K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 68K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 68K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 57K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 72K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 40K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 235K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 235K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 235K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 235K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 70K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 125K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 125K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 69K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 208K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 208K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 103K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 71K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 66K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 153K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 44K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 87K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 69K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 44K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 151K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 103K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 144K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 44K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-08-..> | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 364K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 272K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 147K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 43K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 69K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 43K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 43K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 43K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 74K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 74K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 226K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 40K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-09-..> | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 72K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 43K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 40K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 38K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-15 22:26 | 39K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-15 22:31 | 40K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-15 22:38 | 68K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-18 10:52 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-19 11:02 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-20 09:27 | 26K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-20 12:12 | 40K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-20 12:13 | 40K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-21 10:03 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-22 15:56 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-22 13:28 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-25 10:51 | 26K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-27 10:27 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-27 11:15 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-27 13:18 | 12K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-28 10:17 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-28 12:40 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-28 11:47 | 126K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-28 11:51 | 126K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-28 11:37 | 126K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-28 11:57 | 177K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-28 11:48 | 177K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-28 11:59 | 166K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-28 11:48 | 166K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-28 12:02 | 174K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-10-..> | 2010-10-28 12:10 | 140K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-01 14:43 | 39K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-01 20:15 | 196K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-01 12:48 | 71K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-01 12:49 | 78K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-02 10:02 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-03 10:22 | 116K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-03 14:22 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-04 11:44 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-05 11:48 | 43K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-09 12:01 | 50K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-10 10:41 | 43K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-11 13:23 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-12 10:37 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-14 00:31 | 363K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-15 09:10 | 36K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-15 11:23 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-15 11:58 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-15 12:36 | 44K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-16 09:38 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-17 10:26 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-17 14:39 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-18 15:48 | 61K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-19 10:57 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-19 11:13 | 41K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-24 11:42 | 43K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-11-..> | 2010-11-30 10:48 | 41K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-12-..> | 2010-12-19 03:49 | 138K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-12-..> | 2010-12-28 10:58 | 43K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-12-..> | 2010-12-28 23:22 | 25K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-12-..> | 2010-12-28 23:22 | 62K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-12-..> | 2010-12-28 23:23 | 25K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-12-..> | 2010-12-28 23:23 | 165K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-12-..> | 2010-12-28 23:23 | 37K | |
![[IMG]](/icons/image2.gif) | Screen shot 2010-12-..> | 2010-12-28 14:50 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-04 09:56 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-04 15:21 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-06 20:29 | 284K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-12 11:17 | 22K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-12 11:17 | 24K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-14 19:38 | 53K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-14 19:37 | 55K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-17 17:46 | 81K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-17 17:46 | 31K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-20 16:25 | 40K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-20 16:30 | 40K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-21 14:22 | 929K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-21 14:29 | 240K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-22 20:18 | 122K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-26 11:45 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-26 12:03 | 22K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-26 12:04 | 29K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-27 10:08 | 31K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-27 14:35 | 37K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-28 10:49 | 23K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-01-..> | 2011-01-28 11:53 | 24K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-02-..> | 2011-02-01 10:36 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-02-..> | 2011-02-02 14:03 | 41K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-02-..> | 2011-02-04 09:56 | 32K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-02-..> | 2011-02-06 03:37 | 219K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-02-..> | 2011-02-06 03:38 | 219K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-02-..> | 2011-02-06 03:31 | 219K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-02-..> | 2011-02-11 11:19 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-02-..> | 2011-02-13 05:59 | 85K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-02 11:17 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-02 11:58 | 10K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-04 10:41 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-07 14:16 | 147K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-07 14:36 | 20K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-07 14:38 | 215K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-08 12:11 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-08 12:13 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-08 12:42 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-09 20:23 | 41K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-10 02:24 | 83K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-10 15:53 | 200K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-11 13:18 | 489K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-11 13:23 | 383K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-11 13:25 | 495K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-11 13:19 | 520K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-11 13:31 | 512K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-13 22:27 | 607K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-14 17:46 | 75K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-14 17:52 | 75K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-14 17:46 | 75K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-14 17:47 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-14 17:47 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-15 10:02 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-15 11:14 | 12K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-16 17:03 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-17 16:05 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-17 10:29 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-18 11:02 | 61K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-21 16:09 | 145K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-19 15:11 | 140K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-22 10:58 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-22 11:10 | 66K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-22 10:58 | 66K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-22 11:26 | 67K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-23 10:35 | 137K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-03-24 01:38 | 220K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-03-..> | 2011-04-01 01:15 | 111K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-04-..> | 2011-04-01 09:18 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-04-..> | 2011-04-06 09:45 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-04-..> | 2011-04-12 10:07 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-04-..> | 2011-04-13 16:06 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-04-..> | 2011-04-17 13:03 | 368K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-04-..> | 2011-04-19 15:23 | 154K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-04-..> | 2011-04-19 15:27 | 160K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-04-..> | 2011-04-21 16:04 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-04-..> | 2011-04-21 10:57 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-04-..> | 2011-04-28 11:33 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-04-..> | 2011-04-28 11:34 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-04-..> | 2011-04-29 10:18 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-05-..> | 2011-05-02 12:40 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-05-..> | 2011-05-17 11:04 | 64K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-05-..> | 2011-05-18 15:32 | 47K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-05-..> | 2011-05-20 12:33 | 21K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-05-..> | 2011-05-23 15:37 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-10 16:21 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-06 15:38 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-07 12:04 | 84K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-09 16:03 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-10 09:41 | 45K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-10 10:15 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-13 10:25 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-13 11:04 | 32K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-13 15:38 | 43K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-15 10:55 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-15 15:20 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-16 16:02 | 44K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-16 14:55 | 44K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-22 10:47 | 52K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-22 10:48 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-23 11:05 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-23 12:34 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-24 12:42 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-28 10:45 | 49K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-29 11:08 | 48K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-06-..> | 2011-06-29 11:31 | 27K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-05 20:55 | 44K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-05 20:55 | 44K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-05 20:54 | 44K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-12 14:29 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-18 13:25 | 9.2K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-18 13:26 | 25K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-19 10:31 | 55K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-19 10:31 | 46K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-19 10:32 | 43K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-20 10:42 | 12K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-20 10:43 | 24K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-20 10:43 | 24K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-20 11:00 | 17K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-20 11:01 | 21K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-27 21:23 | 134K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-07-..> | 2011-07-28 13:52 | 148K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-08-..> | 2011-08-02 22:40 | 256K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-08-..> | 2011-08-02 22:42 | 237K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-08-..> | 2011-08-02 22:50 | 235K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-08-..> | 2011-08-15 15:14 | 18K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-08-..> | 2011-08-19 16:34 | 187K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-08-..> | 2011-08-29 16:01 | 422K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-08-..> | 2011-08-21 06:42 | 422K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-08-..> | 2011-08-22 14:22 | 312K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-08-..> | 2011-08-23 11:03 | 433K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-08-..> | 2011-08-23 11:02 | 433K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-10-..> | 2011-10-11 13:00 | 398K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-10-..> | 2011-10-25 11:33 | 172K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-10-..> | 2011-10-25 13:10 | 299K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-10-..> | 2011-10-25 13:09 | 299K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-11-..> | 2011-11-03 13:06 | 73K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-11-..> | 2011-11-16 16:12 | 25K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-11-..> | 2011-11-24 20:08 | 208K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-12-..> | 2011-12-05 13:02 | 51K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-12-..> | 2011-12-09 14:02 | 130K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-12-..> | 2011-12-09 14:01 | 144K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-12-..> | 2011-12-14 15:30 | 134K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-12-..> | 2011-12-14 15:35 | 234K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-12-..> | 2011-12-14 15:18 | 171K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-12-..> | 2011-12-14 15:43 | 202K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-12-..> | 2011-12-28 23:13 | 21K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-12-..> | 2011-12-28 23:37 | 238K | |
![[IMG]](/icons/image2.gif) | Screen shot 2011-12-..> | 2011-12-30 15:34 | 379K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-01-..> | 2012-01-18 17:04 | 165K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-02-..> | 2012-02-06 20:01 | 216K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-02-..> | 2012-02-06 20:09 | 114K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-02-..> | 2012-02-07 14:58 | 206K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-03-..> | 2012-03-06 16:09 | 436K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-03-..> | 2012-03-06 15:03 | 274K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-03-..> | 2012-03-07 17:00 | 195K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-03-..> | 2012-03-07 18:41 | 297K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-03-..> | 2012-03-10 14:30 | 109K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-03-..> | 2012-03-19 14:30 | 77K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-03-..> | 2012-03-29 17:56 | 1.1M | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-03-..> | 2012-03-29 17:44 | 1.1M | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-03-..> | 2012-03-27 17:33 | 40K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-03-..> | 2012-03-27 17:33 | 35K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-03-..> | 2012-04-10 15:21 | 169K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-03-..> | 2012-03-30 16:40 | 169K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-04-..> | 2012-04-04 16:18 | 334K | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-04-..> | 2012-04-10 16:12 | 1.0M | |
![[IMG]](/icons/image2.gif) | Screen shot 2012-04-..> | 2012-04-10 16:03 | 264K | |
![[IMG]](/icons/image2.gif) | Seal(1).jpeg | 2012-09-19 17:31 | 90K | |
![[IMG]](/icons/image2.gif) | Seal-Map.jpeg | 2012-09-19 17:31 | 101K | |
![[IMG]](/icons/image2.gif) | Seal.jpeg | 2012-09-19 17:29 | 90K | |
![[IMG]](/icons/image2.gif) | Seeking Alpha Page A..> | 2013-06-23 12:56 | 14K | |
![[IMG]](/icons/image2.gif) | Sell Signal.png | 2011-09-22 13:48 | 236K | |
![[IMG]](/icons/image2.gif) | Sell Snow.jpg | 2011-05-11 12:10 | 9.4K | |
![[IMG]](/icons/image2.gif) | September 13 Econoda..> | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | September Dozen Sept..> | 2010-10-26 12:05 | 98K | |
![[IMG]](/icons/image2.gif) | Sham Theory.jpg | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | Shanghai Jan 12 2011..> | 2011-01-12 07:37 | 34K | |
![[IMG]](/icons/image2.gif) | Shanghai Jan 12 2011..> | 2011-01-12 07:37 | 34K | |
![[IMG]](/icons/image2.gif) | Shanghai Jan 12a 201..> | 2011-01-12 07:38 | 33K | |
![[IMG]](/icons/image2.gif) | Shanghai Jan 14 2011..> | 2011-01-14 08:14 | 36K | |
![[IMG]](/icons/image2.gif) | Shanghai et al Jan.jpg | 2010-10-26 12:05 | 34K | |
![[IMG]](/icons/image2.gif) | SharpChartv05.png | 2010-10-26 12:05 | 5.1K | |
![[IMG]](/icons/image2.gif) | Sheep on Wall Street..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | Sideways-200-284.png | 2011-01-06 14:20 | 50K | |
![[IMG]](/icons/image2.gif) | Silver April 26 2011..> | 2011-04-26 08:04 | 22K | |
![[IMG]](/icons/image2.gif) | Silver Dec 22 2011.jpg | 2011-12-22 13:49 | 13K | |
![[IMG]](/icons/image2.gif) | Silver and Gold May ..> | 2011-05-25 17:17 | 29K | |
![[IMG]](/icons/image2.gif) | Singapore Report Jul..> | 2011-07-14 09:49 | 41K | |
![[IMG]](/icons/image2.gif) | Slide2.JPG | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | Slide3.JPG | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | Slide4.JPG | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | Slide5.JPG | 2010-10-26 12:05 | 60K | |
![[IMG]](/icons/image2.gif) | Slide6(1).jpg | 2010-10-26 12:05 | 68K | |
![[IMG]](/icons/image2.gif) | Slide6.JPG | 2010-10-26 12:05 | 68K | |
![[IMG]](/icons/image2.gif) | Slide7.JPG | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | Slide8.JPG | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | Slide9.JPG | 2010-10-26 12:05 | 64K | |
![[IMG]](/icons/image2.gif) | Slide10.JPG | 2010-10-26 12:05 | 68K | |
![[IMG]](/icons/image2.gif) | Slide11.JPG | 2010-10-26 12:05 | 64K | |
![[IMG]](/icons/image2.gif) | Slide12.JPG | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | Slide13.JPG | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | Slide14.JPG | 2010-10-26 12:05 | 76K | |
![[IMG]](/icons/image2.gif) | Slide15.JPG | 2010-10-26 12:05 | 81K | |
![[IMG]](/icons/image2.gif) | Slide16.JPG | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | Slide17(1).jpg | 2010-10-26 12:05 | 71K | |
![[IMG]](/icons/image2.gif) | Slide17.JPG | 2010-10-26 12:05 | 71K | |
![[IMG]](/icons/image2.gif) | Slide18.JPG | 2010-10-26 12:05 | 63K | |
![[IMG]](/icons/image2.gif) | Slide19.JPG | 2010-10-26 12:05 | 71K | |
![[IMG]](/icons/image2.gif) | Slide20.JPG | 2010-10-26 12:05 | 71K | |
![[IMG]](/icons/image2.gif) | Slide21.JPG | 2010-10-26 12:05 | 95K | |
![[IMG]](/icons/image2.gif) | Slippery-Slope-e1353..> | 2013-04-22 17:12 | 9.0K | |
![[IMG]](/icons/image2.gif) | Slippery-Slope-e1353..> | 2012-11-26 22:43 | 9.0K | |
![[IMG]](/icons/image2.gif) | SmellsWalgreens 008(..> | 2010-11-08 18:00 | 35K | |
![[IMG]](/icons/image2.gif) | SmellsWalgreens 008.jpg | 2010-11-08 17:58 | 35K | |
![[IMG]](/icons/image2.gif) | South Park Bernanke.jpg | 2010-10-26 12:05 | 4.5K | |
![[IMG]](/icons/image2.gif) | Sp500w52.png | 2011-10-21 12:09 | 67K | |
![[IMG]](/icons/image2.gif) | Sp500w55.png | 2011-10-21 14:44 | 71K | |
![[IMG]](/icons/image2.gif) | Spaint April 11 2012..> | 2012-04-11 09:27 | 37K | |
![[IMG]](/icons/image2.gif) | Spy2Moon4(1).gif | 2011-07-01 11:19 | 50K | |
![[IMG]](/icons/image2.gif) | Spy2Moon4(2).gif | 2011-07-07 09:34 | 50K | |
![[IMG]](/icons/image2.gif) | Spy2Moon4(3).gif | 2011-07-21 11:27 | 50K | |
![[IMG]](/icons/image2.gif) | Spy2Moon4(4).gif | 2011-07-21 11:29 | 50K | |
![[IMG]](/icons/image2.gif) | Spy2Moon4(5).gif | 2011-08-31 16:13 | 50K | |
![[IMG]](/icons/image2.gif) | Spy2Moon4(6).gif | 2011-12-07 13:21 | 50K | |
![[IMG]](/icons/image2.gif) | Spy2Moon4.gif | 2011-06-30 15:45 | 50K | |
![[IMG]](/icons/image2.gif) | Stairway-to-Heaven-L..> | 2011-01-16 15:28 | 25K | |
![[IMG]](/icons/image2.gif) | Star Wars(1).jpg | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | Star Wars.jpg | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | Statistics and lies.jpg | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | Steven-Cohen(1).jpg | 2012-12-06 17:07 | 5.9K | |
![[IMG]](/icons/image2.gif) | Steven-Cohen.jpg | 2012-11-28 16:16 | 5.9K | |
![[IMG]](/icons/image2.gif) | Still haunted by une..> | 2011-10-30 05:38 | 98K | |
![[IMG]](/icons/image2.gif) | StrategyTester.gif | 2011-06-21 17:33 | 13K | |
![[IMG]](/icons/image2.gif) | Superdollar-returns-..> | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | TASR CC Tags March 1..> | 2011-03-01 11:50 | 64K | |
![[IMG]](/icons/image2.gif) | TBT Sept 1 2011.jpg | 2011-09-01 12:56 | 26K | |
![[IMG]](/icons/image2.gif) | THANKS BERNANKE(1).jpg | 2010-12-06 03:51 | 52K | |
![[IMG]](/icons/image2.gif) | THANKS BERNANKE.jpg | 2010-11-23 19:26 | 52K | |
![[IMG]](/icons/image2.gif) | THE Machine(1).jpg | 2010-12-15 14:18 | 240K | |
![[IMG]](/icons/image2.gif) | THE Machine(2).jpg | 2011-01-06 19:43 | 56K | |
![[IMG]](/icons/image2.gif) | THE Machine(3).jpg | 2011-01-15 17:05 | 56K | |
![[IMG]](/icons/image2.gif) | THE Machine.jpg | 2010-11-07 16:35 | 56K | |
![[IMG]](/icons/image2.gif) | THE NEVERENDING BAIL..> | 2010-12-15 14:55 | 60K | |
![[IMG]](/icons/image2.gif) | THRX.JPG | 2011-07-17 19:07 | 89K | |
![[IMG]](/icons/image2.gif) | TLT 020712.jpg | 2012-02-07 08:25 | 91K | |
![[IMG]](/icons/image2.gif) | TLT2 Chart Aug 19 20..> | 2011-08-19 12:34 | 19K | |
![[IMG]](/icons/image2.gif) | TLT Support.png | 2011-04-18 16:21 | 134K | |
![[IMG]](/icons/image2.gif) | TM Sept 1 2010.jpg | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | TNA April 14 2011.jpg | 2011-04-13 22:37 | 32K | |
![[IMG]](/icons/image2.gif) | TNA June 11 2010.jpg | 2010-10-26 12:05 | 37K | |
![[IMG]](/icons/image2.gif) | TNA June 24 2010.jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | TOS_5EMA_Chart(1).jpg | 2010-10-26 12:05 | 105K | |
![[IMG]](/icons/image2.gif) | TOS_5EMA_Chart.jpg | 2010-10-26 12:05 | 105K | |
![[IMG]](/icons/image2.gif) | TOS_5SMA_Chart.jpg | 2010-10-26 12:05 | 106K | |
![[IMG]](/icons/image2.gif) | TPX Jan_ 2004 - Jun_..> | 2012-06-07 19:58 | 135K | |
![[IMG]](/icons/image2.gif) | TRANQ weekly Jan.jpg | 2010-10-26 12:05 | 69K | |
![[IMG]](/icons/image2.gif) | TREE.jpg | 2010-11-29 20:25 | 42K | |
![[IMG]](/icons/image2.gif) | TROJAN.jpg | 2010-12-14 19:11 | 96K | |
![[IMG]](/icons/image2.gif) | TSLA BNN 011513.jpg | 2013-06-05 07:28 | 31K | |
![[IMG]](/icons/image2.gif) | TSLA BNN 11513-2.jpg | 2013-06-05 07:39 | 35K | |
![[IMG]](/icons/image2.gif) | TSN-021910.jpg | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | TYH.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | Target.png | 2011-09-22 13:55 | 79K | |
![[IMG]](/icons/image2.gif) | Tarp.gif | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | Tax Reform Dec 2011.jpg | 2011-12-05 09:27 | 112K | |
![[IMG]](/icons/image2.gif) | Tax spending.jpg | 2013-02-13 09:14 | 91K | |
![[IMG]](/icons/image2.gif) | Taylor-Bernanke-Plan..> | 2010-10-26 12:05 | 177K | |
![[IMG]](/icons/image2.gif) | Tech Talk_AMCC-01221..> | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | Tech Talk_DRH-013110..> | 2010-10-26 12:05 | 81K | |
![[IMG]](/icons/image2.gif) | Tech_Talk_CERN-01151..> | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | Tesla Sales Chart.jpg | 2013-07-02 08:18 | 37K | |
![[IMG]](/icons/image2.gif) | The-Countdown-To-The..> | 2012-05-08 03:37 | 23K | |
![[IMG]](/icons/image2.gif) | The-party-is-over.jpg | 2011-06-21 13:19 | 62K | |
![[IMG]](/icons/image2.gif) | The Amazing Bernanke..> | 2011-09-25 03:53 | 109K | |
![[IMG]](/icons/image2.gif) | The American Worker ..> | 2011-09-04 07:08 | 83K | |
![[IMG]](/icons/image2.gif) | The Euro Zone(1).jpg | 2012-01-29 06:23 | 75K | |
![[IMG]](/icons/image2.gif) | The Euro Zone.jpg | 2011-11-13 03:32 | 75K | |
![[IMG]](/icons/image2.gif) | The Fonz.JPG | 2011-08-31 13:47 | 24K | |
![[IMG]](/icons/image2.gif) | The Future(1).jpg | 2011-09-22 13:56 | 52K | |
![[IMG]](/icons/image2.gif) | The Future(2).jpg | 2011-10-03 15:35 | 52K | |
![[IMG]](/icons/image2.gif) | The Future(3).jpg | 2011-10-12 15:39 | 52K | |
![[IMG]](/icons/image2.gif) | The Future(4).jpg | 2012-01-06 13:35 | 52K | |
![[IMG]](/icons/image2.gif) | The Future (updated)..> | 2012-01-06 13:43 | 48K | |
![[IMG]](/icons/image2.gif) | The Future.JPG | 2011-09-09 13:49 | 52K | |
![[IMG]](/icons/image2.gif) | The Future II(1).jpg | 2011-09-23 15:59 | 38K | |
![[IMG]](/icons/image2.gif) | The Future II(2).jpg | 2011-09-26 14:20 | 38K | |
![[IMG]](/icons/image2.gif) | The Future II(3).jpg | 2011-09-28 11:43 | 38K | |
![[IMG]](/icons/image2.gif) | The Future II(4).jpg | 2011-10-07 12:55 | 38K | |
![[IMG]](/icons/image2.gif) | The Future II(5).jpg | 2011-10-17 15:59 | 38K | |
![[IMG]](/icons/image2.gif) | The Future II(6).jpg | 2011-11-01 13:57 | 38K | |
![[IMG]](/icons/image2.gif) | The Future II(7).jpg | 2011-11-15 11:56 | 38K | |
![[IMG]](/icons/image2.gif) | The Future II(8).jpg | 2011-11-30 14:13 | 38K | |
![[IMG]](/icons/image2.gif) | The Future II(9).jpg | 2011-12-28 15:23 | 38K | |
![[IMG]](/icons/image2.gif) | The Future II(10).jpg | 2012-01-06 12:41 | 38K | |
![[IMG]](/icons/image2.gif) | The Future II.JPG | 2011-09-09 13:54 | 38K | |
![[IMG]](/icons/image2.gif) | The Perfect Gift.jpg | 2011-12-25 02:29 | 64K | |
![[IMG]](/icons/image2.gif) | Thitry-Eight Studios..> | 2012-05-26 21:19 | 75K | |
![[IMG]](/icons/image2.gif) | Three Gauges 3d.jpg | 2011-09-02 17:45 | 92K | |
![[IMG]](/icons/image2.gif) | Time to Short !!.jpg | 2011-11-23 11:49 | 39K | |
![[IMG]](/icons/image2.gif) | Timing - Leveraged E..> | 2011-11-19 15:13 | 41K | |
![[IMG]](/icons/image2.gif) | Timing - Leveraged E..> | 2011-11-19 15:24 | 41K | |
![[IMG]](/icons/image2.gif) | Timing - Leveraged E..> | 2011-11-19 16:41 | 41K | |
![[IMG]](/icons/image2.gif) | Timing - Leveraged E..> | 2011-11-19 15:12 | 41K | |
![[IMG]](/icons/image2.gif) | Timing - Leveraged E..> | 2011-11-19 16:42 | 41K | |
![[IMG]](/icons/image2.gif) | Timing - Leveraged E..> | 2011-11-19 16:44 | 78K | |
![[IMG]](/icons/image2.gif) | Timing - Long and Sh..> | 2011-11-19 15:12 | 51K | |
![[IMG]](/icons/image2.gif) | Timothy-Geithner-500..> | 2011-02-15 16:09 | 32K | |
![[IMG]](/icons/image2.gif) | Timothy-Geithner-500..> | 2011-02-15 12:34 | 32K | |
![[IMG]](/icons/image2.gif) | Toxic Debt.jpg | 2011-10-30 05:42 | 109K | |
![[IMG]](/icons/image2.gif) | Trade Weighted dolla..> | 2012-03-28 14:34 | 23K | |
![[IMG]](/icons/image2.gif) | Train_wreck_at_Montp..> | 2011-10-10 12:51 | 531K | |
![[IMG]](/icons/image2.gif) | Train_wreck_at_Montp..> | 2011-10-16 23:24 | 531K | |
![[IMG]](/icons/image2.gif) | Train_wreck_at_Montp..> | 2011-11-13 16:53 | 531K | |
![[IMG]](/icons/image2.gif) | Train_wreck_at_Montp..> | 2011-10-10 12:50 | 531K | |
![[IMG]](/icons/image2.gif) | Triple A.jpg | 2011-08-14 03:02 | 97K | |
![[IMG]](/icons/image2.gif) | Turbo-Tax-Tim-Jesse.jpg | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | Tweet 031413(1).jpg | 2013-03-14 08:34 | 9.3K | |
![[IMG]](/icons/image2.gif) | Tweet 031413.jpg | 2013-03-14 07:55 | 9.3K | |
![[IMG]](/icons/image2.gif) | Tweet 050613.jpg | 2013-05-06 08:21 | 8.8K | |
![[IMG]](/icons/image2.gif) | Tweet 50613a.jpg | 2013-05-06 09:01 | 9.4K | |
![[IMG]](/icons/image2.gif) | UNG Oct 17 2010(1).jpg | 2010-10-19 08:42 | 26K | |
![[IMG]](/icons/image2.gif) | UNG Oct 17 2010.jpg | 2010-10-19 08:41 | 26K | |
![[IMG]](/icons/image2.gif) | USD Jan 30 2013.jpg | 2013-01-30 08:14 | 64K | |
![[IMG]](/icons/image2.gif) | USO $33 puts May 200..> | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | USO 011210.JPG | 2010-10-26 12:05 | 63K | |
![[IMG]](/icons/image2.gif) | USO 011210a.JPG | 2010-10-26 12:05 | 62K | |
![[IMG]](/icons/image2.gif) | USO June 9 2011.jpg | 2011-06-09 10:24 | 9.7K | |
![[IMG]](/icons/image2.gif) | USO May 12 2011.jpg | 2011-05-12 08:24 | 23K | |
![[IMG]](/icons/image2.gif) | UT(1).png | 2011-04-19 10:06 | 135K | |
![[IMG]](/icons/image2.gif) | UT(2).png | 2011-04-19 10:08 | 135K | |
![[IMG]](/icons/image2.gif) | UT.png | 2011-04-19 10:05 | 135K | |
![[IMG]](/icons/image2.gif) | UUPDaily[2].png | 2011-05-03 11:21 | 44K | |
![[IMG]](/icons/image2.gif) | UUP Sept 21 2011.jpg | 2011-09-22 13:34 | 20K | |
![[IMG]](/icons/image2.gif) | U_S_-Economy-200x133..> | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | Untitled.jpg | 2013-04-03 13:25 | 17K | |
![[IMG]](/icons/image2.gif) | VERTU.jpg | 2010-12-07 16:46 | 75K | |
![[IMG]](/icons/image2.gif) | VIX.png | 2011-07-01 12:46 | 29K | |
![[IMG]](/icons/image2.gif) | VIXRose40PercentIn2D..> | 2011-11-02 12:25 | 26K | |
![[IMG]](/icons/image2.gif) | VXX_15min_68.png | 2011-06-08 14:56 | 75K | |
![[IMG]](/icons/image2.gif) | Vampire Squid(1).jpg | 2011-05-20 01:34 | 20K | |
![[IMG]](/icons/image2.gif) | Vampire Squid.jpg | 2011-02-23 22:23 | 20K | |
![[IMG]](/icons/image2.gif) | Vitaliy.jpg | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | Volcano-Eruption-Mou..> | 2013-06-04 00:49 | 20K | |
![[IMG]](/icons/image2.gif) | Volume and movement.JPG | 2011-02-06 15:17 | 63K | |
![[IMG]](/icons/image2.gif) | WFR.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | WMT Dec 4 2010.jpg | 2010-12-04 08:11 | 23K | |
![[IMG]](/icons/image2.gif) | WOPR.png | 2010-10-26 12:05 | 261K | |
![[IMG]](/icons/image2.gif) | WSE - 12-20-10 11.jpg | 2010-12-22 16:31 | 98K | |
![[IMG]](/icons/image2.gif) | WSE - 12-20-10 33.gif | 2010-12-22 16:32 | 49K | |
![[IMG]](/icons/image2.gif) | WSE - 12-20-10 44.gif | 2010-12-22 16:33 | 67K | |
![[IMG]](/icons/image2.gif) | WSE - 12-20-10 55.jpg | 2010-12-22 16:34 | 90K | |
![[IMG]](/icons/image2.gif) | WSE - 12-20-10 66.jpg | 2010-12-22 16:35 | 88K | |
![[IMG]](/icons/image2.gif) | WSECOUT_Max_630_378.png | 2010-12-03 03:00 | 16K | |
![[IMG]](/icons/image2.gif) | WSJ.jpg | 2011-11-17 10:54 | 23K | |
![[IMG]](/icons/image2.gif) | WSS Feb 26 2010.jpg | 2010-10-26 12:05 | 84K | |
![[IMG]](/icons/image2.gif) | W WO Recovery_0.jpg | 2011-06-08 20:29 | 34K | |
![[IMG]](/icons/image2.gif) | Waiting.JPG | 2011-09-02 13:37 | 70K | |
![[IMG]](/icons/image2.gif) | Wall Street Barf.jpg | 2011-09-02 15:48 | 74K | |
![[IMG]](/icons/image2.gif) | Weekly DJIA.jpg | 2011-11-26 17:07 | 408K | |
![[IMG]](/icons/image2.gif) | What-Is-Globalizatio..> | 2011-02-17 01:08 | 17K | |
![[IMG]](/icons/image2.gif) | What-Is-Globalizatio..> | 2011-02-11 15:23 | 17K | |
![[IMG]](/icons/image2.gif) | What are the odds.png | 2011-12-20 15:40 | 222K | |
![[IMG]](/icons/image2.gif) | Where Taxes Go 2.jpg | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | Why-Is-The-World-Eco..> | 2013-03-21 20:37 | 65K | |
![[IMG]](/icons/image2.gif) | Willy Cyote.JPG | 2011-07-25 15:48 | 67K | |
![[IMG]](/icons/image2.gif) | WinnersCircle.gif | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | Wizard-of-Oz-Emerald..> | 2011-10-12 00:59 | 25K | |
![[IMG]](/icons/image2.gif) | Wordle March 18 2011..> | 2011-03-19 07:50 | 65K | |
![[IMG]](/icons/image2.gif) | Wordle March 18 2011..> | 2011-03-19 07:50 | 65K | |
![[IMG]](/icons/image2.gif) | Wordle NTRI CC Feb 2..> | 2011-02-25 11:39 | 64K | |
![[IMG]](/icons/image2.gif) | Wordle PSW Chat Feb ..> | 2011-03-19 07:52 | 81K | |
![[IMG]](/icons/image2.gif) | Wordle PSW Chat Feb ..> | 2011-02-24 16:32 | 81K | |
![[IMG]](/icons/image2.gif) | XLE Feb 28 2011.jpg | 2011-02-28 11:22 | 50K | |
![[IMG]](/icons/image2.gif) | XLF Daily Chart.jpg | 2011-12-08 13:29 | 106K | |
![[IMG]](/icons/image2.gif) | XLF Fib 7-20-2011.png | 2011-07-20 14:15 | 26K | |
![[IMG]](/icons/image2.gif) | XLF Oct 3 2011(1).jpg | 2011-10-04 03:30 | 58K | |
![[IMG]](/icons/image2.gif) | XLF Oct 3 2011(2).jpg | 2011-10-04 03:30 | 58K | |
![[IMG]](/icons/image2.gif) | XLF Oct 3 2011.jpg | 2011-10-04 03:29 | 58K | |
![[IMG]](/icons/image2.gif) | XLF Oct 3rd 1.png | 2011-10-04 04:07 | 31K | |
![[IMG]](/icons/image2.gif) | XLF Oct 3rd 2.png | 2011-10-04 04:09 | 32K | |
![[IMG]](/icons/image2.gif) | XLF Oct 3rd 3.png | 2011-10-04 04:09 | 33K | |
![[IMG]](/icons/image2.gif) | XLF UUP July 26 201..> | 2011-07-26 12:15 | 33K | |
![[IMG]](/icons/image2.gif) | XOM 022813.jpg | 2013-02-28 07:47 | 28K | |
![[IMG]](/icons/image2.gif) | XOM June 17 2011.jpg | 2011-06-17 13:30 | 27K | |
![[IMG]](/icons/image2.gif) | XRT Jan 15 2010.jpg | 2011-01-15 08:23 | 50K | |
![[IMG]](/icons/image2.gif) | Ya for Greece.jpg | 2011-10-03 19:53 | 53K | |
![[IMG]](/icons/image2.gif) | Yen May 9 2011.jpg | 2011-05-09 14:10 | 14K | |
![[IMG]](/icons/image2.gif) | Yentervention Aug 4 ..> | 2011-08-04 07:49 | 13K | |
![[IMG]](/icons/image2.gif) | You have my attentio..> | 2011-08-03 10:43 | 7.1K | |
![[IMG]](/icons/image2.gif) | You have my attentio..> | 2011-08-12 15:00 | 7.1K | |
![[IMG]](/icons/image2.gif) | You have my attentio..> | 2011-08-02 14:17 | 7.1K | |
![[IMG]](/icons/image2.gif) | Zuccotti.jpg | 2011-11-15 07:43 | 16K | |
![[IMG]](/icons/image2.gif) | _45043744_92c6706a-4..> | 2011-07-07 14:19 | 13K | |
![[DIR]](/icons/folder.gif) | _thumbs/ | 2024-02-28 23:51 | - | |
![[IMG]](/icons/image2.gif) | a_madoff_guilty_0312..> | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | a_wgoldman_0831.jpg | 2010-10-26 12:05 | 59K | |
![[IMG]](/icons/image2.gif) | a_wlostvegas_0824.jpg | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | aa(1).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | aa.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | aaww.png | 2010-10-21 15:12 | 15K | |
![[IMG]](/icons/image2.gif) | abandoned building.jpg | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | absinthemontbart-jes..> | 2011-09-01 15:34 | 77K | |
![[IMG]](/icons/image2.gif) | accountant.jpg | 2011-06-11 20:16 | 19K | |
![[IMG]](/icons/image2.gif) | ackermann.jpg | 2011-09-07 02:18 | 8.3K | |
![[IMG]](/icons/image2.gif) | a classical Japanese..> | 2010-10-26 12:05 | 27K | |
![[DIR]](/icons/folder.gif) | adbc_uploads_7ie55uc..> | 2024-01-23 20:24 | - | |
![[IMG]](/icons/image2.gif) | adi.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | aeis(1).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | aeis.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | aet.png | 2010-11-02 13:28 | 14K | |
![[IMG]](/icons/image2.gif) | air.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | akcs-www.jpeg | 2011-10-16 14:00 | 34K | |
![[IMG]](/icons/image2.gif) | alan_greenspan_panca..> | 2011-08-07 15:56 | 26K | |
![[IMG]](/icons/image2.gif) | alan_greenspan_panca..> | 2011-03-20 20:33 | 26K | |
![[IMG]](/icons/image2.gif) | alessio-rastani(1).jpg | 2011-09-28 02:20 | 68K | |
![[IMG]](/icons/image2.gif) | alessio-rastani.jpg | 2011-09-28 02:20 | 68K | |
![[IMG]](/icons/image2.gif) | algn.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | algn 2.jpg | 2010-11-11 14:35 | 373K | |
![[IMG]](/icons/image2.gif) | algn 5.jpg | 2010-11-11 14:37 | 219K | |
![[IMG]](/icons/image2.gif) | algn report.jpg | 2010-11-11 14:33 | 287K | |
![[IMG]](/icons/image2.gif) | algn report 3.jpg | 2010-11-11 14:36 | 472K | |
![[IMG]](/icons/image2.gif) | algn report 4.jpg | 2010-11-11 14:37 | 203K | |
![[IMG]](/icons/image2.gif) | alice-svankmajer.jpg | 2012-04-03 14:34 | 18K | |
![[IMG]](/icons/image2.gif) | alks.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | amd(1).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | amd(2).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | amd.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | amr.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | anInversefunction.gif | 2010-10-26 12:05 | 3.4K | |
![[IMG]](/icons/image2.gif) | andrew-jackson.jpg | 2011-02-13 13:09 | 12K | |
![[IMG]](/icons/image2.gif) | andrewcuomo5jpg(1).jpg | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | andrewcuomo5jpg.jpg | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | anf.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | anger-luck-hope-5255..> | 2012-09-25 02:59 | 16K | |
![[IMG]](/icons/image2.gif) | animal farm.jpg | 2012-03-12 18:59 | 29K | |
![[IMG]](/icons/image2.gif) | anonymous-bi(1).jpg | 2011-10-05 14:40 | 32K | |
![[IMG]](/icons/image2.gif) | anonymous-bi.jpg | 2011-10-04 13:38 | 32K | |
![[IMG]](/icons/image2.gif) | antibiotics_1016.jpg | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | arba.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | arm_leg_first_born.jpg | 2011-01-05 03:52 | 27K | |
![[IMG]](/icons/image2.gif) | armthehomelsstrhthtt..> | 2012-05-24 16:18 | 37K | |
![[IMG]](/icons/image2.gif) | arnold_speech_0603.jpg | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | around-the-corner_la..> | 2012-02-06 21:24 | 8.8K | |
![[IMG]](/icons/image2.gif) | article-0-0B2C1C4700..> | 2011-03-20 18:09 | 265K | |
![[IMG]](/icons/image2.gif) | article-0-199A473F00..> | 2013-05-05 00:55 | 28K | |
![[IMG]](/icons/image2.gif) | article-1366341-0B2D..> | 2011-03-15 13:45 | 237K | |
![[IMG]](/icons/image2.gif) | article-1371793-0B6C..> | 2011-03-31 15:49 | 97K | |
![[IMG]](/icons/image2.gif) | atlas-shrugged.jpeg | 2012-08-24 17:12 | 35K | |
![[IMG]](/icons/image2.gif) | attention_manipulati..> | 2010-10-26 12:05 | 323K | |
![[IMG]](/icons/image2.gif) | attention_manipulati..> | 2010-10-26 12:05 | 323K | |
![[IMG]](/icons/image2.gif) | aubreymcclendon-with..> | 2012-05-30 04:26 | 45K | |
![[IMG]](/icons/image2.gif) | autism-time.jpg | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | avage.jpg | 2011-04-16 17:02 | 40K | |
![[IMG]](/icons/image2.gif) | avatar_95ca58a2a4dd_..> | 2011-04-08 13:10 | 32K | |
![[IMG]](/icons/image2.gif) | avatar_95ca58a2a4dd_..> | 2011-07-12 13:50 | 32K | |
![[IMG]](/icons/image2.gif) | avatar_95ca58a2a4dd_..> | 2011-04-08 13:09 | 32K | |
![[IMG]](/icons/image2.gif) | avnw.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | axa.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | axp.png | 2010-10-21 09:25 | 13K | |
![[IMG]](/icons/image2.gif) | ayn-rand-alan-greens..> | 2012-07-13 23:43 | 30K | |
![[IMG]](/icons/image2.gif) | ayn-rand-alan-greens..> | 2012-03-20 17:18 | 30K | |
![[IMG]](/icons/image2.gif) | ayn-rand-with-cig-23..> | 2013-03-12 16:49 | 60K | |
![[IMG]](/icons/image2.gif) | ayn rand(1).gif | 2010-10-26 12:05 | 61K | |
![[IMG]](/icons/image2.gif) | ayn rand(1).png | 2010-10-26 12:05 | 372K | |
![[IMG]](/icons/image2.gif) | ayn rand.GIF | 2010-10-26 12:05 | 61K | |
![[IMG]](/icons/image2.gif) | ayn rand.JPG | 2010-10-26 12:05 | 114K | |
![[IMG]](/icons/image2.gif) | ayn rand.PNG | 2010-10-26 12:05 | 372K | |
![[IMG]](/icons/image2.gif) | bac-offering.png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | bac.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | bachmann-debate.jpg | 2011-08-22 13:39 | 45K | |
![[IMG]](/icons/image2.gif) | bailout.jpg | 2011-12-21 17:10 | 37K | |
![[IMG]](/icons/image2.gif) | bailout madness.jpeg | 2012-09-04 19:26 | 28K | |
![[IMG]](/icons/image2.gif) | bailout madness.jpg | 2010-10-18 21:19 | 24K | |
![[IMG]](/icons/image2.gif) | ball robots(1).jpg | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | ball robots(2).jpg | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | ball robots(3).jpg | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | ball robots(4).jpg | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | ball robots(5).jpg | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | ball robots(6).jpg | 2010-11-09 21:15 | 16K | |
![[IMG]](/icons/image2.gif) | ball robots(7).jpg | 2011-02-14 13:02 | 16K | |
![[IMG]](/icons/image2.gif) | ball robots(8).jpg | 2011-05-26 15:14 | 16K | |
![[IMG]](/icons/image2.gif) | ball robots(9).jpg | 2011-06-27 18:03 | 16K | |
![[IMG]](/icons/image2.gif) | ball robots(10).jpg | 2011-09-26 13:53 | 22K | |
![[IMG]](/icons/image2.gif) | ball robots.jpg | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | banana-republic(1).jpg | 2011-07-12 13:00 | 30K | |
![[IMG]](/icons/image2.gif) | banana-republic.jpg | 2011-04-04 13:54 | 30K | |
![[IMG]](/icons/image2.gif) | banker-5.jpg | 2013-05-31 20:03 | 90K | |
![[IMG]](/icons/image2.gif) | banks.jpg | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | banksy-1.jpg | 2012-01-13 14:36 | 50K | |
![[IMG]](/icons/image2.gif) | banksy-again.jpeg | 2011-12-28 23:43 | 36K | |
![[IMG]](/icons/image2.gif) | banksy-graffiti-stre..> | 2012-03-19 16:24 | 28K | |
![[IMG]](/icons/image2.gif) | banksy-graffiti-stre..> | 2012-04-10 13:21 | 120K | |
![[IMG]](/icons/image2.gif) | banksy-graffiti-stre..> | 2012-04-01 05:13 | 61K | |
![[IMG]](/icons/image2.gif) | banksy-graffiti-stre..> | 2012-03-21 15:39 | 61K | |
![[IMG]](/icons/image2.gif) | banksy-graffiti-stre..> | 2012-04-01 05:12 | 83K | |
![[IMG]](/icons/image2.gif) | banksy-graffiti-stre..> | 2012-03-25 02:54 | 52K | |
![[IMG]](/icons/image2.gif) | banksy-graffiti-stre..> | 2012-10-31 16:53 | 52K | |
![[IMG]](/icons/image2.gif) | banksy-graffiti-stre..> | 2012-03-19 15:50 | 52K | |
![[IMG]](/icons/image2.gif) | banksy-graffiti-stre..> | 2012-03-21 15:40 | 68K | |
![[IMG]](/icons/image2.gif) | banksy-graffiti-stre..> | 2012-03-18 02:51 | 68K | |
![[IMG]](/icons/image2.gif) | banksy-graffiti-stre..> | 2012-03-21 15:36 | 52K | |
![[IMG]](/icons/image2.gif) | banksy-money.jpg | 2011-12-04 21:03 | 37K | |
![[IMG]](/icons/image2.gif) | banksy-rat-streets(1..> | 2011-12-02 14:30 | 34K | |
![[IMG]](/icons/image2.gif) | banksy-rat-streets(2..> | 2011-12-02 22:34 | 34K | |
![[IMG]](/icons/image2.gif) | banksy-rat-streets.jpg | 2011-11-30 16:43 | 34K | |
![[IMG]](/icons/image2.gif) | banksy_always_hope.jpeg | 2012-07-24 18:41 | 78K | |
![[IMG]](/icons/image2.gif) | banksy_bang300_300x4..> | 2011-12-02 19:04 | 55K | |
![[IMG]](/icons/image2.gif) | banksy_bang300_300x4..> | 2011-12-02 20:20 | 55K | |
![[IMG]](/icons/image2.gif) | banksy_bang300_300x4..> | 2011-12-21 17:27 | 55K | |
![[IMG]](/icons/image2.gif) | banksy_bang300_300x4..> | 2012-01-13 16:38 | 55K | |
![[IMG]](/icons/image2.gif) | banksy_bang300_300x4..> | 2011-11-25 18:25 | 55K | |
![[IMG]](/icons/image2.gif) | banksy_dont-believe-..> | 2012-03-27 14:07 | 40K | |
![[IMG]](/icons/image2.gif) | banksy_rat_hayne_str..> | 2011-12-02 14:30 | 48K | |
![[IMG]](/icons/image2.gif) | banksy_rat_you_lose.jpg | 2012-01-06 02:29 | 29K | |
![[IMG]](/icons/image2.gif) | banksyjap.jpg | 2012-01-27 14:58 | 29K | |
![[IMG]](/icons/image2.gif) | banner-vert-koch.png | 2010-10-26 12:05 | 10K | |
![[IMG]](/icons/image2.gif) | banzai.jpeg | 2012-10-10 03:50 | 394K | |
![[IMG]](/icons/image2.gif) | banzai2(1).jpeg | 2012-11-05 22:50 | 421K | |
![[IMG]](/icons/image2.gif) | banzai2(2).jpeg | 2012-11-05 22:55 | 421K | |
![[IMG]](/icons/image2.gif) | banzai2.jpeg | 2012-10-10 03:30 | 421K | |
![[IMG]](/icons/image2.gif) | banzai3.jpeg | 2012-10-10 03:54 | 306K | |
![[IMG]](/icons/image2.gif) | barack-obama-figurin..> | 2010-10-15 16:43 | 24K | |
![[IMG]](/icons/image2.gif) | barack-obama.jpg | 2010-10-26 12:05 | 7.5K | |
![[IMG]](/icons/image2.gif) | barons.jpg | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | bave(1).gif | 2010-10-26 12:05 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(2).gif | 2010-10-26 12:05 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(3).gif | 2010-10-26 12:05 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(4).gif | 2010-10-26 12:05 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(5).gif | 2010-10-26 12:05 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(6).gif | 2010-10-26 12:05 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(7).gif | 2010-10-26 12:05 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(8).gif | 2010-11-11 09:51 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(9).gif | 2010-11-16 14:32 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(10).gif | 2010-11-17 09:50 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(11).gif | 2010-11-17 09:51 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(12).gif | 2010-11-17 10:07 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(13).gif | 2010-11-18 14:15 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(14).gif | 2010-11-24 09:32 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(15).gif | 2010-12-03 11:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(16).gif | 2010-12-03 14:15 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(17).gif | 2010-12-03 15:56 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(18).gif | 2010-12-07 13:11 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(19).gif | 2010-12-08 12:17 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(20).gif | 2010-12-28 15:03 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(21).gif | 2010-12-31 10:37 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(22).gif | 2010-12-31 11:41 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(23).gif | 2010-12-31 11:41 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(24).gif | 2011-01-05 16:03 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(25).gif | 2011-01-21 15:38 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(26).gif | 2011-01-25 15:52 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(27).gif | 2011-01-25 15:52 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(28).gif | 2011-02-10 11:44 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(29).gif | 2011-02-15 10:35 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(30).gif | 2011-02-17 15:26 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(31).gif | 2011-02-22 12:43 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(32).gif | 2011-02-22 12:44 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(33).gif | 2011-02-22 12:44 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(34).gif | 2011-02-23 11:39 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(35).gif | 2011-03-02 14:05 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(36).gif | 2011-03-07 13:02 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(37).gif | 2011-03-08 12:52 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(38).gif | 2011-03-08 12:52 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(39).gif | 2011-03-09 12:26 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(40).gif | 2011-03-10 13:14 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(41).gif | 2011-03-16 14:07 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(42).gif | 2011-03-21 13:20 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(43).gif | 2011-03-23 10:33 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(44).gif | 2011-05-03 10:40 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(45).gif | 2011-05-04 11:19 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(46).gif | 2011-05-04 11:20 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(47).gif | 2011-05-16 15:00 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(48).gif | 2011-06-10 15:50 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(49).gif | 2011-06-16 14:04 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(50).gif | 2011-07-14 12:20 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(51).gif | 2011-07-15 10:26 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(52).gif | 2011-07-21 12:03 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(53).gif | 2011-08-04 14:06 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(54).gif | 2011-08-04 15:30 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(55).gif | 2011-08-04 15:30 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(56).gif | 2011-08-05 09:46 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(57).gif | 2011-08-05 09:47 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(58).gif | 2011-08-05 09:47 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(59).gif | 2011-08-08 10:33 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(60).gif | 2011-08-08 13:50 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(61).gif | 2011-08-18 15:02 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(62).gif | 2011-08-19 14:26 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(63).gif | 2011-09-02 15:03 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(64).gif | 2011-09-20 15:05 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(65).gif | 2011-09-21 15:59 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(66).gif | 2011-09-22 11:40 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(67).gif | 2011-09-22 13:31 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(68).gif | 2011-10-07 10:06 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(69).gif | 2011-10-07 10:06 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave(70).gif | 2011-10-20 09:39 | 1.1K | |
![[IMG]](/icons/image2.gif) | bave.gif | 2010-10-26 12:05 | 1.1K | |
![[IMG]](/icons/image2.gif) | bb.jpeg | 2012-07-17 12:57 | 41K | |
![[IMG]](/icons/image2.gif) | bbjl6r6.jpg | 2011-12-07 13:09 | 45K | |
![[IMG]](/icons/image2.gif) | bear-2000-real.png | 2011-11-09 16:21 | 65K | |
![[IMG]](/icons/image2.gif) | bearGIF(1).jpg | 2011-08-29 15:57 | 128K | |
![[IMG]](/icons/image2.gif) | bearGIF.JPG | 2011-08-29 15:54 | 128K | |
![[IMG]](/icons/image2.gif) | bear catch.jpg | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | beary_beary_christma..> | 2011-12-19 15:35 | 110K | |
![[IMG]](/icons/image2.gif) | beast.jpg | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | benkarnack.jpg | 2011-06-24 17:07 | 12K | |
![[IMG]](/icons/image2.gif) | bensphincterboy2.JPG | 2011-07-11 15:20 | 73K | |
![[IMG]](/icons/image2.gif) | benspinningplates(1)..> | 2011-06-24 16:56 | 20K | |
![[IMG]](/icons/image2.gif) | benspinningplates(2)..> | 2011-06-24 16:58 | 20K | |
![[IMG]](/icons/image2.gif) | benspinningplates.jpg | 2011-06-23 00:14 | 20K | |
![[IMG]](/icons/image2.gif) | bernanke-burn-notice..> | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | bernanke-cartoon-tak..> | 2010-10-26 12:05 | 59K | |
![[IMG]](/icons/image2.gif) | bernanke-geithner-qe..> | 2011-04-05 09:00 | 50K | |
![[IMG]](/icons/image2.gif) | bernanke-smiles-bi.jpg | 2011-10-04 13:47 | 72K | |
![[IMG]](/icons/image2.gif) | bernanke.jpg | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | bernanke_2017935b.jpg | 2013-06-19 14:19 | 32K | |
![[IMG]](/icons/image2.gif) | bernanke_titanic_1.jpg | 2010-10-26 12:05 | 121K | |
![[IMG]](/icons/image2.gif) | bernanke magician(1)..> | 2011-01-10 19:16 | 28K | |
![[IMG]](/icons/image2.gif) | bernanke magician.jpg | 2011-01-05 03:45 | 28K | |
![[IMG]](/icons/image2.gif) | bernanke makes it ra..> | 2011-02-15 11:37 | 31K | |
![[IMG]](/icons/image2.gif) | bernanke makes it ra..> | 2011-01-10 19:13 | 31K | |
![[IMG]](/icons/image2.gif) | bhp.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | big(1).png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | big.png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | big_boss.gif | 2011-03-09 13:40 | 20K | |
![[IMG]](/icons/image2.gif) | big_pic.png | 2011-08-22 13:25 | 33K | |
![[IMG]](/icons/image2.gif) | big lots.jpg | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | bill-fleckenstein-he..> | 2011-01-20 17:14 | 15K | |
![[IMG]](/icons/image2.gif) | biotech.JPG | 2011-05-14 19:29 | 37K | |
![[IMG]](/icons/image2.gif) | black_friday_TIME.jpg | 2010-10-26 12:05 | 89K | |
![[IMG]](/icons/image2.gif) | blackswan3-300x225.jpg | 2011-03-28 22:01 | 21K | |
![[IMG]](/icons/image2.gif) | blairmountiaiananan...> | 2012-08-28 15:57 | 47K | |
![[IMG]](/icons/image2.gif) | blind-alley.jpeg | 2011-07-28 15:38 | 6.1K | |
![[IMG]](/icons/image2.gif) | blog-revolution.jpg | 2010-11-04 14:09 | 22K | |
![[IMG]](/icons/image2.gif) | blog_20111209_Dec_TW..> | 2011-12-12 14:50 | 163K | |
![[IMG]](/icons/image2.gif) | blog_20111209_Dec_TW..> | 2011-12-12 14:58 | 163K | |
![[IMG]](/icons/image2.gif) | blog_20111209_Dec_TW..> | 2011-12-12 14:38 | 163K | |
![[IMG]](/icons/image2.gif) | bmy.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | bob-janjuah.jpg | 2011-10-31 13:11 | 25K | |
![[IMG]](/icons/image2.gif) | bonnie.jpg | 2011-09-14 16:29 | 168K | |
![[IMG]](/icons/image2.gif) | bp2j22f(1).png | 2011-03-24 16:47 | 165K | |
![[IMG]](/icons/image2.gif) | bp2j22f.png | 2011-03-24 16:20 | 165K | |
![[IMG]](/icons/image2.gif) | brain.jpg | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | braingraphsci.jpg | 2011-02-14 21:06 | 119K | |
![[IMG]](/icons/image2.gif) | brks.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | broken piggy.jpg | 2011-07-22 01:02 | 31K | |
![[IMG]](/icons/image2.gif) | brooks-brown-bear_82..> | 2011-11-15 11:48 | 44K | |
![[IMG]](/icons/image2.gif) | bubble - crestock.jpg | 2010-10-26 12:05 | 61K | |
![[IMG]](/icons/image2.gif) | bubble1.jpg | 2013-06-18 14:21 | 30K | |
![[IMG]](/icons/image2.gif) | buh bye janet.jpg | 2013-04-28 13:21 | 22K | |
![[IMG]](/icons/image2.gif) | bull-iphone (1).jpg | 2013-04-17 12:14 | 62K | |
![[IMG]](/icons/image2.gif) | bullshit.jpg | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | bulybear.gif | 2011-11-15 11:27 | 40K | |
![[IMG]](/icons/image2.gif) | bungee_jumping.jpg | 2011-03-03 14:12 | 88K | |
![[IMG]](/icons/image2.gif) | burial-ceiling.jpg | 2011-01-07 15:09 | 68K | |
![[IMG]](/icons/image2.gif) | burning-dollar1-300x..> | 2011-04-26 17:39 | 24K | |
![[IMG]](/icons/image2.gif) | bush_account1_2.gif | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | businessman-being-fr..> | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | businessman-being-fr..> | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | button1.jpg | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | bv7wgab.png | 2011-05-27 12:12 | 112K | |
![[IMG]](/icons/image2.gif) | bws(1).png | 2010-11-23 09:31 | 16K | |
![[IMG]](/icons/image2.gif) | bws.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | c(1).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | c.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | c29d9fde1e285158b432..> | 2010-12-13 20:11 | 30K | |
![[IMG]](/icons/image2.gif) | c_129(1).jpg | 2011-03-25 04:58 | 11K | |
![[IMG]](/icons/image2.gif) | c_129.jpg | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | caas(1).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | caas.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | caas report - 2.jpg | 2010-11-09 14:41 | 441K | |
![[IMG]](/icons/image2.gif) | caas report -3 .jpg | 2010-11-09 14:41 | 475K | |
![[IMG]](/icons/image2.gif) | caas report - 4.jpg | 2010-11-09 14:41 | 408K | |
![[IMG]](/icons/image2.gif) | caas report - 5.jpg | 2010-11-09 14:51 | 209K | |
![[IMG]](/icons/image2.gif) | caas report.jpg | 2010-11-09 14:32 | 543K | |
![[IMG]](/icons/image2.gif) | cafe(1).jpeg | 2012-07-30 19:41 | 27K | |
![[IMG]](/icons/image2.gif) | cafe(1).jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | cafe(2).jpeg | 2012-08-22 18:58 | 27K | |
![[IMG]](/icons/image2.gif) | cafe(2).jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | cafe(3).jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | cafe(4).jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | cafe(5).jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | cafe(6).jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | cafe(7).jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | cafe(8).jpg | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | cafe(9).jpg | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | cafe(10).jpg | 2012-02-06 01:04 | 27K | |
![[IMG]](/icons/image2.gif) | cafe.jpeg | 2012-06-28 17:48 | 27K | |
![[IMG]](/icons/image2.gif) | cafe.jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | california broke.jpg | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | caligula-roman-empir..> | 2011-12-18 19:21 | 76K | |
![[IMG]](/icons/image2.gif) | camion(1).gif | 2011-05-04 11:43 | 14K | |
![[IMG]](/icons/image2.gif) | camion.gif | 2011-02-18 14:25 | 14K | |
![[IMG]](/icons/image2.gif) | candy.png | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | capitalism_1435629c(..> | 2011-09-23 15:52 | 28K | |
![[IMG]](/icons/image2.gif) | capitalism_1435629c.jpg | 2011-08-03 01:57 | 28K | |
![[IMG]](/icons/image2.gif) | car-images-2.png | 2010-10-26 12:05 | 168K | |
![[IMG]](/icons/image2.gif) | car_fail_Fail-s461x4..> | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | cardsharps(1).jpg | 2013-05-30 00:40 | 181K | |
![[IMG]](/icons/image2.gif) | cardsharps - jesse(1..> | 2011-02-16 14:38 | 32K | |
![[IMG]](/icons/image2.gif) | cardsharps - jesse(2..> | 2011-02-23 21:28 | 32K | |
![[IMG]](/icons/image2.gif) | cardsharps - jesse(3..> | 2011-02-23 21:43 | 32K | |
![[IMG]](/icons/image2.gif) | cardsharps - jesse(4..> | 2011-03-30 03:01 | 32K | |
![[IMG]](/icons/image2.gif) | cardsharps - jesse(5..> | 2011-08-09 02:10 | 32K | |
![[IMG]](/icons/image2.gif) | cardsharps - jesse(6..> | 2011-08-18 15:10 | 32K | |
![[IMG]](/icons/image2.gif) | cardsharps - jesse(7..> | 2011-09-24 13:38 | 32K | |
![[IMG]](/icons/image2.gif) | cardsharps - jesse(8..> | 2011-10-27 21:42 | 32K | |
![[IMG]](/icons/image2.gif) | cardsharps - jesse.jpg | 2011-01-23 19:59 | 32K | |
![[IMG]](/icons/image2.gif) | cardsharps.JPG | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | carolynandilene.JPG | 2010-10-26 12:05 | 135K | |
![[IMG]](/icons/image2.gif) | cartoon.jpeg | 2011-12-25 02:31 | 56K | |
![[IMG]](/icons/image2.gif) | cartoons_01-time.jpg | 2010-10-26 12:05 | 108K | |
![[IMG]](/icons/image2.gif) | cartoons_03-1(1).jpg | 2010-10-26 12:05 | 90K | |
![[IMG]](/icons/image2.gif) | cartoons_03-1(2).jpg | 2010-10-26 12:05 | 90K | |
![[IMG]](/icons/image2.gif) | cartoons_03-1.jpg | 2010-10-26 12:05 | 90K | |
![[IMG]](/icons/image2.gif) | cartoons_03-time.jpg | 2010-10-26 12:05 | 93K | |
![[IMG]](/icons/image2.gif) | cartoons_05-1.jpg | 2010-10-26 12:05 | 138K | |
![[IMG]](/icons/image2.gif) | cartoons_07.jpg | 2010-10-26 12:05 | 111K | |
![[IMG]](/icons/image2.gif) | case-shiller-updated..> | 2010-10-26 12:05 | 328K | |
![[IMG]](/icons/image2.gif) | caseshillerlevelapri..> | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | cat-and-mouse_thumb[..> | 2012-04-11 16:08 | 17K | |
![[IMG]](/icons/image2.gif) | catchme.jpg | 2011-02-20 05:45 | 27K | |
![[IMG]](/icons/image2.gif) | catshooter.jpg | 2011-09-17 13:41 | 28K | |
![[IMG]](/icons/image2.gif) | cb_Feeling_Grizzly-1..> | 2011-08-23 11:02 | 2.8K | |
![[IMG]](/icons/image2.gif) | cb_Feeling_Grizzly-1..> | 2011-10-27 03:56 | 2.8K | |
![[IMG]](/icons/image2.gif) | cb_Feeling_Grizzly-1..> | 2012-01-12 21:13 | 2.8K | |
![[IMG]](/icons/image2.gif) | cb_Feeling_Grizzly-1..> | 2012-01-12 21:15 | 2.8K | |
![[IMG]](/icons/image2.gif) | cb_Feeling_Grizzly-1..> | 2011-08-23 11:01 | 2.8K | |
![[IMG]](/icons/image2.gif) | cbk.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | cc.JPG | 2011-08-30 10:46 | 44K | |
![[IMG]](/icons/image2.gif) | cco(1).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | cco.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | ceco.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | celg chart.JPG | 2011-02-16 22:52 | 83K | |
![[IMG]](/icons/image2.gif) | cenx(1).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | cenx.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | cfn.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | cftc-commissioner-ba..> | 2012-03-08 14:14 | 27K | |
![[IMG]](/icons/image2.gif) | chair(1).gif | 2010-11-17 15:56 | 3.4K | |
![[IMG]](/icons/image2.gif) | chair(2).gif | 2011-03-09 10:46 | 3.4K | |
![[IMG]](/icons/image2.gif) | chair.gif | 2010-10-28 11:59 | 3.4K | |
![[IMG]](/icons/image2.gif) | change-1(1).jpg | 2011-03-11 14:28 | 36K | |
![[IMG]](/icons/image2.gif) | change-1(2).jpg | 2011-09-18 22:19 | 36K | |
![[IMG]](/icons/image2.gif) | change-1(3).jpg | 2011-09-18 22:20 | 36K | |
![[IMG]](/icons/image2.gif) | change-1(4).jpg | 2011-12-11 15:44 | 36K | |
![[IMG]](/icons/image2.gif) | change-1.jpg | 2010-11-04 14:10 | 36K | |
![[IMG]](/icons/image2.gif) | chart(1).jpg | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | chart(2).jpg | 2011-08-02 10:40 | 106K | |
![[IMG]](/icons/image2.gif) | chart-of-the-day-glo..> | 2011-10-29 16:47 | 25K | |
![[IMG]](/icons/image2.gif) | chart-of-the-day-sp-..> | 2011-08-24 19:48 | 140K | |
![[IMG]](/icons/image2.gif) | chart.gif | 2013-05-14 12:56 | 1.7K | |
![[IMG]](/icons/image2.gif) | chart.jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | chart.png | 2010-10-26 12:05 | 34K | |
![[IMG]](/icons/image2.gif) | chart1.jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | chart2.jpg | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | chest_monopoly_www-t..> | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | china%203(1).jpg | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | china%203.jpg | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | china-great-wall-of-..> | 2011-10-30 19:22 | 53K | |
![[IMG]](/icons/image2.gif) | china-great-wall-of-..> | 2011-10-30 19:23 | 53K | |
![[IMG]](/icons/image2.gif) | china-great-wall-of-..> | 2011-10-18 14:23 | 53K | |
![[IMG]](/icons/image2.gif) | china-realestate.jpg | 2010-10-26 12:05 | 73K | |
![[IMG]](/icons/image2.gif) | china.jpg | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | china.png | 2010-10-26 12:05 | 73K | |
![[IMG]](/icons/image2.gif) | china great wall.jpg | 2011-10-02 16:35 | 64K | |
![[IMG]](/icons/image2.gif) | chrismay3(1).jpg | 2011-01-16 05:12 | 29K | |
![[IMG]](/icons/image2.gif) | chrismay3.jpg | 2011-01-05 03:37 | 29K | |
![[IMG]](/icons/image2.gif) | chs(1).png | 2010-11-17 09:18 | 14K | |
![[IMG]](/icons/image2.gif) | chs.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | church-marketing.gif | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | circus_tent.jpg | 2011-09-07 03:29 | 29K | |
![[IMG]](/icons/image2.gif) | cit-bailout-tbi.jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | citizen-kane.jpg | 2010-10-18 20:17 | 21K | |
![[IMG]](/icons/image2.gif) | clap(1).gif | 2010-11-09 14:53 | 1.2K | |
![[IMG]](/icons/image2.gif) | clap(2).gif | 2010-11-17 15:34 | 1.2K | |
![[IMG]](/icons/image2.gif) | clap(3).gif | 2010-11-24 14:43 | 1.2K | |
![[IMG]](/icons/image2.gif) | clap(4).gif | 2010-11-24 14:43 | 1.2K | |
![[IMG]](/icons/image2.gif) | clap(5).gif | 2011-02-23 09:33 | 1.2K | |
![[IMG]](/icons/image2.gif) | clap(6).gif | 2011-03-07 11:57 | 1.2K | |
![[IMG]](/icons/image2.gif) | clap(7).gif | 2011-03-08 13:21 | 1.2K | |
![[IMG]](/icons/image2.gif) | clap(8).gif | 2011-03-17 14:06 | 1.2K | |
![[IMG]](/icons/image2.gif) | clap(9).gif | 2011-03-23 10:12 | 1.2K | |
![[IMG]](/icons/image2.gif) | clap(10).gif | 2011-03-24 11:36 | 1.2K | |
![[IMG]](/icons/image2.gif) | clap(11).gif | 2011-05-20 10:47 | 1.2K | |
![[IMG]](/icons/image2.gif) | clap(12).gif | 2011-06-09 09:48 | 1.2K | |
![[IMG]](/icons/image2.gif) | clap(13).gif | 2011-06-10 11:04 | 1.2K | |
![[IMG]](/icons/image2.gif) | clap(14).gif | 2011-07-14 11:18 | 1.2K | |
![[IMG]](/icons/image2.gif) | clap.gif | 2010-10-28 14:37 | 1.2K | |
![[IMG]](/icons/image2.gif) | class_warfare_prolet..> | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | cld.png | 2010-11-01 14:42 | 14K | |
![[IMG]](/icons/image2.gif) | cleveland_01.jpg | 2010-10-26 12:05 | 113K | |
![[IMG]](/icons/image2.gif) | cleveland_02.jpg | 2010-10-26 12:05 | 115K | |
![[IMG]](/icons/image2.gif) | clfclose.gif | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | cliff.png | 2012-12-05 19:53 | 213K | |
![[IMG]](/icons/image2.gif) | climate - crestock.jpg | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | closeout_sale.jpg | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | cmc.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | cmsphoto019941.jpg | 2011-01-02 22:31 | 124K | |
![[IMG]](/icons/image2.gif) | col-spx-8-16.png | 2010-10-26 12:05 | 93K | |
![[IMG]](/icons/image2.gif) | col-spx-8-25-2.png | 2010-10-26 12:05 | 63K | |
![[IMG]](/icons/image2.gif) | col-spx-8-25.png | 2010-10-26 12:05 | 131K | |
![[IMG]](/icons/image2.gif) | collage1sddfgdfgdfgf..> | 2012-07-26 14:49 | 25K | |
![[IMG]](/icons/image2.gif) | collage1sddfgdfgdfgf..> | 2012-07-25 12:18 | 25K | |
![[IMG]](/icons/image2.gif) | collar.gif | 2010-10-26 12:05 | 6.7K | |
![[IMG]](/icons/image2.gif) | collaspspspse.jpg | 2012-06-08 18:53 | 50K | |
![[IMG]](/icons/image2.gif) | columns-41-silhouett..> | 2010-12-23 02:11 | 44K | |
![[IMG]](/icons/image2.gif) | comp.gif | 2011-06-21 13:26 | 9.0K | |
![[IMG]](/icons/image2.gif) | confidence May 2009.gif | 2010-10-26 12:05 | 10K | |
![[IMG]](/icons/image2.gif) | congress.jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | console 2.JPG | 2011-07-07 13:14 | 495K | |
![[IMG]](/icons/image2.gif) | consumer credit Aug ..> | 2010-10-26 12:05 | 7.8K | |
![[IMG]](/icons/image2.gif) | consumer credit Mar..> | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | continuumsocial.png | 2011-07-23 23:40 | 142K | |
![[IMG]](/icons/image2.gif) | cookie_monster-fruit..> | 2011-08-02 16:45 | 27K | |
![[IMG]](/icons/image2.gif) | corporate-greed_27-0..> | 2012-09-18 17:28 | 66K | |
![[IMG]](/icons/image2.gif) | costco hot dog.jpg | 2011-02-21 19:27 | 26K | |
![[IMG]](/icons/image2.gif) | cot.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | cov.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | cover-foreclosed1.jpg | 2010-10-16 01:42 | 30K | |
![[IMG]](/icons/image2.gif) | cpi_png.jpg | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | cqb.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | craig031011.jpg | 2011-03-10 11:24 | 22K | |
![[IMG]](/icons/image2.gif) | craigzooka_graph_0.png | 2011-07-16 11:09 | 29K | |
![[IMG]](/icons/image2.gif) | cramer greenspan.png | 2010-10-26 12:05 | 242K | |
![[IMG]](/icons/image2.gif) | cramer wrong.jpg | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | crash(1).jpg | 2011-09-09 13:40 | 99K | |
![[IMG]](/icons/image2.gif) | crash.JPG | 2011-09-09 13:35 | 99K | |
![[IMG]](/icons/image2.gif) | crazy_bargain_shoppe..> | 2011-08-17 13:04 | 26K | |
![[IMG]](/icons/image2.gif) | crime_of_the_century..> | 2010-10-26 12:05 | 83K | |
![[IMG]](/icons/image2.gif) | criminal.jpg | 2010-10-26 12:05 | 44K | |
![[IMG]](/icons/image2.gif) | crisis bernanke(1).jpg | 2011-08-22 11:42 | 8.3K | |
![[IMG]](/icons/image2.gif) | crisis bernanke.jpg | 2011-02-23 22:28 | 8.3K | |
![[IMG]](/icons/image2.gif) | crme.png | 2010-11-10 12:34 | 13K | |
![[IMG]](/icons/image2.gif) | croc(3).jpg | 2012-03-31 04:03 | 37K | |
![[IMG]](/icons/image2.gif) | crocs-time.jpg | 2010-10-26 12:05 | 81K | |
![[IMG]](/icons/image2.gif) | cropped-banner-2.jpeg | 2012-10-04 03:54 | 33K | |
![[IMG]](/icons/image2.gif) | crox.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | crunch.jpg | 2011-12-02 20:22 | 60K | |
![[IMG]](/icons/image2.gif) | crystal-ball(1).jpg | 2011-09-29 16:08 | 293K | |
![[IMG]](/icons/image2.gif) | crystal-ball(2).jpg | 2011-09-29 16:08 | 293K | |
![[IMG]](/icons/image2.gif) | crystal-ball(3).jpg | 2011-12-23 12:50 | 293K | |
![[IMG]](/icons/image2.gif) | crystal-ball.jpg | 2011-09-09 13:04 | 293K | |
![[IMG]](/icons/image2.gif) | crzo.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | csc.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | csco1.png | 2011-07-07 12:30 | 80K | |
![[IMG]](/icons/image2.gif) | csun(1).png | 2010-11-08 12:16 | 15K | |
![[IMG]](/icons/image2.gif) | csun.png | 2010-10-26 12:05 | 16K | |
![[DIR]](/icons/folder.gif) | ctct-logs/ | 2024-10-18 20:19 | - | |
![[IMG]](/icons/image2.gif) | ctrn.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | ctsh(1).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | ctsh.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | current-market-snaps..> | 2012-03-11 08:26 | 76K | |
![[IMG]](/icons/image2.gif) | d-3.jpg | 2011-02-09 03:20 | 67K | |
![[IMG]](/icons/image2.gif) | dailyBuy.jpg | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | dailyBuyNum.jpg | 2010-10-26 12:05 | 38K | |
![[IMG]](/icons/image2.gif) | dailyBuySellRatio.jpg | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | david-brown-sepia(1)..> | 2013-06-18 13:42 | 3.0K | |
![[IMG]](/icons/image2.gif) | david-brown-sepia.jpg | 2013-06-18 13:41 | 3.0K | |
![[IMG]](/icons/image2.gif) | davinci.jpg | 2012-12-25 18:28 | 54K | |
![[IMG]](/icons/image2.gif) | dax Aug 16 2011.jpg | 2011-08-16 12:07 | 32K | |
![[IMG]](/icons/image2.gif) | dbrn.png | 2010-11-15 09:57 | 16K | |
![[IMG]](/icons/image2.gif) | dci.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | dds.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | dead-cat-bounce-2011..> | 2011-08-22 09:28 | 75K | |
![[IMG]](/icons/image2.gif) | dead-cat-bounce-2011..> | 2011-09-06 09:05 | 73K | |
![[IMG]](/icons/image2.gif) | deadcatbounce2008.jpg | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | debt.png | 2011-12-02 13:44 | 244K | |
![[IMG]](/icons/image2.gif) | debt Web Sept 20 201..> | 2011-09-20 08:17 | 61K | |
![[IMG]](/icons/image2.gif) | deer(1).jpg | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | deer.jpg | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | deficit trailing 12 ..> | 2010-10-26 12:05 | 8.2K | |
![[IMG]](/icons/image2.gif) | deflation gum.jpg | 2010-10-26 12:05 | 85K | |
![[IMG]](/icons/image2.gif) | delusionol-ad.png | 2010-10-26 12:05 | 170K | |
![[IMG]](/icons/image2.gif) | demarco(1).png | 2012-01-14 00:57 | 192K | |
![[IMG]](/icons/image2.gif) | demarco.png | 2011-11-30 16:43 | 192K | |
![[IMG]](/icons/image2.gif) | denial.jpg | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | depression.jpg | 2012-02-03 14:11 | 68K | |
![[IMG]](/icons/image2.gif) | depression_fig1.gif | 2010-10-26 12:05 | 4.6K | |
![[IMG]](/icons/image2.gif) | depression_fig2.gif | 2010-10-26 12:05 | 4.7K | |
![[IMG]](/icons/image2.gif) | depression_fig3.gif | 2010-10-26 12:05 | 4.5K | |
![[IMG]](/icons/image2.gif) | depression_fig4.gif | 2010-10-26 12:05 | 4.3K | |
![[IMG]](/icons/image2.gif) | depression_fig5.gif | 2010-10-26 12:05 | 4.1K | |
![[IMG]](/icons/image2.gif) | depression_fig6(1).gif | 2010-10-26 12:05 | 6.5K | |
![[IMG]](/icons/image2.gif) | depression_fig6.gif | 2010-10-26 12:05 | 6.5K | |
![[IMG]](/icons/image2.gif) | dfs.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | dg.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | dh.png | 2010-10-26 12:05 | 82K | |
![[IMG]](/icons/image2.gif) | dhs-mediacontrol.jpg | 2011-10-05 14:55 | 39K | |
![[IMG]](/icons/image2.gif) | dia nov 19 09.png | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | dia puts june 10.png | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | dictateur.jpg | 2011-03-01 16:41 | 47K | |
![[IMG]](/icons/image2.gif) | dig(1).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | dig.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | disease_fatalities_5..> | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | distribution.jpg | 2010-10-26 12:05 | 106K | |
![[IMG]](/icons/image2.gif) | divine greed(1).jpg | 2010-11-15 18:53 | 17K | |
![[IMG]](/icons/image2.gif) | divine greed(2).jpg | 2010-12-21 00:13 | 30K | |
![[IMG]](/icons/image2.gif) | divine greed(3).jpg | 2011-01-15 16:58 | 17K | |
![[IMG]](/icons/image2.gif) | divine greed(4).jpg | 2011-02-16 14:39 | 17K | |
![[IMG]](/icons/image2.gif) | divine greed(5).jpg | 2011-12-14 15:21 | 17K | |
![[IMG]](/icons/image2.gif) | divine greed.jpg | 2010-11-15 18:41 | 17K | |
![[IMG]](/icons/image2.gif) | dji.png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | djia(1).png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | djia.png | 2010-10-26 12:05 | 8.1K | |
![[IMG]](/icons/image2.gif) | djia3peaks.png | 2011-11-22 14:02 | 158K | |
![[IMG]](/icons/image2.gif) | dollar.png | 2011-08-09 01:09 | 227K | |
![[IMG]](/icons/image2.gif) | dont-worry-im-coming..> | 2011-07-27 21:29 | 63K | |
![[IMG]](/icons/image2.gif) | double-dipping-72520..> | 2010-12-23 02:04 | 22K | |
![[IMG]](/icons/image2.gif) | double-dipping-72520..> | 2011-05-04 04:10 | 22K | |
![[IMG]](/icons/image2.gif) | double-dipping-72520..> | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | double-dipping.jpg | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | dow.png | 2010-11-18 15:48 | 13K | |
![[IMG]](/icons/image2.gif) | dow70yearupdatesept1..> | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | dow 81 puts may 2009..> | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | dow 1209(1).jpg | 2010-10-26 12:05 | 66K | |
![[IMG]](/icons/image2.gif) | dow 1209.jpg | 2010-10-26 12:05 | 66K | |
![[IMG]](/icons/image2.gif) | dow cloud.PNG | 2011-11-28 14:01 | 159K | |
![[IMG]](/icons/image2.gif) | download(1).jpeg | 2012-08-02 14:26 | 4.7K | |
![[IMG]](/icons/image2.gif) | download(2).jpeg | 2012-12-11 23:09 | 9.8K | |
![[IMG]](/icons/image2.gif) | download.jpeg | 2012-07-17 12:49 | 8.8K | |
![[IMG]](/icons/image2.gif) | download.png | 2012-09-14 02:11 | 34K | |
![[IMG]](/icons/image2.gif) | dow resistance.PNG | 2011-11-28 14:00 | 191K | |
![[IMG]](/icons/image2.gif) | dps.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | dpz.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | dr_mabuse-jesse(1).jpg | 2011-10-08 18:02 | 37K | |
![[IMG]](/icons/image2.gif) | dr_mabuse-jesse.jpg | 2011-10-08 15:13 | 37K | |
![[IMG]](/icons/image2.gif) | dried-apple.jpg | 2012-04-23 21:31 | 45K | |
![[IMG]](/icons/image2.gif) | drink-coffee(1).jpg | 2011-06-30 02:20 | 29K | |
![[IMG]](/icons/image2.gif) | drink-coffee.jpg | 2011-06-10 13:54 | 29K | |
![[IMG]](/icons/image2.gif) | drn(1).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | drn.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | drv(1).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | drv(2).png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | drv(3).png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | drv.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | dshortcurrent-0_55x0..> | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | dsw.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | dtv.png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | dude_wheres_my_car_p..> | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | dug(1).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | dug.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | durable goods Sept 0..> | 2010-10-26 12:05 | 10K | |
![[IMG]](/icons/image2.gif) | dx.JPG | 2011-07-19 10:20 | 266K | |
![[IMG]](/icons/image2.gif) | dx1.png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | e5410c4f93256a7a30f9..> | 2011-03-23 13:54 | 12K | |
![[IMG]](/icons/image2.gif) | ear-2(1).jpg | 2013-06-02 22:57 | 49K | |
![[IMG]](/icons/image2.gif) | ear-2.jpg | 2013-06-02 22:56 | 49K | |
![[IMG]](/icons/image2.gif) | easy_credit-jda.jpg | 2011-10-19 17:03 | 30K | |
![[IMG]](/icons/image2.gif) | easy_credit.jpg | 2011-01-05 03:55 | 27K | |
![[IMG]](/icons/image2.gif) | eberly (1).jpg | 2012-05-05 13:13 | 14K | |
![[IMG]](/icons/image2.gif) | eberly.jpg | 2012-05-05 13:12 | 14K | |
![[IMG]](/icons/image2.gif) | einstein-math.jpg | 2012-02-01 03:32 | 41K | |
![[IMG]](/icons/image2.gif) | ek.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | elizabeth-warren-att..> | 2012-11-07 05:39 | 12K | |
![[IMG]](/icons/image2.gif) | elizabeth-warren-ban..> | 2012-11-20 20:49 | 30K | |
![[IMG]](/icons/image2.gif) | elizabeth-warren.jpg | 2011-09-20 12:25 | 49K | |
![[IMG]](/icons/image2.gif) | elk.jpg | 2010-10-26 12:05 | 110K | |
![[IMG]](/icons/image2.gif) | email-1344348_44.png | 2011-08-04 12:56 | 94K | |
![[IMG]](/icons/image2.gif) | employment cost oct ..> | 2010-10-26 12:05 | 6.7K | |
![[IMG]](/icons/image2.gif) | endfed2.jpg | 2011-04-09 04:31 | 45K | |
![[IMG]](/icons/image2.gif) | ener.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | enhanced-buzz-10173-..> | 2013-05-22 13:00 | 114K | |
![[IMG]](/icons/image2.gif) | ens(1).png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | ens.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | entg.png | 2010-10-26 09:19 | 16K | |
![[IMG]](/icons/image2.gif) | entitlements_02-850.jpg | 2010-10-26 12:05 | 58K | |
![[IMG]](/icons/image2.gif) | ericschmidt4_tbi(1).jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | ericschmidt4_tbi.jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | erts.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | erx(1).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | erx(2).png | 2010-11-09 09:21 | 13K | |
![[IMG]](/icons/image2.gif) | erx.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | ery(1).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | ery(2).png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | ery(3).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | ery(4).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | ery(5).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | ery(6).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | ery(7).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | ery(8).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | ery(9).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | ery.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | ery3.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | ery4.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | es-1.png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | es.JPG | 2011-11-15 10:08 | 20K | |
![[IMG]](/icons/image2.gif) | euo.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | evil.jpg | 2010-11-13 13:29 | 513K | |
![[IMG]](/icons/image2.gif) | evolution-ape-teachi..> | 2012-03-23 03:19 | 14K | |
![[IMG]](/icons/image2.gif) | excrement.jpg | 2011-03-11 14:34 | 20K | |
![[IMG]](/icons/image2.gif) | excuse-me-im-calling..> | 2011-10-31 22:24 | 26K | |
![[IMG]](/icons/image2.gif) | excuse-me-im-calling..> | 2011-01-05 16:26 | 23K | |
![[IMG]](/icons/image2.gif) | executive comp.jpg | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | f(1).jpg | 2010-10-26 12:05 | 140K | |
![[IMG]](/icons/image2.gif) | f(1).png | 2010-10-20 12:16 | 18K | |
![[IMG]](/icons/image2.gif) | f.jpg | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | f.png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | f_bomb.jpg | 2011-02-11 01:24 | 19K | |
![[IMG]](/icons/image2.gif) | f_for_fake_poster(1)..> | 2011-10-12 13:12 | 66K | |
![[IMG]](/icons/image2.gif) | f_for_fake_poster.jpg | 2011-10-05 17:04 | 66K | |
![[IMG]](/icons/image2.gif) | fail-19922441_0.jpg | 2013-01-12 03:43 | 63K | |
![[IMG]](/icons/image2.gif) | fas(1).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | fas(2).png | 2010-10-18 09:28 | 16K | |
![[IMG]](/icons/image2.gif) | fas.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | fas Aug 9 2011.jpg | 2011-08-08 10:16 | 62K | |
![[IMG]](/icons/image2.gif) | faz(1).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | faz.png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | fcs.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | fdo.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | fed Chart Aug 15 201..> | 2011-08-15 09:09 | 14K | |
![[IMG]](/icons/image2.gif) | fedds_dees.jpg | 2012-03-27 16:28 | 57K | |
![[IMG]](/icons/image2.gif) | fed punchbowl 2-dail..> | 2011-09-21 16:23 | 27K | |
![[IMG]](/icons/image2.gif) | ff-mat-honan-passwor..> | 2012-12-11 13:15 | 107K | |
![[IMG]](/icons/image2.gif) | fib2.gif | 2011-05-04 16:59 | 2.4K | |
![[IMG]](/icons/image2.gif) | fiber-lies.jpg | 2010-10-26 12:05 | 58K | |
![[IMG]](/icons/image2.gif) | file.png | 2011-12-06 14:28 | 4.2K | |
![[DIR]](/icons/folder.gif) | file/ | 2024-02-28 23:39 | - | |
![[IMG]](/icons/image2.gif) | financial Bridge.jpg | 2011-06-18 09:28 | 3.7K | |
![[IMG]](/icons/image2.gif) | financialengineers(1..> | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | financialengineers(2..> | 2010-12-23 02:31 | 36K | |
![[IMG]](/icons/image2.gif) | financialengineers(3..> | 2011-02-12 05:25 | 36K | |
![[IMG]](/icons/image2.gif) | financialengineers(4..> | 2011-02-14 02:13 | 36K | |
![[IMG]](/icons/image2.gif) | financialengineers(5..> | 2011-02-23 22:14 | 36K | |
![[IMG]](/icons/image2.gif) | financialengineers(6..> | 2011-09-03 11:51 | 36K | |
![[IMG]](/icons/image2.gif) | financialengineers(7..> | 2011-11-05 14:09 | 36K | |
![[IMG]](/icons/image2.gif) | financialengineers(8..> | 2012-01-09 13:32 | 36K | |
![[IMG]](/icons/image2.gif) | financialengineers.jpg | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | fired-jda.jpg | 2011-10-17 15:45 | 31K | |
![[IMG]](/icons/image2.gif) | first-solar-hq-tbi-0..> | 2010-10-26 12:05 | 73K | |
![[IMG]](/icons/image2.gif) | first national bank.jpg | 2011-09-17 12:59 | 19K | |
![[IMG]](/icons/image2.gif) | fisker.jpg | 2013-04-18 15:03 | 75K | |
![[IMG]](/icons/image2.gif) | fitb.png | 2010-10-26 12:05 | 15K | |
![[DIR]](/icons/folder.gif) | flash/ | 2016-08-07 09:57 | - | |
![[IMG]](/icons/image2.gif) | flash gordon.gif | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | flat-world-earth(1).jpg | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | flat-world-earth.jpg | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | flush.gif | 2010-10-26 12:05 | 3.6K | |
![[IMG]](/icons/image2.gif) | fmcn.png | 2010-11-18 12:11 | 14K | |
![[IMG]](/icons/image2.gif) | fo.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | forclosure.gif | 2010-10-26 12:05 | 101K | |
![[IMG]](/icons/image2.gif) | foreclosed scene.jpg | 2011-03-03 23:28 | 38K | |
![[IMG]](/icons/image2.gif) | forex.png | 2012-04-28 08:25 | 64K | |
![[IMG]](/icons/image2.gif) | fork.jpg | 2011-11-21 15:32 | 5.4K | |
![[IMG]](/icons/image2.gif) | fosl(1).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | fosl.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | fq8x5lk(1).png | 2011-03-28 15:21 | 121K | |
![[IMG]](/icons/image2.gif) | fq8x5lk.png | 2011-03-24 19:41 | 121K | |
![[IMG]](/icons/image2.gif) | free-lunch.jpg | 2011-09-30 12:24 | 91K | |
![[IMG]](/icons/image2.gif) | free-money(1).jpg | 2011-07-07 12:57 | 36K | |
![[IMG]](/icons/image2.gif) | free-money.jpg | 2011-07-07 12:56 | 36K | |
![[IMG]](/icons/image2.gif) | free-trade-cartoon.jpeg | 2012-09-20 15:49 | 88K | |
![[IMG]](/icons/image2.gif) | free_400222.jpg | 2011-01-13 19:55 | 81K | |
![[IMG]](/icons/image2.gif) | freedom.jpeg | 2012-09-20 15:45 | 12K | |
![[IMG]](/icons/image2.gif) | freedom.jpg | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | f report(1).jpg | 2010-11-15 11:23 | 301K | |
![[IMG]](/icons/image2.gif) | f report.jpg | 2010-11-15 11:19 | 301K | |
![[IMG]](/icons/image2.gif) | f report 2.jpg | 2010-11-15 11:23 | 342K | |
![[IMG]](/icons/image2.gif) | f report 3.jpg | 2010-11-15 11:24 | 771K | |
![[IMG]](/icons/image2.gif) | f report 4.jpg | 2010-11-15 11:24 | 506K | |
![[IMG]](/icons/image2.gif) | f report 5.jpg | 2010-11-15 11:25 | 192K | |
![[IMG]](/icons/image2.gif) | frohlichesneujahr-je..> | 2011-12-31 14:36 | 27K | |
![[IMG]](/icons/image2.gif) | fruit.jpg | 2010-10-26 12:05 | 44K | |
![[IMG]](/icons/image2.gif) | fsii.png | 2010-10-19 15:11 | 15K | |
![[IMG]](/icons/image2.gif) | fslr.png | 2010-11-09 09:21 | 15K | |
![[IMG]](/icons/image2.gif) | fslr report 1.jpg | 2010-11-12 15:29 | 291K | |
![[IMG]](/icons/image2.gif) | fslr report 2.jpg | 2010-11-12 15:30 | 366K | |
![[IMG]](/icons/image2.gif) | fslr report 3.jpg | 2010-11-12 15:43 | 776K | |
![[IMG]](/icons/image2.gif) | fslr report 4.jpg | 2010-11-12 15:43 | 342K | |
![[IMG]](/icons/image2.gif) | fu.JPG | 2011-10-27 13:06 | 27K | |
![[IMG]](/icons/image2.gif) | funny-graffiti-stenc..> | 2012-01-13 14:37 | 29K | |
![[IMG]](/icons/image2.gif) | funny-graffiti-stenc..> | 2012-01-06 02:26 | 29K | |
![[IMG]](/icons/image2.gif) | future.png | 2012-01-12 03:35 | 178K | |
![[IMG]](/icons/image2.gif) | g2basn5.png | 2012-01-06 13:54 | 100K | |
![[IMG]](/icons/image2.gif) | galex-20060823-brows..> | 2011-11-01 04:27 | 109K | |
![[IMG]](/icons/image2.gif) | gann 360.png | 2011-10-07 13:57 | 84K | |
![[IMG]](/icons/image2.gif) | gap.png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | gateau-au-fromage.jpeg | 2012-08-22 18:39 | 25K | |
![[IMG]](/icons/image2.gif) | gdp-russ.png | 2011-10-22 21:37 | 20K | |
![[IMG]](/icons/image2.gif) | gdp Sept 12 2011.jpg | 2011-09-12 07:41 | 13K | |
![[IMG]](/icons/image2.gif) | geithner.jpg | 2010-10-26 12:05 | 9.5K | |
![[IMG]](/icons/image2.gif) | geithy(1).jpg | 2011-09-16 16:20 | 20K | |
![[IMG]](/icons/image2.gif) | geithy.jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | george-orwell4-tm.jpeg | 2012-08-03 15:32 | 19K | |
![[IMG]](/icons/image2.gif) | george-soros-pretty-..> | 2011-09-22 03:07 | 102K | |
![[IMG]](/icons/image2.gif) | germany_1295447c.jpg | 2011-08-16 15:58 | 26K | |
![[IMG]](/icons/image2.gif) | gethner.jpg | 2010-10-26 12:05 | 79K | |
![[IMG]](/icons/image2.gif) | gil.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | global_meltdown_002.gif | 2010-10-26 12:05 | 59K | |
![[IMG]](/icons/image2.gif) | gloomy.jpg | 2011-12-21 23:53 | 34K | |
![[IMG]](/icons/image2.gif) | gmCR July 27 2011.jpg | 2011-07-27 10:58 | 11K | |
![[IMG]](/icons/image2.gif) | gmcr.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | gmdestroyed-tbi.jpg | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | gmxr.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | goats-bi.jpg | 2011-10-20 16:03 | 7.2K | |
![[IMG]](/icons/image2.gif) | godzilla1954c.jpg | 2013-06-03 13:44 | 410K | |
![[IMG]](/icons/image2.gif) | going-out-of-busines..> | 2011-08-31 20:54 | 25K | |
![[IMG]](/icons/image2.gif) | gold in Euros nov 09..> | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | goldman, tbi.jpg | 2010-10-26 12:05 | 80K | |
![[IMG]](/icons/image2.gif) | goldman-large.jpg | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | goldman_market_0720.jpg | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | goldman_sachs_0716.jpg | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | goldmine.jpg | 2011-03-14 14:42 | 44K | |
![[IMG]](/icons/image2.gif) | goldonmilkcarton.jpg | 2013-04-25 15:09 | 23K | |
![[IMG]](/icons/image2.gif) | goodnews.jpg | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | gordon-gecko_1.png | 2010-10-26 12:05 | 60K | |
![[IMG]](/icons/image2.gif) | gordon-gekko-from-wa..> | 2012-08-03 15:34 | 27K | |
![[IMG]](/icons/image2.gif) | gore-hockey-stick(1)..> | 2011-04-04 15:35 | 27K | |
![[IMG]](/icons/image2.gif) | gore-hockey-stick(2)..> | 2011-04-04 15:40 | 27K | |
![[IMG]](/icons/image2.gif) | gore-hockey-stick(3)..> | 2011-04-08 15:28 | 27K | |
![[IMG]](/icons/image2.gif) | gore-hockey-stick.jpg | 2011-04-04 15:34 | 27K | |
![[IMG]](/icons/image2.gif) | governmentdemotivato..> | 2011-12-02 11:18 | 100K | |
![[IMG]](/icons/image2.gif) | governmentdemotivato..> | 2011-11-15 11:12 | 100K | |
![[IMG]](/icons/image2.gif) | graffiti_15.jpg | 2011-01-08 16:13 | 40K | |
![[IMG]](/icons/image2.gif) | grapevine - crestock..> | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | graph-1.jpg | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | graph.jpg | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | graphic873(1).png | 2011-08-10 01:00 | 12K | |
![[IMG]](/icons/image2.gif) | graphic873.png | 2011-08-10 00:54 | 12K | |
![[IMG]](/icons/image2.gif) | graphic874(1).png | 2011-08-10 01:01 | 16K | |
![[IMG]](/icons/image2.gif) | graphic874.png | 2011-08-10 00:54 | 16K | |
![[IMG]](/icons/image2.gif) | graphic875(1).png | 2011-08-10 01:03 | 14K | |
![[IMG]](/icons/image2.gif) | graphic875.png | 2011-08-10 00:55 | 14K | |
![[IMG]](/icons/image2.gif) | graphic1235.png | 2011-12-17 17:50 | 20K | |
![[IMG]](/icons/image2.gif) | graphic1469.png | 2012-02-09 20:43 | 21K | |
![[IMG]](/icons/image2.gif) | graphic1521.png | 2012-03-04 17:24 | 30K | |
![[DIR]](/icons/folder.gif) | gravity_forms/ | 2024-02-23 00:00 | - | |
![[IMG]](/icons/image2.gif) | great-depression.jpg | 2011-08-05 15:19 | 54K | |
![[IMG]](/icons/image2.gif) | greece-violence(1).jpg | 2012-02-11 05:05 | 42K | |
![[IMG]](/icons/image2.gif) | greece-violence.jpg | 2012-02-11 05:04 | 42K | |
![[IMG]](/icons/image2.gif) | green-beer.jpg | 2010-10-26 12:05 | 88K | |
![[IMG]](/icons/image2.gif) | green-traffic-light.jpg | 2013-04-21 21:20 | 13K | |
![[IMG]](/icons/image2.gif) | greenlight-freefoto.jpg | 2010-10-26 12:05 | 91K | |
![[IMG]](/icons/image2.gif) | grilled squid.jpg | 2010-12-10 01:52 | 17K | |
![[IMG]](/icons/image2.gif) | grim_reaper_by_black..> | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | grocery2.jpg | 2011-08-03 14:45 | 28K | |
![[IMG]](/icons/image2.gif) | gross_pimco_1218(1).jpg | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | gross_pimco_1218.jpg | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | groundhoghole_thumb.jpg | 2012-02-06 00:33 | 4.9K | |
![[IMG]](/icons/image2.gif) | groupwave(1).gif | 2010-11-17 10:14 | 16K | |
![[IMG]](/icons/image2.gif) | groupwave(2).gif | 2011-03-01 13:21 | 16K | |
![[IMG]](/icons/image2.gif) | groupwave(3).gif | 2011-03-08 14:05 | 16K | |
![[IMG]](/icons/image2.gif) | groupwave(4).gif | 2011-03-10 13:58 | 16K | |
![[IMG]](/icons/image2.gif) | groupwave(5).gif | 2011-05-26 14:48 | 16K | |
![[IMG]](/icons/image2.gif) | groupwave(6).gif | 2011-06-16 14:25 | 16K | |
![[IMG]](/icons/image2.gif) | groupwave.gif | 2010-11-10 13:29 | 16K | |
![[IMG]](/icons/image2.gif) | gs.png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | gse_multipart40934.jpg | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | gtl 8_0(1).png | 2011-05-05 03:39 | 34K | |
![[IMG]](/icons/image2.gif) | gtl 8_0.png | 2011-05-05 03:35 | 34K | |
![[IMG]](/icons/image2.gif) | gtl 12.gif | 2011-05-05 03:44 | 77K | |
![[IMG]](/icons/image2.gif) | gty_occupy_wall_Stre..> | 2011-10-27 21:28 | 47K | |
![[IMG]](/icons/image2.gif) | guantanamo.jpg | 2011-04-25 15:17 | 18K | |
![[IMG]](/icons/image2.gif) | gun-control-policies..> | 2012-12-15 03:34 | 136K | |
![[IMG]](/icons/image2.gif) | gun1dailybail(1).jpg | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | gun1dailybail.jpg | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | gun_ownership_deaths..> | 2013-01-25 21:48 | 102K | |
![[IMG]](/icons/image2.gif) | gy_box.png | 2015-06-03 09:23 | 82K | |
![[IMG]](/icons/image2.gif) | gy_chart_gogo.png | 2015-06-03 09:23 | 43K | |
![[IMG]](/icons/image2.gif) | gy_chart_uco.png | 2015-06-03 09:23 | 33K | |
![[IMG]](/icons/image2.gif) | gymb.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | h2.gif | 2011-09-30 10:21 | 2.2K | |
![[IMG]](/icons/image2.gif) | haggenmacher-jesse's..> | 2010-10-26 12:05 | 44K | |
![[IMG]](/icons/image2.gif) | hangover.jpg | 2012-11-13 17:52 | 82K | |
![[IMG]](/icons/image2.gif) | har.png | 2010-11-11 09:21 | 14K | |
![[IMG]](/icons/image2.gif) | harold-camping_t470-..> | 2011-06-23 13:15 | 18K | |
![[IMG]](/icons/image2.gif) | hban.png | 2010-10-18 15:10 | 15K | |
![[IMG]](/icons/image2.gif) | head04(1).jpg | 2011-01-27 20:33 | 127K | |
![[IMG]](/icons/image2.gif) | head04.jpg | 2011-01-27 03:28 | 127K | |
![[IMG]](/icons/image2.gif) | health care.jpg | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | helicopter ben(1).jpg | 2011-08-23 00:19 | 11K | |
![[IMG]](/icons/image2.gif) | helicopter ben(2).jpg | 2011-09-08 15:57 | 11K | |
![[IMG]](/icons/image2.gif) | helicopter ben(3).jpg | 2011-09-21 03:34 | 11K | |
![[IMG]](/icons/image2.gif) | helicopter ben(4).jpg | 2011-10-13 15:51 | 11K | |
![[IMG]](/icons/image2.gif) | helicopter ben(5).jpg | 2011-12-12 16:06 | 11K | |
![[IMG]](/icons/image2.gif) | helicopter ben.jpg | 2011-03-01 23:10 | 11K | |
![[IMG]](/icons/image2.gif) | henry-paulson-0910-0..> | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | henry niman(1).gif | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | henry niman.GIF | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | henry niman.JPG | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | henry niman.PNG | 2010-10-26 12:05 | 172K | |
![[IMG]](/icons/image2.gif) | here-come-the-stock-..> | 2012-11-18 18:36 | 11K | |
![[IMG]](/icons/image2.gif) | hibb.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | hnt.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | holiday_labor.JPG | 2011-09-01 12:56 | 42K | |
![[IMG]](/icons/image2.gif) | home3v2.jpg | 2010-11-08 12:57 | 160K | |
![[IMG]](/icons/image2.gif) | hopen1(1).png | 2011-10-20 12:14 | 205K | |
![[IMG]](/icons/image2.gif) | hopen1.png | 2011-10-20 12:13 | 205K | |
![[IMG]](/icons/image2.gif) | hot.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | householdsurvey20091..> | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | housing(1).jpg | 2010-11-10 14:25 | 24K | |
![[IMG]](/icons/image2.gif) | housing(2).jpg | 2011-02-10 03:46 | 24K | |
![[IMG]](/icons/image2.gif) | housing-slump-pictur..> | 2011-07-27 21:50 | 23K | |
![[IMG]](/icons/image2.gif) | housing.jpg | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | housing_0810_05(1).jpg | 2010-10-26 12:05 | 71K | |
![[IMG]](/icons/image2.gif) | housing_0810_05.jpg | 2010-10-26 12:05 | 71K | |
![[IMG]](/icons/image2.gif) | housing_0810_07.jpg | 2010-10-26 12:05 | 71K | |
![[IMG]](/icons/image2.gif) | hov(1).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | hov(2).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | hov.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | hrbn.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | hudson-200x300.jpg | 2011-03-25 05:05 | 17K | |
![[IMG]](/icons/image2.gif) | hugh-hendry(1).jpg | 2011-09-19 12:33 | 8.2K | |
![[IMG]](/icons/image2.gif) | hugh-hendry(2).jpg | 2011-10-27 19:40 | 8.2K | |
![[IMG]](/icons/image2.gif) | hugh-hendry.jpg | 2010-10-26 12:05 | 8.2K | |
![[IMG]](/icons/image2.gif) | hurricane.jpg | 2011-08-26 04:07 | 47K | |
![[IMG]](/icons/image2.gif) | hurts.png | 2012-01-14 23:37 | 60K | |
![[IMG]](/icons/image2.gif) | hydrogen-nuclear-wea..> | 2011-08-18 15:16 | 60K | |
![[IMG]](/icons/image2.gif) | hyperinflation(1).jpg | 2011-10-16 14:57 | 35K | |
![[IMG]](/icons/image2.gif) | hyperinflation.jpg | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | hyperinflation_(1).jpg | 2010-10-26 12:05 | 34K | |
![[IMG]](/icons/image2.gif) | hyperinflation_.jpg | 2010-10-26 12:05 | 34K | |
![[IMG]](/icons/image2.gif) | i-told-you-so-jigsaw..> | 2010-10-26 12:05 | 40K | |
![[IMG]](/icons/image2.gif) | iBtGrmuTu0Ljw-russ-o..> | 2011-10-22 21:38 | 124K | |
![[IMG]](/icons/image2.gif) | ibm.png | 2011-04-19 16:14 | 110K | |
![[IMG]](/icons/image2.gif) | idiots(1).jpg | 2011-03-20 20:40 | 39K | |
![[IMG]](/icons/image2.gif) | idiots.jpg | 2010-12-13 20:10 | 39K | |
![[IMG]](/icons/image2.gif) | iiin.png | 2010-10-21 09:25 | 12K | |
![[IMG]](/icons/image2.gif) | image.jpg | 2012-01-12 15:21 | 38K | |
![[DIR]](/icons/folder.gif) | image/ | 2024-02-28 23:51 | - | |
![[IMG]](/icons/image2.gif) | image001.jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | image001.png | 2011-07-08 14:59 | 14K | |
![[IMG]](/icons/image2.gif) | image002(1).png | 2011-07-08 15:00 | 45K | |
![[IMG]](/icons/image2.gif) | image002.jpg | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | image002.png | 2011-07-08 15:00 | 45K | |
![[IMG]](/icons/image2.gif) | image002_30698E10.gif | 2010-12-18 16:59 | 9.9K | |
![[IMG]](/icons/image2.gif) | image1589.jpg | 2012-03-23 14:06 | 27K | |
![[IMG]](/icons/image2.gif) | images(1).jpeg | 2012-07-21 14:53 | 7.7K | |
![[IMG]](/icons/image2.gif) | images(1).jpg | 2011-08-08 13:54 | 3.3K | |
![[IMG]](/icons/image2.gif) | images(2).jpeg | 2012-08-09 16:00 | 5.4K | |
![[IMG]](/icons/image2.gif) | images(2).jpg | 2011-08-16 15:07 | 9.9K | |
![[IMG]](/icons/image2.gif) | images(3).jpeg | 2012-09-14 12:26 | 11K | |
![[IMG]](/icons/image2.gif) | images(3).jpg | 2011-08-23 23:28 | 6.1K | |
![[IMG]](/icons/image2.gif) | images-1 (2).jpg | 2011-12-02 14:32 | 7.2K | |
![[IMG]](/icons/image2.gif) | images.jpeg | 2011-10-04 19:57 | 12K | |
![[IMG]](/icons/image2.gif) | images.jpg | 2011-07-02 03:10 | 2.5K | |
![[IMG]](/icons/image2.gif) | imagesCA5FX97W.jpg | 2011-05-30 16:21 | 6.8K | |
![[IMG]](/icons/image2.gif) | imagesCAD66X9T.jpg | 2011-06-26 17:30 | 4.5K | |
![[IMG]](/icons/image2.gif) | immelt-1.jpg | 2013-04-27 13:10 | 28K | |
![[IMG]](/icons/image2.gif) | income.png | 2012-08-05 05:34 | 139K | |
![[IMG]](/icons/image2.gif) | incomegrowth.jpg | 2012-04-18 14:31 | 24K | |
![[TXT]](/icons/text.gif) | info.php | 2012-11-23 21:28 | 58 | |
![[IMG]](/icons/image2.gif) | infy(1).png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | infy.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | inside-job-top.jpg | 2011-01-13 04:14 | 224K | |
![[IMG]](/icons/image2.gif) | insider_trading_1016..> | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | insider_trading_1019..> | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | intel-smart-tv-subwa..> | 2013-01-03 05:33 | 86K | |
![[IMG]](/icons/image2.gif) | investors-hedge-news..> | 2010-10-26 12:05 | 790K | |
![[IMG]](/icons/image2.gif) | investors-hedge-news..> | 2010-10-26 12:05 | 787K | |
![[IMG]](/icons/image2.gif) | ista.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | italy (1).png | 2011-12-06 21:15 | 243K | |
![[IMG]](/icons/image2.gif) | its-a-conspiracy.jpg | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | iwm 11_1(1).png | 2011-11-01 13:48 | 348K | |
![[IMG]](/icons/image2.gif) | iwm 11_1(2).png | 2011-11-01 14:28 | 348K | |
![[IMG]](/icons/image2.gif) | iwm 11_1.png | 2011-11-01 13:40 | 348K | |
![[IMG]](/icons/image2.gif) | iwm513.png | 2011-05-13 09:49 | 114K | |
![[IMG]](/icons/image2.gif) | jack.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | jamie dimon.jpg | 2011-02-18 21:35 | 24K | |
![[IMG]](/icons/image2.gif) | jamie dimon quotes(1..> | 2011-01-27 18:33 | 17K | |
![[IMG]](/icons/image2.gif) | jamie dimon quotes(2..> | 2012-04-13 15:02 | 19K | |
![[IMG]](/icons/image2.gif) | jamie dimon quotes.jpg | 2011-01-25 16:34 | 17K | |
![[IMG]](/icons/image2.gif) | janet-tavakoli.jpg | 2011-10-30 19:15 | 9.9K | |
![[IMG]](/icons/image2.gif) | janet.jpg | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | japan-spinning-plate..> | 2012-03-05 16:30 | 13K | |
![[IMG]](/icons/image2.gif) | japan-wave.jpg | 2011-08-05 00:12 | 33K | |
![[IMG]](/icons/image2.gif) | japan.jpg | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | jaso.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | jaw-hit.jpg | 2012-01-08 14:15 | 24K | |
![[IMG]](/icons/image2.gif) | jbl(1).png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | jbl.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | jcg.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | jcp.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | jesseamericaincafe.jpg | 2010-10-26 12:05 | 37K | |
![[IMG]](/icons/image2.gif) | jh6nurj.png | 2011-04-01 14:02 | 52K | |
![[IMG]](/icons/image2.gif) | jks.png | 2010-10-28 10:29 | 15K | |
![[IMG]](/icons/image2.gif) | jnpr.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | jobs.jpeg | 2012-02-09 17:26 | 54K | |
![[IMG]](/icons/image2.gif) | jobs Sept 9 2011.jpg | 2011-09-09 07:51 | 20K | |
![[IMG]](/icons/image2.gif) | john-boehner.jpg | 2011-09-18 22:08 | 33K | |
![[IMG]](/icons/image2.gif) | john-paulson(1).jpg | 2011-12-08 12:21 | 28K | |
![[IMG]](/icons/image2.gif) | john-paulson.jpg | 2011-10-13 15:34 | 28K | |
![[IMG]](/icons/image2.gif) | johnmack-serious_tbi..> | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | johnpaulson-glasses-..> | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | joker(1).jpg | 2011-08-02 14:41 | 48K | |
![[IMG]](/icons/image2.gif) | joker(2).jpg | 2011-08-09 11:03 | 48K | |
![[IMG]](/icons/image2.gif) | joker.JPG | 2011-07-26 14:29 | 48K | |
![[IMG]](/icons/image2.gif) | jon-corzine-bi.jpg | 2011-11-01 15:24 | 17K | |
![[IMG]](/icons/image2.gif) | jon-corzine-new-jers..> | 2011-11-10 16:35 | 39K | |
![[IMG]](/icons/image2.gif) | joseph_j_cassano(1).jpg | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | joseph_j_cassano.jpg | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | jpgImage.jpg | 2010-11-21 03:11 | 70K | |
![[IMG]](/icons/image2.gif) | jrubino.jpg | 2010-10-26 12:05 | 5.1K | |
![[DIR]](/icons/folder.gif) | js_cache/ | 2024-02-28 23:51 | - | |
![[IMG]](/icons/image2.gif) | jump.jpg | 2012-03-19 21:19 | 25K | |
![[IMG]](/icons/image2.gif) | justin_timberlake_di..> | 2011-12-22 00:32 | 35K | |
![[IMG]](/icons/image2.gif) | jwn(1).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | jwn(2).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | jwn.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | karl.png | 2010-10-26 12:05 | 4.9K | |
![[IMG]](/icons/image2.gif) | karl1.png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | karl2.png | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | kaysha.png | 2012-01-05 12:45 | 54K | |
![[IMG]](/icons/image2.gif) | kbh(1).png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | kbh.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | kbh3.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | kd.png | 2012-04-18 12:34 | 169K | |
![[IMG]](/icons/image2.gif) | keg.png | 2010-10-27 13:20 | 14K | |
![[IMG]](/icons/image2.gif) | ken-rogoff.jpg | 2011-08-02 20:44 | 15K | |
![[IMG]](/icons/image2.gif) | kfc-china-1.png | 2013-04-10 20:46 | 44K | |
![[IMG]](/icons/image2.gif) | killer.jpg | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | kingdome-seattle-imp..> | 2011-08-08 18:55 | 26K | |
![[IMG]](/icons/image2.gif) | klic.png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | kmx.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | koch-brothers-bloomb..> | 2011-10-02 20:02 | 1.6M | |
![[IMG]](/icons/image2.gif) | koch-brothers-bloomb..> | 2011-10-02 20:03 | 1.6M | |
![[IMG]](/icons/image2.gif) | koch-brothers-bloomb..> | 2011-10-02 20:02 | 1.6M | |
![[IMG]](/icons/image2.gif) | koeln-despair-death-..> | 2012-04-02 14:47 | 34K | |
![[IMG]](/icons/image2.gif) | lady-gaga-poison fro..> | 2011-12-14 15:03 | 22K | |
![[IMG]](/icons/image2.gif) | lagarde.jpg | 2011-11-28 02:35 | 47K | |
![[IMG]](/icons/image2.gif) | lampadina01.jpg | 2011-01-16 19:06 | 46K | |
![[IMG]](/icons/image2.gif) | large_4eesofp.png | 2011-03-24 17:19 | 223K | |
![[IMG]](/icons/image2.gif) | large_jobless-claims..> | 2012-04-12 22:16 | 12K | |
![[IMG]](/icons/image2.gif) | large_jobless-claims..> | 2012-04-12 22:14 | 12K | |
![[IMG]](/icons/image2.gif) | large_xidbuu5.png | 2011-05-16 15:29 | 130K | |
![[IMG]](/icons/image2.gif) | las_vegas_04.jpg | 2010-10-26 12:05 | 148K | |
![[IMG]](/icons/image2.gif) | las_vegas_07.jpg | 2010-10-26 12:05 | 85K | |
![[IMG]](/icons/image2.gif) | las_vegas_08.jpg | 2010-10-26 12:05 | 94K | |
![[IMG]](/icons/image2.gif) | lawrence-lessig-at-t..> | 2013-04-08 19:01 | 118K | |
![[IMG]](/icons/image2.gif) | lawyers.jpg | 2010-10-26 12:05 | 9.7K | |
![[IMG]](/icons/image2.gif) | ldk.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | le-pacific.jpeg | 2012-10-11 16:16 | 62K | |
![[IMG]](/icons/image2.gif) | lecafeamer(1).jpg | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | lecafeamer(2).jpg | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | lecafeamer.JPG | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | len.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | lenin, clusterstock(..> | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | lenin, clusterstock.jpg | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | lens2054263_12292910..> | 2011-10-17 21:29 | 20K | |
![[IMG]](/icons/image2.gif) | leverage.jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | limbo_dancer1_48-48.jpg | 2010-10-26 12:05 | 179K | |
![[IMG]](/icons/image2.gif) | limoforeclosed.gif | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | lipstick_on_a_pig(1)..> | 2011-07-12 14:26 | 20K | |
![[IMG]](/icons/image2.gif) | lipstick_on_a_pig.jpg | 2011-06-03 16:15 | 20K | |
![[IMG]](/icons/image2.gif) | liquidity.jpeg | 2012-03-12 18:55 | 32K | |
![[IMG]](/icons/image2.gif) | liquidity[1].JPG | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | little white lion 2...> | 2013-02-27 19:59 | 54K | |
![[IMG]](/icons/image2.gif) | livestock(1).jpg | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | livestock.jpg | 2010-10-26 12:05 | 51K | |
![[IMG]](/icons/image2.gif) | lloydschnmoe(1).jpg | 2011-11-22 14:47 | 23K | |
![[IMG]](/icons/image2.gif) | lloydschnmoe.JPG | 2011-08-24 13:18 | 23K | |
![[IMG]](/icons/image2.gif) | lobbyists - jda(1)(1..> | 2011-08-15 17:55 | 19K | |
![[IMG]](/icons/image2.gif) | lobbyists - jda(1)(2..> | 2011-08-15 18:07 | 19K | |
![[IMG]](/icons/image2.gif) | lobbyists - jda(1).jpg | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | lobbyists - jda.jpg | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | look here.jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | loot-whore.jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | lossgain_0.jpg | 2011-02-26 18:04 | 121K | |
![[IMG]](/icons/image2.gif) | lsi.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | ltd.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | ltxc.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | lulu.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | lunch-on-the-boat.jpg | 2011-09-02 13:14 | 32K | |
![[IMG]](/icons/image2.gif) | luv.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | m3b.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | ma.jpg | 2011-11-03 15:36 | 7.2K | |
![[IMG]](/icons/image2.gif) | mac.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | madoff090302_150.jpg | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | madoff_06.jpg | 2010-10-26 12:05 | 70K | |
![[IMG]](/icons/image2.gif) | madoff_10.jpg | 2010-10-26 12:05 | 75K | |
![[IMG]](/icons/image2.gif) | mail2.jpg | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | main-qimg-6bfe4d099a..> | 2012-03-30 16:21 | 7.5K | |
![[IMG]](/icons/image2.gif) | make_it_work.jpg | 2010-10-26 12:05 | 50K | |
![[IMG]](/icons/image2.gif) | makkennadrive_0.png | 2010-10-26 12:05 | 594K | |
![[IMG]](/icons/image2.gif) | mama_bear_with_cubsx..> | 2013-06-20 19:17 | 397K | |
![[IMG]](/icons/image2.gif) | manipulation.jpg | 2011-02-17 01:40 | 13K | |
![[IMG]](/icons/image2.gif) | mar(1).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | mar.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | marga.jpeg | 2010-11-17 14:37 | 855 | |
![[IMG]](/icons/image2.gif) | margarita.gif | 2010-12-03 13:49 | 30K | |
![[IMG]](/icons/image2.gif) | markets_in_turmoil.jpg | 2012-06-05 09:18 | 21K | |
![[IMG]](/icons/image2.gif) | marketticker.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | markit.png | 2010-10-26 12:05 | 8.7K | |
![[IMG]](/icons/image2.gif) | martin-luther-king2.jpg | 2011-01-08 16:49 | 33K | |
![[IMG]](/icons/image2.gif) | math(1).jpg | 2011-12-10 14:02 | 48K | |
![[IMG]](/icons/image2.gif) | math(2).jpg | 2011-12-20 16:10 | 48K | |
![[IMG]](/icons/image2.gif) | math.jpg | 2011-11-25 21:40 | 48K | |
![[IMG]](/icons/image2.gif) | matrix(1).png | 2011-08-12 14:47 | 97K | |
![[IMG]](/icons/image2.gif) | matrix.png | 2011-08-12 14:45 | 97K | |
![[IMG]](/icons/image2.gif) | mco.png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | meatmarket1.png | 2010-10-26 12:05 | 250K | |
![[DIR]](/icons/folder.gif) | media/ | 2011-07-04 14:55 | - | |
![[IMG]](/icons/image2.gif) | mega-bear-2000-exten..> | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | mega-bear-2000-nomin..> | 2010-10-26 12:05 | 34K | |
![[IMG]](/icons/image2.gif) | mega-bear-quartet.gif | 2010-10-26 12:05 | 37K | |
![[IMG]](/icons/image2.gif) | meredith-whitney.jpg | 2010-12-24 22:09 | 22K | |
![[IMG]](/icons/image2.gif) | meredith whitney.jpg | 2011-02-08 12:42 | 11K | |
![[IMG]](/icons/image2.gif) | mexico.jpg | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | mf.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | mf_bluesbrother(1).gif | 2010-10-19 11:05 | 1.2K | |
![[IMG]](/icons/image2.gif) | mf_bluesbrother.gif | 2010-10-26 12:05 | 1.2K | |
![[IMG]](/icons/image2.gif) | mf_doctor.gif | 2010-10-19 11:31 | 1.1K | |
![[IMG]](/icons/image2.gif) | mfg.png | 2011-12-11 15:23 | 174K | |
![[IMG]](/icons/image2.gif) | mg.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | mg21228340_100-2_300..> | 2011-10-24 16:50 | 27K | |
![[IMG]](/icons/image2.gif) | mgw5bqe.png | 2011-04-04 12:21 | 25K | |
![[IMG]](/icons/image2.gif) | mho.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | michael's chart.png | 2010-10-26 12:05 | 91K | |
![[IMG]](/icons/image2.gif) | michelle-meyer.jpg | 2012-04-05 04:48 | 45K | |
![[IMG]](/icons/image2.gif) | mick-jagger.jpg | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | mid-Peoples_Micropho..> | 2011-10-11 15:50 | 57K | |
![[IMG]](/icons/image2.gif) | mishphoto.png | 2011-02-08 12:30 | 11K | |
![[IMG]](/icons/image2.gif) | mm2(1).jpg | 2011-04-06 18:18 | 69K | |
![[IMG]](/icons/image2.gif) | mm2.JPG | 2011-04-06 18:12 | 42K | |
![[IMG]](/icons/image2.gif) | mnkd.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | money-toilet.jpg | 2011-04-14 16:50 | 14K | |
![[IMG]](/icons/image2.gif) | money-tp.jpg | 2010-10-26 12:05 | 38K | |
![[IMG]](/icons/image2.gif) | moneyfromsky-crestoc..> | 2010-10-26 12:05 | 44K | |
![[IMG]](/icons/image2.gif) | monopolyblowjobEEEEE..> | 2012-04-17 15:37 | 25K | |
![[IMG]](/icons/image2.gif) | monthly-spx.jpg | 2012-01-06 12:33 | 112K | |
![[IMG]](/icons/image2.gif) | mortgage_funny_sign[..> | 2010-10-26 12:05 | 76K | |
![[IMG]](/icons/image2.gif) | mos(1).png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | mos.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | mountain-climber-fli..> | 2011-08-15 03:53 | 27K | |
![[IMG]](/icons/image2.gif) | mr-t-gold-chains-spa..> | 2010-11-23 21:49 | 124K | |
![[IMG]](/icons/image2.gif) | mr-t-gold-chains-spa..> | 2010-11-23 21:48 | 124K | |
![[IMG]](/icons/image2.gif) | mrvl(1).png | 2010-11-18 09:26 | 14K | |
![[IMG]](/icons/image2.gif) | mrvl.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | mtg.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | mtn(1).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | mtn.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | mu.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | multi Chart Oct 18 2..> | 2011-10-18 08:26 | 103K | |
![[IMG]](/icons/image2.gif) | multi Chart Oct 18 2..> | 2011-10-18 08:07 | 103K | |
![[IMG]](/icons/image2.gif) | multi[1].jpg | 2011-05-19 12:53 | 34K | |
![[IMG]](/icons/image2.gif) | multi chart Dec 29 2..> | 2010-12-29 08:32 | 97K | |
![[IMG]](/icons/image2.gif) | multi chart Jan 16.JPG | 2010-10-26 12:05 | 86K | |
![[IMG]](/icons/image2.gif) | multi chart Jan 26 2..> | 2011-01-27 13:54 | 32K | |
![[IMG]](/icons/image2.gif) | multi chart July 14 ..> | 2010-10-26 12:05 | 90K | |
![[IMG]](/icons/image2.gif) | multi chart July 14..> | 2011-07-14 15:20 | 32K | |
![[IMG]](/icons/image2.gif) | multi chart July 14a..> | 2010-10-26 12:05 | 97K | |
![[IMG]](/icons/image2.gif) | multi chart July 19..> | 2011-07-19 15:37 | 31K | |
![[IMG]](/icons/image2.gif) | multi chart June 14..> | 2011-06-14 07:39 | 87K | |
![[IMG]](/icons/image2.gif) | multi chart June 15..> | 2011-06-15 15:24 | 84K | |
![[IMG]](/icons/image2.gif) | multi chart June 15..> | 2011-06-15 15:26 | 83K | |
![[IMG]](/icons/image2.gif) | multi chart feb 21.jpg | 2010-10-26 12:05 | 95K | |
![[IMG]](/icons/image2.gif) | munchen-jesse.jpg | 2012-02-06 00:50 | 40K | |
![[IMG]](/icons/image2.gif) | mw.png | 2010-10-26 12:05 | 14K | |
![[TXT]](/icons/text.gif) | mwai_LZEeuEzv.log | 2025-10-04 18:32 | 0 | |
![[IMG]](/icons/image2.gif) | mwo010811.png | 2011-01-09 19:36 | 33K | |
![[IMG]](/icons/image2.gif) | mwo012211.jpg | 2011-01-24 01:20 | 22K | |
![[IMG]](/icons/image2.gif) | mwo012911.jpg | 2011-01-30 22:23 | 14K | |
![[IMG]](/icons/image2.gif) | mwo022611.jpg | 2011-02-27 13:17 | 11K | |
![[IMG]](/icons/image2.gif) | mwo040712.jpg | 2012-04-09 16:29 | 15K | |
![[IMG]](/icons/image2.gif) | mwo051212.jpg | 2012-05-13 23:18 | 20K | |
![[IMG]](/icons/image2.gif) | mwo060311.jpg | 2011-06-04 15:07 | 11K | |
![[IMG]](/icons/image2.gif) | mwo060912.jpg | 2012-06-10 11:12 | 13K | |
![[IMG]](/icons/image2.gif) | mwo061612.jpg | 2012-06-17 01:30 | 14K | |
![[IMG]](/icons/image2.gif) | mwo062312.jpg | 2012-06-24 21:29 | 16K | |
![[IMG]](/icons/image2.gif) | mwo063012.jpeg | 2012-07-01 00:31 | 26K | |
![[IMG]](/icons/image2.gif) | mwo071412.jpeg | 2012-07-15 04:50 | 18K | |
![[IMG]](/icons/image2.gif) | mwo081112.jpeg | 2012-08-11 15:26 | 21K | |
![[IMG]](/icons/image2.gif) | mwo081712.jpeg | 2012-08-18 23:01 | 11K | |
![[IMG]](/icons/image2.gif) | mwo082512.jpeg | 2012-08-25 18:24 | 15K | |
![[IMG]](/icons/image2.gif) | mwo091512.jpeg | 2012-09-16 05:05 | 9.1K | |
![[IMG]](/icons/image2.gif) | mwo092212.jpeg | 2012-09-23 05:22 | 18K | |
![[IMG]](/icons/image2.gif) | mwo102912_lg.jpeg | 2012-10-29 14:17 | 44K | |
![[IMG]](/icons/image2.gif) | mwo111212.jpg | 2012-11-12 17:00 | 15K | |
![[IMG]](/icons/image2.gif) | mwo112612.jpg | 2012-11-26 22:20 | 12K | |
![[IMG]](/icons/image2.gif) | mwo113012.jpg | 2012-12-09 03:48 | 14K | |
![[IMG]](/icons/image2.gif) | my-bad-bank1.jpeg | 2012-02-01 17:16 | 163K | |
![[IMG]](/icons/image2.gif) | mybadbank(1).jpg | 2011-07-18 04:32 | 28K | |
![[IMG]](/icons/image2.gif) | mybadbank(2).jpg | 2011-07-29 02:10 | 28K | |
![[IMG]](/icons/image2.gif) | mybadbank(3).jpg | 2011-08-24 10:15 | 28K | |
![[IMG]](/icons/image2.gif) | mybadbank(4).jpg | 2011-09-02 15:10 | 28K | |
![[IMG]](/icons/image2.gif) | mybadbank.jpg | 2011-01-13 16:51 | 28K | |
![[IMG]](/icons/image2.gif) | my little pony.jpg | 2011-01-05 01:39 | 28K | |
![[IMG]](/icons/image2.gif) | n809235230_7172681_7..> | 2011-03-14 15:30 | 54K | |
![[IMG]](/icons/image2.gif) | nasdaq.jpg | 2011-03-20 18:48 | 558K | |
![[IMG]](/icons/image2.gif) | nav.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | nchart_j.jpg | 2011-02-08 18:30 | 24K | |
![[IMG]](/icons/image2.gif) | ndx(1).jpg | 2011-09-19 13:25 | 69K | |
![[IMG]](/icons/image2.gif) | ndx.JPG | 2011-09-19 13:10 | 69K | |
![[IMG]](/icons/image2.gif) | neo1.jpg | 2011-11-09 15:32 | 41K | |
![[IMG]](/icons/image2.gif) | newhome prices.gif | 2010-10-26 12:05 | 8.4K | |
![[IMG]](/icons/image2.gif) | new homes March 2010..> | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | newhome sales(1).gif | 2010-10-26 12:05 | 7.2K | |
![[IMG]](/icons/image2.gif) | newhome sales.gif | 2010-10-26 12:05 | 7.2K | |
![[IMG]](/icons/image2.gif) | newjanpic.jpg | 2010-12-21 02:47 | 17K | |
![[DIR]](/icons/folder.gif) | newsletter/ | 2024-02-28 23:51 | - | |
![[IMG]](/icons/image2.gif) | newtownsdndnnd.jpg | 2013-03-18 15:10 | 44K | |
![[IMG]](/icons/image2.gif) | ngfclose(1).gif | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | ngfclose.gif | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | nic cage -tbi.jpg | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | nicetry.jpg | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | night of the living ..> | 2010-11-08 17:54 | 27K | |
![[IMG]](/icons/image2.gif) | no-confidence.png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | nosferatu_1922_poste..> | 2011-10-08 15:12 | 46K | |
![[IMG]](/icons/image2.gif) | nosferatu_1922_poste..> | 2011-10-17 16:44 | 46K | |
![[IMG]](/icons/image2.gif) | nosferatu_1922_poste..> | 2011-10-06 19:29 | 46K | |
![[IMG]](/icons/image2.gif) | nothingupmysleeve-jd..> | 2011-10-15 23:43 | 21K | |
![[IMG]](/icons/image2.gif) | nothingupmysleeve-jd..> | 2011-12-08 12:22 | 21K | |
![[IMG]](/icons/image2.gif) | nothingupmysleeve-jd..> | 2011-09-03 12:09 | 17K | |
![[IMG]](/icons/image2.gif) | nouriel-roubini.jpg | 2011-09-22 15:56 | 22K | |
![[IMG]](/icons/image2.gif) | novl.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | nsm(1).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | nsm.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | nvda.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | nws.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | nwy.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | nyad021211.png | 2011-02-14 02:16 | 25K | |
![[IMG]](/icons/image2.gif) | nymEX Aug 25 2011.jpg | 2011-08-25 09:06 | 75K | |
![[IMG]](/icons/image2.gif) | nyse2(1).jpg | 2010-10-26 12:05 | 161K | |
![[IMG]](/icons/image2.gif) | nyse2.jpg | 2010-10-26 12:05 | 161K | |
![[IMG]](/icons/image2.gif) | nyse bullish percent..> | 2011-01-12 22:50 | 12K | |
![[IMG]](/icons/image2.gif) | nyseflagpatternsept8..> | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | nyud0224.png | 2011-02-26 13:43 | 48K | |
![[IMG]](/icons/image2.gif) | nzd.JPG | 2011-12-02 10:21 | 74K | |
![[IMG]](/icons/image2.gif) | obama-unicorn(1).jpg | 2011-01-24 21:16 | 24K | |
![[IMG]](/icons/image2.gif) | obama-unicorn(2).jpg | 2011-02-15 20:57 | 24K | |
![[IMG]](/icons/image2.gif) | obama-unicorn.jpg | 2011-01-24 21:15 | 24K | |
![[IMG]](/icons/image2.gif) | obama.jpg | 2011-09-18 22:09 | 39K | |
![[IMG]](/icons/image2.gif) | obamacare(1).jpg | 2010-12-13 19:26 | 28K | |
![[IMG]](/icons/image2.gif) | obamacare - jrdep.jpg | 2010-12-11 12:58 | 28K | |
![[IMG]](/icons/image2.gif) | obamacare.jpg | 2010-12-13 19:05 | 28K | |
![[IMG]](/icons/image2.gif) | obamacare15(1).jpg | 2010-12-13 19:27 | 23K | |
![[IMG]](/icons/image2.gif) | obamacare15.jpg | 2010-12-13 19:04 | 23K | |
![[IMG]](/icons/image2.gif) | occupy.jpg | 2011-10-18 13:49 | 8.8K | |
![[IMG]](/icons/image2.gif) | oge_biere_du_lion(1)..> | 2012-07-20 15:47 | 62K | |
![[IMG]](/icons/image2.gif) | oge_biere_du_lion-je..> | 2012-07-14 00:24 | 62K | |
![[IMG]](/icons/image2.gif) | oge_biere_du_lion.jpeg | 2012-07-19 13:38 | 62K | |
![[IMG]](/icons/image2.gif) | oil(1).jpg | 2011-09-19 13:24 | 45K | |
![[IMG]](/icons/image2.gif) | oil-price-economy.gif | 2012-04-08 16:43 | 48K | |
![[IMG]](/icons/image2.gif) | oil.JPG | 2011-09-19 13:09 | 45K | |
![[IMG]](/icons/image2.gif) | oil_speculators_0806..> | 2010-10-26 12:05 | 61K | |
![[IMG]](/icons/image2.gif) | oil contributions to..> | 2011-02-22 08:40 | 8.7K | |
![[IMG]](/icons/image2.gif) | oilspxcorrelation.png | 2011-03-06 21:05 | 28K | |
![[IMG]](/icons/image2.gif) | oliver-twist.jpeg | 2012-12-07 06:17 | 26K | |
![[IMG]](/icons/image2.gif) | ontap.jpg | 2010-10-26 12:05 | 38K | |
![[IMG]](/icons/image2.gif) | opecstocksjune(1).jpg | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | opecstocksjune.jpg | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | ordos_01-patrickchov..> | 2011-10-03 22:58 | 17K | |
![[IMG]](/icons/image2.gif) | orthorexia_0202.jpg | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | osama_billmaher.jpg | 2010-10-26 12:05 | 40K | |
![[IMG]](/icons/image2.gif) | osignweb(1).jpg | 2012-01-09 21:21 | 24K | |
![[IMG]](/icons/image2.gif) | osignweb.jpg | 2012-01-09 21:08 | 24K | |
![[IMG]](/icons/image2.gif) | osk.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | ows.jpeg | 2011-10-28 16:48 | 10K | |
![[IMG]](/icons/image2.gif) | paco.jpg | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | pag.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | page1-433px-Carroll_..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | page1-433px-Carroll_..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | page1-433px-Carroll_..> | 2010-10-26 12:05 | 53K | |
![[IMG]](/icons/image2.gif) | paladin(1).gif | 2011-03-08 12:52 | 27K | |
![[IMG]](/icons/image2.gif) | paladin.gif | 2011-02-18 13:41 | 27K | |
![[IMG]](/icons/image2.gif) | palin-map.jpg | 2011-01-09 12:57 | 83K | |
![[IMG]](/icons/image2.gif) | panic(1).jpg | 2011-11-22 11:37 | 46K | |
![[IMG]](/icons/image2.gif) | panic.jpg | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | paperman.JPG | 2011-10-26 01:31 | 130K | |
![[IMG]](/icons/image2.gif) | patient bear(1).jpg | 2011-06-24 15:38 | 35K | |
![[IMG]](/icons/image2.gif) | patient bear(2).jpg | 2011-07-27 10:05 | 35K | |
![[IMG]](/icons/image2.gif) | patient bear.jpg | 2011-06-24 15:37 | 35K | |
![[IMG]](/icons/image2.gif) | paul-krugman.jpeg | 2012-11-03 15:48 | 6.8K | |
![[IMG]](/icons/image2.gif) | paul-volcker.jpg | 2011-01-08 02:42 | 8.7K | |
![[IMG]](/icons/image2.gif) | paulson.jpg | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | pay.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | payx.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | pboc.jpg | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | pce sept 09.gif | 2010-10-26 12:05 | 6.4K | |
![[IMG]](/icons/image2.gif) | pennies-jda.jpg | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | pep_talk.png | 2010-12-23 14:12 | 34K | |
![[IMG]](/icons/image2.gif) | percent-job-losses-9..> | 2010-10-26 12:05 | 127K | |
![[IMG]](/icons/image2.gif) | perso consumption q1..> | 2010-10-26 12:05 | 6.7K | |
![[IMG]](/icons/image2.gif) | petline_2.jpg | 2011-01-05 12:31 | 57K | |
![[IMG]](/icons/image2.gif) | pg_index1.jpg | 2012-03-12 15:27 | 64K | |
![[IMG]](/icons/image2.gif) | philstockworld_logo_..> | 2010-10-26 12:05 | 8.1K | |
![[IMG]](/icons/image2.gif) | phm(1).png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | phm.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | photo.JPG | 2011-03-03 12:59 | 224K | |
![[IMG]](/icons/image2.gif) | photo.jpg | 2010-10-26 12:05 | 134K | |
![[IMG]](/icons/image2.gif) | photo_2874_20090101.jpg | 2011-01-14 14:37 | 165K | |
![[IMG]](/icons/image2.gif) | photo_3522_20071006.jpg | 2011-01-12 19:45 | 99K | |
![[IMG]](/icons/image2.gif) | photo_5898_20090422.jpg | 2011-01-10 16:28 | 300K | |
![[IMG]](/icons/image2.gif) | photo_17156_20100531..> | 2011-01-11 19:05 | 121K | |
![[IMG]](/icons/image2.gif) | photo_17592_20100610..> | 2011-01-11 20:49 | 120K | |
![[IMG]](/icons/image2.gif) | photo_17592_20100610..> | 2011-01-11 20:49 | 120K | |
![[IMG]](/icons/image2.gif) | photo_17592_20100610..> | 2011-01-11 20:50 | 120K | |
![[IMG]](/icons/image2.gif) | photo_17592_20100610..> | 2011-01-11 20:47 | 120K | |
![[IMG]](/icons/image2.gif) | photo_17592_20100610..> | 2011-01-11 20:51 | 120K | |
![[IMG]](/icons/image2.gif) | photo_20203_20100906..> | 2011-01-10 15:14 | 195K | |
![[IMG]](/icons/image2.gif) | phpFQdhoiPM(1).jpg | 2010-12-29 15:53 | 31K | |
![[IMG]](/icons/image2.gif) | phpFQdhoiPM.jpg | 2010-12-29 15:53 | 31K | |
![[IMG]](/icons/image2.gif) | picture-4.jpg | 2010-10-26 12:05 | 1.7K | |
![[IMG]](/icons/image2.gif) | pie.jpg | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | pig-bank-robbery-of-..> | 2011-01-24 21:09 | 28K | |
![[IMG]](/icons/image2.gif) | piggy_photo(1).jpg | 2010-12-10 13:10 | 18K | |
![[IMG]](/icons/image2.gif) | piggy_photo(2).jpg | 2011-01-05 01:59 | 18K | |
![[IMG]](/icons/image2.gif) | piggy_photo(3).jpg | 2011-08-29 19:45 | 18K | |
![[IMG]](/icons/image2.gif) | piggy_photo.jpg | 2010-12-10 13:10 | 18K | |
![[IMG]](/icons/image2.gif) | piggybanks-crestock.jpg | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | pigs.jpg | 2012-03-07 13:19 | 30K | |
![[IMG]](/icons/image2.gif) | pir.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | pirateDM2505_468x456..> | 2011-04-27 18:14 | 62K | |
![[IMG]](/icons/image2.gif) | pizza-crestock.jpg | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | poisson-de-dieppe.jpg | 2012-12-10 15:56 | 57K | |
![[IMG]](/icons/image2.gif) | polanyi.png | 2012-09-20 15:44 | 126K | |
![[IMG]](/icons/image2.gif) | portrait(1).jpg | 2011-09-30 01:34 | 9.6K | |
![[IMG]](/icons/image2.gif) | portrait(2).jpg | 2011-12-04 20:44 | 9.6K | |
![[IMG]](/icons/image2.gif) | portrait.jpg | 2010-10-26 12:05 | 9.6K | |
![[IMG]](/icons/image2.gif) | portraitTriffin.jpg | 2011-04-27 17:03 | 21K | |
![[IMG]](/icons/image2.gif) | position jan014(1).png | 2010-12-30 18:16 | 264K | |
![[IMG]](/icons/image2.gif) | position jan014(2).png | 2010-12-30 19:28 | 264K | |
![[IMG]](/icons/image2.gif) | position jan014(3).png | 2010-12-30 19:29 | 264K | |
![[IMG]](/icons/image2.gif) | position jan014(4).png | 2010-12-30 19:41 | 264K | |
![[IMG]](/icons/image2.gif) | position jan014.png | 2010-12-30 18:15 | 264K | |
![[IMG]](/icons/image2.gif) | potemkineconomy.JPG | 2012-11-28 13:53 | 47K | |
![[IMG]](/icons/image2.gif) | pouletdanse.gif | 2010-10-26 12:05 | 6.4K | |
![[IMG]](/icons/image2.gif) | pound.png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | powertothepeoplesmok..> | 2012-12-10 18:57 | 44K | |
![[IMG]](/icons/image2.gif) | printermoney.jpg | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | printing-money.jpg | 2010-12-02 13:18 | 22K | |
![[IMG]](/icons/image2.gif) | prnphotos-DOWNLOAD p..> | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | prnphotos062110.jpg | 2010-10-26 12:05 | 55K | |
![[IMG]](/icons/image2.gif) | prnphotos075994.jpg | 2011-01-02 21:32 | 95K | |
![[IMG]](/icons/image2.gif) | prnphotos084770-wild..> | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | productivity Q2 09.gif | 2010-10-26 12:05 | 9.3K | |
![[IMG]](/icons/image2.gif) | protest-crap-jda.jpg | 2012-02-28 16:49 | 35K | |
![[IMG]](/icons/image2.gif) | psmt.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | psun.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | psycho(1).jpeg | 2012-03-02 21:27 | 3.5K | |
![[IMG]](/icons/image2.gif) | psycho(1).jpg | 2011-12-21 20:38 | 44K | |
![[IMG]](/icons/image2.gif) | psycho.jpeg | 2012-03-02 21:26 | 3.5K | |
![[IMG]](/icons/image2.gif) | psycho.jpg | 2011-12-02 14:13 | 44K | |
![[IMG]](/icons/image2.gif) | psychopath.jpeg | 2011-11-10 17:11 | 3.5K | |
![[IMG]](/icons/image2.gif) | pug-sp-500-60-min-eo..> | 2011-03-31 12:12 | 156K | |
![[IMG]](/icons/image2.gif) | purple_gang_hats.jpg | 2012-03-30 16:51 | 24K | |
![[IMG]](/icons/image2.gif) | putoptionssp100-0407..> | 2011-04-08 12:24 | 12K | |
![[IMG]](/icons/image2.gif) | pvtb.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | pxd.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | qdel.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | qe-and-fib-time-sequ..> | 2011-05-02 13:10 | 70K | |
![[IMG]](/icons/image2.gif) | qe-and-fib-time-sequ..> | 2011-05-03 16:19 | 70K | |
![[IMG]](/icons/image2.gif) | qe-and-fib-time-sequ..> | 2011-05-03 16:19 | 70K | |
![[IMG]](/icons/image2.gif) | qe-and-fib-time-sequ..> | 2011-05-02 13:09 | 56K | |
![[IMG]](/icons/image2.gif) | qlti.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | quoteII.png | 2012-02-09 22:16 | 18K | |
![[IMG]](/icons/image2.gif) | qxq6qg4.png | 2011-05-09 13:46 | 74K | |
![[IMG]](/icons/image2.gif) | r2utb9v.png | 2011-04-08 14:28 | 32K | |
![[IMG]](/icons/image2.gif) | rainbow chart Nov 18..> | 2010-11-18 08:02 | 33K | |
![[IMG]](/icons/image2.gif) | rainbow chart Nov 18..> | 2010-11-18 08:03 | 33K | |
![[IMG]](/icons/image2.gif) | rainbow chart Nov 18..> | 2010-11-18 08:02 | 33K | |
![[IMG]](/icons/image2.gif) | rancho-center.jpg | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | ranting.gif | 2011-04-01 11:04 | 18K | |
![[IMG]](/icons/image2.gif) | rawr.png | 2011-11-15 12:06 | 68K | |
![[IMG]](/icons/image2.gif) | raymond-mcdaniel.jpg | 2011-08-19 15:18 | 15K | |
![[IMG]](/icons/image2.gif) | reagan-bear-ad-bi.jpg | 2011-10-04 14:08 | 91K | |
![[IMG]](/icons/image2.gif) | reagan.jpg | 2010-10-26 12:05 | 7.2K | |
![[IMG]](/icons/image2.gif) | really-simple.gif | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | red-cart2.jpg | 2011-06-15 19:50 | 43K | |
![[IMG]](/icons/image2.gif) | regulation_duel.jpg | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | reload.png | 2011-01-09 13:10 | 228K | |
![[IMG]](/icons/image2.gif) | res.JPG | 2011-11-04 15:02 | 58K | |
![[IMG]](/icons/image2.gif) | resistance.PNG | 2011-11-28 13:59 | 137K | |
![[IMG]](/icons/image2.gif) | resized_Henry_Niman_..> | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | restaurant-conversat..> | 2011-09-15 00:56 | 32K | |
![[IMG]](/icons/image2.gif) | retail-heck3-charles..> | 2010-10-26 12:05 | 40K | |
![[IMG]](/icons/image2.gif) | retailers,TIME.jpg | 2010-10-26 12:05 | 90K | |
![[DIR]](/icons/folder.gif) | revslider/ | 2024-02-28 23:51 | - | |
![[IMG]](/icons/image2.gif) | richard-koo.jpg | 2011-11-23 03:37 | 16K | |
![[IMG]](/icons/image2.gif) | rick-perry.jpg | 2011-08-18 03:32 | 30K | |
![[IMG]](/icons/image2.gif) | rimm(1).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | rimm(2).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | rimm.png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | risk.jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | risk2.jpeg | 2012-03-23 03:55 | 10K | |
![[IMG]](/icons/image2.gif) | riskcannon_bokske.jpg | 2013-02-19 08:26 | 94K | |
![[IMG]](/icons/image2.gif) | rnewosi(1).png | 2011-04-25 12:12 | 140K | |
![[IMG]](/icons/image2.gif) | rnewosi(2).png | 2011-07-12 14:25 | 140K | |
![[IMG]](/icons/image2.gif) | rnewosi.png | 2011-04-04 13:48 | 140K | |
![[IMG]](/icons/image2.gif) | robert reich.JPG | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | rock(1).gif | 2010-10-26 12:05 | 1.5K | |
![[IMG]](/icons/image2.gif) | rock(2).gif | 2010-10-26 12:05 | 1.5K | |
![[IMG]](/icons/image2.gif) | rock-and-a-hard-plac..> | 2011-12-10 14:00 | 11K | |
![[IMG]](/icons/image2.gif) | rock.gif | 2010-10-26 12:05 | 1.5K | |
![[IMG]](/icons/image2.gif) | rrlidm5.png | 2011-04-12 13:19 | 44K | |
![[IMG]](/icons/image2.gif) | rs.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | rubber-glove-431.jpg | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | rue.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | rugd5ad.png | 2011-03-28 15:22 | 65K | |
![[IMG]](/icons/image2.gif) | rut.png | 2011-11-07 10:41 | 37K | |
![[IMG]](/icons/image2.gif) | rut1(1).png | 2011-04-11 15:22 | 55K | |
![[IMG]](/icons/image2.gif) | rut1.png | 2011-04-11 15:18 | 55K | |
![[IMG]](/icons/image2.gif) | rut4(1).png | 2011-03-30 15:05 | 101K | |
![[IMG]](/icons/image2.gif) | rut4.png | 2011-03-30 15:03 | 101K | |
![[IMG]](/icons/image2.gif) | rut Chart Aug 15 201..> | 2011-08-15 13:34 | 31K | |
![[IMG]](/icons/image2.gif) | rutGIF(1).gif | 2011-07-07 12:48 | 27K | |
![[IMG]](/icons/image2.gif) | rutGIF.GIF | 2011-07-07 11:03 | 57K | |
![[IMG]](/icons/image2.gif) | rykan-v-bear-smoking..> | 2011-07-28 10:07 | 27K | |
![[IMG]](/icons/image2.gif) | rykan-v-bear-smoking..> | 2011-06-29 14:55 | 27K | |
![[IMG]](/icons/image2.gif) | ryl(1).png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | ryl.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | s-GREECE-AUSTERITY-P..> | 2011-06-14 15:44 | 24K | |
![[IMG]](/icons/image2.gif) | s.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | s6ijyhb(1).png | 2011-03-29 14:51 | 61K | |
![[IMG]](/icons/image2.gif) | s6ijyhb.png | 2011-03-29 14:50 | 61K | |
![[IMG]](/icons/image2.gif) | sah.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | saint greenspan.jpg | 2011-04-14 16:50 | 14K | |
![[IMG]](/icons/image2.gif) | sam.jpg | 2010-10-26 12:05 | 8.7K | |
![[IMG]](/icons/image2.gif) | sanbernadinodon.jpeg | 2012-09-09 14:33 | 48K | |
![[IMG]](/icons/image2.gif) | saupload_ad_20line_2..> | 2011-05-26 14:18 | 85K | |
![[IMG]](/icons/image2.gif) | saupload_capture1108..> | 2011-05-20 15:45 | 55K | |
![[IMG]](/icons/image2.gif) | saupload_capture1108..> | 2011-05-20 15:43 | 62K | |
![[IMG]](/icons/image2.gif) | saupload_european_de..> | 2011-03-31 13:14 | 227K | |
![[IMG]](/icons/image2.gif) | saupload_saint_peter..> | 2012-03-14 13:33 | 263K | |
![[IMG]](/icons/image2.gif) | sbcf.png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | sbs.png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | sc(1).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | sc(2).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | sc(3).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | sc(4).png | 2010-11-01 09:10 | 15K | |
![[IMG]](/icons/image2.gif) | sc(5).png | 2011-04-12 13:39 | 40K | |
![[IMG]](/icons/image2.gif) | sc(6).png | 2011-08-12 15:31 | 9.9K | |
![[IMG]](/icons/image2.gif) | sc(7).png | 2011-08-31 13:33 | 43K | |
![[IMG]](/icons/image2.gif) | sc(8).png | 2011-09-02 14:52 | 43K | |
![[IMG]](/icons/image2.gif) | sc-P1,2,3.png | 2010-10-26 12:05 | 92K | |
![[IMG]](/icons/image2.gif) | sc-david.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | sc-michael.png | 2010-10-26 12:05 | 93K | |
![[IMG]](/icons/image2.gif) | sc.png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | sc 2.png | 2011-11-03 12:29 | 18K | |
![[IMG]](/icons/image2.gif) | sc4.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | sc5.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | sc22.png | 2011-11-09 14:08 | 112K | |
![[IMG]](/icons/image2.gif) | sc519.png | 2011-05-19 16:11 | 21K | |
![[IMG]](/icons/image2.gif) | sc524(1).png | 2011-05-24 16:01 | 55K | |
![[IMG]](/icons/image2.gif) | sc524(2).png | 2011-05-24 16:02 | 55K | |
![[IMG]](/icons/image2.gif) | sc524.png | 2011-05-24 16:00 | 55K | |
![[IMG]](/icons/image2.gif) | scII.png | 2011-04-29 11:00 | 127K | |
![[IMG]](/icons/image2.gif) | scams.jpg | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | schn(1).png | 2010-10-26 09:19 | 15K | |
![[IMG]](/icons/image2.gif) | schn.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | sc jrw.png | 2011-05-07 12:31 | 22K | |
![[IMG]](/icons/image2.gif) | scott-brown.jpg | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | screen shot 2012-12-..> | 2012-12-14 04:57 | 253K | |
![[IMG]](/icons/image2.gif) | screenshotdlb.png | 2012-05-09 21:18 | 98K | |
![[IMG]](/icons/image2.gif) | screw.png | 2012-01-12 03:36 | 217K | |
![[IMG]](/icons/image2.gif) | secret(1).gif | 2010-10-26 12:05 | 2.1K | |
![[IMG]](/icons/image2.gif) | secret(2).gif | 2011-03-08 10:12 | 2.1K | |
![[IMG]](/icons/image2.gif) | secret(3).gif | 2011-06-24 15:15 | 2.1K | |
![[IMG]](/icons/image2.gif) | secret.gif | 2010-10-26 12:05 | 2.1K | |
![[IMG]](/icons/image2.gif) | self_help_0706.jpg | 2010-10-26 12:05 | 65K | |
![[IMG]](/icons/image2.gif) | shame01 (1).jpg | 2011-12-08 02:39 | 25K | |
![[IMG]](/icons/image2.gif) | sheep_off_cliff.jpg | 2010-10-26 12:05 | 100K | |
![[IMG]](/icons/image2.gif) | shell_game.jpg | 2012-04-04 03:48 | 11K | |
![[IMG]](/icons/image2.gif) | shfl.png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | shiny-gold-bullion-b..> | 2011-09-08 16:22 | 27K | |
![[IMG]](/icons/image2.gif) | shiny-gold-bullion-b..> | 2011-09-09 20:45 | 27K | |
![[IMG]](/icons/image2.gif) | shiny-gold-bullion-b..> | 2011-09-09 20:45 | 27K | |
![[IMG]](/icons/image2.gif) | shiny-gold-bullion-b..> | 2011-09-01 19:47 | 27K | |
![[IMG]](/icons/image2.gif) | ship-150.jpg | 2010-10-18 16:33 | 6.4K | |
![[IMG]](/icons/image2.gif) | ship_sailing_off_edg..> | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | ship_sailing_off_edg..> | 2011-08-09 02:13 | 34K | |
![[IMG]](/icons/image2.gif) | ship_sailing_off_edg..> | 2011-09-09 16:06 | 34K | |
![[IMG]](/icons/image2.gif) | ship_sailing_off_edg..> | 2010-10-26 12:05 | 27K | |
![[IMG]](/icons/image2.gif) | shirt(1).jpg | 2011-11-03 12:07 | 29K | |
![[IMG]](/icons/image2.gif) | shirt(2).jpg | 2011-11-30 16:11 | 29K | |
![[IMG]](/icons/image2.gif) | shirt.JPG | 2011-08-09 17:21 | 31K | |
![[IMG]](/icons/image2.gif) | shit-creek-paddles(1..> | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | shit-creek-paddles.jpg | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | shocking.gif | 2010-10-26 13:35 | 1.3K | |
![[IMG]](/icons/image2.gif) | short_term_us_0721.jpg | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | shrinkingworkers.jpg | 2011-06-14 21:47 | 72K | |
![[IMG]](/icons/image2.gif) | simon-johnson.jpg | 2010-11-08 20:02 | 15K | |
![[IMG]](/icons/image2.gif) | simon johnson(1).jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | simon johnson.jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | sina.png | 2010-11-16 13:44 | 14K | |
![[IMG]](/icons/image2.gif) | siri.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | sisyphus.gif | 2012-03-07 08:17 | 39K | |
![[IMG]](/icons/image2.gif) | sketchy geithner(1).jpg | 2011-04-19 12:45 | 25K | |
![[IMG]](/icons/image2.gif) | sketchy geithner(2).jpg | 2011-07-28 15:33 | 25K | |
![[IMG]](/icons/image2.gif) | sketchy geithner(3).jpg | 2011-09-15 11:38 | 25K | |
![[IMG]](/icons/image2.gif) | sketchy geithner(4).jpg | 2011-09-15 11:39 | 25K | |
![[IMG]](/icons/image2.gif) | sketchy geithner(5).jpg | 2011-09-16 16:04 | 25K | |
![[IMG]](/icons/image2.gif) | sketchy geithner(6).jpg | 2011-09-29 03:58 | 25K | |
![[IMG]](/icons/image2.gif) | sketchy geithner.jpg | 2011-01-05 03:45 | 25K | |
![[IMG]](/icons/image2.gif) | skf(1).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | skf(2).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | skf(3).png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | skf.png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | sks.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | skx(1).png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | skx(2).png | 2010-10-25 10:52 | 14K | |
![[IMG]](/icons/image2.gif) | skx.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | slab.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | sleep.gif | 2010-10-26 12:05 | 1.5K | |
![[IMG]](/icons/image2.gif) | slide0001_image001.png | 2010-10-26 12:05 | 8.7K | |
![[IMG]](/icons/image2.gif) | slm.png | 2010-10-15 10:53 | 16K | |
![[IMG]](/icons/image2.gif) | smoke-and-mirrors.jpg | 2013-05-15 14:56 | 78K | |
![[IMG]](/icons/image2.gif) | smrt.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | smsc.png | 2010-10-26 12:05 | 15K | |
![[TXT]](/icons/text.gif) | smush-83f1d8bef5875f..> | 2021-12-22 09:44 | 222K | |
![[IMG]](/icons/image2.gif) | snapback.png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | sny3(1).jpg | 2010-10-26 12:05 | 58K | |
![[IMG]](/icons/image2.gif) | sny3.JPG | 2010-10-26 12:05 | 58K | |
![[IMG]](/icons/image2.gif) | solar, tbi.jpg | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | solar-suntech-prodli..> | 2010-10-26 12:05 | 60K | |
![[IMG]](/icons/image2.gif) | solf(1).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | solf(2).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | solf(3).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | solf(4).png | 2010-11-03 11:13 | 15K | |
![[IMG]](/icons/image2.gif) | solf(5).png | 2010-11-03 11:13 | 15K | |
![[IMG]](/icons/image2.gif) | solf.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | sp500WaveC.png | 2011-11-23 12:05 | 73K | |
![[IMG]](/icons/image2.gif) | spain.png | 2012-04-14 17:41 | 177K | |
![[IMG]](/icons/image2.gif) | spainoritaluthfhfhf ..> | 2013-03-18 19:49 | 32K | |
![[IMG]](/icons/image2.gif) | spanish-unemployment..> | 2012-04-15 14:29 | 44K | |
![[IMG]](/icons/image2.gif) | spanish-unemployment..> | 2012-04-15 14:28 | 44K | |
![[IMG]](/icons/image2.gif) | spbi-3b.jpg | 2010-10-26 12:05 | 46K | |
![[IMG]](/icons/image2.gif) | sphourly2.PNG | 2010-10-26 12:05 | 483K | |
![[IMG]](/icons/image2.gif) | spiralpath.jpg | 2011-10-12 01:37 | 81K | |
![[IMG]](/icons/image2.gif) | spock-illogical2.png | 2010-10-26 12:05 | 247K | |
![[IMG]](/icons/image2.gif) | spot-gold_image004(1..> | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | spot-gold_image004.jpg | 2010-10-26 12:05 | 52K | |
![[IMG]](/icons/image2.gif) | spwra(1).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | spwra.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | spx-close.png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | spx042352011.PNG | 2011-04-27 15:09 | 66K | |
![[IMG]](/icons/image2.gif) | spx04272011(1).png | 2011-05-04 11:50 | 71K | |
![[IMG]](/icons/image2.gif) | spx04272011(2).png | 2011-05-10 13:48 | 71K | |
![[IMG]](/icons/image2.gif) | spx04272011.PNG | 2011-05-04 11:49 | 71K | |
![[IMG]](/icons/image2.gif) | spx1.png | 2011-09-02 12:25 | 43K | |
![[IMG]](/icons/image2.gif) | spx 3.png | 2011-10-20 12:23 | 129K | |
![[IMG]](/icons/image2.gif) | spx 8-26 09.gif | 2010-10-26 12:05 | 47K | |
![[IMG]](/icons/image2.gif) | spx60min81510.png | 2010-10-26 12:05 | 36K | |
![[IMG]](/icons/image2.gif) | spx2012-20.jpg | 2012-01-06 12:32 | 67K | |
![[IMG]](/icons/image2.gif) | spx Oct 15 2010.jpg | 2010-10-15 07:58 | 1.0M | |
![[IMG]](/icons/image2.gif) | spx Oct 22 2011.jpg | 2011-10-24 08:14 | 25K | |
![[IMG]](/icons/image2.gif) | spx_60.png | 2011-11-07 10:59 | 42K | |
![[IMG]](/icons/image2.gif) | spx euro june 10.png | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | spx euro nov 6.png | 2010-10-26 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | spx wtic Sept 09.png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | spy(1).jpg | 2011-05-02 13:15 | 236K | |
![[IMG]](/icons/image2.gif) | spy.JPG | 2011-04-27 15:10 | 154K | |
![[IMG]](/icons/image2.gif) | spy05172011.PNG | 2011-05-18 15:55 | 87K | |
![[IMG]](/icons/image2.gif) | spy_vs_worldcurrency..> | 2011-06-24 18:14 | 53K | |
![[IMG]](/icons/image2.gif) | spy daily Jan 5 10.jpg | 2010-10-26 12:05 | 40K | |
![[IMG]](/icons/image2.gif) | spy h&s.png | 2011-05-13 13:58 | 60K | |
![[IMG]](/icons/image2.gif) | srp30(1).png | 2011-08-30 08:57 | 16K | |
![[IMG]](/icons/image2.gif) | srp30(2).png | 2011-08-30 08:58 | 16K | |
![[IMG]](/icons/image2.gif) | srp30.png | 2011-08-30 08:55 | 16K | |
![[IMG]](/icons/image2.gif) | srs(1).png | 2010-10-26 12:05 | 11K | |
![[IMG]](/icons/image2.gif) | srs(2).png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | srs(3).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | srs(4).png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | srs.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | ss(1).gif | 2011-08-12 12:30 | 69K | |
![[IMG]](/icons/image2.gif) | ss.gif | 2011-08-12 12:28 | 87K | |
![[IMG]](/icons/image2.gif) | ssec111610.png | 2010-11-16 22:57 | 14K | |
![[IMG]](/icons/image2.gif) | start()(1).png | 2011-03-22 14:21 | 24K | |
![[IMG]](/icons/image2.gif) | start().png | 2011-03-22 14:18 | 15K | |
![[IMG]](/icons/image2.gif) | starve the beast.jpg | 2010-10-26 12:05 | 60K | |
![[IMG]](/icons/image2.gif) | statistics-extrapola..> | 2010-10-26 12:05 | 62K | |
![[IMG]](/icons/image2.gif) | statistics-extrapola..> | 2010-10-26 12:05 | 62K | |
![[IMG]](/icons/image2.gif) | stec.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | steve-jobs-rejecting..> | 2010-10-26 12:05 | 35K | |
![[IMG]](/icons/image2.gif) | steve-jobs.jpg | 2011-10-20 16:20 | 16K | |
![[IMG]](/icons/image2.gif) | steve ballmer.jpg | 2010-10-26 12:05 | 10K | |
![[IMG]](/icons/image2.gif) | stimulus Aug 2010.jpg | 2010-10-26 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | stimulus plan.jpg | 2011-04-14 21:02 | 26K | |
![[IMG]](/icons/image2.gif) | stj.png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | stoc.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | stockmarketcorrectio..> | 2010-10-26 12:05 | 37K | |
![[IMG]](/icons/image2.gif) | stop ZB.jpg | 2011-02-14 02:54 | 26K | |
![[IMG]](/icons/image2.gif) | store_closing_0528.jpg | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | stp(1).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | stp(2).png | 2010-11-12 11:55 | 15K | |
![[IMG]](/icons/image2.gif) | stp.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | stress_teat.gif | 2010-10-26 12:05 | 49K | |
![[IMG]](/icons/image2.gif) | stretcher.gif | 2010-10-26 12:05 | 2.7K | |
![[IMG]](/icons/image2.gif) | stringsposter.jpg | 2010-10-26 12:05 | 123K | |
![[IMG]](/icons/image2.gif) | stx(1).png | 2010-10-19 09:14 | 14K | |
![[IMG]](/icons/image2.gif) | stx.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | stz.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | su.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | subs.jpg | 2010-10-26 12:05 | 38K | |
![[IMG]](/icons/image2.gif) | summer-job1.jpg | 2010-10-26 12:05 | 22K | |
![[IMG]](/icons/image2.gif) | summers.jpg | 2010-10-26 12:05 | 9.4K | |
![[IMG]](/icons/image2.gif) | sun-cameron.jpg | 2011-04-15 18:52 | 31K | |
![[IMG]](/icons/image2.gif) | sun-earth-explosion-..> | 2011-10-10 14:03 | 29K | |
![[IMG]](/icons/image2.gif) | svnt.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | swine_ca_1102.jpg | 2010-10-26 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | swks.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | swy.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | symc.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | syria.jpg | 2011-03-28 16:32 | 12K | |
![[IMG]](/icons/image2.gif) | system is anti us.jpg | 2011-05-22 23:16 | 210K | |
![[IMG]](/icons/image2.gif) | t9kvy93.png | 2011-03-24 15:39 | 107K | |
![[IMG]](/icons/image2.gif) | tankers.jpg | 2010-10-26 12:05 | 33K | |
![[IMG]](/icons/image2.gif) | tarp-funds(1).jpg | 2012-03-14 12:37 | 153K | |
![[IMG]](/icons/image2.gif) | tarp-funds.jpg | 2012-03-14 12:36 | 153K | |
![[IMG]](/icons/image2.gif) | tax dollars.jpg | 2011-06-08 20:27 | 32K | |
![[IMG]](/icons/image2.gif) | taxtherich.jpg | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | tdn_pic_1-150x150.png | 2022-07-01 18:07 | 8.4K | |
![[IMG]](/icons/image2.gif) | tdn_pic_1-300x204.png | 2022-07-01 18:07 | 12K | |
![[IMG]](/icons/image2.gif) | tdn_pic_1.png | 2022-07-02 20:15 | 22K | |
![[IMG]](/icons/image2.gif) | tdn_pic_2-150x150.png | 2022-07-01 18:07 | 7.4K | |
![[IMG]](/icons/image2.gif) | tdn_pic_2-300x203.png | 2022-07-01 18:07 | 12K | |
![[IMG]](/icons/image2.gif) | tdn_pic_2.png | 2022-07-02 02:05 | 38K | |
![[IMG]](/icons/image2.gif) | tdn_pic_3-150x150.png | 2022-07-01 18:07 | 12K | |
![[IMG]](/icons/image2.gif) | tdn_pic_3-300x216.png | 2022-07-01 18:07 | 20K | |
![[IMG]](/icons/image2.gif) | tdn_pic_3.png | 2022-07-02 20:44 | 61K | |
![[IMG]](/icons/image2.gif) | techland_googleplus_..> | 2011-07-07 21:47 | 6.6K | |
![[IMG]](/icons/image2.gif) | technical-video-16.jpg | 2011-10-25 11:40 | 66K | |
![[IMG]](/icons/image2.gif) | teleprompter.jpg | 2010-10-26 12:05 | 56K | |
![[IMG]](/icons/image2.gif) | tent city.jpg | 2010-10-26 12:05 | 67K | |
![[IMG]](/icons/image2.gif) | tequila_poster_03.jpg | 2011-04-07 23:21 | 35K | |
![[IMG]](/icons/image2.gif) | ter(1).png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | ter(2).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | ter(3).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | ter(4).png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | ter.png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | that-word-inigo-mont..> | 2011-12-08 04:50 | 60K | |
![[IMG]](/icons/image2.gif) | thc.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | the-end-banksy-graff..> | 2011-12-29 23:31 | 10K | |
![[IMG]](/icons/image2.gif) | the-end-banksy-graff..> | 2011-11-25 13:31 | 10K | |
![[IMG]](/icons/image2.gif) | the-wiggles-pic.gif | 2010-10-26 12:05 | 45K | |
![[IMG]](/icons/image2.gif) | the end is nigh.jpg | 2010-10-26 12:05 | 31K | |
![[IMG]](/icons/image2.gif) | the fail boat-jda.jpg | 2011-08-31 13:26 | 21K | |
![[IMG]](/icons/image2.gif) | the fail boat.jpg | 2010-11-20 12:26 | 27K | |
![[IMG]](/icons/image2.gif) | the real fed(1).jpg | 2011-01-27 14:41 | 21K | |
![[IMG]](/icons/image2.gif) | the real fed.jpg | 2011-01-24 23:02 | 21K | |
![[IMG]](/icons/image2.gif) | the testament of dr ..> | 2011-10-08 18:04 | 72K | |
![[IMG]](/icons/image2.gif) | the testament of dr ..> | 2011-10-08 15:14 | 72K | |
![[IMG]](/icons/image2.gif) | things_thumb.jpg | 2010-10-26 12:05 | 54K | |
![[IMG]](/icons/image2.gif) | tho.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | tho real.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | tibx.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | tim-cook-congress-te..> | 2013-05-21 21:52 | 361K | |
![[IMG]](/icons/image2.gif) | tim1.JPG | 2011-09-15 12:16 | 33K | |
![[IMG]](/icons/image2.gif) | timothy_naegele-a.jpg | 2010-10-26 12:05 | 6.4K | |
![[IMG]](/icons/image2.gif) | timthumb-frompragcap..> | 2010-10-26 12:05 | 29K | |
![[IMG]](/icons/image2.gif) | timthumb.jpg | 2010-10-26 12:05 | 24K | |
![[IMG]](/icons/image2.gif) | tinkerbell-2242785-l..> | 2011-01-18 14:32 | 174K | |
![[IMG]](/icons/image2.gif) | titanic_3.jpg | 2010-12-01 16:20 | 64K | |
![[IMG]](/icons/image2.gif) | tlb.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | tlt1 Chart Aug 19 20..> | 2011-08-19 12:32 | 20K | |
![[IMG]](/icons/image2.gif) | top-one-percent(1).jpg | 2011-04-02 15:32 | 86K | |
![[IMG]](/icons/image2.gif) | top-one-percent.jpg | 2011-04-02 15:31 | 86K | |
![[IMG]](/icons/image2.gif) | top 1% pie(1).png | 2010-10-26 12:05 | 74K | |
![[IMG]](/icons/image2.gif) | top 1% pie.png | 2010-10-26 12:05 | 74K | |
![[IMG]](/icons/image2.gif) | top 1% pie chart.png | 2010-10-26 12:05 | 74K | |
![[IMG]](/icons/image2.gif) | top 1 percent pie ch..> | 2010-10-26 12:05 | 590K | |
![[IMG]](/icons/image2.gif) | top 1 percent pie ch..> | 2010-10-26 12:05 | 74K | |
![[IMG]](/icons/image2.gif) | trade1.gif | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | trade2.gif | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | tragicflaws.jpg | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | train.jpg | 2011-08-19 15:02 | 43K | |
![[IMG]](/icons/image2.gif) | trainwreck2.jpg | 2012-05-27 14:38 | 38K | |
![[IMG]](/icons/image2.gif) | treasury department-..> | 2010-10-26 12:05 | 39K | |
![[IMG]](/icons/image2.gif) | triangle thingy up.gif | 2011-11-16 10:20 | 5.7K | |
![[IMG]](/icons/image2.gif) | trichet said(1).jpg | 2011-10-16 04:12 | 18K | |
![[IMG]](/icons/image2.gif) | trichet said.jpg | 2011-10-16 04:09 | 18K | |
![[IMG]](/icons/image2.gif) | trickle-down-economi..> | 2011-09-08 08:39 | 38K | |
![[IMG]](/icons/image2.gif) | trickle-down-economi..> | 2011-09-08 08:49 | 39K | |
![[IMG]](/icons/image2.gif) | tsl(1).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | tsl.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | tso.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | tumblr_lb1vbdXhHy1qe..> | 2012-04-11 05:18 | 56K | |
![[IMG]](/icons/image2.gif) | tumblr_lw3mp1Rljg1qz..> | 2012-04-08 07:10 | 72K | |
![[IMG]](/icons/image2.gif) | txt.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | typ.png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | tzA Nov 26 2010.jpg | 2010-11-26 08:21 | 46K | |
![[IMG]](/icons/image2.gif) | ucabpsj.png | 2011-03-23 14:12 | 440K | |
![[IMG]](/icons/image2.gif) | uncle_sam.jpg | 2010-10-26 12:05 | 57K | |
![[IMG]](/icons/image2.gif) | underwear.jpg | 2010-10-26 12:05 | 48K | |
![[IMG]](/icons/image2.gif) | unemployed-artistpre..> | 2011-10-02 17:18 | 23K | |
![[IMG]](/icons/image2.gif) | unemployed-artistpre..> | 2011-09-30 12:29 | 23K | |
![[IMG]](/icons/image2.gif) | unemployed-artistpre..> | 2011-07-08 20:31 | 23K | |
![[IMG]](/icons/image2.gif) | unemployment.jpg | 2010-10-26 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | unemployment july 20..> | 2010-10-26 12:05 | 8.4K | |
![[IMG]](/icons/image2.gif) | unravel_greece.jpg | 2010-10-26 12:05 | 82K | |
![[IMG]](/icons/image2.gif) | untitled(1).jpg | 2011-05-19 13:37 | 28K | |
![[IMG]](/icons/image2.gif) | untitled(2).jpg | 2011-05-19 13:48 | 28K | |
![[IMG]](/icons/image2.gif) | untitled(3).jpg | 2011-07-22 15:24 | 28K | |
![[IMG]](/icons/image2.gif) | untitled(4).jpg | 2011-08-18 16:18 | 27K | |
![[IMG]](/icons/image2.gif) | untitled(5).jpg | 2011-08-31 16:18 | 60K | |
![[IMG]](/icons/image2.gif) | untitled(6).jpg | 2011-08-31 16:20 | 60K | |
![[IMG]](/icons/image2.gif) | untitled(7).jpg | 2011-09-09 12:37 | 52K | |
![[IMG]](/icons/image2.gif) | untitled(8).jpg | 2011-10-19 17:27 | 62K | |
![[IMG]](/icons/image2.gif) | untitled(9).jpg | 2011-11-16 12:27 | 53K | |
![[IMG]](/icons/image2.gif) | untitled(10).jpg | 2011-11-16 12:29 | 53K | |
![[IMG]](/icons/image2.gif) | untitled(11).jpg | 2011-11-16 12:30 | 53K | |
![[IMG]](/icons/image2.gif) | untitled(12).jpg | 2011-11-16 12:32 | 53K | |
![[IMG]](/icons/image2.gif) | untitled(13).jpg | 2011-12-19 14:35 | 35K | |
![[IMG]](/icons/image2.gif) | untitled.JPG | 2011-01-14 08:29 | 44K | |
![[IMG]](/icons/image2.gif) | untitled 2(1).jpg | 2011-07-22 15:25 | 46K | |
![[IMG]](/icons/image2.gif) | untitled 2.JPG | 2011-07-15 15:12 | 46K | |
![[IMG]](/icons/image2.gif) | untitled 3(1).jpg | 2011-07-25 15:51 | 28K | |
![[IMG]](/icons/image2.gif) | untitled 3.JPG | 2011-07-22 15:25 | 28K | |
![[IMG]](/icons/image2.gif) | uomafjw.png | 2011-04-08 12:26 | 76K | |
![[IMG]](/icons/image2.gif) | up_green_arrow.png | 2011-08-24 14:45 | 32K | |
![[IMG]](/icons/image2.gif) | urbn.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | url-11(1).jpg | 2010-11-15 18:09 | 29K | |
![[IMG]](/icons/image2.gif) | url-11(2).jpg | 2010-11-15 18:09 | 29K | |
![[IMG]](/icons/image2.gif) | url-11(3).jpg | 2010-11-16 13:43 | 29K | |
![[IMG]](/icons/image2.gif) | url-11.jpg | 2010-11-15 18:09 | 29K | |
![[IMG]](/icons/image2.gif) | us-credit-downgrade.jpg | 2011-09-18 22:24 | 17K | |
![[IMG]](/icons/image2.gif) | us-income-tax-top-br..> | 2011-09-18 22:10 | 97K | |
![[IMG]](/icons/image2.gif) | usD Nov 27 2010.jpg | 2010-11-27 10:28 | 60K | |
![[IMG]](/icons/image2.gif) | usO $35 puts May 200..> | 2010-10-26 12:05 | 30K | |
![[IMG]](/icons/image2.gif) | usd05202011(1).png | 2011-05-20 12:28 | 54K | |
![[IMG]](/icons/image2.gif) | usd05202011.PNG | 2011-05-20 12:25 | 54K | |
![[IMG]](/icons/image2.gif) | usd62011.png | 2011-06-21 12:22 | 35K | |
![[IMG]](/icons/image2.gif) | usd110101(1).png | 2010-11-16 22:58 | 14K | |
![[IMG]](/icons/image2.gif) | usd110101.png | 2010-11-16 22:58 | 14K | |
![[IMG]](/icons/image2.gif) | usd jan 12 2011.png | 2011-01-12 15:47 | 20K | |
![[IMG]](/icons/image2.gif) | uso.png | 2010-10-26 12:05 | 9.1K | |
![[IMG]](/icons/image2.gif) | uup.png | 2011-06-24 10:50 | 74K | |
![[IMG]](/icons/image2.gif) | uyg(1).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | uyg.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | valencay.jpg | 2013-06-12 12:51 | 59K | |
![[IMG]](/icons/image2.gif) | value at risk.jpg | 2010-10-26 12:05 | 65K | |
![[TXT]](/icons/text.gif) | ver.txt | 2024-02-23 12:55 | 441K | |
![[IMG]](/icons/image2.gif) | vghgbg.gif | 2011-06-23 15:39 | 4.5K | |
![[IMG]](/icons/image2.gif) | via.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | vix.JPG | 2011-11-30 13:38 | 92K | |
![[IMG]](/icons/image2.gif) | vix.png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | viz.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | vrgy.png | 2010-11-19 11:55 | 16K | |
![[IMG]](/icons/image2.gif) | vts86wr.png | 2011-03-31 11:59 | 69K | |
![[IMG]](/icons/image2.gif) | wall_street_0201.jpg | 2010-10-26 12:05 | 42K | |
![[IMG]](/icons/image2.gif) | walmart sig sauer fu..> | 2012-12-24 06:23 | 99K | |
![[IMG]](/icons/image2.gif) | walnuts1.JPG | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | warehouse1.jpg | 2011-07-27 18:18 | 29K | |
![[IMG]](/icons/image2.gif) | watg.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | wbs.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | webdesign(1).jpg | 2011-10-08 15:24 | 30K | |
![[IMG]](/icons/image2.gif) | webdesign.jpg | 2011-10-08 15:23 | 30K | |
![[IMG]](/icons/image2.gif) | webdesign 3.jpg | 2011-10-08 15:28 | 79K | |
![[IMG]](/icons/image2.gif) | webdesign4.png | 2011-10-08 15:32 | 35K | |
![[IMG]](/icons/image2.gif) | webdesign5.png | 2011-10-08 15:32 | 28K | |
![[IMG]](/icons/image2.gif) | webdesign6.png | 2011-10-08 15:33 | 36K | |
![[IMG]](/icons/image2.gif) | webdesign7.png | 2011-10-08 15:33 | 33K | |
![[IMG]](/icons/image2.gif) | webdesign8.png | 2011-10-08 15:33 | 37K | |
![[IMG]](/icons/image2.gif) | webdesign9.jpg | 2011-10-08 15:34 | 97K | |
![[IMG]](/icons/image2.gif) | webdesignhell,oatmea..> | 2011-10-08 15:25 | 30K | |
![[IMG]](/icons/image2.gif) | webdesignhell,oatmea..> | 2011-10-08 15:24 | 30K | |
![[IMG]](/icons/image2.gif) | wedesign 2.jpg | 2011-10-08 15:28 | 108K | |
![[IMG]](/icons/image2.gif) | wengen.jpg | 2011-03-17 12:18 | 38K | |
![[IMG]](/icons/image2.gif) | wethecorporationsgbh..> | 2012-06-09 13:20 | 43K | |
![[IMG]](/icons/image2.gif) | wgo(1).png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | wgo.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | what-predicts-a-fina..> | 2011-09-25 14:13 | 8.2K | |
![[IMG]](/icons/image2.gif) | what-predicts-a-fina..> | 2011-09-25 14:12 | 8.2K | |
![[IMG]](/icons/image2.gif) | where-the-wild-thing..> | 2010-10-26 12:05 | 161K | |
![[IMG]](/icons/image2.gif) | whit-71l.jpg | 2010-10-26 12:05 | 41K | |
![[IMG]](/icons/image2.gif) | whr.png | 2010-10-26 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | wibayf-3a.jpg | 2010-10-26 12:05 | 25K | |
![[IMG]](/icons/image2.gif) | wileyonarocketgoingf..> | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | wileyonarocketgoingf..> | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | wileyonarocketgoingf..> | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | wileyonarocketgoingf..> | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | wileyonarocketgoingf..> | 2010-12-02 13:10 | 18K | |
![[IMG]](/icons/image2.gif) | wileyonarocketgoingf..> | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | will-work-for-food-j..> | 2011-05-09 14:53 | 20K | |
![[IMG]](/icons/image2.gif) | william black.jpg | 2010-10-26 12:05 | 6.8K | |
![[IMG]](/icons/image2.gif) | winners_losers_tout.jpg | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | wizard-of-oz2.jpg | 2011-10-12 01:42 | 73K | |
![[IMG]](/icons/image2.gif) | wmc090810a.gif | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | wmc090810b.jpg | 2010-10-26 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | wmc090817-hussman.gif | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | wmc091011_TNH.gif | 2010-10-26 12:05 | 4.2K | |
![[IMG]](/icons/image2.gif) | wolf-in-sheeps-cloth..> | 2010-10-26 12:05 | 32K | |
![[IMG]](/icons/image2.gif) | wor.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | wordle PSW Chat Feb ..> | 2011-02-18 15:23 | 85K | |
![[IMG]](/icons/image2.gif) | wordle PSW Chat Feb ..> | 2011-02-22 18:20 | 81K | |
![[IMG]](/icons/image2.gif) | wordle PSW Chat Feb ..> | 2011-02-23 21:08 | 61K | |
![[IMG]](/icons/image2.gif) | wordle PSW Chat Feb ..> | 2011-02-23 21:04 | 61K | |
![[IMG]](/icons/image2.gif) | wordle PSW chat2 wee..> | 2011-02-21 16:06 | 52K | |
![[IMG]](/icons/image2.gif) | wordle PSW chat week..> | 2011-02-21 15:49 | 64K | |
![[IMG]](/icons/image2.gif) | wordle PSW week Feb ..> | 2011-02-21 15:36 | 52K | |
![[IMG]](/icons/image2.gif) | work_tout_0513.jpg | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | world_stock_index_ca..> | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | worlde Fed Minutes J..> | 2011-02-18 15:15 | 68K | |
![[IMG]](/icons/image2.gif) | worlde PCLN Minutes ..> | 2011-02-23 20:50 | 75K | |
![[IMG]](/icons/image2.gif) | worlde PCLN Minutes ..> | 2011-02-23 21:07 | 75K | |
![[IMG]](/icons/image2.gif) | worlde PCLN Minutes ..> | 2011-02-23 20:50 | 75K | |
![[DIR]](/icons/folder.gif) | wp-staging/ | 2022-08-18 08:31 | - | |
![[DIR]](/icons/folder.gif) | wpcf7_captcha/ | 2024-02-28 23:54 | - | |
![[DIR]](/icons/folder.gif) | wpdiscuz/ | 2024-02-28 23:54 | - | |
![[ ]](/icons/unknown.gif) | wpo-plugins-tables-l..> | 2022-07-24 14:29 | 770K | |
![[DIR]](/icons/folder.gif) | wpo/ | 2024-02-28 23:54 | - | |
![[IMG]](/icons/image2.gif) | wr(1).png | 2010-11-28 01:50 | 259K | |
![[IMG]](/icons/image2.gif) | wr.png | 2010-11-28 01:48 | 22K | |
![[IMG]](/icons/image2.gif) | writers-block-4.jpg | 2010-10-26 12:05 | 26K | |
![[IMG]](/icons/image2.gif) | wsm.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | wtic 1 year 2009.png | 2010-10-26 12:05 | 5.1K | |
![[IMG]](/icons/image2.gif) | wtic may 2009.png | 2010-10-26 12:05 | 64K | |
![[IMG]](/icons/image2.gif) | wy.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | x.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | xec.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | xeu.png | 2010-10-26 12:05 | 12K | |
![[IMG]](/icons/image2.gif) | xide(1).png | 2010-10-26 12:05 | 7.7K | |
![[IMG]](/icons/image2.gif) | xide.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | xide1.png | 2010-10-26 12:05 | 13K | |
![[IMG]](/icons/image2.gif) | xle Feb 23 2011.jpg | 2011-02-23 08:13 | 57K | |
![[IMG]](/icons/image2.gif) | xray.png | 2010-10-26 12:05 | 14K | |
![[IMG]](/icons/image2.gif) | xrt Jan 15 2010.jpg | 2011-01-15 08:22 | 50K | |
![[IMG]](/icons/image2.gif) | yen charts Feb 1 201..> | 2011-02-01 08:49 | 37K | |
![[IMG]](/icons/image2.gif) | yg3.png | 2010-10-26 12:05 | 18K | |
![[IMG]](/icons/image2.gif) | yingyang1.jpg | 2011-04-27 14:45 | 5.2K | |
![[IMG]](/icons/image2.gif) | yjjluob.png | 2011-04-07 17:53 | 174K | |
![[IMG]](/icons/image2.gif) | you lie banksy-jda(1..> | 2011-08-12 04:09 | 19K | |
![[IMG]](/icons/image2.gif) | you lie banksy-jda.jpg | 2011-08-12 04:09 | 19K | |
![[IMG]](/icons/image2.gif) | you wanna buy some M..> | 2011-07-21 20:17 | 15K | |
![[IMG]](/icons/image2.gif) | zeitgeist.jpeg | 2012-09-11 21:29 | 26K | |
![[IMG]](/icons/image2.gif) | zn2.png | 2010-10-26 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | zqk.png | 2010-10-26 12:05 | 15K | |
![[IMG]](/icons/image2.gif) | zweig.png | 2011-06-29 13:27 | 46K | |
|